[PATCH] - add fedora-bootstrap-1.5.0 to apps.fp.o/global

[Ryan Lerch <rlerch@xxxxxxxxxx>]

Add the latest release of Fedora Bootstrap (1.5.0) to apps.fp.o/global

From 6bceecc572545123bfe17a9086c7541f6d51cfbb Mon Sep 17 00:00:00 2001
From: Ryan Lerch <rlerch@xxxxxxxxxx>
Date: Wed, 20 Feb 2019 09:06:28 +1000
Subject: [PATCH] Add fedora-bootstrap 1.5.0

Version 1.5.0 of Fedora Bootstrap

https://pagure.io/fedora-bootstrap/releases

Signed-off-by: Ryan Lerch <rlerch@xxxxxxxxxx>
---
 .../fedora-bootstrap.css                      | 7634 +++++++++++++++++
 .../fedora-bootstrap.js                       | 7013 +++++++++++++++
 .../fedora-bootstrap.min.css                  |    6 +
 .../fedora-bootstrap.min.js                   |    7 +
 4 files changed, 14660 insertions(+)
 create mode 100644 roles/apps-fp-o/files/global/fedora-bootstrap-1.5.0/fedora-bootstrap.css
 create mode 100644 roles/apps-fp-o/files/global/fedora-bootstrap-1.5.0/fedora-bootstrap.js
 create mode 100644 roles/apps-fp-o/files/global/fedora-bootstrap-1.5.0/fedora-bootstrap.min.css
 create mode 100644 roles/apps-fp-o/files/global/fedora-bootstrap-1.5.0/fedora-bootstrap.min.js

diff --git a/roles/apps-fp-o/files/global/fedora-bootstrap-1.5.0/fedora-bootstrap.css b/roles/apps-fp-o/files/global/fedora-bootstrap-1.5.0/fedora-bootstrap.css
new file mode 100644
index 000000000..15b549757
--- /dev/null
+++ b/roles/apps-fp-o/files/global/fedora-bootstrap-1.5.0/fedora-bootstrap.css
@@ -0,0 +1,7634 @@
+/*!fedora-bootstrap v1.5.0 -- https://pagure.io/fedora-bootstrap */
+/*!
+ * Bootstrap v4.3.1 (https://getbootstrap.com/)
+ * Copyright 2011-2019 The Bootstrap Authors
+ * Copyright 2011-2019 Twitter, Inc.
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+ */
+:root {
+  --blue: #3c6eb4;
+  --indigo: #6610f2;
+  --purple: #6f42c1;
+  --pink: #e83e8c;
+  --red: #dc3545;
+  --orange: #fd7e14;
+  --yellow: #ffc107;
+  --green: #28a745;
+  --teal: #20c997;
+  --cyan: #17a2b8;
+  --white: #fff;
+  --gray: #6c757d;
+  --gray-dark: #343a40;
+  --primary: #3c6eb4;
+  --secondary: #6c757d;
+  --success: #28a745;
+  --info: #17a2b8;
+  --warning: #ffc107;
+  --danger: #dc3545;
+  --light: #f8f9fa;
+  --dark: #343a40;
+  --breakpoint-xs: 0;
+  --breakpoint-sm: 576px;
+  --breakpoint-md: 768px;
+  --breakpoint-lg: 992px;
+  --breakpoint-xl: 1200px;
+  --font-family-sans-serif: Open Sans;
+  --font-family-monospace: "Hack", monospace; }
+
+*,
+*::before,
+*::after {
+  box-sizing: border-box; }
+
+html {
+  font-family: sans-serif;
+  line-height: 1.15;
+  -webkit-text-size-adjust: 100%;
+  -webkit-tap-highlight-color: rgba(0, 0, 0, 0); }
+
+article, aside, figcaption, figure, footer, header, hgroup, main, nav, section {
+  display: block; }
+
+body {
+  margin: 0;
+  font-family: "Open Sans";
+  font-size: 0.875rem;
+  font-weight: 400;
+  line-height: 1.5;
+  color: #373a3c;
+  text-align: left;
+  background-color: #fff; }
+
+[tabindex="-1"]:focus {
+  outline: 0 !important; }
+
+hr {
+  box-sizing: content-box;
+  height: 0;
+  overflow: visible; }
+
+h1, h2, h3, h4, h5, h6 {
+  margin-top: 0;
+  margin-bottom: 0.5rem; }
+
+p {
+  margin-top: 0;
+  margin-bottom: 1rem; }
+
+abbr[title],
+abbr[data-original-title] {
+  text-decoration: underline;
+  text-decoration: underline dotted;
+  cursor: help;
+  border-bottom: 0;
+  text-decoration-skip-ink: none; }
+
+address {
+  margin-bottom: 1rem;
+  font-style: normal;
+  line-height: inherit; }
+
+ol,
+ul,
+dl {
+  margin-top: 0;
+  margin-bottom: 1rem; }
+
+ol ol,
+ul ul,
+ol ul,
+ul ol {
+  margin-bottom: 0; }
+
+dt {
+  font-weight: 700; }
+
+dd {
+  margin-bottom: .5rem;
+  margin-left: 0; }
+
+blockquote {
+  margin: 0 0 1rem; }
+
+b,
+strong {
+  font-weight: bolder; }
+
+small {
+  font-size: 80%; }
+
+sub,
+sup {
+  position: relative;
+  font-size: 75%;
+  line-height: 0;
+  vertical-align: baseline; }
+
+sub {
+  bottom: -.25em; }
+
+sup {
+  top: -.5em; }
+
+a {
+  color: #3c6eb4;
+  text-decoration: none;
+  background-color: transparent; }
+  a:hover {
+    color: #294b7b;
+    text-decoration: underline; }
+
+a:not([href]):not([tabindex]) {
+  color: inherit;
+  text-decoration: none; }
+  a:not([href]):not([tabindex]):hover, a:not([href]):not([tabindex]):focus {
+    color: inherit;
+    text-decoration: none; }
+  a:not([href]):not([tabindex]):focus {
+    outline: 0; }
+
+pre,
+code,
+kbd,
+samp {
+  font-family: "Hack", monospace;
+  font-size: 1em; }
+
+pre {
+  margin-top: 0;
+  margin-bottom: 1rem;
+  overflow: auto; }
+
+figure {
+  margin: 0 0 1rem; }
+
+img {
+  vertical-align: middle;
+  border-style: none; }
+
+svg {
+  overflow: hidden;
+  vertical-align: middle; }
+
+table {
+  border-collapse: collapse; }
+
+caption {
+  padding-top: 0.75rem;
+  padding-bottom: 0.75rem;
+  color: #6c757d;
+  text-align: left;
+  caption-side: bottom; }
+
+th {
+  text-align: inherit; }
+
+label {
+  display: inline-block;
+  margin-bottom: 0.5rem; }
+
+button {
+  border-radius: 0; }
+
+button:focus {
+  outline: 1px dotted;
+  outline: 5px auto -webkit-focus-ring-color; }
+
+input,
+button,
+select,
+optgroup,
+textarea {
+  margin: 0;
+  font-family: inherit;
+  font-size: inherit;
+  line-height: inherit; }
+
+button,
+input {
+  overflow: visible; }
+
+button,
+select {
+  text-transform: none; }
+
+select {
+  word-wrap: normal; }
+
+button,
+[type="button"],
+[type="reset"],
+[type="submit"] {
+  -webkit-appearance: button; }
+
+button:not(:disabled),
+[type="button"]:not(:disabled),
+[type="reset"]:not(:disabled),
+[type="submit"]:not(:disabled) {
+  cursor: pointer; }
+
+button::-moz-focus-inner,
+[type="button"]::-moz-focus-inner,
+[type="reset"]::-moz-focus-inner,
+[type="submit"]::-moz-focus-inner {
+  padding: 0;
+  border-style: none; }
+
+input[type="radio"],
+input[type="checkbox"] {
+  box-sizing: border-box;
+  padding: 0; }
+
+input[type="date"],
+input[type="time"],
+input[type="datetime-local"],
+input[type="month"] {
+  -webkit-appearance: listbox; }
+
+textarea {
+  overflow: auto;
+  resize: vertical; }
+
+fieldset {
+  min-width: 0;
+  padding: 0;
+  margin: 0;
+  border: 0; }
+
+legend {
+  display: block;
+  width: 100%;
+  max-width: 100%;
+  padding: 0;
+  margin-bottom: .5rem;
+  font-size: 1.5rem;
+  line-height: inherit;
+  color: inherit;
+  white-space: normal; }
+
+progress {
+  vertical-align: baseline; }
+
+[type="number"]::-webkit-inner-spin-button,
+[type="number"]::-webkit-outer-spin-button {
+  height: auto; }
+
+[type="search"] {
+  outline-offset: -2px;
+  -webkit-appearance: none; }
+
+[type="search"]::-webkit-search-decoration {
+  -webkit-appearance: none; }
+
+::-webkit-file-upload-button {
+  font: inherit;
+  -webkit-appearance: button; }
+
+output {
+  display: inline-block; }
+
+summary {
+  display: list-item;
+  cursor: pointer; }
+
+template {
+  display: none; }
+
+[hidden] {
+  display: none !important; }
+
+h1, h2, h3, h4, h5, h6,
+.h1, .h2, .h3, .h4, .h5, .h6 {
+  margin-bottom: 0.5rem;
+  font-weight: 500;
+  line-height: 1.1; }
+
+h1, .h1 {
+  font-size: 1.75rem; }
+
+h2, .h2 {
+  font-size: 1.53125rem; }
+
+h3, .h3 {
+  font-size: 1.3125rem; }
+
+h4, .h4 {
+  font-size: 1.09375rem; }
+
+h5, .h5 {
+  font-size: 0.875rem; }
+
+h6, .h6 {
+  font-size: 0.875rem; }
+
+.lead {
+  font-size: 1.09375rem;
+  font-weight: 300; }
+
+.display-1 {
+  font-size: 6rem;
+  font-weight: 300;
+  line-height: 1.1; }
+
+.display-2 {
+  font-size: 5.5rem;
+  font-weight: 300;
+  line-height: 1.1; }
+
+.display-3 {
+  font-size: 4.5rem;
+  font-weight: 300;
+  line-height: 1.1; }
+
+.display-4 {
+  font-size: 3.5rem;
+  font-weight: 300;
+  line-height: 1.1; }
+
+hr {
+  margin-top: 1rem;
+  margin-bottom: 1rem;
+  border: 0;
+  border-top: 1px solid rgba(0, 0, 0, 0.1); }
+
+small,
+.small {
+  font-size: 80%;
+  font-weight: 400; }
+
+mark,
+.mark {
+  padding: 0.2em;
+  background-color: #fcf8e3; }
+
+.list-unstyled {
+  padding-left: 0;
+  list-style: none; }
+
+.list-inline {
+  padding-left: 0;
+  list-style: none; }
+
+.list-inline-item {
+  display: inline-block; }
+  .list-inline-item:not(:last-child) {
+    margin-right: 0.5rem; }
+
+.initialism {
+  font-size: 90%;
+  text-transform: uppercase; }
+
+.blockquote {
+  margin-bottom: 1rem;
+  font-size: 1.09375rem; }
+
+.blockquote-footer {
+  display: block;
+  font-size: 80%;
+  color: #6c757d; }
+  .blockquote-footer::before {
+    content: "\2014\00A0"; }
+
+.img-fluid {
+  max-width: 100%;
+  height: auto; }
+
+.img-thumbnail {
+  padding: 0.25rem;
+  background-color: #fff;
+  border: 1px solid #dee2e6;
+  border-radius: 0.25rem;
+  max-width: 100%;
+  height: auto; }
+
+.figure {
+  display: inline-block; }
+
+.figure-img {
+  margin-bottom: 0.5rem;
+  line-height: 1; }
+
+.figure-caption {
+  font-size: 90%;
+  color: #6c757d; }
+
+code {
+  font-size: 87.5%;
+  color: #e83e8c;
+  word-break: break-word; }
+  a > code {
+    color: inherit; }
+
+kbd {
+  padding: 0.2rem 0.4rem;
+  font-size: 87.5%;
+  color: #fff;
+  background-color: #212529;
+  border-radius: 0.2rem; }
+  kbd kbd {
+    padding: 0;
+    font-size: 100%;
+    font-weight: 700; }
+
+pre {
+  display: block;
+  font-size: 87.5%;
+  color: #586e75; }
+  pre code {
+    font-size: inherit;
+    color: inherit;
+    word-break: normal; }
+
+.pre-scrollable {
+  max-height: 340px;
+  overflow-y: scroll; }
+
+.container {
+  width: 100%;
+  padding-right: 15px;
+  padding-left: 15px;
+  margin-right: auto;
+  margin-left: auto; }
+  @media (min-width: 576px) {
+    .container {
+      max-width: 540px; } }
+  @media (min-width: 768px) {
+    .container {
+      max-width: 720px; } }
+  @media (min-width: 992px) {
+    .container {
+      max-width: 960px; } }
+  @media (min-width: 1200px) {
+    .container {
+      max-width: 1140px; } }
+
+.container-fluid {
+  width: 100%;
+  padding-right: 15px;
+  padding-left: 15px;
+  margin-right: auto;
+  margin-left: auto; }
+
+.row {
+  display: flex;
+  flex-wrap: wrap;
+  margin-right: -15px;
+  margin-left: -15px; }
+
+.no-gutters {
+  margin-right: 0;
+  margin-left: 0; }
+  .no-gutters > .col,
+  .no-gutters > [class*="col-"] {
+    padding-right: 0;
+    padding-left: 0; }
+
+.col-1, .col-2, .col-3, .col-4, .col-5, .col-6, .col-7, .col-8, .col-9, .col-10, .col-11, .col-12, .col,
+.col-auto, .col-sm-1, .col-sm-2, .col-sm-3, .col-sm-4, .col-sm-5, .col-sm-6, .col-sm-7, .col-sm-8, .col-sm-9, .col-sm-10, .col-sm-11, .col-sm-12, .col-sm,
+.col-sm-auto, .col-md-1, .col-md-2, .col-md-3, .col-md-4, .col-md-5, .col-md-6, .col-md-7, .col-md-8, .col-md-9, .col-md-10, .col-md-11, .col-md-12, .col-md,
+.col-md-auto, .col-lg-1, .col-lg-2, .col-lg-3, .col-lg-4, .col-lg-5, .col-lg-6, .col-lg-7, .col-lg-8, .col-lg-9, .col-lg-10, .col-lg-11, .col-lg-12, .col-lg,
+.col-lg-auto, .col-xl-1, .col-xl-2, .col-xl-3, .col-xl-4, .col-xl-5, .col-xl-6, .col-xl-7, .col-xl-8, .col-xl-9, .col-xl-10, .col-xl-11, .col-xl-12, .col-xl,
+.col-xl-auto {
+  position: relative;
+  width: 100%;
+  padding-right: 15px;
+  padding-left: 15px; }
+
+.col {
+  flex-basis: 0;
+  flex-grow: 1;
+  max-width: 100%; }
+
+.col-auto {
+  flex: 0 0 auto;
+  width: auto;
+  max-width: 100%; }
+
+.col-1 {
+  flex: 0 0 8.33333%;
+  max-width: 8.33333%; }
+
+.col-2 {
+  flex: 0 0 16.66667%;
+  max-width: 16.66667%; }
+
+.col-3 {
+  flex: 0 0 25%;
+  max-width: 25%; }
+
+.col-4 {
+  flex: 0 0 33.33333%;
+  max-width: 33.33333%; }
+
+.col-5 {
+  flex: 0 0 41.66667%;
+  max-width: 41.66667%; }
+
+.col-6 {
+  flex: 0 0 50%;
+  max-width: 50%; }
+
+.col-7 {
+  flex: 0 0 58.33333%;
+  max-width: 58.33333%; }
+
+.col-8 {
+  flex: 0 0 66.66667%;
+  max-width: 66.66667%; }
+
+.col-9 {
+  flex: 0 0 75%;
+  max-width: 75%; }
+
+.col-10 {
+  flex: 0 0 83.33333%;
+  max-width: 83.33333%; }
+
+.col-11 {
+  flex: 0 0 91.66667%;
+  max-width: 91.66667%; }
+
+.col-12 {
+  flex: 0 0 100%;
+  max-width: 100%; }
+
+.order-first {
+  order: -1; }
+
+.order-last {
+  order: 13; }
+
+.order-0 {
+  order: 0; }
+
+.order-1 {
+  order: 1; }
+
+.order-2 {
+  order: 2; }
+
+.order-3 {
+  order: 3; }
+
+.order-4 {
+  order: 4; }
+
+.order-5 {
+  order: 5; }
+
+.order-6 {
+  order: 6; }
+
+.order-7 {
+  order: 7; }
+
+.order-8 {
+  order: 8; }
+
+.order-9 {
+  order: 9; }
+
+.order-10 {
+  order: 10; }
+
+.order-11 {
+  order: 11; }
+
+.order-12 {
+  order: 12; }
+
+.offset-1 {
+  margin-left: 8.33333%; }
+
+.offset-2 {
+  margin-left: 16.66667%; }
+
+.offset-3 {
+  margin-left: 25%; }
+
+.offset-4 {
+  margin-left: 33.33333%; }
+
+.offset-5 {
+  margin-left: 41.66667%; }
+
+.offset-6 {
+  margin-left: 50%; }
+
+.offset-7 {
+  margin-left: 58.33333%; }
+
+.offset-8 {
+  margin-left: 66.66667%; }
+
+.offset-9 {
+  margin-left: 75%; }
+
+.offset-10 {
+  margin-left: 83.33333%; }
+
+.offset-11 {
+  margin-left: 91.66667%; }
+
+@media (min-width: 576px) {
+  .col-sm {
+    flex-basis: 0;
+    flex-grow: 1;
+    max-width: 100%; }
+  .col-sm-auto {
+    flex: 0 0 auto;
+    width: auto;
+    max-width: 100%; }
+  .col-sm-1 {
+    flex: 0 0 8.33333%;
+    max-width: 8.33333%; }
+  .col-sm-2 {
+    flex: 0 0 16.66667%;
+    max-width: 16.66667%; }
+  .col-sm-3 {
+    flex: 0 0 25%;
+    max-width: 25%; }
+  .col-sm-4 {
+    flex: 0 0 33.33333%;
+    max-width: 33.33333%; }
+  .col-sm-5 {
+    flex: 0 0 41.66667%;
+    max-width: 41.66667%; }
+  .col-sm-6 {
+    flex: 0 0 50%;
+    max-width: 50%; }
+  .col-sm-7 {
+    flex: 0 0 58.33333%;
+    max-width: 58.33333%; }
+  .col-sm-8 {
+    flex: 0 0 66.66667%;
+    max-width: 66.66667%; }
+  .col-sm-9 {
+    flex: 0 0 75%;
+    max-width: 75%; }
+  .col-sm-10 {
+    flex: 0 0 83.33333%;
+    max-width: 83.33333%; }
+  .col-sm-11 {
+    flex: 0 0 91.66667%;
+    max-width: 91.66667%; }
+  .col-sm-12 {
+    flex: 0 0 100%;
+    max-width: 100%; }
+  .order-sm-first {
+    order: -1; }
+  .order-sm-last {
+    order: 13; }
+  .order-sm-0 {
+    order: 0; }
+  .order-sm-1 {
+    order: 1; }
+  .order-sm-2 {
+    order: 2; }
+  .order-sm-3 {
+    order: 3; }
+  .order-sm-4 {
+    order: 4; }
+  .order-sm-5 {
+    order: 5; }
+  .order-sm-6 {
+    order: 6; }
+  .order-sm-7 {
+    order: 7; }
+  .order-sm-8 {
+    order: 8; }
+  .order-sm-9 {
+    order: 9; }
+  .order-sm-10 {
+    order: 10; }
+  .order-sm-11 {
+    order: 11; }
+  .order-sm-12 {
+    order: 12; }
+  .offset-sm-0 {
+    margin-left: 0; }
+  .offset-sm-1 {
+    margin-left: 8.33333%; }
+  .offset-sm-2 {
+    margin-left: 16.66667%; }
+  .offset-sm-3 {
+    margin-left: 25%; }
+  .offset-sm-4 {
+    margin-left: 33.33333%; }
+  .offset-sm-5 {
+    margin-left: 41.66667%; }
+  .offset-sm-6 {
+    margin-left: 50%; }
+  .offset-sm-7 {
+    margin-left: 58.33333%; }
+  .offset-sm-8 {
+    margin-left: 66.66667%; }
+  .offset-sm-9 {
+    margin-left: 75%; }
+  .offset-sm-10 {
+    margin-left: 83.33333%; }
+  .offset-sm-11 {
+    margin-left: 91.66667%; } }
+
+@media (min-width: 768px) {
+  .col-md {
+    flex-basis: 0;
+    flex-grow: 1;
+    max-width: 100%; }
+  .col-md-auto {
+    flex: 0 0 auto;
+    width: auto;
+    max-width: 100%; }
+  .col-md-1 {
+    flex: 0 0 8.33333%;
+    max-width: 8.33333%; }
+  .col-md-2 {
+    flex: 0 0 16.66667%;
+    max-width: 16.66667%; }
+  .col-md-3 {
+    flex: 0 0 25%;
+    max-width: 25%; }
+  .col-md-4 {
+    flex: 0 0 33.33333%;
+    max-width: 33.33333%; }
+  .col-md-5 {
+    flex: 0 0 41.66667%;
+    max-width: 41.66667%; }
+  .col-md-6 {
+    flex: 0 0 50%;
+    max-width: 50%; }
+  .col-md-7 {
+    flex: 0 0 58.33333%;
+    max-width: 58.33333%; }
+  .col-md-8 {
+    flex: 0 0 66.66667%;
+    max-width: 66.66667%; }
+  .col-md-9 {
+    flex: 0 0 75%;
+    max-width: 75%; }
+  .col-md-10 {
+    flex: 0 0 83.33333%;
+    max-width: 83.33333%; }
+  .col-md-11 {
+    flex: 0 0 91.66667%;
+    max-width: 91.66667%; }
+  .col-md-12 {
+    flex: 0 0 100%;
+    max-width: 100%; }
+  .order-md-first {
+    order: -1; }
+  .order-md-last {
+    order: 13; }
+  .order-md-0 {
+    order: 0; }
+  .order-md-1 {
+    order: 1; }
+  .order-md-2 {
+    order: 2; }
+  .order-md-3 {
+    order: 3; }
+  .order-md-4 {
+    order: 4; }
+  .order-md-5 {
+    order: 5; }
+  .order-md-6 {
+    order: 6; }
+  .order-md-7 {
+    order: 7; }
+  .order-md-8 {
+    order: 8; }
+  .order-md-9 {
+    order: 9; }
+  .order-md-10 {
+    order: 10; }
+  .order-md-11 {
+    order: 11; }
+  .order-md-12 {
+    order: 12; }
+  .offset-md-0 {
+    margin-left: 0; }
+  .offset-md-1 {
+    margin-left: 8.33333%; }
+  .offset-md-2 {
+    margin-left: 16.66667%; }
+  .offset-md-3 {
+    margin-left: 25%; }
+  .offset-md-4 {
+    margin-left: 33.33333%; }
+  .offset-md-5 {
+    margin-left: 41.66667%; }
+  .offset-md-6 {
+    margin-left: 50%; }
+  .offset-md-7 {
+    margin-left: 58.33333%; }
+  .offset-md-8 {
+    margin-left: 66.66667%; }
+  .offset-md-9 {
+    margin-left: 75%; }
+  .offset-md-10 {
+    margin-left: 83.33333%; }
+  .offset-md-11 {
+    margin-left: 91.66667%; } }
+
+@media (min-width: 992px) {
+  .col-lg {
+    flex-basis: 0;
+    flex-grow: 1;
+    max-width: 100%; }
+  .col-lg-auto {
+    flex: 0 0 auto;
+    width: auto;
+    max-width: 100%; }
+  .col-lg-1 {
+    flex: 0 0 8.33333%;
+    max-width: 8.33333%; }
+  .col-lg-2 {
+    flex: 0 0 16.66667%;
+    max-width: 16.66667%; }
+  .col-lg-3 {
+    flex: 0 0 25%;
+    max-width: 25%; }
+  .col-lg-4 {
+    flex: 0 0 33.33333%;
+    max-width: 33.33333%; }
+  .col-lg-5 {
+    flex: 0 0 41.66667%;
+    max-width: 41.66667%; }
+  .col-lg-6 {
+    flex: 0 0 50%;
+    max-width: 50%; }
+  .col-lg-7 {
+    flex: 0 0 58.33333%;
+    max-width: 58.33333%; }
+  .col-lg-8 {
+    flex: 0 0 66.66667%;
+    max-width: 66.66667%; }
+  .col-lg-9 {
+    flex: 0 0 75%;
+    max-width: 75%; }
+  .col-lg-10 {
+    flex: 0 0 83.33333%;
+    max-width: 83.33333%; }
+  .col-lg-11 {
+    flex: 0 0 91.66667%;
+    max-width: 91.66667%; }
+  .col-lg-12 {
+    flex: 0 0 100%;
+    max-width: 100%; }
+  .order-lg-first {
+    order: -1; }
+  .order-lg-last {
+    order: 13; }
+  .order-lg-0 {
+    order: 0; }
+  .order-lg-1 {
+    order: 1; }
+  .order-lg-2 {
+    order: 2; }
+  .order-lg-3 {
+    order: 3; }
+  .order-lg-4 {
+    order: 4; }
+  .order-lg-5 {
+    order: 5; }
+  .order-lg-6 {
+    order: 6; }
+  .order-lg-7 {
+    order: 7; }
+  .order-lg-8 {
+    order: 8; }
+  .order-lg-9 {
+    order: 9; }
+  .order-lg-10 {
+    order: 10; }
+  .order-lg-11 {
+    order: 11; }
+  .order-lg-12 {
+    order: 12; }
+  .offset-lg-0 {
+    margin-left: 0; }
+  .offset-lg-1 {
+    margin-left: 8.33333%; }
+  .offset-lg-2 {
+    margin-left: 16.66667%; }
+  .offset-lg-3 {
+    margin-left: 25%; }
+  .offset-lg-4 {
+    margin-left: 33.33333%; }
+  .offset-lg-5 {
+    margin-left: 41.66667%; }
+  .offset-lg-6 {
+    margin-left: 50%; }
+  .offset-lg-7 {
+    margin-left: 58.33333%; }
+  .offset-lg-8 {
+    margin-left: 66.66667%; }
+  .offset-lg-9 {
+    margin-left: 75%; }
+  .offset-lg-10 {
+    margin-left: 83.33333%; }
+  .offset-lg-11 {
+    margin-left: 91.66667%; } }
+
+@media (min-width: 1200px) {
+  .col-xl {
+    flex-basis: 0;
+    flex-grow: 1;
+    max-width: 100%; }
+  .col-xl-auto {
+    flex: 0 0 auto;
+    width: auto;
+    max-width: 100%; }
+  .col-xl-1 {
+    flex: 0 0 8.33333%;
+    max-width: 8.33333%; }
+  .col-xl-2 {
+    flex: 0 0 16.66667%;
+    max-width: 16.66667%; }
+  .col-xl-3 {
+    flex: 0 0 25%;
+    max-width: 25%; }
+  .col-xl-4 {
+    flex: 0 0 33.33333%;
+    max-width: 33.33333%; }
+  .col-xl-5 {
+    flex: 0 0 41.66667%;
+    max-width: 41.66667%; }
+  .col-xl-6 {
+    flex: 0 0 50%;
+    max-width: 50%; }
+  .col-xl-7 {
+    flex: 0 0 58.33333%;
+    max-width: 58.33333%; }
+  .col-xl-8 {
+    flex: 0 0 66.66667%;
+    max-width: 66.66667%; }
+  .col-xl-9 {
+    flex: 0 0 75%;
+    max-width: 75%; }
+  .col-xl-10 {
+    flex: 0 0 83.33333%;
+    max-width: 83.33333%; }
+  .col-xl-11 {
+    flex: 0 0 91.66667%;
+    max-width: 91.66667%; }
+  .col-xl-12 {
+    flex: 0 0 100%;
+    max-width: 100%; }
+  .order-xl-first {
+    order: -1; }
+  .order-xl-last {
+    order: 13; }
+  .order-xl-0 {
+    order: 0; }
+  .order-xl-1 {
+    order: 1; }
+  .order-xl-2 {
+    order: 2; }
+  .order-xl-3 {
+    order: 3; }
+  .order-xl-4 {
+    order: 4; }
+  .order-xl-5 {
+    order: 5; }
+  .order-xl-6 {
+    order: 6; }
+  .order-xl-7 {
+    order: 7; }
+  .order-xl-8 {
+    order: 8; }
+  .order-xl-9 {
+    order: 9; }
+  .order-xl-10 {
+    order: 10; }
+  .order-xl-11 {
+    order: 11; }
+  .order-xl-12 {
+    order: 12; }
+  .offset-xl-0 {
+    margin-left: 0; }
+  .offset-xl-1 {
+    margin-left: 8.33333%; }
+  .offset-xl-2 {
+    margin-left: 16.66667%; }
+  .offset-xl-3 {
+    margin-left: 25%; }
+  .offset-xl-4 {
+    margin-left: 33.33333%; }
+  .offset-xl-5 {
+    margin-left: 41.66667%; }
+  .offset-xl-6 {
+    margin-left: 50%; }
+  .offset-xl-7 {
+    margin-left: 58.33333%; }
+  .offset-xl-8 {
+    margin-left: 66.66667%; }
+  .offset-xl-9 {
+    margin-left: 75%; }
+  .offset-xl-10 {
+    margin-left: 83.33333%; }
+  .offset-xl-11 {
+    margin-left: 91.66667%; } }
+
+.table {
+  width: 100%;
+  margin-bottom: 1rem;
+  color: #373a3c; }
+  .table th,
+  .table td {
+    padding: 0.75rem;
+    vertical-align: top;
+    border-top: 1px solid #dee2e6; }
+  .table thead th {
+    vertical-align: bottom;
+    border-bottom: 2px solid #dee2e6; }
+  .table tbody + tbody {
+    border-top: 2px solid #dee2e6; }
+
+.table-sm th,
+.table-sm td {
+  padding: 0.3rem; }
+
+.table-bordered {
+  border: 1px solid #dee2e6; }
+  .table-bordered th,
+  .table-bordered td {
+    border: 1px solid #dee2e6; }
+  .table-bordered thead th,
+  .table-bordered thead td {
+    border-bottom-width: 2px; }
+
+.table-borderless th,
+.table-borderless td,
+.table-borderless thead th,
+.table-borderless tbody + tbody {
+  border: 0; }
+
+.table-striped tbody tr:nth-of-type(odd) {
+  background-color: rgba(0, 0, 0, 0.05); }
+
+.table-hover tbody tr:hover {
+  color: #373a3c;
+  background-color: rgba(0, 0, 0, 0.075); }
+
+.table-primary,
+.table-primary > th,
+.table-primary > td {
+  background-color: #c8d6ea; }
+
+.table-primary th,
+.table-primary td,
+.table-primary thead th,
+.table-primary tbody + tbody {
+  border-color: #9ab4d8; }
+
+.table-hover .table-primary:hover {
+  background-color: #b6c8e3; }
+  .table-hover .table-primary:hover > td,
+  .table-hover .table-primary:hover > th {
+    background-color: #b6c8e3; }
+
+.table-secondary,
+.table-secondary > th,
+.table-secondary > td {
+  background-color: #d6d8db; }
+
+.table-secondary th,
+.table-secondary td,
+.table-secondary thead th,
+.table-secondary tbody + tbody {
+  border-color: #b3b7bb; }
+
+.table-hover .table-secondary:hover {
+  background-color: #c8cbcf; }
+  .table-hover .table-secondary:hover > td,
+  .table-hover .table-secondary:hover > th {
+    background-color: #c8cbcf; }
+
+.table-success,
+.table-success > th,
+.table-success > td {
+  background-color: #c3e6cb; }
+
+.table-success th,
+.table-success td,
+.table-success thead th,
+.table-success tbody + tbody {
+  border-color: #8fd19e; }
+
+.table-hover .table-success:hover {
+  background-color: #b1dfbb; }
+  .table-hover .table-success:hover > td,
+  .table-hover .table-success:hover > th {
+    background-color: #b1dfbb; }
+
+.table-info,
+.table-info > th,
+.table-info > td {
+  background-color: #bee5eb; }
+
+.table-info th,
+.table-info td,
+.table-info thead th,
+.table-info tbody + tbody {
+  border-color: #86cfda; }
+
+.table-hover .table-info:hover {
+  background-color: #abdde5; }
+  .table-hover .table-info:hover > td,
+  .table-hover .table-info:hover > th {
+    background-color: #abdde5; }
+
+.table-warning,
+.table-warning > th,
+.table-warning > td {
+  background-color: #ffeeba; }
+
+.table-warning th,
+.table-warning td,
+.table-warning thead th,
+.table-warning tbody + tbody {
+  border-color: #ffdf7e; }
+
+.table-hover .table-warning:hover {
+  background-color: #ffe8a1; }
+  .table-hover .table-warning:hover > td,
+  .table-hover .table-warning:hover > th {
+    background-color: #ffe8a1; }
+
+.table-danger,
+.table-danger > th,
+.table-danger > td {
+  background-color: #f5c6cb; }
+
+.table-danger th,
+.table-danger td,
+.table-danger thead th,
+.table-danger tbody + tbody {
+  border-color: #ed969e; }
+
+.table-hover .table-danger:hover {
+  background-color: #f1b0b7; }
+  .table-hover .table-danger:hover > td,
+  .table-hover .table-danger:hover > th {
+    background-color: #f1b0b7; }
+
+.table-light,
+.table-light > th,
+.table-light > td {
+  background-color: #fdfdfe; }
+
+.table-light th,
+.table-light td,
+.table-light thead th,
+.table-light tbody + tbody {
+  border-color: #fbfcfc; }
+
+.table-hover .table-light:hover {
+  background-color: #ececf6; }
+  .table-hover .table-light:hover > td,
+  .table-hover .table-light:hover > th {
+    background-color: #ececf6; }
+
+.table-dark,
+.table-dark > th,
+.table-dark > td {
+  background-color: #c6c8ca; }
+
+.table-dark th,
+.table-dark td,
+.table-dark thead th,
+.table-dark tbody + tbody {
+  border-color: #95999c; }
+
+.table-hover .table-dark:hover {
+  background-color: #b9bbbe; }
+  .table-hover .table-dark:hover > td,
+  .table-hover .table-dark:hover > th {
+    background-color: #b9bbbe; }
+
+.table-active,
+.table-active > th,
+.table-active > td {
+  background-color: rgba(0, 0, 0, 0.075); }
+
+.table-hover .table-active:hover {
+  background-color: rgba(0, 0, 0, 0.075); }
+  .table-hover .table-active:hover > td,
+  .table-hover .table-active:hover > th {
+    background-color: rgba(0, 0, 0, 0.075); }
+
+.table .thead-dark th {
+  color: #fff;
+  background-color: #343a40;
+  border-color: #454d55; }
+
+.table .thead-light th {
+  color: #495057;
+  background-color: #e9ecef;
+  border-color: #dee2e6; }
+
+.table-dark {
+  color: #fff;
+  background-color: #343a40; }
+  .table-dark th,
+  .table-dark td,
+  .table-dark thead th {
+    border-color: #454d55; }
+  .table-dark.table-bordered {
+    border: 0; }
+  .table-dark.table-striped tbody tr:nth-of-type(odd) {
+    background-color: rgba(255, 255, 255, 0.05); }
+  .table-dark.table-hover tbody tr:hover {
+    color: #fff;
+    background-color: rgba(255, 255, 255, 0.075); }
+
+@media (max-width: 575.98px) {
+  .table-responsive-sm {
+    display: block;
+    width: 100%;
+    overflow-x: auto;
+    -webkit-overflow-scrolling: touch; }
+    .table-responsive-sm > .table-bordered {
+      border: 0; } }
+
+@media (max-width: 767.98px) {
+  .table-responsive-md {
+    display: block;
+    width: 100%;
+    overflow-x: auto;
+    -webkit-overflow-scrolling: touch; }
+    .table-responsive-md > .table-bordered {
+      border: 0; } }
+
+@media (max-width: 991.98px) {
+  .table-responsive-lg {
+    display: block;
+    width: 100%;
+    overflow-x: auto;
+    -webkit-overflow-scrolling: touch; }
+    .table-responsive-lg > .table-bordered {
+      border: 0; } }
+
+@media (max-width: 1199.98px) {
+  .table-responsive-xl {
+    display: block;
+    width: 100%;
+    overflow-x: auto;
+    -webkit-overflow-scrolling: touch; }
+    .table-responsive-xl > .table-bordered {
+      border: 0; } }
+
+.table-responsive {
+  display: block;
+  width: 100%;
+  overflow-x: auto;
+  -webkit-overflow-scrolling: touch; }
+  .table-responsive > .table-bordered {
+    border: 0; }
+
+.form-control {
+  display: block;
+  width: 100%;
+  height: calc(1.5em + 0.75rem + 2px);
+  padding: 0.375rem 0.75rem;
+  font-size: 0.875rem;
+  font-weight: 400;
+  line-height: 1.5;
+  color: #495057;
+  background-color: #fff;
+  background-clip: padding-box;
+  border: 1px solid #ced4da;
+  border-radius: 0.25rem;
+  transition: border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; }
+  @media (prefers-reduced-motion: reduce) {
+    .form-control {
+      transition: none; } }
+  .form-control::-ms-expand {
+    background-color: transparent;
+    border: 0; }
+  .form-control:focus {
+    color: #495057;
+    background-color: #fff;
+    border-color: #94b2db;
+    outline: 0;
+    box-shadow: 0 0 0 0.2rem rgba(60, 110, 180, 0.25); }
+  .form-control::placeholder {
+    color: #6c757d;
+    opacity: 1; }
+  .form-control:disabled, .form-control[readonly] {
+    background-color: #e9ecef;
+    opacity: 1; }
+
+select.form-control:focus::-ms-value {
+  color: #495057;
+  background-color: #fff; }
+
+.form-control-file,
+.form-control-range {
+  display: block;
+  width: 100%; }
+
+.col-form-label {
+  padding-top: calc(0.375rem + 1px);
+  padding-bottom: calc(0.375rem + 1px);
+  margin-bottom: 0;
+  font-size: inherit;
+  line-height: 1.5; }
+
+.col-form-label-lg {
+  padding-top: calc(0.5rem + 1px);
+  padding-bottom: calc(0.5rem + 1px);
+  font-size: 1.09375rem;
+  line-height: 1.5; }
+
+.col-form-label-sm {
+  padding-top: calc(0.25rem + 1px);
+  padding-bottom: calc(0.25rem + 1px);
+  font-size: 0.76562rem;
+  line-height: 1.5; }
+
+.form-control-plaintext {
+  display: block;
+  width: 100%;
+  padding-top: 0.375rem;
+  padding-bottom: 0.375rem;
+  margin-bottom: 0;
+  line-height: 1.5;
+  color: #373a3c;
+  background-color: transparent;
+  border: solid transparent;
+  border-width: 1px 0; }
+  .form-control-plaintext.form-control-sm, .form-control-plaintext.form-control-lg {
+    padding-right: 0;
+    padding-left: 0; }
+
+.form-control-sm {
+  height: calc(1.5em + 0.5rem + 2px);
+  padding: 0.25rem 0.5rem;
+  font-size: 0.76562rem;
+  line-height: 1.5;
+  border-radius: 0.2rem; }
+
+.form-control-lg {
+  height: calc(1.5em + 1rem + 2px);
+  padding: 0.5rem 1rem;
+  font-size: 1.09375rem;
+  line-height: 1.5;
+  border-radius: 0.3rem; }
+
+select.form-control[size], select.form-control[multiple] {
+  height: auto; }
+
+textarea.form-control {
+  height: auto; }
+
+.form-group {
+  margin-bottom: 1rem; }
+
+.form-text {
+  display: block;
+  margin-top: 0.25rem; }
+
+.form-row {
+  display: flex;
+  flex-wrap: wrap;
+  margin-right: -5px;
+  margin-left: -5px; }
+  .form-row > .col,
+  .form-row > [class*="col-"] {
+    padding-right: 5px;
+    padding-left: 5px; }
+
+.form-check {
+  position: relative;
+  display: block;
+  padding-left: 1.25rem; }
+
+.form-check-input {
+  position: absolute;
+  margin-top: 0.3rem;
+  margin-left: -1.25rem; }
+  .form-check-input:disabled ~ .form-check-label {
+    color: #6c757d; }
+
+.form-check-label {
+  margin-bottom: 0; }
+
+.form-check-inline {
+  display: inline-flex;
+  align-items: center;
+  padding-left: 0;
+  margin-right: 0.75rem; }
+  .form-check-inline .form-check-input {
+    position: static;
+    margin-top: 0;
+    margin-right: 0.3125rem;
+    margin-left: 0; }
+
+.valid-feedback {
+  display: none;
+  width: 100%;
+  margin-top: 0.25rem;
+  font-size: 80%;
+  color: #28a745; }
+
+.valid-tooltip {
+  position: absolute;
+  top: 100%;
+  z-index: 5;
+  display: none;
+  max-width: 100%;
+  padding: 0.25rem 0.5rem;
+  margin-top: .1rem;
+  font-size: 0.76562rem;
+  line-height: 1.5;
+  color: #fff;
+  background-color: rgba(40, 167, 69, 0.9);
+  border-radius: 0.25rem; }
+
+.was-validated .form-control:valid, .form-control.is-valid {
+  border-color: #28a745;
+  padding-right: calc(1.5em + 0.75rem);
+  background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%2328a745' d='M2.3 6.73L.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e");
+  background-repeat: no-repeat;
+  background-position: center right calc(0.375em + 0.1875rem);
+  background-size: calc(0.75em + 0.375rem) calc(0.75em + 0.375rem); }
+  .was-validated .form-control:valid:focus, .form-control.is-valid:focus {
+    border-color: #28a745;
+    box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.25); }
+  .was-validated .form-control:valid ~ .valid-feedback,
+  .was-validated .form-control:valid ~ .valid-tooltip, .form-control.is-valid ~ .valid-feedback,
+  .form-control.is-valid ~ .valid-tooltip {
+    display: block; }
+
+.was-validated textarea.form-control:valid, textarea.form-control.is-valid {
+  padding-right: calc(1.5em + 0.75rem);
+  background-position: top calc(0.375em + 0.1875rem) right calc(0.375em + 0.1875rem); }
+
+.was-validated .custom-select:valid, .custom-select.is-valid {
+  border-color: #28a745;
+  padding-right: calc((1em + 0.75rem) * 3 / 4 + 1.75rem);
+  background: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 4 5'%3e%3cpath fill='%23343a40' d='M2 0L0 2h4zm0 5L0 3h4z'/%3e%3c/svg%3e") no-repeat right 0.75rem center/8px 10px, url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%2328a745' d='M2.3 6.73L.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e") #fff no-repeat center right 1.75rem/calc(0.75em + 0.375rem) calc(0.75em + 0.375rem); }
+  .was-validated .custom-select:valid:focus, .custom-select.is-valid:focus {
+    border-color: #28a745;
+    box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.25); }
+  .was-validated .custom-select:valid ~ .valid-feedback,
+  .was-validated .custom-select:valid ~ .valid-tooltip, .custom-select.is-valid ~ .valid-feedback,
+  .custom-select.is-valid ~ .valid-tooltip {
+    display: block; }
+
+.was-validated .form-control-file:valid ~ .valid-feedback,
+.was-validated .form-control-file:valid ~ .valid-tooltip, .form-control-file.is-valid ~ .valid-feedback,
+.form-control-file.is-valid ~ .valid-tooltip {
+  display: block; }
+
+.was-validated .form-check-input:valid ~ .form-check-label, .form-check-input.is-valid ~ .form-check-label {
+  color: #28a745; }
+
+.was-validated .form-check-input:valid ~ .valid-feedback,
+.was-validated .form-check-input:valid ~ .valid-tooltip, .form-check-input.is-valid ~ .valid-feedback,
+.form-check-input.is-valid ~ .valid-tooltip {
+  display: block; }
+
+.was-validated .custom-control-input:valid ~ .custom-control-label, .custom-control-input.is-valid ~ .custom-control-label {
+  color: #28a745; }
+  .was-validated .custom-control-input:valid ~ .custom-control-label::before, .custom-control-input.is-valid ~ .custom-control-label::before {
+    border-color: #28a745; }
+
+.was-validated .custom-control-input:valid ~ .valid-feedback,
+.was-validated .custom-control-input:valid ~ .valid-tooltip, .custom-control-input.is-valid ~ .valid-feedback,
+.custom-control-input.is-valid ~ .valid-tooltip {
+  display: block; }
+
+.was-validated .custom-control-input:valid:checked ~ .custom-control-label::before, .custom-control-input.is-valid:checked ~ .custom-control-label::before {
+  border-color: #34ce57;
+  background-color: #34ce57; }
+
+.was-validated .custom-control-input:valid:focus ~ .custom-control-label::before, .custom-control-input.is-valid:focus ~ .custom-control-label::before {
+  box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.25); }
+
+.was-validated .custom-control-input:valid:focus:not(:checked) ~ .custom-control-label::before, .custom-control-input.is-valid:focus:not(:checked) ~ .custom-control-label::before {
+  border-color: #28a745; }
+
+.was-validated .custom-file-input:valid ~ .custom-file-label, .custom-file-input.is-valid ~ .custom-file-label {
+  border-color: #28a745; }
+
+.was-validated .custom-file-input:valid ~ .valid-feedback,
+.was-validated .custom-file-input:valid ~ .valid-tooltip, .custom-file-input.is-valid ~ .valid-feedback,
+.custom-file-input.is-valid ~ .valid-tooltip {
+  display: block; }
+
+.was-validated .custom-file-input:valid:focus ~ .custom-file-label, .custom-file-input.is-valid:focus ~ .custom-file-label {
+  border-color: #28a745;
+  box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.25); }
+
+.invalid-feedback {
+  display: none;
+  width: 100%;
+  margin-top: 0.25rem;
+  font-size: 80%;
+  color: #dc3545; }
+
+.invalid-tooltip {
+  position: absolute;
+  top: 100%;
+  z-index: 5;
+  display: none;
+  max-width: 100%;
+  padding: 0.25rem 0.5rem;
+  margin-top: .1rem;
+  font-size: 0.76562rem;
+  line-height: 1.5;
+  color: #fff;
+  background-color: rgba(220, 53, 69, 0.9);
+  border-radius: 0.25rem; }
+
+.was-validated .form-control:invalid, .form-control.is-invalid {
+  border-color: #dc3545;
+  padding-right: calc(1.5em + 0.75rem);
+  background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' fill='%23dc3545' viewBox='-2 -2 7 7'%3e%3cpath stroke='%23dc3545' d='M0 0l3 3m0-3L0 3'/%3e%3ccircle r='.5'/%3e%3ccircle cx='3' r='.5'/%3e%3ccircle cy='3' r='.5'/%3e%3ccircle cx='3' cy='3' r='.5'/%3e%3c/svg%3E");
+  background-repeat: no-repeat;
+  background-position: center right calc(0.375em + 0.1875rem);
+  background-size: calc(0.75em + 0.375rem) calc(0.75em + 0.375rem); }
+  .was-validated .form-control:invalid:focus, .form-control.is-invalid:focus {
+    border-color: #dc3545;
+    box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.25); }
+  .was-validated .form-control:invalid ~ .invalid-feedback,
+  .was-validated .form-control:invalid ~ .invalid-tooltip, .form-control.is-invalid ~ .invalid-feedback,
+  .form-control.is-invalid ~ .invalid-tooltip {
+    display: block; }
+
+.was-validated textarea.form-control:invalid, textarea.form-control.is-invalid {
+  padding-right: calc(1.5em + 0.75rem);
+  background-position: top calc(0.375em + 0.1875rem) right calc(0.375em + 0.1875rem); }
+
+.was-validated .custom-select:invalid, .custom-select.is-invalid {
+  border-color: #dc3545;
+  padding-right: calc((1em + 0.75rem) * 3 / 4 + 1.75rem);
+  background: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 4 5'%3e%3cpath fill='%23343a40' d='M2 0L0 2h4zm0 5L0 3h4z'/%3e%3c/svg%3e") no-repeat right 0.75rem center/8px 10px, url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' fill='%23dc3545' viewBox='-2 -2 7 7'%3e%3cpath stroke='%23dc3545' d='M0 0l3 3m0-3L0 3'/%3e%3ccircle r='.5'/%3e%3ccircle cx='3' r='.5'/%3e%3ccircle cy='3' r='.5'/%3e%3ccircle cx='3' cy='3' r='.5'/%3e%3c/svg%3E") #fff no-repeat center right 1.75rem/calc(0.75em + 0.375rem) calc(0.75em + 0.375rem); }
+  .was-validated .custom-select:invalid:focus, .custom-select.is-invalid:focus {
+    border-color: #dc3545;
+    box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.25); }
+  .was-validated .custom-select:invalid ~ .invalid-feedback,
+  .was-validated .custom-select:invalid ~ .invalid-tooltip, .custom-select.is-invalid ~ .invalid-feedback,
+  .custom-select.is-invalid ~ .invalid-tooltip {
+    display: block; }
+
+.was-validated .form-control-file:invalid ~ .invalid-feedback,
+.was-validated .form-control-file:invalid ~ .invalid-tooltip, .form-control-file.is-invalid ~ .invalid-feedback,
+.form-control-file.is-invalid ~ .invalid-tooltip {
+  display: block; }
+
+.was-validated .form-check-input:invalid ~ .form-check-label, .form-check-input.is-invalid ~ .form-check-label {
+  color: #dc3545; }
+
+.was-validated .form-check-input:invalid ~ .invalid-feedback,
+.was-validated .form-check-input:invalid ~ .invalid-tooltip, .form-check-input.is-invalid ~ .invalid-feedback,
+.form-check-input.is-invalid ~ .invalid-tooltip {
+  display: block; }
+
+.was-validated .custom-control-input:invalid ~ .custom-control-label, .custom-control-input.is-invalid ~ .custom-control-label {
+  color: #dc3545; }
+  .was-validated .custom-control-input:invalid ~ .custom-control-label::before, .custom-control-input.is-invalid ~ .custom-control-label::before {
+    border-color: #dc3545; }
+
+.was-validated .custom-control-input:invalid ~ .invalid-feedback,
+.was-validated .custom-control-input:invalid ~ .invalid-tooltip, .custom-control-input.is-invalid ~ .invalid-feedback,
+.custom-control-input.is-invalid ~ .invalid-tooltip {
+  display: block; }
+
+.was-validated .custom-control-input:invalid:checked ~ .custom-control-label::before, .custom-control-input.is-invalid:checked ~ .custom-control-label::before {
+  border-color: #e4606d;
+  background-color: #e4606d; }
+
+.was-validated .custom-control-input:invalid:focus ~ .custom-control-label::before, .custom-control-input.is-invalid:focus ~ .custom-control-label::before {
+  box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.25); }
+
+.was-validated .custom-control-input:invalid:focus:not(:checked) ~ .custom-control-label::before, .custom-control-input.is-invalid:focus:not(:checked) ~ .custom-control-label::before {
+  border-color: #dc3545; }
+
+.was-validated .custom-file-input:invalid ~ .custom-file-label, .custom-file-input.is-invalid ~ .custom-file-label {
+  border-color: #dc3545; }
+
+.was-validated .custom-file-input:invalid ~ .invalid-feedback,
+.was-validated .custom-file-input:invalid ~ .invalid-tooltip, .custom-file-input.is-invalid ~ .invalid-feedback,
+.custom-file-input.is-invalid ~ .invalid-tooltip {
+  display: block; }
+
+.was-validated .custom-file-input:invalid:focus ~ .custom-file-label, .custom-file-input.is-invalid:focus ~ .custom-file-label {
+  border-color: #dc3545;
+  box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.25); }
+
+.form-inline {
+  display: flex;
+  flex-flow: row wrap;
+  align-items: center; }
+  .form-inline .form-check {
+    width: 100%; }
+  @media (min-width: 576px) {
+    .form-inline label {
+      display: flex;
+      align-items: center;
+      justify-content: center;
+      margin-bottom: 0; }
+    .form-inline .form-group {
+      display: flex;
+      flex: 0 0 auto;
+      flex-flow: row wrap;
+      align-items: center;
+      margin-bottom: 0; }
+    .form-inline .form-control {
+      display: inline-block;
+      width: auto;
+      vertical-align: middle; }
+    .form-inline .form-control-plaintext {
+      display: inline-block; }
+    .form-inline .input-group,
+    .form-inline .custom-select {
+      width: auto; }
+    .form-inline .form-check {
+      display: flex;
+      align-items: center;
+      justify-content: center;
+      width: auto;
+      padding-left: 0; }
+    .form-inline .form-check-input {
+      position: relative;
+      flex-shrink: 0;
+      margin-top: 0;
+      margin-right: 0.25rem;
+      margin-left: 0; }
+    .form-inline .custom-control {
+      align-items: center;
+      justify-content: center; }
+    .form-inline .custom-control-label {
+      margin-bottom: 0; } }
+
+.btn {
+  display: inline-block;
+  font-weight: 400;
+  color: #373a3c;
+  text-align: center;
+  vertical-align: middle;
+  user-select: none;
+  background-color: transparent;
+  border: 1px solid transparent;
+  padding: 0.375rem 0.75rem;
+  font-size: 0.875rem;
+  line-height: 1.5;
+  border-radius: 0.25rem;
+  transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; }
+  @media (prefers-reduced-motion: reduce) {
+    .btn {
+      transition: none; } }
+  .btn:hover {
+    color: #373a3c;
+    text-decoration: none; }
+  .btn:focus, .btn.focus {
+    outline: 0;
+    box-shadow: 0 0 0 0.2rem rgba(60, 110, 180, 0.25); }
+  .btn.disabled, .btn:disabled {
+    opacity: 0.65; }
+
+a.btn.disabled,
+fieldset:disabled a.btn {
+  pointer-events: none; }
+
+.btn-primary {
+  color: #fff;
+  background-color: #3c6eb4;
+  border-color: #3c6eb4; }
+  .btn-primary:hover {
+    color: #fff;
+    background-color: #325c97;
+    border-color: #2f578e; }
+  .btn-primary:focus, .btn-primary.focus {
+    box-shadow: 0 0 0 0.2rem rgba(89, 132, 191, 0.5); }
+  .btn-primary.disabled, .btn-primary:disabled {
+    color: #fff;
+    background-color: #3c6eb4;
+    border-color: #3c6eb4; }
+  .btn-primary:not(:disabled):not(.disabled):active, .btn-primary:not(:disabled):not(.disabled).active,
+  .show > .btn-primary.dropdown-toggle {
+    color: #fff;
+    background-color: #2f578e;
+    border-color: #2c5184; }
+    .btn-primary:not(:disabled):not(.disabled):active:focus, .btn-primary:not(:disabled):not(.disabled).active:focus,
+    .show > .btn-primary.dropdown-toggle:focus {
+      box-shadow: 0 0 0 0.2rem rgba(89, 132, 191, 0.5); }
+
+.btn-secondary {
+  color: #fff;
+  background-color: #6c757d;
+  border-color: #6c757d; }
+  .btn-secondary:hover {
+    color: #fff;
+    background-color: #5a6268;
+    border-color: #545b62; }
+  .btn-secondary:focus, .btn-secondary.focus {
+    box-shadow: 0 0 0 0.2rem rgba(130, 138, 145, 0.5); }
+  .btn-secondary.disabled, .btn-secondary:disabled {
+    color: #fff;
+    background-color: #6c757d;
+    border-color: #6c757d; }
+  .btn-secondary:not(:disabled):not(.disabled):active, .btn-secondary:not(:disabled):not(.disabled).active,
+  .show > .btn-secondary.dropdown-toggle {
+    color: #fff;
+    background-color: #545b62;
+    border-color: #4e555b; }
+    .btn-secondary:not(:disabled):not(.disabled):active:focus, .btn-secondary:not(:disabled):not(.disabled).active:focus,
+    .show > .btn-secondary.dropdown-toggle:focus {
+      box-shadow: 0 0 0 0.2rem rgba(130, 138, 145, 0.5); }
+
+.btn-success {
+  color: #fff;
+  background-color: #28a745;
+  border-color: #28a745; }
+  .btn-success:hover {
+    color: #fff;
+    background-color: #218838;
+    border-color: #1e7e34; }
+  .btn-success:focus, .btn-success.focus {
+    box-shadow: 0 0 0 0.2rem rgba(72, 180, 97, 0.5); }
+  .btn-success.disabled, .btn-success:disabled {
+    color: #fff;
+    background-color: #28a745;
+    border-color: #28a745; }
+  .btn-success:not(:disabled):not(.disabled):active, .btn-success:not(:disabled):not(.disabled).active,
+  .show > .btn-success.dropdown-toggle {
+    color: #fff;
+    background-color: #1e7e34;
+    border-color: #1c7430; }
+    .btn-success:not(:disabled):not(.disabled):active:focus, .btn-success:not(:disabled):not(.disabled).active:focus,
+    .show > .btn-success.dropdown-toggle:focus {
+      box-shadow: 0 0 0 0.2rem rgba(72, 180, 97, 0.5); }
+
+.btn-info {
+  color: #fff;
+  background-color: #17a2b8;
+  border-color: #17a2b8; }
+  .btn-info:hover {
+    color: #fff;
+    background-color: #138496;
+    border-color: #117a8b; }
+  .btn-info:focus, .btn-info.focus {
+    box-shadow: 0 0 0 0.2rem rgba(58, 176, 195, 0.5); }
+  .btn-info.disabled, .btn-info:disabled {
+    color: #fff;
+    background-color: #17a2b8;
+    border-color: #17a2b8; }
+  .btn-info:not(:disabled):not(.disabled):active, .btn-info:not(:disabled):not(.disabled).active,
+  .show > .btn-info.dropdown-toggle {
+    color: #fff;
+    background-color: #117a8b;
+    border-color: #10707f; }
+    .btn-info:not(:disabled):not(.disabled):active:focus, .btn-info:not(:disabled):not(.disabled).active:focus,
+    .show > .btn-info.dropdown-toggle:focus {
+      box-shadow: 0 0 0 0.2rem rgba(58, 176, 195, 0.5); }
+
+.btn-warning {
+  color: #212529;
+  background-color: #ffc107;
+  border-color: #ffc107; }
+  .btn-warning:hover {
+    color: #212529;
+    background-color: #e0a800;
+    border-color: #d39e00; }
+  .btn-warning:focus, .btn-warning.focus {
+    box-shadow: 0 0 0 0.2rem rgba(222, 170, 12, 0.5); }
+  .btn-warning.disabled, .btn-warning:disabled {
+    color: #212529;
+    background-color: #ffc107;
+    border-color: #ffc107; }
+  .btn-warning:not(:disabled):not(.disabled):active, .btn-warning:not(:disabled):not(.disabled).active,
+  .show > .btn-warning.dropdown-toggle {
+    color: #212529;
+    background-color: #d39e00;
+    border-color: #c69500; }
+    .btn-warning:not(:disabled):not(.disabled):active:focus, .btn-warning:not(:disabled):not(.disabled).active:focus,
+    .show > .btn-warning.dropdown-toggle:focus {
+      box-shadow: 0 0 0 0.2rem rgba(222, 170, 12, 0.5); }
+
+.btn-danger {
+  color: #fff;
+  background-color: #dc3545;
+  border-color: #dc3545; }
+  .btn-danger:hover {
+    color: #fff;
+    background-color: #c82333;
+    border-color: #bd2130; }
+  .btn-danger:focus, .btn-danger.focus {
+    box-shadow: 0 0 0 0.2rem rgba(225, 83, 97, 0.5); }
+  .btn-danger.disabled, .btn-danger:disabled {
+    color: #fff;
+    background-color: #dc3545;
+    border-color: #dc3545; }
+  .btn-danger:not(:disabled):not(.disabled):active, .btn-danger:not(:disabled):not(.disabled).active,
+  .show > .btn-danger.dropdown-toggle {
+    color: #fff;
+    background-color: #bd2130;
+    border-color: #b21f2d; }
+    .btn-danger:not(:disabled):not(.disabled):active:focus, .btn-danger:not(:disabled):not(.disabled).active:focus,
+    .show > .btn-danger.dropdown-toggle:focus {
+      box-shadow: 0 0 0 0.2rem rgba(225, 83, 97, 0.5); }
+
+.btn-light {
+  color: #212529;
+  background-color: #f8f9fa;
+  border-color: #f8f9fa; }
+  .btn-light:hover {
+    color: #212529;
+    background-color: #e2e6ea;
+    border-color: #dae0e5; }
+  .btn-light:focus, .btn-light.focus {
+    box-shadow: 0 0 0 0.2rem rgba(216, 217, 219, 0.5); }
+  .btn-light.disabled, .btn-light:disabled {
+    color: #212529;
+    background-color: #f8f9fa;
+    border-color: #f8f9fa; }
+  .btn-light:not(:disabled):not(.disabled):active, .btn-light:not(:disabled):not(.disabled).active,
+  .show > .btn-light.dropdown-toggle {
+    color: #212529;
+    background-color: #dae0e5;
+    border-color: #d3d9df; }
+    .btn-light:not(:disabled):not(.disabled):active:focus, .btn-light:not(:disabled):not(.disabled).active:focus,
+    .show > .btn-light.dropdown-toggle:focus {
+      box-shadow: 0 0 0 0.2rem rgba(216, 217, 219, 0.5); }
+
+.btn-dark {
+  color: #fff;
+  background-color: #343a40;
+  border-color: #343a40; }
+  .btn-dark:hover {
+    color: #fff;
+    background-color: #23272b;
+    border-color: #1d2124; }
+  .btn-dark:focus, .btn-dark.focus {
+    box-shadow: 0 0 0 0.2rem rgba(82, 88, 93, 0.5); }
+  .btn-dark.disabled, .btn-dark:disabled {
+    color: #fff;
+    background-color: #343a40;
+    border-color: #343a40; }
+  .btn-dark:not(:disabled):not(.disabled):active, .btn-dark:not(:disabled):not(.disabled).active,
+  .show > .btn-dark.dropdown-toggle {
+    color: #fff;
+    background-color: #1d2124;
+    border-color: #171a1d; }
+    .btn-dark:not(:disabled):not(.disabled):active:focus, .btn-dark:not(:disabled):not(.disabled).active:focus,
+    .show > .btn-dark.dropdown-toggle:focus {
+      box-shadow: 0 0 0 0.2rem rgba(82, 88, 93, 0.5); }
+
+.btn-outline-primary {
+  color: #3c6eb4;
+  border-color: #3c6eb4; }
+  .btn-outline-primary:hover {
+    color: #fff;
+    background-color: #3c6eb4;
+    border-color: #3c6eb4; }
+  .btn-outline-primary:focus, .btn-outline-primary.focus {
+    box-shadow: 0 0 0 0.2rem rgba(60, 110, 180, 0.5); }
+  .btn-outline-primary.disabled, .btn-outline-primary:disabled {
+    color: #3c6eb4;
+    background-color: transparent; }
+  .btn-outline-primary:not(:disabled):not(.disabled):active, .btn-outline-primary:not(:disabled):not(.disabled).active,
+  .show > .btn-outline-primary.dropdown-toggle {
+    color: #fff;
+    background-color: #3c6eb4;
+    border-color: #3c6eb4; }
+    .btn-outline-primary:not(:disabled):not(.disabled):active:focus, .btn-outline-primary:not(:disabled):not(.disabled).active:focus,
+    .show > .btn-outline-primary.dropdown-toggle:focus {
+      box-shadow: 0 0 0 0.2rem rgba(60, 110, 180, 0.5); }
+
+.btn-outline-secondary {
+  color: #6c757d;
+  border-color: #6c757d; }
+  .btn-outline-secondary:hover {
+    color: #fff;
+    background-color: #6c757d;
+    border-color: #6c757d; }
+  .btn-outline-secondary:focus, .btn-outline-secondary.focus {
+    box-shadow: 0 0 0 0.2rem rgba(108, 117, 125, 0.5); }
+  .btn-outline-secondary.disabled, .btn-outline-secondary:disabled {
+    color: #6c757d;
+    background-color: transparent; }
+  .btn-outline-secondary:not(:disabled):not(.disabled):active, .btn-outline-secondary:not(:disabled):not(.disabled).active,
+  .show > .btn-outline-secondary.dropdown-toggle {
+    color: #fff;
+    background-color: #6c757d;
+    border-color: #6c757d; }
+    .btn-outline-secondary:not(:disabled):not(.disabled):active:focus, .btn-outline-secondary:not(:disabled):not(.disabled).active:focus,
+    .show > .btn-outline-secondary.dropdown-toggle:focus {
+      box-shadow: 0 0 0 0.2rem rgba(108, 117, 125, 0.5); }
+
+.btn-outline-success {
+  color: #28a745;
+  border-color: #28a745; }
+  .btn-outline-success:hover {
+    color: #fff;
+    background-color: #28a745;
+    border-color: #28a745; }
+  .btn-outline-success:focus, .btn-outline-success.focus {
+    box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.5); }
+  .btn-outline-success.disabled, .btn-outline-success:disabled {
+    color: #28a745;
+    background-color: transparent; }
+  .btn-outline-success:not(:disabled):not(.disabled):active, .btn-outline-success:not(:disabled):not(.disabled).active,
+  .show > .btn-outline-success.dropdown-toggle {
+    color: #fff;
+    background-color: #28a745;
+    border-color: #28a745; }
+    .btn-outline-success:not(:disabled):not(.disabled):active:focus, .btn-outline-success:not(:disabled):not(.disabled).active:focus,
+    .show > .btn-outline-success.dropdown-toggle:focus {
+      box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.5); }
+
+.btn-outline-info {
+  color: #17a2b8;
+  border-color: #17a2b8; }
+  .btn-outline-info:hover {
+    color: #fff;
+    background-color: #17a2b8;
+    border-color: #17a2b8; }
+  .btn-outline-info:focus, .btn-outline-info.focus {
+    box-shadow: 0 0 0 0.2rem rgba(23, 162, 184, 0.5); }
+  .btn-outline-info.disabled, .btn-outline-info:disabled {
+    color: #17a2b8;
+    background-color: transparent; }
+  .btn-outline-info:not(:disabled):not(.disabled):active, .btn-outline-info:not(:disabled):not(.disabled).active,
+  .show > .btn-outline-info.dropdown-toggle {
+    color: #fff;
+    background-color: #17a2b8;
+    border-color: #17a2b8; }
+    .btn-outline-info:not(:disabled):not(.disabled):active:focus, .btn-outline-info:not(:disabled):not(.disabled).active:focus,
+    .show > .btn-outline-info.dropdown-toggle:focus {
+      box-shadow: 0 0 0 0.2rem rgba(23, 162, 184, 0.5); }
+
+.btn-outline-warning {
+  color: #ffc107;
+  border-color: #ffc107; }
+  .btn-outline-warning:hover {
+    color: #212529;
+    background-color: #ffc107;
+    border-color: #ffc107; }
+  .btn-outline-warning:focus, .btn-outline-warning.focus {
+    box-shadow: 0 0 0 0.2rem rgba(255, 193, 7, 0.5); }
+  .btn-outline-warning.disabled, .btn-outline-warning:disabled {
+    color: #ffc107;
+    background-color: transparent; }
+  .btn-outline-warning:not(:disabled):not(.disabled):active, .btn-outline-warning:not(:disabled):not(.disabled).active,
+  .show > .btn-outline-warning.dropdown-toggle {
+    color: #212529;
+    background-color: #ffc107;
+    border-color: #ffc107; }
+    .btn-outline-warning:not(:disabled):not(.disabled):active:focus, .btn-outline-warning:not(:disabled):not(.disabled).active:focus,
+    .show > .btn-outline-warning.dropdown-toggle:focus {
+      box-shadow: 0 0 0 0.2rem rgba(255, 193, 7, 0.5); }
+
+.btn-outline-danger {
+  color: #dc3545;
+  border-color: #dc3545; }
+  .btn-outline-danger:hover {
+    color: #fff;
+    background-color: #dc3545;
+    border-color: #dc3545; }
+  .btn-outline-danger:focus, .btn-outline-danger.focus {
+    box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.5); }
+  .btn-outline-danger.disabled, .btn-outline-danger:disabled {
+    color: #dc3545;
+    background-color: transparent; }
+  .btn-outline-danger:not(:disabled):not(.disabled):active, .btn-outline-danger:not(:disabled):not(.disabled).active,
+  .show > .btn-outline-danger.dropdown-toggle {
+    color: #fff;
+    background-color: #dc3545;
+    border-color: #dc3545; }
+    .btn-outline-danger:not(:disabled):not(.disabled):active:focus, .btn-outline-danger:not(:disabled):not(.disabled).active:focus,
+    .show > .btn-outline-danger.dropdown-toggle:focus {
+      box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.5); }
+
+.btn-outline-light {
+  color: #f8f9fa;
+  border-color: #f8f9fa; }
+  .btn-outline-light:hover {
+    color: #212529;
+    background-color: #f8f9fa;
+    border-color: #f8f9fa; }
+  .btn-outline-light:focus, .btn-outline-light.focus {
+    box-shadow: 0 0 0 0.2rem rgba(248, 249, 250, 0.5); }
+  .btn-outline-light.disabled, .btn-outline-light:disabled {
+    color: #f8f9fa;
+    background-color: transparent; }
+  .btn-outline-light:not(:disabled):not(.disabled):active, .btn-outline-light:not(:disabled):not(.disabled).active,
+  .show > .btn-outline-light.dropdown-toggle {
+    color: #212529;
+    background-color: #f8f9fa;
+    border-color: #f8f9fa; }
+    .btn-outline-light:not(:disabled):not(.disabled):active:focus, .btn-outline-light:not(:disabled):not(.disabled).active:focus,
+    .show > .btn-outline-light.dropdown-toggle:focus {
+      box-shadow: 0 0 0 0.2rem rgba(248, 249, 250, 0.5); }
+
+.btn-outline-dark {
+  color: #343a40;
+  border-color: #343a40; }
+  .btn-outline-dark:hover {
+    color: #fff;
+    background-color: #343a40;
+    border-color: #343a40; }
+  .btn-outline-dark:focus, .btn-outline-dark.focus {
+    box-shadow: 0 0 0 0.2rem rgba(52, 58, 64, 0.5); }
+  .btn-outline-dark.disabled, .btn-outline-dark:disabled {
+    color: #343a40;
+    background-color: transparent; }
+  .btn-outline-dark:not(:disabled):not(.disabled):active, .btn-outline-dark:not(:disabled):not(.disabled).active,
+  .show > .btn-outline-dark.dropdown-toggle {
+    color: #fff;
+    background-color: #343a40;
+    border-color: #343a40; }
+    .btn-outline-dark:not(:disabled):not(.disabled):active:focus, .btn-outline-dark:not(:disabled):not(.disabled).active:focus,
+    .show > .btn-outline-dark.dropdown-toggle:focus {
+      box-shadow: 0 0 0 0.2rem rgba(52, 58, 64, 0.5); }
+
+.btn-link {
+  font-weight: 400;
+  color: #3c6eb4;
+  text-decoration: none; }
+  .btn-link:hover {
+    color: #294b7b;
+    text-decoration: underline; }
+  .btn-link:focus, .btn-link.focus {
+    text-decoration: underline;
+    box-shadow: none; }
+  .btn-link:disabled, .btn-link.disabled {
+    color: #6c757d;
+    pointer-events: none; }
+
+.btn-lg, .btn-group-lg > .btn {
+  padding: 0.5rem 1rem;
+  font-size: 1.09375rem;
+  line-height: 1.5;
+  border-radius: 0.3rem; }
+
+.btn-sm, .btn-group-sm > .btn {
+  padding: 0.25rem 0.5rem;
+  font-size: 0.76562rem;
+  line-height: 1.5;
+  border-radius: 0.2rem; }
+
+.btn-block {
+  display: block;
+  width: 100%; }
+  .btn-block + .btn-block {
+    margin-top: 0.5rem; }
+
+input[type="submit"].btn-block,
+input[type="reset"].btn-block,
+input[type="button"].btn-block {
+  width: 100%; }
+
+.fade {
+  transition: opacity 0.15s linear; }
+  @media (prefers-reduced-motion: reduce) {
+    .fade {
+      transition: none; } }
+  .fade:not(.show) {
+    opacity: 0; }
+
+.collapse:not(.show) {
+  display: none; }
+
+.collapsing {
+  position: relative;
+  height: 0;
+  overflow: hidden;
+  transition: height 0.35s ease; }
+  @media (prefers-reduced-motion: reduce) {
+    .collapsing {
+      transition: none; } }
+
+.dropup,
+.dropright,
+.dropdown,
+.dropleft {
+  position: relative; }
+
+.dropdown-toggle {
+  white-space: nowrap; }
+  .dropdown-toggle::after {
+    display: inline-block;
+    margin-left: 0.255em;
+    vertical-align: 0.255em;
+    content: "";
+    border-top: 0.3em solid;
+    border-right: 0.3em solid transparent;
+    border-bottom: 0;
+    border-left: 0.3em solid transparent; }
+  .dropdown-toggle:empty::after {
+    margin-left: 0; }
+
+.dropdown-menu {
+  position: absolute;
+  top: 100%;
+  left: 0;
+  z-index: 1000;
+  display: none;
+  float: left;
+  min-width: 10rem;
+  padding: 0.5rem 0;
+  margin: 0.125rem 0 0;
+  font-size: 0.875rem;
+  color: #373a3c;
+  text-align: left;
+  list-style: none;
+  background-color: #fff;
+  background-clip: padding-box;
+  border: 1px solid rgba(0, 0, 0, 0.15);
+  border-radius: 0.25rem; }
+
+.dropdown-menu-left {
+  right: auto;
+  left: 0; }
+
+.dropdown-menu-right {
+  right: 0;
+  left: auto; }
+
+@media (min-width: 576px) {
+  .dropdown-menu-sm-left {
+    right: auto;
+    left: 0; }
+  .dropdown-menu-sm-right {
+    right: 0;
+    left: auto; } }
+
+@media (min-width: 768px) {
+  .dropdown-menu-md-left {
+    right: auto;
+    left: 0; }
+  .dropdown-menu-md-right {
+    right: 0;
+    left: auto; } }
+
+@media (min-width: 992px) {
+  .dropdown-menu-lg-left {
+    right: auto;
+    left: 0; }
+  .dropdown-menu-lg-right {
+    right: 0;
+    left: auto; } }
+
+@media (min-width: 1200px) {
+  .dropdown-menu-xl-left {
+    right: auto;
+    left: 0; }
+  .dropdown-menu-xl-right {
+    right: 0;
+    left: auto; } }
+
+.dropup .dropdown-menu {
+  top: auto;
+  bottom: 100%;
+  margin-top: 0;
+  margin-bottom: 0.125rem; }
+
+.dropup .dropdown-toggle::after {
+  display: inline-block;
+  margin-left: 0.255em;
+  vertical-align: 0.255em;
+  content: "";
+  border-top: 0;
+  border-right: 0.3em solid transparent;
+  border-bottom: 0.3em solid;
+  border-left: 0.3em solid transparent; }
+
+.dropup .dropdown-toggle:empty::after {
+  margin-left: 0; }
+
+.dropright .dropdown-menu {
+  top: 0;
+  right: auto;
+  left: 100%;
+  margin-top: 0;
+  margin-left: 0.125rem; }
+
+.dropright .dropdown-toggle::after {
+  display: inline-block;
+  margin-left: 0.255em;
+  vertical-align: 0.255em;
+  content: "";
+  border-top: 0.3em solid transparent;
+  border-right: 0;
+  border-bottom: 0.3em solid transparent;
+  border-left: 0.3em solid; }
+
+.dropright .dropdown-toggle:empty::after {
+  margin-left: 0; }
+
+.dropright .dropdown-toggle::after {
+  vertical-align: 0; }
+
+.dropleft .dropdown-menu {
+  top: 0;
+  right: 100%;
+  left: auto;
+  margin-top: 0;
+  margin-right: 0.125rem; }
+
+.dropleft .dropdown-toggle::after {
+  display: inline-block;
+  margin-left: 0.255em;
+  vertical-align: 0.255em;
+  content: ""; }
+
+.dropleft .dropdown-toggle::after {
+  display: none; }
+
+.dropleft .dropdown-toggle::before {
+  display: inline-block;
+  margin-right: 0.255em;
+  vertical-align: 0.255em;
+  content: "";
+  border-top: 0.3em solid transparent;
+  border-right: 0.3em solid;
+  border-bottom: 0.3em solid transparent; }
+
+.dropleft .dropdown-toggle:empty::after {
+  margin-left: 0; }
+
+.dropleft .dropdown-toggle::before {
+  vertical-align: 0; }
+
+.dropdown-menu[x-placement^="top"], .dropdown-menu[x-placement^="right"], .dropdown-menu[x-placement^="bottom"], .dropdown-menu[x-placement^="left"] {
+  right: auto;
+  bottom: auto; }
+
+.dropdown-divider {
+  height: 0;
+  margin: 0.5rem 0;
+  overflow: hidden;
+  border-top: 1px solid #e9ecef; }
+
+.dropdown-item {
+  display: block;
+  width: 100%;
+  padding: 0.25rem 1.5rem;
+  clear: both;
+  font-weight: 400;
+  color: #212529;
+  text-align: inherit;
+  white-space: nowrap;
+  background-color: transparent;
+  border: 0; }
+  .dropdown-item:hover, .dropdown-item:focus {
+    color: #16181b;
+    text-decoration: none;
+    background-color: #f8f9fa; }
+  .dropdown-item.active, .dropdown-item:active {
+    color: #fff;
+    text-decoration: none;
+    background-color: #3c6eb4; }
+  .dropdown-item.disabled, .dropdown-item:disabled {
+    color: #6c757d;
+    pointer-events: none;
+    background-color: transparent; }
+
+.dropdown-menu.show {
+  display: block; }
+
+.dropdown-header {
+  display: block;
+  padding: 0.5rem 1.5rem;
+  margin-bottom: 0;
+  font-size: 0.76562rem;
+  color: #6c757d;
+  white-space: nowrap; }
+
+.dropdown-item-text {
+  display: block;
+  padding: 0.25rem 1.5rem;
+  color: #212529; }
+
+.btn-group,
+.btn-group-vertical {
+  position: relative;
+  display: inline-flex;
+  vertical-align: middle; }
+  .btn-group > .btn,
+  .btn-group-vertical > .btn {
+    position: relative;
+    flex: 1 1 auto; }
+    .btn-group > .btn:hover,
+    .btn-group-vertical > .btn:hover {
+      z-index: 1; }
+    .btn-group > .btn:focus, .btn-group > .btn:active, .btn-group > .btn.active,
+    .btn-group-vertical > .btn:focus,
+    .btn-group-vertical > .btn:active,
+    .btn-group-vertical > .btn.active {
+      z-index: 1; }
+
+.btn-toolbar {
+  display: flex;
+  flex-wrap: wrap;
+  justify-content: flex-start; }
+  .btn-toolbar .input-group {
+    width: auto; }
+
+.btn-group > .btn:not(:first-child),
+.btn-group > .btn-group:not(:first-child) {
+  margin-left: -1px; }
+
+.btn-group > .btn:not(:last-child):not(.dropdown-toggle),
+.btn-group > .btn-group:not(:last-child) > .btn {
+  border-top-right-radius: 0;
+  border-bottom-right-radius: 0; }
+
+.btn-group > .btn:not(:first-child),
+.btn-group > .btn-group:not(:first-child) > .btn {
+  border-top-left-radius: 0;
+  border-bottom-left-radius: 0; }
+
+.dropdown-toggle-split {
+  padding-right: 0.5625rem;
+  padding-left: 0.5625rem; }
+  .dropdown-toggle-split::after,
+  .dropup .dropdown-toggle-split::after,
+  .dropright .dropdown-toggle-split::after {
+    margin-left: 0; }
+  .dropleft .dropdown-toggle-split::before {
+    margin-right: 0; }
+
+.btn-sm + .dropdown-toggle-split, .btn-group-sm > .btn + .dropdown-toggle-split {
+  padding-right: 0.375rem;
+  padding-left: 0.375rem; }
+
+.btn-lg + .dropdown-toggle-split, .btn-group-lg > .btn + .dropdown-toggle-split {
+  padding-right: 0.75rem;
+  padding-left: 0.75rem; }
+
+.btn-group-vertical {
+  flex-direction: column;
+  align-items: flex-start;
+  justify-content: center; }
+  .btn-group-vertical > .btn,
+  .btn-group-vertical > .btn-group {
+    width: 100%; }
+  .btn-group-vertical > .btn:not(:first-child),
+  .btn-group-vertical > .btn-group:not(:first-child) {
+    margin-top: -1px; }
+  .btn-group-vertical > .btn:not(:last-child):not(.dropdown-toggle),
+  .btn-group-vertical > .btn-group:not(:last-child) > .btn {
+    border-bottom-right-radius: 0;
+    border-bottom-left-radius: 0; }
+  .btn-group-vertical > .btn:not(:first-child),
+  .btn-group-vertical > .btn-group:not(:first-child) > .btn {
+    border-top-left-radius: 0;
+    border-top-right-radius: 0; }
+
+.btn-group-toggle > .btn,
+.btn-group-toggle > .btn-group > .btn {
+  margin-bottom: 0; }
+  .btn-group-toggle > .btn input[type="radio"],
+  .btn-group-toggle > .btn input[type="checkbox"],
+  .btn-group-toggle > .btn-group > .btn input[type="radio"],
+  .btn-group-toggle > .btn-group > .btn input[type="checkbox"] {
+    position: absolute;
+    clip: rect(0, 0, 0, 0);
+    pointer-events: none; }
+
+.input-group {
+  position: relative;
+  display: flex;
+  flex-wrap: wrap;
+  align-items: stretch;
+  width: 100%; }
+  .input-group > .form-control,
+  .input-group > .form-control-plaintext,
+  .input-group > .custom-select,
+  .input-group > .custom-file {
+    position: relative;
+    flex: 1 1 auto;
+    width: 1%;
+    margin-bottom: 0; }
+    .input-group > .form-control + .form-control,
+    .input-group > .form-control + .custom-select,
+    .input-group > .form-control + .custom-file,
+    .input-group > .form-control-plaintext + .form-control,
+    .input-group > .form-control-plaintext + .custom-select,
+    .input-group > .form-control-plaintext + .custom-file,
+    .input-group > .custom-select + .form-control,
+    .input-group > .custom-select + .custom-select,
+    .input-group > .custom-select + .custom-file,
+    .input-group > .custom-file + .form-control,
+    .input-group > .custom-file + .custom-select,
+    .input-group > .custom-file + .custom-file {
+      margin-left: -1px; }
+  .input-group > .form-control:focus,
+  .input-group > .custom-select:focus,
+  .input-group > .custom-file .custom-file-input:focus ~ .custom-file-label {
+    z-index: 3; }
+  .input-group > .custom-file .custom-file-input:focus {
+    z-index: 4; }
+  .input-group > .form-control:not(:last-child),
+  .input-group > .custom-select:not(:last-child) {
+    border-top-right-radius: 0;
+    border-bottom-right-radius: 0; }
+  .input-group > .form-control:not(:first-child),
+  .input-group > .custom-select:not(:first-child) {
+    border-top-left-radius: 0;
+    border-bottom-left-radius: 0; }
+  .input-group > .custom-file {
+    display: flex;
+    align-items: center; }
+    .input-group > .custom-file:not(:last-child) .custom-file-label,
+    .input-group > .custom-file:not(:last-child) .custom-file-label::after {
+      border-top-right-radius: 0;
+      border-bottom-right-radius: 0; }
+    .input-group > .custom-file:not(:first-child) .custom-file-label {
+      border-top-left-radius: 0;
+      border-bottom-left-radius: 0; }
+
+.input-group-prepend,
+.input-group-append {
+  display: flex; }
+  .input-group-prepend .btn,
+  .input-group-append .btn {
+    position: relative;
+    z-index: 2; }
+    .input-group-prepend .btn:focus,
+    .input-group-append .btn:focus {
+      z-index: 3; }
+  .input-group-prepend .btn + .btn,
+  .input-group-prepend .btn + .input-group-text,
+  .input-group-prepend .input-group-text + .input-group-text,
+  .input-group-prepend .input-group-text + .btn,
+  .input-group-append .btn + .btn,
+  .input-group-append .btn + .input-group-text,
+  .input-group-append .input-group-text + .input-group-text,
+  .input-group-append .input-group-text + .btn {
+    margin-left: -1px; }
+
+.input-group-prepend {
+  margin-right: -1px; }
+
+.input-group-append {
+  margin-left: -1px; }
+
+.input-group-text {
+  display: flex;
+  align-items: center;
+  padding: 0.375rem 0.75rem;
+  margin-bottom: 0;
+  font-size: 0.875rem;
+  font-weight: 400;
+  line-height: 1.5;
+  color: #495057;
+  text-align: center;
+  white-space: nowrap;
+  background-color: #e9ecef;
+  border: 1px solid #ced4da;
+  border-radius: 0.25rem; }
+  .input-group-text input[type="radio"],
+  .input-group-text input[type="checkbox"] {
+    margin-top: 0; }
+
+.input-group-lg > .form-control:not(textarea),
+.input-group-lg > .custom-select {
+  height: calc(1.5em + 1rem + 2px); }
+
+.input-group-lg > .form-control,
+.input-group-lg > .custom-select,
+.input-group-lg > .input-group-prepend > .input-group-text,
+.input-group-lg > .input-group-append > .input-group-text,
+.input-group-lg > .input-group-prepend > .btn,
+.input-group-lg > .input-group-append > .btn {
+  padding: 0.5rem 1rem;
+  font-size: 1.09375rem;
+  line-height: 1.5;
+  border-radius: 0.3rem; }
+
+.input-group-sm > .form-control:not(textarea),
+.input-group-sm > .custom-select {
+  height: calc(1.5em + 0.5rem + 2px); }
+
+.input-group-sm > .form-control,
+.input-group-sm > .custom-select,
+.input-group-sm > .input-group-prepend > .input-group-text,
+.input-group-sm > .input-group-append > .input-group-text,
+.input-group-sm > .input-group-prepend > .btn,
+.input-group-sm > .input-group-append > .btn {
+  padding: 0.25rem 0.5rem;
+  font-size: 0.76562rem;
+  line-height: 1.5;
+  border-radius: 0.2rem; }
+
+.input-group-lg > .custom-select,
+.input-group-sm > .custom-select {
+  padding-right: 1.75rem; }
+
+.input-group > .input-group-prepend > .btn,
+.input-group > .input-group-prepend > .input-group-text,
+.input-group > .input-group-append:not(:last-child) > .btn,
+.input-group > .input-group-append:not(:last-child) > .input-group-text,
+.input-group > .input-group-append:last-child > .btn:not(:last-child):not(.dropdown-toggle),
+.input-group > .input-group-append:last-child > .input-group-text:not(:last-child) {
+  border-top-right-radius: 0;
+  border-bottom-right-radius: 0; }
+
+.input-group > .input-group-append > .btn,
+.input-group > .input-group-append > .input-group-text,
+.input-group > .input-group-prepend:not(:first-child) > .btn,
+.input-group > .input-group-prepend:not(:first-child) > .input-group-text,
+.input-group > .input-group-prepend:first-child > .btn:not(:first-child),
+.input-group > .input-group-prepend:first-child > .input-group-text:not(:first-child) {
+  border-top-left-radius: 0;
+  border-bottom-left-radius: 0; }
+
+.custom-control {
+  position: relative;
+  display: block;
+  min-height: 1.3125rem;
+  padding-left: 1.5rem; }
+
+.custom-control-inline {
+  display: inline-flex;
+  margin-right: 1rem; }
+
+.custom-control-input {
+  position: absolute;
+  z-index: -1;
+  opacity: 0; }
+  .custom-control-input:checked ~ .custom-control-label::before {
+    color: #fff;
+    border-color: #3c6eb4;
+    background-color: #3c6eb4; }
+  .custom-control-input:focus ~ .custom-control-label::before {
+    box-shadow: 0 0 0 0.2rem rgba(60, 110, 180, 0.25); }
+  .custom-control-input:focus:not(:checked) ~ .custom-control-label::before {
+    border-color: #94b2db; }
+  .custom-control-input:not(:disabled):active ~ .custom-control-label::before {
+    color: #fff;
+    background-color: #bacde8;
+    border-color: #bacde8; }
+  .custom-control-input:disabled ~ .custom-control-label {
+    color: #6c757d; }
+    .custom-control-input:disabled ~ .custom-control-label::before {
+      background-color: #e9ecef; }
+
+.custom-control-label {
+  position: relative;
+  margin-bottom: 0;
+  vertical-align: top; }
+  .custom-control-label::before {
+    position: absolute;
+    top: 0.15625rem;
+    left: -1.5rem;
+    display: block;
+    width: 1rem;
+    height: 1rem;
+    pointer-events: none;
+    content: "";
+    background-color: #fff;
+    border: #adb5bd solid 1px; }
+  .custom-control-label::after {
+    position: absolute;
+    top: 0.15625rem;
+    left: -1.5rem;
+    display: block;
+    width: 1rem;
+    height: 1rem;
+    content: "";
+    background: no-repeat 50% / 50% 50%; }
+
+.custom-checkbox .custom-control-label::before {
+  border-radius: 0.25rem; }
+
+.custom-checkbox .custom-control-input:checked ~ .custom-control-label::after {
+  background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23fff' d='M6.564.75l-3.59 3.612-1.538-1.55L0 4.26 2.974 7.25 8 2.193z'/%3e%3c/svg%3e"); }
+
+.custom-checkbox .custom-control-input:indeterminate ~ .custom-control-label::before {
+  border-color: #3c6eb4;
+  background-color: #3c6eb4; }
+
+.custom-checkbox .custom-control-input:indeterminate ~ .custom-control-label::after {
+  background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 4 4'%3e%3cpath stroke='%23fff' d='M0 2h4'/%3e%3c/svg%3e"); }
+
+.custom-checkbox .custom-control-input:disabled:checked ~ .custom-control-label::before {
+  background-color: rgba(60, 110, 180, 0.5); }
+
+.custom-checkbox .custom-control-input:disabled:indeterminate ~ .custom-control-label::before {
+  background-color: rgba(60, 110, 180, 0.5); }
+
+.custom-radio .custom-control-label::before {
+  border-radius: 50%; }
+
+.custom-radio .custom-control-input:checked ~ .custom-control-label::after {
+  background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%23fff'/%3e%3c/svg%3e"); }
+
+.custom-radio .custom-control-input:disabled:checked ~ .custom-control-label::before {
+  background-color: rgba(60, 110, 180, 0.5); }
+
+.custom-switch {
+  padding-left: 2.25rem; }
+  .custom-switch .custom-control-label::before {
+    left: -2.25rem;
+    width: 1.75rem;
+    pointer-events: all;
+    border-radius: 0.5rem; }
+  .custom-switch .custom-control-label::after {
+    top: calc(0.15625rem + 2px);
+    left: calc(-2.25rem + 2px);
+    width: calc(1rem - 4px);
+    height: calc(1rem - 4px);
+    background-color: #adb5bd;
+    border-radius: 0.5rem;
+    transition: transform 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; }
+    @media (prefers-reduced-motion: reduce) {
+      .custom-switch .custom-control-label::after {
+        transition: none; } }
+  .custom-switch .custom-control-input:checked ~ .custom-control-label::after {
+    background-color: #fff;
+    transform: translateX(0.75rem); }
+  .custom-switch .custom-control-input:disabled:checked ~ .custom-control-label::before {
+    background-color: rgba(60, 110, 180, 0.5); }
+
+.custom-select {
+  display: inline-block;
+  width: 100%;
+  height: calc(1.5em + 0.75rem + 2px);
+  padding: 0.375rem 1.75rem 0.375rem 0.75rem;
+  font-size: 0.875rem;
+  font-weight: 400;
+  line-height: 1.5;
+  color: #495057;
+  vertical-align: middle;
+  background: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 4 5'%3e%3cpath fill='%23343a40' d='M2 0L0 2h4zm0 5L0 3h4z'/%3e%3c/svg%3e") no-repeat right 0.75rem center/8px 10px;
+  background-color: #fff;
+  border: 1px solid #ced4da;
+  border-radius: 0.25rem;
+  appearance: none; }
+  .custom-select:focus {
+    border-color: #94b2db;
+    outline: 0;
+    box-shadow: 0 0 0 0.2rem rgba(60, 110, 180, 0.25); }
+    .custom-select:focus::-ms-value {
+      color: #495057;
+      background-color: #fff; }
+  .custom-select[multiple], .custom-select[size]:not([size="1"]) {
+    height: auto;
+    padding-right: 0.75rem;
+    background-image: none; }
+  .custom-select:disabled {
+    color: #6c757d;
+    background-color: #e9ecef; }
+  .custom-select::-ms-expand {
+    display: none; }
+
+.custom-select-sm {
+  height: calc(1.5em + 0.5rem + 2px);
+  padding-top: 0.25rem;
+  padding-bottom: 0.25rem;
+  padding-left: 0.5rem;
+  font-size: 0.76562rem; }
+
+.custom-select-lg {
+  height: calc(1.5em + 1rem + 2px);
+  padding-top: 0.5rem;
+  padding-bottom: 0.5rem;
+  padding-left: 1rem;
+  font-size: 1.09375rem; }
+
+.custom-file {
+  position: relative;
+  display: inline-block;
+  width: 100%;
+  height: calc(1.5em + 0.75rem + 2px);
+  margin-bottom: 0; }
+
+.custom-file-input {
+  position: relative;
+  z-index: 2;
+  width: 100%;
+  height: calc(1.5em + 0.75rem + 2px);
+  margin: 0;
+  opacity: 0; }
+  .custom-file-input:focus ~ .custom-file-label {
+    border-color: #94b2db;
+    box-shadow: 0 0 0 0.2rem rgba(60, 110, 180, 0.25); }
+  .custom-file-input:disabled ~ .custom-file-label {
+    background-color: #e9ecef; }
+  .custom-file-input:lang(en) ~ .custom-file-label::after {
+    content: "Browse"; }
+  .custom-file-input ~ .custom-file-label[data-browse]::after {
+    content: attr(data-browse); }
+
+.custom-file-label {
+  position: absolute;
+  top: 0;
+  right: 0;
+  left: 0;
+  z-index: 1;
+  height: calc(1.5em + 0.75rem + 2px);
+  padding: 0.375rem 0.75rem;
+  font-weight: 400;
+  line-height: 1.5;
+  color: #495057;
+  background-color: #fff;
+  border: 1px solid #ced4da;
+  border-radius: 0.25rem; }
+  .custom-file-label::after {
+    position: absolute;
+    top: 0;
+    right: 0;
+    bottom: 0;
+    z-index: 3;
+    display: block;
+    height: calc(1.5em + 0.75rem);
+    padding: 0.375rem 0.75rem;
+    line-height: 1.5;
+    color: #495057;
+    content: "Browse";
+    background-color: #e9ecef;
+    border-left: inherit;
+    border-radius: 0 0.25rem 0.25rem 0; }
+
+.custom-range {
+  width: 100%;
+  height: calc(1rem + 0.4rem);
+  padding: 0;
+  background-color: transparent;
+  appearance: none; }
+  .custom-range:focus {
+    outline: none; }
+    .custom-range:focus::-webkit-slider-thumb {
+      box-shadow: 0 0 0 1px #fff, 0 0 0 0.2rem rgba(60, 110, 180, 0.25); }
+    .custom-range:focus::-moz-range-thumb {
+      box-shadow: 0 0 0 1px #fff, 0 0 0 0.2rem rgba(60, 110, 180, 0.25); }
+    .custom-range:focus::-ms-thumb {
+      box-shadow: 0 0 0 1px #fff, 0 0 0 0.2rem rgba(60, 110, 180, 0.25); }
+  .custom-range::-moz-focus-outer {
+    border: 0; }
+  .custom-range::-webkit-slider-thumb {
+    width: 1rem;
+    height: 1rem;
+    margin-top: -0.25rem;
+    background-color: #3c6eb4;
+    border: 0;
+    border-radius: 1rem;
+    transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
+    appearance: none; }
+    @media (prefers-reduced-motion: reduce) {
+      .custom-range::-webkit-slider-thumb {
+        transition: none; } }
+    .custom-range::-webkit-slider-thumb:active {
+      background-color: #bacde8; }
+  .custom-range::-webkit-slider-runnable-track {
+    width: 100%;
+    height: 0.5rem;
+    color: transparent;
+    cursor: pointer;
+    background-color: #dee2e6;
+    border-color: transparent;
+    border-radius: 1rem; }
+  .custom-range::-moz-range-thumb {
+    width: 1rem;
+    height: 1rem;
+    background-color: #3c6eb4;
+    border: 0;
+    border-radius: 1rem;
+    transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
+    appearance: none; }
+    @media (prefers-reduced-motion: reduce) {
+      .custom-range::-moz-range-thumb {
+        transition: none; } }
+    .custom-range::-moz-range-thumb:active {
+      background-color: #bacde8; }
+  .custom-range::-moz-range-track {
+    width: 100%;
+    height: 0.5rem;
+    color: transparent;
+    cursor: pointer;
+    background-color: #dee2e6;
+    border-color: transparent;
+    border-radius: 1rem; }
+  .custom-range::-ms-thumb {
+    width: 1rem;
+    height: 1rem;
+    margin-top: 0;
+    margin-right: 0.2rem;
+    margin-left: 0.2rem;
+    background-color: #3c6eb4;
+    border: 0;
+    border-radius: 1rem;
+    transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
+    appearance: none; }
+    @media (prefers-reduced-motion: reduce) {
+      .custom-range::-ms-thumb {
+        transition: none; } }
+    .custom-range::-ms-thumb:active {
+      background-color: #bacde8; }
+  .custom-range::-ms-track {
+    width: 100%;
+    height: 0.5rem;
+    color: transparent;
+    cursor: pointer;
+    background-color: transparent;
+    border-color: transparent;
+    border-width: 0.5rem; }
+  .custom-range::-ms-fill-lower {
+    background-color: #dee2e6;
+    border-radius: 1rem; }
+  .custom-range::-ms-fill-upper {
+    margin-right: 15px;
+    background-color: #dee2e6;
+    border-radius: 1rem; }
+  .custom-range:disabled::-webkit-slider-thumb {
+    background-color: #adb5bd; }
+  .custom-range:disabled::-webkit-slider-runnable-track {
+    cursor: default; }
+  .custom-range:disabled::-moz-range-thumb {
+    background-color: #adb5bd; }
+  .custom-range:disabled::-moz-range-track {
+    cursor: default; }
+  .custom-range:disabled::-ms-thumb {
+    background-color: #adb5bd; }
+
+.custom-control-label::before,
+.custom-file-label,
+.custom-select {
+  transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; }
+  @media (prefers-reduced-motion: reduce) {
+    .custom-control-label::before,
+    .custom-file-label,
+    .custom-select {
+      transition: none; } }
+
+.nav {
+  display: flex;
+  flex-wrap: wrap;
+  padding-left: 0;
+  margin-bottom: 0;
+  list-style: none; }
+
+.nav-link {
+  display: block;
+  padding: 0.5rem 1rem; }
+  .nav-link:hover, .nav-link:focus {
+    text-decoration: none; }
+  .nav-link.disabled {
+    color: #6c757d;
+    pointer-events: none;
+    cursor: default; }
+
+.nav-tabs {
+  border-bottom: 1px solid #dee2e6; }
+  .nav-tabs .nav-item {
+    margin-bottom: -1px; }
+  .nav-tabs .nav-link {
+    border: 1px solid transparent;
+    border-top-left-radius: 0.25rem;
+    border-top-right-radius: 0.25rem; }
+    .nav-tabs .nav-link:hover, .nav-tabs .nav-link:focus {
+      border-color: #e9ecef #e9ecef #dee2e6; }
+    .nav-tabs .nav-link.disabled {
+      color: #6c757d;
+      background-color: transparent;
+      border-color: transparent; }
+  .nav-tabs .nav-link.active,
+  .nav-tabs .nav-item.show .nav-link {
+    color: #495057;
+    background-color: #fff;
+    border-color: #dee2e6 #dee2e6 #fff; }
+  .nav-tabs .dropdown-menu {
+    margin-top: -1px;
+    border-top-left-radius: 0;
+    border-top-right-radius: 0; }
+
+.nav-pills .nav-link {
+  border-radius: 0.25rem; }
+
+.nav-pills .nav-link.active,
+.nav-pills .show > .nav-link {
+  color: #fff;
+  background-color: #3c6eb4; }
+
+.nav-fill .nav-item {
+  flex: 1 1 auto;
+  text-align: center; }
+
+.nav-justified .nav-item {
+  flex-basis: 0;
+  flex-grow: 1;
+  text-align: center; }
+
+.tab-content > .tab-pane {
+  display: none; }
+
+.tab-content > .active {
+  display: block; }
+
+.navbar {
+  position: relative;
+  display: flex;
+  flex-wrap: wrap;
+  align-items: center;
+  justify-content: space-between;
+  padding: 0.5rem 1rem; }
+  .navbar > .container,
+  .navbar > .container-fluid {
+    display: flex;
+    flex-wrap: wrap;
+    align-items: center;
+    justify-content: space-between; }
+
+.navbar-brand {
+  display: inline-block;
+  padding-top: 0.33594rem;
+  padding-bottom: 0.33594rem;
+  margin-right: 1rem;
+  font-size: 1.09375rem;
+  line-height: inherit;
+  white-space: nowrap; }
+  .navbar-brand:hover, .navbar-brand:focus {
+    text-decoration: none; }
+
+.navbar-nav {
+  display: flex;
+  flex-direction: column;
+  padding-left: 0;
+  margin-bottom: 0;
+  list-style: none; }
+  .navbar-nav .nav-link {
+    padding-right: 0;
+    padding-left: 0; }
+  .navbar-nav .dropdown-menu {
+    position: static;
+    float: none; }
+
+.navbar-text {
+  display: inline-block;
+  padding-top: 0.5rem;
+  padding-bottom: 0.5rem; }
+
+.navbar-collapse {
+  flex-basis: 100%;
+  flex-grow: 1;
+  align-items: center; }
+
+.navbar-toggler {
+  padding: 0.25rem 0.75rem;
+  font-size: 1.09375rem;
+  line-height: 1;
+  background-color: transparent;
+  border: 1px solid transparent;
+  border-radius: 0.25rem; }
+  .navbar-toggler:hover, .navbar-toggler:focus {
+    text-decoration: none; }
+
+.navbar-toggler-icon {
+  display: inline-block;
+  width: 1.5em;
+  height: 1.5em;
+  vertical-align: middle;
+  content: "";
+  background: no-repeat center center;
+  background-size: 100% 100%; }
+
+@media (max-width: 575.98px) {
+  .navbar-expand-sm > .container,
+  .navbar-expand-sm > .container-fluid {
+    padding-right: 0;
+    padding-left: 0; } }
+
+@media (min-width: 576px) {
+  .navbar-expand-sm {
+    flex-flow: row nowrap;
+    justify-content: flex-start; }
+    .navbar-expand-sm .navbar-nav {
+      flex-direction: row; }
+      .navbar-expand-sm .navbar-nav .dropdown-menu {
+        position: absolute; }
+      .navbar-expand-sm .navbar-nav .nav-link {
+        padding-right: 0.5rem;
+        padding-left: 0.5rem; }
+    .navbar-expand-sm > .container,
+    .navbar-expand-sm > .container-fluid {
+      flex-wrap: nowrap; }
+    .navbar-expand-sm .navbar-collapse {
+      display: flex !important;
+      flex-basis: auto; }
+    .navbar-expand-sm .navbar-toggler {
+      display: none; } }
+
+@media (max-width: 767.98px) {
+  .navbar-expand-md > .container,
+  .navbar-expand-md > .container-fluid {
+    padding-right: 0;
+    padding-left: 0; } }
+
+@media (min-width: 768px) {
+  .navbar-expand-md {
+    flex-flow: row nowrap;
+    justify-content: flex-start; }
+    .navbar-expand-md .navbar-nav {
+      flex-direction: row; }
+      .navbar-expand-md .navbar-nav .dropdown-menu {
+        position: absolute; }
+      .navbar-expand-md .navbar-nav .nav-link {
+        padding-right: 0.5rem;
+        padding-left: 0.5rem; }
+    .navbar-expand-md > .container,
+    .navbar-expand-md > .container-fluid {
+      flex-wrap: nowrap; }
+    .navbar-expand-md .navbar-collapse {
+      display: flex !important;
+      flex-basis: auto; }
+    .navbar-expand-md .navbar-toggler {
+      display: none; } }
+
+@media (max-width: 991.98px) {
+  .navbar-expand-lg > .container,
+  .navbar-expand-lg > .container-fluid {
+    padding-right: 0;
+    padding-left: 0; } }
+
+@media (min-width: 992px) {
+  .navbar-expand-lg {
+    flex-flow: row nowrap;
+    justify-content: flex-start; }
+    .navbar-expand-lg .navbar-nav {
+      flex-direction: row; }
+      .navbar-expand-lg .navbar-nav .dropdown-menu {
+        position: absolute; }
+      .navbar-expand-lg .navbar-nav .nav-link {
+        padding-right: 0.5rem;
+        padding-left: 0.5rem; }
+    .navbar-expand-lg > .container,
+    .navbar-expand-lg > .container-fluid {
+      flex-wrap: nowrap; }
+    .navbar-expand-lg .navbar-collapse {
+      display: flex !important;
+      flex-basis: auto; }
+    .navbar-expand-lg .navbar-toggler {
+      display: none; } }
+
+@media (max-width: 1199.98px) {
+  .navbar-expand-xl > .container,
+  .navbar-expand-xl > .container-fluid {
+    padding-right: 0;
+    padding-left: 0; } }
+
+@media (min-width: 1200px) {
+  .navbar-expand-xl {
+    flex-flow: row nowrap;
+    justify-content: flex-start; }
+    .navbar-expand-xl .navbar-nav {
+      flex-direction: row; }
+      .navbar-expand-xl .navbar-nav .dropdown-menu {
+        position: absolute; }
+      .navbar-expand-xl .navbar-nav .nav-link {
+        padding-right: 0.5rem;
+        padding-left: 0.5rem; }
+    .navbar-expand-xl > .container,
+    .navbar-expand-xl > .container-fluid {
+      flex-wrap: nowrap; }
+    .navbar-expand-xl .navbar-collapse {
+      display: flex !important;
+      flex-basis: auto; }
+    .navbar-expand-xl .navbar-toggler {
+      display: none; } }
+
+.navbar-expand {
+  flex-flow: row nowrap;
+  justify-content: flex-start; }
+  .navbar-expand > .container,
+  .navbar-expand > .container-fluid {
+    padding-right: 0;
+    padding-left: 0; }
+  .navbar-expand .navbar-nav {
+    flex-direction: row; }
+    .navbar-expand .navbar-nav .dropdown-menu {
+      position: absolute; }
+    .navbar-expand .navbar-nav .nav-link {
+      padding-right: 0.5rem;
+      padding-left: 0.5rem; }
+  .navbar-expand > .container,
+  .navbar-expand > .container-fluid {
+    flex-wrap: nowrap; }
+  .navbar-expand .navbar-collapse {
+    display: flex !important;
+    flex-basis: auto; }
+  .navbar-expand .navbar-toggler {
+    display: none; }
+
+.navbar-light .navbar-brand {
+  color: rgba(0, 0, 0, 0.9); }
+  .navbar-light .navbar-brand:hover, .navbar-light .navbar-brand:focus {
+    color: rgba(0, 0, 0, 0.9); }
+
+.navbar-light .navbar-nav .nav-link {
+  color: rgba(0, 0, 0, 0.5); }
+  .navbar-light .navbar-nav .nav-link:hover, .navbar-light .navbar-nav .nav-link:focus {
+    color: rgba(0, 0, 0, 0.7); }
+  .navbar-light .navbar-nav .nav-link.disabled {
+    color: rgba(0, 0, 0, 0.3); }
+
+.navbar-light .navbar-nav .show > .nav-link,
+.navbar-light .navbar-nav .active > .nav-link,
+.navbar-light .navbar-nav .nav-link.show,
+.navbar-light .navbar-nav .nav-link.active {
+  color: rgba(0, 0, 0, 0.9); }
+
+.navbar-light .navbar-toggler {
+  color: rgba(0, 0, 0, 0.5);
+  border-color: rgba(0, 0, 0, 0.1); }
+
+.navbar-light .navbar-toggler-icon {
+  background-image: url("data:image/svg+xml,%3csvg viewBox='0 0 30 30' xmlns='http://www.w3.org/2000/svg'%3e%3cpath stroke='rgba(0, 0, 0, 0.5)' stroke-width='2' stroke-linecap='round' stroke-miterlimit='10' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e"); }
+
+.navbar-light .navbar-text {
+  color: rgba(0, 0, 0, 0.5); }
+  .navbar-light .navbar-text a {
+    color: rgba(0, 0, 0, 0.9); }
+    .navbar-light .navbar-text a:hover, .navbar-light .navbar-text a:focus {
+      color: rgba(0, 0, 0, 0.9); }
+
+.navbar-dark .navbar-brand {
+  color: #fff; }
+  .navbar-dark .navbar-brand:hover, .navbar-dark .navbar-brand:focus {
+    color: #fff; }
+
+.navbar-dark .navbar-nav .nav-link {
+  color: rgba(255, 255, 255, 0.5); }
+  .navbar-dark .navbar-nav .nav-link:hover, .navbar-dark .navbar-nav .nav-link:focus {
+    color: rgba(255, 255, 255, 0.75); }
+  .navbar-dark .navbar-nav .nav-link.disabled {
+    color: rgba(255, 255, 255, 0.25); }
+
+.navbar-dark .navbar-nav .show > .nav-link,
+.navbar-dark .navbar-nav .active > .nav-link,
+.navbar-dark .navbar-nav .nav-link.show,
+.navbar-dark .navbar-nav .nav-link.active {
+  color: #fff; }
+
+.navbar-dark .navbar-toggler {
+  color: rgba(255, 255, 255, 0.5);
+  border-color: rgba(255, 255, 255, 0.1); }
+
+.navbar-dark .navbar-toggler-icon {
+  background-image: url("data:image/svg+xml,%3csvg viewBox='0 0 30 30' xmlns='http://www.w3.org/2000/svg'%3e%3cpath stroke='rgba(255, 255, 255, 0.5)' stroke-width='2' stroke-linecap='round' stroke-miterlimit='10' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e"); }
+
+.navbar-dark .navbar-text {
+  color: rgba(255, 255, 255, 0.5); }
+  .navbar-dark .navbar-text a {
+    color: #fff; }
+    .navbar-dark .navbar-text a:hover, .navbar-dark .navbar-text a:focus {
+      color: #fff; }
+
+.card {
+  position: relative;
+  display: flex;
+  flex-direction: column;
+  min-width: 0;
+  word-wrap: break-word;
+  background-color: #fff;
+  background-clip: border-box;
+  border: 1px solid rgba(0, 0, 0, 0.125);
+  border-radius: 0.25rem; }
+  .card > hr {
+    margin-right: 0;
+    margin-left: 0; }
+  .card > .list-group:first-child .list-group-item:first-child {
+    border-top-left-radius: 0.25rem;
+    border-top-right-radius: 0.25rem; }
+  .card > .list-group:last-child .list-group-item:last-child {
+    border-bottom-right-radius: 0.25rem;
+    border-bottom-left-radius: 0.25rem; }
+
+.card-body {
+  flex: 1 1 auto;
+  padding: 1.25rem; }
+
+.card-title {
+  margin-bottom: 0.75rem; }
+
+.card-subtitle {
+  margin-top: -0.375rem;
+  margin-bottom: 0; }
+
+.card-text:last-child {
+  margin-bottom: 0; }
+
+.card-link:hover {
+  text-decoration: none; }
+
+.card-link + .card-link {
+  margin-left: 1.25rem; }
+
+.card-header {
+  padding: 0.75rem 1.25rem;
+  margin-bottom: 0;
+  background-color: rgba(0, 0, 0, 0.03);
+  border-bottom: 1px solid rgba(0, 0, 0, 0.125); }
+  .card-header:first-child {
+    border-radius: calc(0.25rem - 1px) calc(0.25rem - 1px) 0 0; }
+  .card-header + .list-group .list-group-item:first-child {
+    border-top: 0; }
+
+.card-footer {
+  padding: 0.75rem 1.25rem;
+  background-color: rgba(0, 0, 0, 0.03);
+  border-top: 1px solid rgba(0, 0, 0, 0.125); }
+  .card-footer:last-child {
+    border-radius: 0 0 calc(0.25rem - 1px) calc(0.25rem - 1px); }
+
+.card-header-tabs {
+  margin-right: -0.625rem;
+  margin-bottom: -0.75rem;
+  margin-left: -0.625rem;
+  border-bottom: 0; }
+
+.card-header-pills {
+  margin-right: -0.625rem;
+  margin-left: -0.625rem; }
+
+.card-img-overlay {
+  position: absolute;
+  top: 0;
+  right: 0;
+  bottom: 0;
+  left: 0;
+  padding: 1.25rem; }
+
+.card-img {
+  width: 100%;
+  border-radius: calc(0.25rem - 1px); }
+
+.card-img-top {
+  width: 100%;
+  border-top-left-radius: calc(0.25rem - 1px);
+  border-top-right-radius: calc(0.25rem - 1px); }
+
+.card-img-bottom {
+  width: 100%;
+  border-bottom-right-radius: calc(0.25rem - 1px);
+  border-bottom-left-radius: calc(0.25rem - 1px); }
+
+.card-deck {
+  display: flex;
+  flex-direction: column; }
+  .card-deck .card {
+    margin-bottom: 15px; }
+  @media (min-width: 576px) {
+    .card-deck {
+      flex-flow: row wrap;
+      margin-right: -15px;
+      margin-left: -15px; }
+      .card-deck .card {
+        display: flex;
+        flex: 1 0 0%;
+        flex-direction: column;
+        margin-right: 15px;
+        margin-bottom: 0;
+        margin-left: 15px; } }
+
+.card-group {
+  display: flex;
+  flex-direction: column; }
+  .card-group > .card {
+    margin-bottom: 15px; }
+  @media (min-width: 576px) {
+    .card-group {
+      flex-flow: row wrap; }
+      .card-group > .card {
+        flex: 1 0 0%;
+        margin-bottom: 0; }
+        .card-group > .card + .card {
+          margin-left: 0;
+          border-left: 0; }
+        .card-group > .card:not(:last-child) {
+          border-top-right-radius: 0;
+          border-bottom-right-radius: 0; }
+          .card-group > .card:not(:last-child) .card-img-top,
+          .card-group > .card:not(:last-child) .card-header {
+            border-top-right-radius: 0; }
+          .card-group > .card:not(:last-child) .card-img-bottom,
+          .card-group > .card:not(:last-child) .card-footer {
+            border-bottom-right-radius: 0; }
+        .card-group > .card:not(:first-child) {
+          border-top-left-radius: 0;
+          border-bottom-left-radius: 0; }
+          .card-group > .card:not(:first-child) .card-img-top,
+          .card-group > .card:not(:first-child) .card-header {
+            border-top-left-radius: 0; }
+          .card-group > .card:not(:first-child) .card-img-bottom,
+          .card-group > .card:not(:first-child) .card-footer {
+            border-bottom-left-radius: 0; } }
+
+.card-columns .card {
+  margin-bottom: 0.75rem; }
+
+@media (min-width: 576px) {
+  .card-columns {
+    column-count: 3;
+    column-gap: 1.25rem;
+    orphans: 1;
+    widows: 1; }
+    .card-columns .card {
+      display: inline-block;
+      width: 100%; } }
+
+.accordion > .card {
+  overflow: hidden; }
+  .accordion > .card:not(:first-of-type) .card-header:first-child {
+    border-radius: 0; }
+  .accordion > .card:not(:first-of-type):not(:last-of-type) {
+    border-bottom: 0;
+    border-radius: 0; }
+  .accordion > .card:first-of-type {
+    border-bottom: 0;
+    border-bottom-right-radius: 0;
+    border-bottom-left-radius: 0; }
+  .accordion > .card:last-of-type {
+    border-top-left-radius: 0;
+    border-top-right-radius: 0; }
+  .accordion > .card .card-header {
+    margin-bottom: -1px; }
+
+.breadcrumb {
+  display: flex;
+  flex-wrap: wrap;
+  padding: 0.75rem 1rem;
+  margin-bottom: 1rem;
+  list-style: none;
+  background-color: #e9ecef;
+  border-radius: 0.25rem; }
+
+.breadcrumb-item + .breadcrumb-item {
+  padding-left: 0.5rem; }
+  .breadcrumb-item + .breadcrumb-item::before {
+    display: inline-block;
+    padding-right: 0.5rem;
+    color: #6c757d;
+    content: "/"; }
+
+.breadcrumb-item + .breadcrumb-item:hover::before {
+  text-decoration: underline; }
+
+.breadcrumb-item + .breadcrumb-item:hover::before {
+  text-decoration: none; }
+
+.breadcrumb-item.active {
+  color: #6c757d; }
+
+.pagination {
+  display: flex;
+  padding-left: 0;
+  list-style: none;
+  border-radius: 0.25rem; }
+
+.page-link {
+  position: relative;
+  display: block;
+  padding: 0.5rem 0.75rem;
+  margin-left: -1px;
+  line-height: 1.25;
+  color: #3c6eb4;
+  background-color: #fff;
+  border: 1px solid #dee2e6; }
+  .page-link:hover {
+    z-index: 2;
+    color: #294b7b;
+    text-decoration: none;
+    background-color: #e9ecef;
+    border-color: #dee2e6; }
+  .page-link:focus {
+    z-index: 2;
+    outline: 0;
+    box-shadow: 0 0 0 0.2rem rgba(60, 110, 180, 0.25); }
+
+.page-item:first-child .page-link {
+  margin-left: 0;
+  border-top-left-radius: 0.25rem;
+  border-bottom-left-radius: 0.25rem; }
+
+.page-item:last-child .page-link {
+  border-top-right-radius: 0.25rem;
+  border-bottom-right-radius: 0.25rem; }
+
+.page-item.active .page-link {
+  z-index: 1;
+  color: #fff;
+  background-color: #3c6eb4;
+  border-color: #3c6eb4; }
+
+.page-item.disabled .page-link {
+  color: #6c757d;
+  pointer-events: none;
+  cursor: auto;
+  background-color: #fff;
+  border-color: #dee2e6; }
+
+.pagination-lg .page-link {
+  padding: 0.75rem 1.5rem;
+  font-size: 1.09375rem;
+  line-height: 1.5; }
+
+.pagination-lg .page-item:first-child .page-link {
+  border-top-left-radius: 0.3rem;
+  border-bottom-left-radius: 0.3rem; }
+
+.pagination-lg .page-item:last-child .page-link {
+  border-top-right-radius: 0.3rem;
+  border-bottom-right-radius: 0.3rem; }
+
+.pagination-sm .page-link {
+  padding: 0.25rem 0.5rem;
+  font-size: 0.76562rem;
+  line-height: 1.5; }
+
+.pagination-sm .page-item:first-child .page-link {
+  border-top-left-radius: 0.2rem;
+  border-bottom-left-radius: 0.2rem; }
+
+.pagination-sm .page-item:last-child .page-link {
+  border-top-right-radius: 0.2rem;
+  border-bottom-right-radius: 0.2rem; }
+
+.badge {
+  display: inline-block;
+  padding: 0.25em 0.4em;
+  font-size: 75%;
+  font-weight: 700;
+  line-height: 1;
+  text-align: center;
+  white-space: nowrap;
+  vertical-align: baseline;
+  border-radius: 0.25rem;
+  transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; }
+  @media (prefers-reduced-motion: reduce) {
+    .badge {
+      transition: none; } }
+  a.badge:hover, a.badge:focus {
+    text-decoration: none; }
+  .badge:empty {
+    display: none; }
+
+.btn .badge {
+  position: relative;
+  top: -1px; }
+
+.badge-pill {
+  padding-right: 0.6em;
+  padding-left: 0.6em;
+  border-radius: 10rem; }
+
+.badge-primary {
+  color: #fff;
+  background-color: #3c6eb4; }
+  a.badge-primary:hover, a.badge-primary:focus {
+    color: #fff;
+    background-color: #2f578e; }
+  a.badge-primary:focus, a.badge-primary.focus {
+    outline: 0;
+    box-shadow: 0 0 0 0.2rem rgba(60, 110, 180, 0.5); }
+
+.badge-secondary {
+  color: #fff;
+  background-color: #6c757d; }
+  a.badge-secondary:hover, a.badge-secondary:focus {
+    color: #fff;
+    background-color: #545b62; }
+  a.badge-secondary:focus, a.badge-secondary.focus {
+    outline: 0;
+    box-shadow: 0 0 0 0.2rem rgba(108, 117, 125, 0.5); }
+
+.badge-success {
+  color: #fff;
+  background-color: #28a745; }
+  a.badge-success:hover, a.badge-success:focus {
+    color: #fff;
+    background-color: #1e7e34; }
+  a.badge-success:focus, a.badge-success.focus {
+    outline: 0;
+    box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.5); }
+
+.badge-info {
+  color: #fff;
+  background-color: #17a2b8; }
+  a.badge-info:hover, a.badge-info:focus {
+    color: #fff;
+    background-color: #117a8b; }
+  a.badge-info:focus, a.badge-info.focus {
+    outline: 0;
+    box-shadow: 0 0 0 0.2rem rgba(23, 162, 184, 0.5); }
+
+.badge-warning {
+  color: #212529;
+  background-color: #ffc107; }
+  a.badge-warning:hover, a.badge-warning:focus {
+    color: #212529;
+    background-color: #d39e00; }
+  a.badge-warning:focus, a.badge-warning.focus {
+    outline: 0;
+    box-shadow: 0 0 0 0.2rem rgba(255, 193, 7, 0.5); }
+
+.badge-danger {
+  color: #fff;
+  background-color: #dc3545; }
+  a.badge-danger:hover, a.badge-danger:focus {
+    color: #fff;
+    background-color: #bd2130; }
+  a.badge-danger:focus, a.badge-danger.focus {
+    outline: 0;
+    box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.5); }
+
+.badge-light {
+  color: #212529;
+  background-color: #f8f9fa; }
+  a.badge-light:hover, a.badge-light:focus {
+    color: #212529;
+    background-color: #dae0e5; }
+  a.badge-light:focus, a.badge-light.focus {
+    outline: 0;
+    box-shadow: 0 0 0 0.2rem rgba(248, 249, 250, 0.5); }
+
+.badge-dark {
+  color: #fff;
+  background-color: #343a40; }
+  a.badge-dark:hover, a.badge-dark:focus {
+    color: #fff;
+    background-color: #1d2124; }
+  a.badge-dark:focus, a.badge-dark.focus {
+    outline: 0;
+    box-shadow: 0 0 0 0.2rem rgba(52, 58, 64, 0.5); }
+
+.jumbotron {
+  padding: 2rem 1rem;
+  margin-bottom: 2rem;
+  background-color: #e9ecef;
+  border-radius: 0.3rem; }
+  @media (min-width: 576px) {
+    .jumbotron {
+      padding: 4rem 2rem; } }
+
+.jumbotron-fluid {
+  padding-right: 0;
+  padding-left: 0;
+  border-radius: 0; }
+
+.alert {
+  position: relative;
+  padding: 0.75rem 1.25rem;
+  margin-bottom: 1rem;
+  border: 1px solid transparent;
+  border-radius: 0.25rem; }
+
+.alert-heading {
+  color: inherit; }
+
+.alert-link {
+  font-weight: 700; }
+
+.alert-dismissible {
+  padding-right: 3.8125rem; }
+  .alert-dismissible .close {
+    position: absolute;
+    top: 0;
+    right: 0;
+    padding: 0.75rem 1.25rem;
+    color: inherit; }
+
+.alert-primary {
+  color: #1f395e;
+  background-color: #d8e2f0;
+  border-color: #c8d6ea; }
+  .alert-primary hr {
+    border-top-color: #b6c8e3; }
+  .alert-primary .alert-link {
+    color: #122238; }
+
+.alert-secondary {
+  color: #383d41;
+  background-color: #e2e3e5;
+  border-color: #d6d8db; }
+  .alert-secondary hr {
+    border-top-color: #c8cbcf; }
+  .alert-secondary .alert-link {
+    color: #202326; }
+
+.alert-success {
+  color: #155724;
+  background-color: #d4edda;
+  border-color: #c3e6cb; }
+  .alert-success hr {
+    border-top-color: #b1dfbb; }
+  .alert-success .alert-link {
+    color: #0b2e13; }
+
+.alert-info {
+  color: #0c5460;
+  background-color: #d1ecf1;
+  border-color: #bee5eb; }
+  .alert-info hr {
+    border-top-color: #abdde5; }
+  .alert-info .alert-link {
+    color: #062c33; }
+
+.alert-warning {
+  color: #856404;
+  background-color: #fff3cd;
+  border-color: #ffeeba; }
+  .alert-warning hr {
+    border-top-color: #ffe8a1; }
+  .alert-warning .alert-link {
+    color: #533f03; }
+
+.alert-danger {
+  color: #721c24;
+  background-color: #f8d7da;
+  border-color: #f5c6cb; }
+  .alert-danger hr {
+    border-top-color: #f1b0b7; }
+  .alert-danger .alert-link {
+    color: #491217; }
+
+.alert-light {
+  color: #818182;
+  background-color: #fefefe;
+  border-color: #fdfdfe; }
+  .alert-light hr {
+    border-top-color: #ececf6; }
+  .alert-light .alert-link {
+    color: #686868; }
+
+.alert-dark {
+  color: #1b1e21;
+  background-color: #d6d8d9;
+  border-color: #c6c8ca; }
+  .alert-dark hr {
+    border-top-color: #b9bbbe; }
+  .alert-dark .alert-link {
+    color: #040505; }
+
+@keyframes progress-bar-stripes {
+  from {
+    background-position: 1rem 0; }
+  to {
+    background-position: 0 0; } }
+
+.progress {
+  display: flex;
+  height: 1rem;
+  overflow: hidden;
+  font-size: 0.65625rem;
+  background-color: #e9ecef;
+  border-radius: 0.25rem; }
+
+.progress-bar {
+  display: flex;
+  flex-direction: column;
+  justify-content: center;
+  color: #fff;
+  text-align: center;
+  white-space: nowrap;
+  background-color: #3c6eb4;
+  transition: width 0.6s ease; }
+  @media (prefers-reduced-motion: reduce) {
+    .progress-bar {
+      transition: none; } }
+
+.progress-bar-striped {
+  background-image: linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+  background-size: 1rem 1rem; }
+
+.progress-bar-animated {
+  animation: progress-bar-stripes 1s linear infinite; }
+  @media (prefers-reduced-motion: reduce) {
+    .progress-bar-animated {
+      animation: none; } }
+
+.media {
+  display: flex;
+  align-items: flex-start; }
+
+.media-body {
+  flex: 1; }
+
+.list-group {
+  display: flex;
+  flex-direction: column;
+  padding-left: 0;
+  margin-bottom: 0; }
+
+.list-group-item-action {
+  width: 100%;
+  color: #495057;
+  text-align: inherit; }
+  .list-group-item-action:hover, .list-group-item-action:focus {
+    z-index: 1;
+    color: #495057;
+    text-decoration: none;
+    background-color: #f8f9fa; }
+  .list-group-item-action:active {
+    color: #373a3c;
+    background-color: #e9ecef; }
+
+.list-group-item {
+  position: relative;
+  display: block;
+  padding: 0.75rem 1.25rem;
+  margin-bottom: -1px;
+  background-color: #fff;
+  border: 1px solid rgba(0, 0, 0, 0.125); }
+  .list-group-item:first-child {
+    border-top-left-radius: 0.25rem;
+    border-top-right-radius: 0.25rem; }
+  .list-group-item:last-child {
+    margin-bottom: 0;
+    border-bottom-right-radius: 0.25rem;
+    border-bottom-left-radius: 0.25rem; }
+  .list-group-item.disabled, .list-group-item:disabled {
+    color: #6c757d;
+    pointer-events: none;
+    background-color: #fff; }
+  .list-group-item.active {
+    z-index: 2;
+    color: #fff;
+    background-color: #3c6eb4;
+    border-color: #3c6eb4; }
+
+.list-group-horizontal {
+  flex-direction: row; }
+  .list-group-horizontal .list-group-item {
+    margin-right: -1px;
+    margin-bottom: 0; }
+    .list-group-horizontal .list-group-item:first-child {
+      border-top-left-radius: 0.25rem;
+      border-bottom-left-radius: 0.25rem;
+      border-top-right-radius: 0; }
+    .list-group-horizontal .list-group-item:last-child {
+      margin-right: 0;
+      border-top-right-radius: 0.25rem;
+      border-bottom-right-radius: 0.25rem;
+      border-bottom-left-radius: 0; }
+
+@media (min-width: 576px) {
+  .list-group-horizontal-sm {
+    flex-direction: row; }
+    .list-group-horizontal-sm .list-group-item {
+      margin-right: -1px;
+      margin-bottom: 0; }
+      .list-group-horizontal-sm .list-group-item:first-child {
+        border-top-left-radius: 0.25rem;
+        border-bottom-left-radius: 0.25rem;
+        border-top-right-radius: 0; }
+      .list-group-horizontal-sm .list-group-item:last-child {
+        margin-right: 0;
+        border-top-right-radius: 0.25rem;
+        border-bottom-right-radius: 0.25rem;
+        border-bottom-left-radius: 0; } }
+
+@media (min-width: 768px) {
+  .list-group-horizontal-md {
+    flex-direction: row; }
+    .list-group-horizontal-md .list-group-item {
+      margin-right: -1px;
+      margin-bottom: 0; }
+      .list-group-horizontal-md .list-group-item:first-child {
+        border-top-left-radius: 0.25rem;
+        border-bottom-left-radius: 0.25rem;
+        border-top-right-radius: 0; }
+      .list-group-horizontal-md .list-group-item:last-child {
+        margin-right: 0;
+        border-top-right-radius: 0.25rem;
+        border-bottom-right-radius: 0.25rem;
+        border-bottom-left-radius: 0; } }
+
+@media (min-width: 992px) {
+  .list-group-horizontal-lg {
+    flex-direction: row; }
+    .list-group-horizontal-lg .list-group-item {
+      margin-right: -1px;
+      margin-bottom: 0; }
+      .list-group-horizontal-lg .list-group-item:first-child {
+        border-top-left-radius: 0.25rem;
+        border-bottom-left-radius: 0.25rem;
+        border-top-right-radius: 0; }
+      .list-group-horizontal-lg .list-group-item:last-child {
+        margin-right: 0;
+        border-top-right-radius: 0.25rem;
+        border-bottom-right-radius: 0.25rem;
+        border-bottom-left-radius: 0; } }
+
+@media (min-width: 1200px) {
+  .list-group-horizontal-xl {
+    flex-direction: row; }
+    .list-group-horizontal-xl .list-group-item {
+      margin-right: -1px;
+      margin-bottom: 0; }
+      .list-group-horizontal-xl .list-group-item:first-child {
+        border-top-left-radius: 0.25rem;
+        border-bottom-left-radius: 0.25rem;
+        border-top-right-radius: 0; }
+      .list-group-horizontal-xl .list-group-item:last-child {
+        margin-right: 0;
+        border-top-right-radius: 0.25rem;
+        border-bottom-right-radius: 0.25rem;
+        border-bottom-left-radius: 0; } }
+
+.list-group-flush .list-group-item {
+  border-right: 0;
+  border-left: 0;
+  border-radius: 0; }
+  .list-group-flush .list-group-item:last-child {
+    margin-bottom: -1px; }
+
+.list-group-flush:first-child .list-group-item:first-child {
+  border-top: 0; }
+
+.list-group-flush:last-child .list-group-item:last-child {
+  margin-bottom: 0;
+  border-bottom: 0; }
+
+.list-group-item-primary {
+  color: #1f395e;
+  background-color: #c8d6ea; }
+  .list-group-item-primary.list-group-item-action:hover, .list-group-item-primary.list-group-item-action:focus {
+    color: #1f395e;
+    background-color: #b6c8e3; }
+  .list-group-item-primary.list-group-item-action.active {
+    color: #fff;
+    background-color: #1f395e;
+    border-color: #1f395e; }
+
+.list-group-item-secondary {
+  color: #383d41;
+  background-color: #d6d8db; }
+  .list-group-item-secondary.list-group-item-action:hover, .list-group-item-secondary.list-group-item-action:focus {
+    color: #383d41;
+    background-color: #c8cbcf; }
+  .list-group-item-secondary.list-group-item-action.active {
+    color: #fff;
+    background-color: #383d41;
+    border-color: #383d41; }
+
+.list-group-item-success {
+  color: #155724;
+  background-color: #c3e6cb; }
+  .list-group-item-success.list-group-item-action:hover, .list-group-item-success.list-group-item-action:focus {
+    color: #155724;
+    background-color: #b1dfbb; }
+  .list-group-item-success.list-group-item-action.active {
+    color: #fff;
+    background-color: #155724;
+    border-color: #155724; }
+
+.list-group-item-info {
+  color: #0c5460;
+  background-color: #bee5eb; }
+  .list-group-item-info.list-group-item-action:hover, .list-group-item-info.list-group-item-action:focus {
+    color: #0c5460;
+    background-color: #abdde5; }
+  .list-group-item-info.list-group-item-action.active {
+    color: #fff;
+    background-color: #0c5460;
+    border-color: #0c5460; }
+
+.list-group-item-warning {
+  color: #856404;
+  background-color: #ffeeba; }
+  .list-group-item-warning.list-group-item-action:hover, .list-group-item-warning.list-group-item-action:focus {
+    color: #856404;
+    background-color: #ffe8a1; }
+  .list-group-item-warning.list-group-item-action.active {
+    color: #fff;
+    background-color: #856404;
+    border-color: #856404; }
+
+.list-group-item-danger {
+  color: #721c24;
+  background-color: #f5c6cb; }
+  .list-group-item-danger.list-group-item-action:hover, .list-group-item-danger.list-group-item-action:focus {
+    color: #721c24;
+    background-color: #f1b0b7; }
+  .list-group-item-danger.list-group-item-action.active {
+    color: #fff;
+    background-color: #721c24;
+    border-color: #721c24; }
+
+.list-group-item-light {
+  color: #818182;
+  background-color: #fdfdfe; }
+  .list-group-item-light.list-group-item-action:hover, .list-group-item-light.list-group-item-action:focus {
+    color: #818182;
+    background-color: #ececf6; }
+  .list-group-item-light.list-group-item-action.active {
+    color: #fff;
+    background-color: #818182;
+    border-color: #818182; }
+
+.list-group-item-dark {
+  color: #1b1e21;
+  background-color: #c6c8ca; }
+  .list-group-item-dark.list-group-item-action:hover, .list-group-item-dark.list-group-item-action:focus {
+    color: #1b1e21;
+    background-color: #b9bbbe; }
+  .list-group-item-dark.list-group-item-action.active {
+    color: #fff;
+    background-color: #1b1e21;
+    border-color: #1b1e21; }
+
+.close {
+  float: right;
+  font-size: 1.3125rem;
+  font-weight: 700;
+  line-height: 1;
+  color: #000;
+  text-shadow: 0 1px 0 #fff;
+  opacity: .5; }
+  .close:hover {
+    color: #000;
+    text-decoration: none; }
+  .close:not(:disabled):not(.disabled):hover, .close:not(:disabled):not(.disabled):focus {
+    opacity: .75; }
+
+button.close {
+  padding: 0;
+  background-color: transparent;
+  border: 0;
+  appearance: none; }
+
+a.close.disabled {
+  pointer-events: none; }
+
+.toast {
+  max-width: 350px;
+  overflow: hidden;
+  font-size: 0.875rem;
+  background-color: rgba(255, 255, 255, 0.85);
+  background-clip: padding-box;
+  border: 1px solid rgba(0, 0, 0, 0.1);
+  box-shadow: 0 0.25rem 0.75rem rgba(0, 0, 0, 0.1);
+  backdrop-filter: blur(10px);
+  opacity: 0;
+  border-radius: 0.25rem; }
+  .toast:not(:last-child) {
+    margin-bottom: 0.75rem; }
+  .toast.showing {
+    opacity: 1; }
+  .toast.show {
+    display: block;
+    opacity: 1; }
+  .toast.hide {
+    display: none; }
+
+.toast-header {
+  display: flex;
+  align-items: center;
+  padding: 0.25rem 0.75rem;
+  color: #6c757d;
+  background-color: rgba(255, 255, 255, 0.85);
+  background-clip: padding-box;
+  border-bottom: 1px solid rgba(0, 0, 0, 0.05); }
+
+.toast-body {
+  padding: 0.75rem; }
+
+.modal-open {
+  overflow: hidden; }
+  .modal-open .modal {
+    overflow-x: hidden;
+    overflow-y: auto; }
+
+.modal {
+  position: fixed;
+  top: 0;
+  left: 0;
+  z-index: 1050;
+  display: none;
+  width: 100%;
+  height: 100%;
+  overflow: hidden;
+  outline: 0; }
+
+.modal-dialog {
+  position: relative;
+  width: auto;
+  margin: 0.5rem;
+  pointer-events: none; }
+  .modal.fade .modal-dialog {
+    transition: transform 0.3s ease-out;
+    transform: translate(0, -50px); }
+    @media (prefers-reduced-motion: reduce) {
+      .modal.fade .modal-dialog {
+        transition: none; } }
+  .modal.show .modal-dialog {
+    transform: none; }
+
+.modal-dialog-scrollable {
+  display: flex;
+  max-height: calc(100% - 1rem); }
+  .modal-dialog-scrollable .modal-content {
+    max-height: calc(100vh - 1rem);
+    overflow: hidden; }
+  .modal-dialog-scrollable .modal-header,
+  .modal-dialog-scrollable .modal-footer {
+    flex-shrink: 0; }
+  .modal-dialog-scrollable .modal-body {
+    overflow-y: auto; }
+
+.modal-dialog-centered {
+  display: flex;
+  align-items: center;
+  min-height: calc(100% - 1rem); }
+  .modal-dialog-centered::before {
+    display: block;
+    height: calc(100vh - 1rem);
+    content: ""; }
+  .modal-dialog-centered.modal-dialog-scrollable {
+    flex-direction: column;
+    justify-content: center;
+    height: 100%; }
+    .modal-dialog-centered.modal-dialog-scrollable .modal-content {
+      max-height: none; }
+    .modal-dialog-centered.modal-dialog-scrollable::before {
+      content: none; }
+
+.modal-content {
+  position: relative;
+  display: flex;
+  flex-direction: column;
+  width: 100%;
+  pointer-events: auto;
+  background-color: #fff;
+  background-clip: padding-box;
+  border: 1px solid rgba(0, 0, 0, 0.2);
+  border-radius: 0.3rem;
+  outline: 0; }
+
+.modal-backdrop {
+  position: fixed;
+  top: 0;
+  left: 0;
+  z-index: 1040;
+  width: 100vw;
+  height: 100vh;
+  background-color: #000; }
+  .modal-backdrop.fade {
+    opacity: 0; }
+  .modal-backdrop.show {
+    opacity: 0.5; }
+
+.modal-header {
+  display: flex;
+  align-items: flex-start;
+  justify-content: space-between;
+  padding: 1rem 1rem;
+  border-bottom: 1px solid #dee2e6;
+  border-top-left-radius: 0.3rem;
+  border-top-right-radius: 0.3rem; }
+  .modal-header .close {
+    padding: 1rem 1rem;
+    margin: -1rem -1rem -1rem auto; }
+
+.modal-title {
+  margin-bottom: 0;
+  line-height: 1.5; }
+
+.modal-body {
+  position: relative;
+  flex: 1 1 auto;
+  padding: 1rem; }
+
+.modal-footer {
+  display: flex;
+  align-items: center;
+  justify-content: flex-end;
+  padding: 1rem;
+  border-top: 1px solid #dee2e6;
+  border-bottom-right-radius: 0.3rem;
+  border-bottom-left-radius: 0.3rem; }
+  .modal-footer > :not(:first-child) {
+    margin-left: .25rem; }
+  .modal-footer > :not(:last-child) {
+    margin-right: .25rem; }
+
+.modal-scrollbar-measure {
+  position: absolute;
+  top: -9999px;
+  width: 50px;
+  height: 50px;
+  overflow: scroll; }
+
+@media (min-width: 576px) {
+  .modal-dialog {
+    max-width: 500px;
+    margin: 1.75rem auto; }
+  .modal-dialog-scrollable {
+    max-height: calc(100% - 3.5rem); }
+    .modal-dialog-scrollable .modal-content {
+      max-height: calc(100vh - 3.5rem); }
+  .modal-dialog-centered {
+    min-height: calc(100% - 3.5rem); }
+    .modal-dialog-centered::before {
+      height: calc(100vh - 3.5rem); }
+  .modal-sm {
+    max-width: 300px; } }
+
+@media (min-width: 992px) {
+  .modal-lg,
+  .modal-xl {
+    max-width: 800px; } }
+
+@media (min-width: 1200px) {
+  .modal-xl {
+    max-width: 1140px; } }
+
+.tooltip {
+  position: absolute;
+  z-index: 1070;
+  display: block;
+  margin: 0;
+  font-family: "Open Sans";
+  font-style: normal;
+  font-weight: 400;
+  line-height: 1.5;
+  text-align: left;
+  text-align: start;
+  text-decoration: none;
+  text-shadow: none;
+  text-transform: none;
+  letter-spacing: normal;
+  word-break: normal;
+  word-spacing: normal;
+  white-space: normal;
+  line-break: auto;
+  font-size: 0.76562rem;
+  word-wrap: break-word;
+  opacity: 0; }
+  .tooltip.show {
+    opacity: 0.9; }
+  .tooltip .arrow {
+    position: absolute;
+    display: block;
+    width: 0.8rem;
+    height: 0.4rem; }
+    .tooltip .arrow::before {
+      position: absolute;
+      content: "";
+      border-color: transparent;
+      border-style: solid; }
+
+.bs-tooltip-top, .bs-tooltip-auto[x-placement^="top"] {
+  padding: 0.4rem 0; }
+  .bs-tooltip-top .arrow, .bs-tooltip-auto[x-placement^="top"] .arrow {
+    bottom: 0; }
+    .bs-tooltip-top .arrow::before, .bs-tooltip-auto[x-placement^="top"] .arrow::before {
+      top: 0;
+      border-width: 0.4rem 0.4rem 0;
+      border-top-color: #000; }
+
+.bs-tooltip-right, .bs-tooltip-auto[x-placement^="right"] {
+  padding: 0 0.4rem; }
+  .bs-tooltip-right .arrow, .bs-tooltip-auto[x-placement^="right"] .arrow {
+    left: 0;
+    width: 0.4rem;
+    height: 0.8rem; }
+    .bs-tooltip-right .arrow::before, .bs-tooltip-auto[x-placement^="right"] .arrow::before {
+      right: 0;
+      border-width: 0.4rem 0.4rem 0.4rem 0;
+      border-right-color: #000; }
+
+.bs-tooltip-bottom, .bs-tooltip-auto[x-placement^="bottom"] {
+  padding: 0.4rem 0; }
+  .bs-tooltip-bottom .arrow, .bs-tooltip-auto[x-placement^="bottom"] .arrow {
+    top: 0; }
+    .bs-tooltip-bottom .arrow::before, .bs-tooltip-auto[x-placement^="bottom"] .arrow::before {
+      bottom: 0;
+      border-width: 0 0.4rem 0.4rem;
+      border-bottom-color: #000; }
+
+.bs-tooltip-left, .bs-tooltip-auto[x-placement^="left"] {
+  padding: 0 0.4rem; }
+  .bs-tooltip-left .arrow, .bs-tooltip-auto[x-placement^="left"] .arrow {
+    right: 0;
+    width: 0.4rem;
+    height: 0.8rem; }
+    .bs-tooltip-left .arrow::before, .bs-tooltip-auto[x-placement^="left"] .arrow::before {
+      left: 0;
+      border-width: 0.4rem 0 0.4rem 0.4rem;
+      border-left-color: #000; }
+
+.tooltip-inner {
+  max-width: 200px;
+  padding: 0.25rem 0.5rem;
+  color: #fff;
+  text-align: center;
+  background-color: #000;
+  border-radius: 0.25rem; }
+
+.popover {
+  position: absolute;
+  top: 0;
+  left: 0;
+  z-index: 1060;
+  display: block;
+  max-width: 276px;
+  font-family: "Open Sans";
+  font-style: normal;
+  font-weight: 400;
+  line-height: 1.5;
+  text-align: left;
+  text-align: start;
+  text-decoration: none;
+  text-shadow: none;
+  text-transform: none;
+  letter-spacing: normal;
+  word-break: normal;
+  word-spacing: normal;
+  white-space: normal;
+  line-break: auto;
+  font-size: 0.76562rem;
+  word-wrap: break-word;
+  background-color: #fff;
+  background-clip: padding-box;
+  border: 1px solid rgba(0, 0, 0, 0.2);
+  border-radius: 0.3rem; }
+  .popover .arrow {
+    position: absolute;
+    display: block;
+    width: 1rem;
+    height: 0.5rem;
+    margin: 0 0.3rem; }
+    .popover .arrow::before, .popover .arrow::after {
+      position: absolute;
+      display: block;
+      content: "";
+      border-color: transparent;
+      border-style: solid; }
+
+.bs-popover-top, .bs-popover-auto[x-placement^="top"] {
+  margin-bottom: 0.5rem; }
+  .bs-popover-top > .arrow, .bs-popover-auto[x-placement^="top"] > .arrow {
+    bottom: calc((0.5rem + 1px) * -1); }
+    .bs-popover-top > .arrow::before, .bs-popover-auto[x-placement^="top"] > .arrow::before {
+      bottom: 0;
+      border-width: 0.5rem 0.5rem 0;
+      border-top-color: rgba(0, 0, 0, 0.25); }
+    .bs-popover-top > .arrow::after, .bs-popover-auto[x-placement^="top"] > .arrow::after {
+      bottom: 1px;
+      border-width: 0.5rem 0.5rem 0;
+      border-top-color: #fff; }
+
+.bs-popover-right, .bs-popover-auto[x-placement^="right"] {
+  margin-left: 0.5rem; }
+  .bs-popover-right > .arrow, .bs-popover-auto[x-placement^="right"] > .arrow {
+    left: calc((0.5rem + 1px) * -1);
+    width: 0.5rem;
+    height: 1rem;
+    margin: 0.3rem 0; }
+    .bs-popover-right > .arrow::before, .bs-popover-auto[x-placement^="right"] > .arrow::before {
+      left: 0;
+      border-width: 0.5rem 0.5rem 0.5rem 0;
+      border-right-color: rgba(0, 0, 0, 0.25); }
+    .bs-popover-right > .arrow::after, .bs-popover-auto[x-placement^="right"] > .arrow::after {
+      left: 1px;
+      border-width: 0.5rem 0.5rem 0.5rem 0;
+      border-right-color: #fff; }
+
+.bs-popover-bottom, .bs-popover-auto[x-placement^="bottom"] {
+  margin-top: 0.5rem; }
+  .bs-popover-bottom > .arrow, .bs-popover-auto[x-placement^="bottom"] > .arrow {
+    top: calc((0.5rem + 1px) * -1); }
+    .bs-popover-bottom > .arrow::before, .bs-popover-auto[x-placement^="bottom"] > .arrow::before {
+      top: 0;
+      border-width: 0 0.5rem 0.5rem 0.5rem;
+      border-bottom-color: rgba(0, 0, 0, 0.25); }
+    .bs-popover-bottom > .arrow::after, .bs-popover-auto[x-placement^="bottom"] > .arrow::after {
+      top: 1px;
+      border-width: 0 0.5rem 0.5rem 0.5rem;
+      border-bottom-color: #fff; }
+  .bs-popover-bottom .popover-header::before, .bs-popover-auto[x-placement^="bottom"] .popover-header::before {
+    position: absolute;
+    top: 0;
+    left: 50%;
+    display: block;
+    width: 1rem;
+    margin-left: -0.5rem;
+    content: "";
+    border-bottom: 1px solid #f7f7f7; }
+
+.bs-popover-left, .bs-popover-auto[x-placement^="left"] {
+  margin-right: 0.5rem; }
+  .bs-popover-left > .arrow, .bs-popover-auto[x-placement^="left"] > .arrow {
+    right: calc((0.5rem + 1px) * -1);
+    width: 0.5rem;
+    height: 1rem;
+    margin: 0.3rem 0; }
+    .bs-popover-left > .arrow::before, .bs-popover-auto[x-placement^="left"] > .arrow::before {
+      right: 0;
+      border-width: 0.5rem 0 0.5rem 0.5rem;
+      border-left-color: rgba(0, 0, 0, 0.25); }
+    .bs-popover-left > .arrow::after, .bs-popover-auto[x-placement^="left"] > .arrow::after {
+      right: 1px;
+      border-width: 0.5rem 0 0.5rem 0.5rem;
+      border-left-color: #fff; }
+
+.popover-header {
+  padding: 0.5rem 0.75rem;
+  margin-bottom: 0;
+  font-size: 0.875rem;
+  background-color: #f7f7f7;
+  border-bottom: 1px solid #ebebeb;
+  border-top-left-radius: calc(0.3rem - 1px);
+  border-top-right-radius: calc(0.3rem - 1px); }
+  .popover-header:empty {
+    display: none; }
+
+.popover-body {
+  padding: 0.5rem 0.75rem;
+  color: #373a3c; }
+
+.carousel {
+  position: relative; }
+
+.carousel.pointer-event {
+  touch-action: pan-y; }
+
+.carousel-inner {
+  position: relative;
+  width: 100%;
+  overflow: hidden; }
+  .carousel-inner::after {
+    display: block;
+    clear: both;
+    content: ""; }
+
+.carousel-item {
+  position: relative;
+  display: none;
+  float: left;
+  width: 100%;
+  margin-right: -100%;
+  backface-visibility: hidden;
+  transition: transform 0.6s ease-in-out; }
+  @media (prefers-reduced-motion: reduce) {
+    .carousel-item {
+      transition: none; } }
+
+.carousel-item.active,
+.carousel-item-next,
+.carousel-item-prev {
+  display: block; }
+
+.carousel-item-next:not(.carousel-item-left),
+.active.carousel-item-right {
+  transform: translateX(100%); }
+
+.carousel-item-prev:not(.carousel-item-right),
+.active.carousel-item-left {
+  transform: translateX(-100%); }
+
+.carousel-fade .carousel-item {
+  opacity: 0;
+  transition-property: opacity;
+  transform: none; }
+
+.carousel-fade .carousel-item.active,
+.carousel-fade .carousel-item-next.carousel-item-left,
+.carousel-fade .carousel-item-prev.carousel-item-right {
+  z-index: 1;
+  opacity: 1; }
+
+.carousel-fade .active.carousel-item-left,
+.carousel-fade .active.carousel-item-right {
+  z-index: 0;
+  opacity: 0;
+  transition: 0s 0.6s opacity; }
+  @media (prefers-reduced-motion: reduce) {
+    .carousel-fade .active.carousel-item-left,
+    .carousel-fade .active.carousel-item-right {
+      transition: none; } }
+
+.carousel-control-prev,
+.carousel-control-next {
+  position: absolute;
+  top: 0;
+  bottom: 0;
+  z-index: 1;
+  display: flex;
+  align-items: center;
+  justify-content: center;
+  width: 15%;
+  color: #fff;
+  text-align: center;
+  opacity: 0.5;
+  transition: opacity 0.15s ease; }
+  @media (prefers-reduced-motion: reduce) {
+    .carousel-control-prev,
+    .carousel-control-next {
+      transition: none; } }
+  .carousel-control-prev:hover, .carousel-control-prev:focus,
+  .carousel-control-next:hover,
+  .carousel-control-next:focus {
+    color: #fff;
+    text-decoration: none;
+    outline: 0;
+    opacity: 0.9; }
+
+.carousel-control-prev {
+  left: 0; }
+
+.carousel-control-next {
+  right: 0; }
+
+.carousel-control-prev-icon,
+.carousel-control-next-icon {
+  display: inline-block;
+  width: 20px;
+  height: 20px;
+  background: no-repeat 50% / 100% 100%; }
+
+.carousel-control-prev-icon {
+  background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' fill='%23fff' viewBox='0 0 8 8'%3e%3cpath d='M5.25 0l-4 4 4 4 1.5-1.5-2.5-2.5 2.5-2.5-1.5-1.5z'/%3e%3c/svg%3e"); }
+
+.carousel-control-next-icon {
+  background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' fill='%23fff' viewBox='0 0 8 8'%3e%3cpath d='M2.75 0l-1.5 1.5 2.5 2.5-2.5 2.5 1.5 1.5 4-4-4-4z'/%3e%3c/svg%3e"); }
+
+.carousel-indicators {
+  position: absolute;
+  right: 0;
+  bottom: 0;
+  left: 0;
+  z-index: 15;
+  display: flex;
+  justify-content: center;
+  padding-left: 0;
+  margin-right: 15%;
+  margin-left: 15%;
+  list-style: none; }
+  .carousel-indicators li {
+    box-sizing: content-box;
+    flex: 0 1 auto;
+    width: 30px;
+    height: 3px;
+    margin-right: 3px;
+    margin-left: 3px;
+    text-indent: -999px;
+    cursor: pointer;
+    background-color: #fff;
+    background-clip: padding-box;
+    border-top: 10px solid transparent;
+    border-bottom: 10px solid transparent;
+    opacity: .5;
+    transition: opacity 0.6s ease; }
+    @media (prefers-reduced-motion: reduce) {
+      .carousel-indicators li {
+        transition: none; } }
+  .carousel-indicators .active {
+    opacity: 1; }
+
+.carousel-caption {
+  position: absolute;
+  right: 15%;
+  bottom: 20px;
+  left: 15%;
+  z-index: 10;
+  padding-top: 20px;
+  padding-bottom: 20px;
+  color: #fff;
+  text-align: center; }
+
+@keyframes spinner-border {
+  to {
+    transform: rotate(360deg); } }
+
+.spinner-border {
+  display: inline-block;
+  width: 2rem;
+  height: 2rem;
+  vertical-align: text-bottom;
+  border: 0.25em solid currentColor;
+  border-right-color: transparent;
+  border-radius: 50%;
+  animation: spinner-border .75s linear infinite; }
+
+.spinner-border-sm {
+  width: 1rem;
+  height: 1rem;
+  border-width: 0.2em; }
+
+@keyframes spinner-grow {
+  0% {
+    transform: scale(0); }
+  50% {
+    opacity: 1; } }
+
+.spinner-grow {
+  display: inline-block;
+  width: 2rem;
+  height: 2rem;
+  vertical-align: text-bottom;
+  background-color: currentColor;
+  border-radius: 50%;
+  opacity: 0;
+  animation: spinner-grow .75s linear infinite; }
+
+.spinner-grow-sm {
+  width: 1rem;
+  height: 1rem; }
+
+.align-baseline {
+  vertical-align: baseline !important; }
+
+.align-top {
+  vertical-align: top !important; }
+
+.align-middle {
+  vertical-align: middle !important; }
+
+.align-bottom {
+  vertical-align: bottom !important; }
+
+.align-text-bottom {
+  vertical-align: text-bottom !important; }
+
+.align-text-top {
+  vertical-align: text-top !important; }
+
+.bg-primary {
+  background-color: #3c6eb4 !important; }
+
+a.bg-primary:hover, a.bg-primary:focus,
+button.bg-primary:hover,
+button.bg-primary:focus {
+  background-color: #2f578e !important; }
+
+.bg-secondary {
+  background-color: #6c757d !important; }
+
+a.bg-secondary:hover, a.bg-secondary:focus,
+button.bg-secondary:hover,
+button.bg-secondary:focus {
+  background-color: #545b62 !important; }
+
+.bg-success {
+  background-color: #28a745 !important; }
+
+a.bg-success:hover, a.bg-success:focus,
+button.bg-success:hover,
+button.bg-success:focus {
+  background-color: #1e7e34 !important; }
+
+.bg-info {
+  background-color: #17a2b8 !important; }
+
+a.bg-info:hover, a.bg-info:focus,
+button.bg-info:hover,
+button.bg-info:focus {
+  background-color: #117a8b !important; }
+
+.bg-warning {
+  background-color: #ffc107 !important; }
+
+a.bg-warning:hover, a.bg-warning:focus,
+button.bg-warning:hover,
+button.bg-warning:focus {
+  background-color: #d39e00 !important; }
+
+.bg-danger {
+  background-color: #dc3545 !important; }
+
+a.bg-danger:hover, a.bg-danger:focus,
+button.bg-danger:hover,
+button.bg-danger:focus {
+  background-color: #bd2130 !important; }
+
+.bg-light {
+  background-color: #f8f9fa !important; }
+
+a.bg-light:hover, a.bg-light:focus,
+button.bg-light:hover,
+button.bg-light:focus {
+  background-color: #dae0e5 !important; }
+
+.bg-dark {
+  background-color: #343a40 !important; }
+
+a.bg-dark:hover, a.bg-dark:focus,
+button.bg-dark:hover,
+button.bg-dark:focus {
+  background-color: #1d2124 !important; }
+
+.bg-white {
+  background-color: #fff !important; }
+
+.bg-transparent {
+  background-color: transparent !important; }
+
+.border {
+  border: 1px solid #dee2e6 !important; }
+
+.border-top {
+  border-top: 1px solid #dee2e6 !important; }
+
+.border-right {
+  border-right: 1px solid #dee2e6 !important; }
+
+.border-bottom {
+  border-bottom: 1px solid #dee2e6 !important; }
+
+.border-left {
+  border-left: 1px solid #dee2e6 !important; }
+
+.border-0 {
+  border: 0 !important; }
+
+.border-top-0 {
+  border-top: 0 !important; }
+
+.border-right-0 {
+  border-right: 0 !important; }
+
+.border-bottom-0 {
+  border-bottom: 0 !important; }
+
+.border-left-0 {
+  border-left: 0 !important; }
+
+.border-primary {
+  border-color: #3c6eb4 !important; }
+
+.border-secondary {
+  border-color: #6c757d !important; }
+
+.border-success {
+  border-color: #28a745 !important; }
+
+.border-info {
+  border-color: #17a2b8 !important; }
+
+.border-warning {
+  border-color: #ffc107 !important; }
+
+.border-danger {
+  border-color: #dc3545 !important; }
+
+.border-light {
+  border-color: #f8f9fa !important; }
+
+.border-dark {
+  border-color: #343a40 !important; }
+
+.border-white {
+  border-color: #fff !important; }
+
+.rounded-sm {
+  border-radius: 0.2rem !important; }
+
+.rounded {
+  border-radius: 0.25rem !important; }
+
+.rounded-top {
+  border-top-left-radius: 0.25rem !important;
+  border-top-right-radius: 0.25rem !important; }
+
+.rounded-right {
+  border-top-right-radius: 0.25rem !important;
+  border-bottom-right-radius: 0.25rem !important; }
+
+.rounded-bottom {
+  border-bottom-right-radius: 0.25rem !important;
+  border-bottom-left-radius: 0.25rem !important; }
+
+.rounded-left {
+  border-top-left-radius: 0.25rem !important;
+  border-bottom-left-radius: 0.25rem !important; }
+
+.rounded-lg {
+  border-radius: 0.3rem !important; }
+
+.rounded-circle {
+  border-radius: 50% !important; }
+
+.rounded-pill {
+  border-radius: 50rem !important; }
+
+.rounded-0 {
+  border-radius: 0 !important; }
+
+.clearfix::after {
+  display: block;
+  clear: both;
+  content: ""; }
+
+.d-none {
+  display: none !important; }
+
+.d-inline {
+  display: inline !important; }
+
+.d-inline-block {
+  display: inline-block !important; }
+
+.d-block {
+  display: block !important; }
+
+.d-table {
+  display: table !important; }
+
+.d-table-row {
+  display: table-row !important; }
+
+.d-table-cell {
+  display: table-cell !important; }
+
+.d-flex {
+  display: flex !important; }
+
+.d-inline-flex {
+  display: inline-flex !important; }
+
+@media (min-width: 576px) {
+  .d-sm-none {
+    display: none !important; }
+  .d-sm-inline {
+    display: inline !important; }
+  .d-sm-inline-block {
+    display: inline-block !important; }
+  .d-sm-block {
+    display: block !important; }
+  .d-sm-table {
+    display: table !important; }
+  .d-sm-table-row {
+    display: table-row !important; }
+  .d-sm-table-cell {
+    display: table-cell !important; }
+  .d-sm-flex {
+    display: flex !important; }
+  .d-sm-inline-flex {
+    display: inline-flex !important; } }
+
+@media (min-width: 768px) {
+  .d-md-none {
+    display: none !important; }
+  .d-md-inline {
+    display: inline !important; }
+  .d-md-inline-block {
+    display: inline-block !important; }
+  .d-md-block {
+    display: block !important; }
+  .d-md-table {
+    display: table !important; }
+  .d-md-table-row {
+    display: table-row !important; }
+  .d-md-table-cell {
+    display: table-cell !important; }
+  .d-md-flex {
+    display: flex !important; }
+  .d-md-inline-flex {
+    display: inline-flex !important; } }
+
+@media (min-width: 992px) {
+  .d-lg-none {
+    display: none !important; }
+  .d-lg-inline {
+    display: inline !important; }
+  .d-lg-inline-block {
+    display: inline-block !important; }
+  .d-lg-block {
+    display: block !important; }
+  .d-lg-table {
+    display: table !important; }
+  .d-lg-table-row {
+    display: table-row !important; }
+  .d-lg-table-cell {
+    display: table-cell !important; }
+  .d-lg-flex {
+    display: flex !important; }
+  .d-lg-inline-flex {
+    display: inline-flex !important; } }
+
+@media (min-width: 1200px) {
+  .d-xl-none {
+    display: none !important; }
+  .d-xl-inline {
+    display: inline !important; }
+  .d-xl-inline-block {
+    display: inline-block !important; }
+  .d-xl-block {
+    display: block !important; }
+  .d-xl-table {
+    display: table !important; }
+  .d-xl-table-row {
+    display: table-row !important; }
+  .d-xl-table-cell {
+    display: table-cell !important; }
+  .d-xl-flex {
+    display: flex !important; }
+  .d-xl-inline-flex {
+    display: inline-flex !important; } }
+
+@media print {
+  .d-print-none {
+    display: none !important; }
+  .d-print-inline {
+    display: inline !important; }
+  .d-print-inline-block {
+    display: inline-block !important; }
+  .d-print-block {
+    display: block !important; }
+  .d-print-table {
+    display: table !important; }
+  .d-print-table-row {
+    display: table-row !important; }
+  .d-print-table-cell {
+    display: table-cell !important; }
+  .d-print-flex {
+    display: flex !important; }
+  .d-print-inline-flex {
+    display: inline-flex !important; } }
+
+.embed-responsive {
+  position: relative;
+  display: block;
+  width: 100%;
+  padding: 0;
+  overflow: hidden; }
+  .embed-responsive::before {
+    display: block;
+    content: ""; }
+  .embed-responsive .embed-responsive-item,
+  .embed-responsive iframe,
+  .embed-responsive embed,
+  .embed-responsive object,
+  .embed-responsive video {
+    position: absolute;
+    top: 0;
+    bottom: 0;
+    left: 0;
+    width: 100%;
+    height: 100%;
+    border: 0; }
+
+.embed-responsive-21by9::before {
+  padding-top: 42.85714%; }
+
+.embed-responsive-16by9::before {
+  padding-top: 56.25%; }
+
+.embed-responsive-4by3::before {
+  padding-top: 75%; }
+
+.embed-responsive-1by1::before {
+  padding-top: 100%; }
+
+.flex-row {
+  flex-direction: row !important; }
+
+.flex-column {
+  flex-direction: column !important; }
+
+.flex-row-reverse {
+  flex-direction: row-reverse !important; }
+
+.flex-column-reverse {
+  flex-direction: column-reverse !important; }
+
+.flex-wrap {
+  flex-wrap: wrap !important; }
+
+.flex-nowrap {
+  flex-wrap: nowrap !important; }
+
+.flex-wrap-reverse {
+  flex-wrap: wrap-reverse !important; }
+
+.flex-fill {
+  flex: 1 1 auto !important; }
+
+.flex-grow-0 {
+  flex-grow: 0 !important; }
+
+.flex-grow-1 {
+  flex-grow: 1 !important; }
+
+.flex-shrink-0 {
+  flex-shrink: 0 !important; }
+
+.flex-shrink-1 {
+  flex-shrink: 1 !important; }
+
+.justify-content-start {
+  justify-content: flex-start !important; }
+
+.justify-content-end {
+  justify-content: flex-end !important; }
+
+.justify-content-center {
+  justify-content: center !important; }
+
+.justify-content-between {
+  justify-content: space-between !important; }
+
+.justify-content-around {
+  justify-content: space-around !important; }
+
+.align-items-start {
+  align-items: flex-start !important; }
+
+.align-items-end {
+  align-items: flex-end !important; }
+
+.align-items-center {
+  align-items: center !important; }
+
+.align-items-baseline {
+  align-items: baseline !important; }
+
+.align-items-stretch {
+  align-items: stretch !important; }
+
+.align-content-start {
+  align-content: flex-start !important; }
+
+.align-content-end {
+  align-content: flex-end !important; }
+
+.align-content-center {
+  align-content: center !important; }
+
+.align-content-between {
+  align-content: space-between !important; }
+
+.align-content-around {
+  align-content: space-around !important; }
+
+.align-content-stretch {
+  align-content: stretch !important; }
+
+.align-self-auto {
+  align-self: auto !important; }
+
+.align-self-start {
+  align-self: flex-start !important; }
+
+.align-self-end {
+  align-self: flex-end !important; }
+
+.align-self-center {
+  align-self: center !important; }
+
+.align-self-baseline {
+  align-self: baseline !important; }
+
+.align-self-stretch {
+  align-self: stretch !important; }
+
+@media (min-width: 576px) {
+  .flex-sm-row {
+    flex-direction: row !important; }
+  .flex-sm-column {
+    flex-direction: column !important; }
+  .flex-sm-row-reverse {
+    flex-direction: row-reverse !important; }
+  .flex-sm-column-reverse {
+    flex-direction: column-reverse !important; }
+  .flex-sm-wrap {
+    flex-wrap: wrap !important; }
+  .flex-sm-nowrap {
+    flex-wrap: nowrap !important; }
+  .flex-sm-wrap-reverse {
+    flex-wrap: wrap-reverse !important; }
+  .flex-sm-fill {
+    flex: 1 1 auto !important; }
+  .flex-sm-grow-0 {
+    flex-grow: 0 !important; }
+  .flex-sm-grow-1 {
+    flex-grow: 1 !important; }
+  .flex-sm-shrink-0 {
+    flex-shrink: 0 !important; }
+  .flex-sm-shrink-1 {
+    flex-shrink: 1 !important; }
+  .justify-content-sm-start {
+    justify-content: flex-start !important; }
+  .justify-content-sm-end {
+    justify-content: flex-end !important; }
+  .justify-content-sm-center {
+    justify-content: center !important; }
+  .justify-content-sm-between {
+    justify-content: space-between !important; }
+  .justify-content-sm-around {
+    justify-content: space-around !important; }
+  .align-items-sm-start {
+    align-items: flex-start !important; }
+  .align-items-sm-end {
+    align-items: flex-end !important; }
+  .align-items-sm-center {
+    align-items: center !important; }
+  .align-items-sm-baseline {
+    align-items: baseline !important; }
+  .align-items-sm-stretch {
+    align-items: stretch !important; }
+  .align-content-sm-start {
+    align-content: flex-start !important; }
+  .align-content-sm-end {
+    align-content: flex-end !important; }
+  .align-content-sm-center {
+    align-content: center !important; }
+  .align-content-sm-between {
+    align-content: space-between !important; }
+  .align-content-sm-around {
+    align-content: space-around !important; }
+  .align-content-sm-stretch {
+    align-content: stretch !important; }
+  .align-self-sm-auto {
+    align-self: auto !important; }
+  .align-self-sm-start {
+    align-self: flex-start !important; }
+  .align-self-sm-end {
+    align-self: flex-end !important; }
+  .align-self-sm-center {
+    align-self: center !important; }
+  .align-self-sm-baseline {
+    align-self: baseline !important; }
+  .align-self-sm-stretch {
+    align-self: stretch !important; } }
+
+@media (min-width: 768px) {
+  .flex-md-row {
+    flex-direction: row !important; }
+  .flex-md-column {
+    flex-direction: column !important; }
+  .flex-md-row-reverse {
+    flex-direction: row-reverse !important; }
+  .flex-md-column-reverse {
+    flex-direction: column-reverse !important; }
+  .flex-md-wrap {
+    flex-wrap: wrap !important; }
+  .flex-md-nowrap {
+    flex-wrap: nowrap !important; }
+  .flex-md-wrap-reverse {
+    flex-wrap: wrap-reverse !important; }
+  .flex-md-fill {
+    flex: 1 1 auto !important; }
+  .flex-md-grow-0 {
+    flex-grow: 0 !important; }
+  .flex-md-grow-1 {
+    flex-grow: 1 !important; }
+  .flex-md-shrink-0 {
+    flex-shrink: 0 !important; }
+  .flex-md-shrink-1 {
+    flex-shrink: 1 !important; }
+  .justify-content-md-start {
+    justify-content: flex-start !important; }
+  .justify-content-md-end {
+    justify-content: flex-end !important; }
+  .justify-content-md-center {
+    justify-content: center !important; }
+  .justify-content-md-between {
+    justify-content: space-between !important; }
+  .justify-content-md-around {
+    justify-content: space-around !important; }
+  .align-items-md-start {
+    align-items: flex-start !important; }
+  .align-items-md-end {
+    align-items: flex-end !important; }
+  .align-items-md-center {
+    align-items: center !important; }
+  .align-items-md-baseline {
+    align-items: baseline !important; }
+  .align-items-md-stretch {
+    align-items: stretch !important; }
+  .align-content-md-start {
+    align-content: flex-start !important; }
+  .align-content-md-end {
+    align-content: flex-end !important; }
+  .align-content-md-center {
+    align-content: center !important; }
+  .align-content-md-between {
+    align-content: space-between !important; }
+  .align-content-md-around {
+    align-content: space-around !important; }
+  .align-content-md-stretch {
+    align-content: stretch !important; }
+  .align-self-md-auto {
+    align-self: auto !important; }
+  .align-self-md-start {
+    align-self: flex-start !important; }
+  .align-self-md-end {
+    align-self: flex-end !important; }
+  .align-self-md-center {
+    align-self: center !important; }
+  .align-self-md-baseline {
+    align-self: baseline !important; }
+  .align-self-md-stretch {
+    align-self: stretch !important; } }
+
+@media (min-width: 992px) {
+  .flex-lg-row {
+    flex-direction: row !important; }
+  .flex-lg-column {
+    flex-direction: column !important; }
+  .flex-lg-row-reverse {
+    flex-direction: row-reverse !important; }
+  .flex-lg-column-reverse {
+    flex-direction: column-reverse !important; }
+  .flex-lg-wrap {
+    flex-wrap: wrap !important; }
+  .flex-lg-nowrap {
+    flex-wrap: nowrap !important; }
+  .flex-lg-wrap-reverse {
+    flex-wrap: wrap-reverse !important; }
+  .flex-lg-fill {
+    flex: 1 1 auto !important; }
+  .flex-lg-grow-0 {
+    flex-grow: 0 !important; }
+  .flex-lg-grow-1 {
+    flex-grow: 1 !important; }
+  .flex-lg-shrink-0 {
+    flex-shrink: 0 !important; }
+  .flex-lg-shrink-1 {
+    flex-shrink: 1 !important; }
+  .justify-content-lg-start {
+    justify-content: flex-start !important; }
+  .justify-content-lg-end {
+    justify-content: flex-end !important; }
+  .justify-content-lg-center {
+    justify-content: center !important; }
+  .justify-content-lg-between {
+    justify-content: space-between !important; }
+  .justify-content-lg-around {
+    justify-content: space-around !important; }
+  .align-items-lg-start {
+    align-items: flex-start !important; }
+  .align-items-lg-end {
+    align-items: flex-end !important; }
+  .align-items-lg-center {
+    align-items: center !important; }
+  .align-items-lg-baseline {
+    align-items: baseline !important; }
+  .align-items-lg-stretch {
+    align-items: stretch !important; }
+  .align-content-lg-start {
+    align-content: flex-start !important; }
+  .align-content-lg-end {
+    align-content: flex-end !important; }
+  .align-content-lg-center {
+    align-content: center !important; }
+  .align-content-lg-between {
+    align-content: space-between !important; }
+  .align-content-lg-around {
+    align-content: space-around !important; }
+  .align-content-lg-stretch {
+    align-content: stretch !important; }
+  .align-self-lg-auto {
+    align-self: auto !important; }
+  .align-self-lg-start {
+    align-self: flex-start !important; }
+  .align-self-lg-end {
+    align-self: flex-end !important; }
+  .align-self-lg-center {
+    align-self: center !important; }
+  .align-self-lg-baseline {
+    align-self: baseline !important; }
+  .align-self-lg-stretch {
+    align-self: stretch !important; } }
+
+@media (min-width: 1200px) {
+  .flex-xl-row {
+    flex-direction: row !important; }
+  .flex-xl-column {
+    flex-direction: column !important; }
+  .flex-xl-row-reverse {
+    flex-direction: row-reverse !important; }
+  .flex-xl-column-reverse {
+    flex-direction: column-reverse !important; }
+  .flex-xl-wrap {
+    flex-wrap: wrap !important; }
+  .flex-xl-nowrap {
+    flex-wrap: nowrap !important; }
+  .flex-xl-wrap-reverse {
+    flex-wrap: wrap-reverse !important; }
+  .flex-xl-fill {
+    flex: 1 1 auto !important; }
+  .flex-xl-grow-0 {
+    flex-grow: 0 !important; }
+  .flex-xl-grow-1 {
+    flex-grow: 1 !important; }
+  .flex-xl-shrink-0 {
+    flex-shrink: 0 !important; }
+  .flex-xl-shrink-1 {
+    flex-shrink: 1 !important; }
+  .justify-content-xl-start {
+    justify-content: flex-start !important; }
+  .justify-content-xl-end {
+    justify-content: flex-end !important; }
+  .justify-content-xl-center {
+    justify-content: center !important; }
+  .justify-content-xl-between {
+    justify-content: space-between !important; }
+  .justify-content-xl-around {
+    justify-content: space-around !important; }
+  .align-items-xl-start {
+    align-items: flex-start !important; }
+  .align-items-xl-end {
+    align-items: flex-end !important; }
+  .align-items-xl-center {
+    align-items: center !important; }
+  .align-items-xl-baseline {
+    align-items: baseline !important; }
+  .align-items-xl-stretch {
+    align-items: stretch !important; }
+  .align-content-xl-start {
+    align-content: flex-start !important; }
+  .align-content-xl-end {
+    align-content: flex-end !important; }
+  .align-content-xl-center {
+    align-content: center !important; }
+  .align-content-xl-between {
+    align-content: space-between !important; }
+  .align-content-xl-around {
+    align-content: space-around !important; }
+  .align-content-xl-stretch {
+    align-content: stretch !important; }
+  .align-self-xl-auto {
+    align-self: auto !important; }
+  .align-self-xl-start {
+    align-self: flex-start !important; }
+  .align-self-xl-end {
+    align-self: flex-end !important; }
+  .align-self-xl-center {
+    align-self: center !important; }
+  .align-self-xl-baseline {
+    align-self: baseline !important; }
+  .align-self-xl-stretch {
+    align-self: stretch !important; } }
+
+.float-left {
+  float: left !important; }
+
+.float-right {
+  float: right !important; }
+
+.float-none {
+  float: none !important; }
+
+@media (min-width: 576px) {
+  .float-sm-left {
+    float: left !important; }
+  .float-sm-right {
+    float: right !important; }
+  .float-sm-none {
+    float: none !important; } }
+
+@media (min-width: 768px) {
+  .float-md-left {
+    float: left !important; }
+  .float-md-right {
+    float: right !important; }
+  .float-md-none {
+    float: none !important; } }
+
+@media (min-width: 992px) {
+  .float-lg-left {
+    float: left !important; }
+  .float-lg-right {
+    float: right !important; }
+  .float-lg-none {
+    float: none !important; } }
+
+@media (min-width: 1200px) {
+  .float-xl-left {
+    float: left !important; }
+  .float-xl-right {
+    float: right !important; }
+  .float-xl-none {
+    float: none !important; } }
+
+.overflow-auto {
+  overflow: auto !important; }
+
+.overflow-hidden {
+  overflow: hidden !important; }
+
+.position-static {
+  position: static !important; }
+
+.position-relative {
+  position: relative !important; }
+
+.position-absolute {
+  position: absolute !important; }
+
+.position-fixed {
+  position: fixed !important; }
+
+.position-sticky {
+  position: sticky !important; }
+
+.fixed-top {
+  position: fixed;
+  top: 0;
+  right: 0;
+  left: 0;
+  z-index: 1030; }
+
+.fixed-bottom {
+  position: fixed;
+  right: 0;
+  bottom: 0;
+  left: 0;
+  z-index: 1030; }
+
+@supports (position: sticky) {
+  .sticky-top {
+    position: sticky;
+    top: 0;
+    z-index: 1020; } }
+
+.sr-only {
+  position: absolute;
+  width: 1px;
+  height: 1px;
+  padding: 0;
+  overflow: hidden;
+  clip: rect(0, 0, 0, 0);
+  white-space: nowrap;
+  border: 0; }
+
+.sr-only-focusable:active, .sr-only-focusable:focus {
+  position: static;
+  width: auto;
+  height: auto;
+  overflow: visible;
+  clip: auto;
+  white-space: normal; }
+
+.shadow-sm {
+  box-shadow: 0 0.125rem 0.25rem rgba(0, 0, 0, 0.075) !important; }
+
+.shadow {
+  box-shadow: 0 0.5rem 1rem rgba(0, 0, 0, 0.15) !important; }
+
+.shadow-lg {
+  box-shadow: 0 1rem 3rem rgba(0, 0, 0, 0.175) !important; }
+
+.shadow-none {
+  box-shadow: none !important; }
+
+.w-25 {
+  width: 25% !important; }
+
+.w-50 {
+  width: 50% !important; }
+
+.w-75 {
+  width: 75% !important; }
+
+.w-100 {
+  width: 100% !important; }
+
+.w-auto {
+  width: auto !important; }
+
+.h-25 {
+  height: 25% !important; }
+
+.h-50 {
+  height: 50% !important; }
+
+.h-75 {
+  height: 75% !important; }
+
+.h-100 {
+  height: 100% !important; }
+
+.h-auto {
+  height: auto !important; }
+
+.mw-100 {
+  max-width: 100% !important; }
+
+.mh-100 {
+  max-height: 100% !important; }
+
+.min-vw-100 {
+  min-width: 100vw !important; }
+
+.min-vh-100 {
+  min-height: 100vh !important; }
+
+.vw-100 {
+  width: 100vw !important; }
+
+.vh-100 {
+  height: 100vh !important; }
+
+.stretched-link::after {
+  position: absolute;
+  top: 0;
+  right: 0;
+  bottom: 0;
+  left: 0;
+  z-index: 1;
+  pointer-events: auto;
+  content: "";
+  background-color: rgba(0, 0, 0, 0); }
+
+.m-0 {
+  margin: 0 !important; }
+
+.mt-0,
+.my-0 {
+  margin-top: 0 !important; }
+
+.mr-0,
+.mx-0 {
+  margin-right: 0 !important; }
+
+.mb-0,
+.my-0 {
+  margin-bottom: 0 !important; }
+
+.ml-0,
+.mx-0 {
+  margin-left: 0 !important; }
+
+.m-1 {
+  margin: 0.25rem !important; }
+
+.mt-1,
+.my-1 {
+  margin-top: 0.25rem !important; }
+
+.mr-1,
+.mx-1 {
+  margin-right: 0.25rem !important; }
+
+.mb-1,
+.my-1 {
+  margin-bottom: 0.25rem !important; }
+
+.ml-1,
+.mx-1 {
+  margin-left: 0.25rem !important; }
+
+.m-2 {
+  margin: 0.5rem !important; }
+
+.mt-2,
+.my-2 {
+  margin-top: 0.5rem !important; }
+
+.mr-2,
+.mx-2 {
+  margin-right: 0.5rem !important; }
+
+.mb-2,
+.my-2 {
+  margin-bottom: 0.5rem !important; }
+
+.ml-2,
+.mx-2 {
+  margin-left: 0.5rem !important; }
+
+.m-3 {
+  margin: 1rem !important; }
+
+.mt-3,
+.my-3 {
+  margin-top: 1rem !important; }
+
+.mr-3,
+.mx-3 {
+  margin-right: 1rem !important; }
+
+.mb-3,
+.my-3 {
+  margin-bottom: 1rem !important; }
+
+.ml-3,
+.mx-3 {
+  margin-left: 1rem !important; }
+
+.m-4 {
+  margin: 1.5rem !important; }
+
+.mt-4,
+.my-4 {
+  margin-top: 1.5rem !important; }
+
+.mr-4,
+.mx-4 {
+  margin-right: 1.5rem !important; }
+
+.mb-4,
+.my-4 {
+  margin-bottom: 1.5rem !important; }
+
+.ml-4,
+.mx-4 {
+  margin-left: 1.5rem !important; }
+
+.m-5 {
+  margin: 3rem !important; }
+
+.mt-5,
+.my-5 {
+  margin-top: 3rem !important; }
+
+.mr-5,
+.mx-5 {
+  margin-right: 3rem !important; }
+
+.mb-5,
+.my-5 {
+  margin-bottom: 3rem !important; }
+
+.ml-5,
+.mx-5 {
+  margin-left: 3rem !important; }
+
+.p-0 {
+  padding: 0 !important; }
+
+.pt-0,
+.py-0 {
+  padding-top: 0 !important; }
+
+.pr-0,
+.px-0 {
+  padding-right: 0 !important; }
+
+.pb-0,
+.py-0 {
+  padding-bottom: 0 !important; }
+
+.pl-0,
+.px-0 {
+  padding-left: 0 !important; }
+
+.p-1 {
+  padding: 0.25rem !important; }
+
+.pt-1,
+.py-1 {
+  padding-top: 0.25rem !important; }
+
+.pr-1,
+.px-1 {
+  padding-right: 0.25rem !important; }
+
+.pb-1,
+.py-1 {
+  padding-bottom: 0.25rem !important; }
+
+.pl-1,
+.px-1 {
+  padding-left: 0.25rem !important; }
+
+.p-2 {
+  padding: 0.5rem !important; }
+
+.pt-2,
+.py-2 {
+  padding-top: 0.5rem !important; }
+
+.pr-2,
+.px-2 {
+  padding-right: 0.5rem !important; }
+
+.pb-2,
+.py-2 {
+  padding-bottom: 0.5rem !important; }
+
+.pl-2,
+.px-2 {
+  padding-left: 0.5rem !important; }
+
+.p-3 {
+  padding: 1rem !important; }
+
+.pt-3,
+.py-3 {
+  padding-top: 1rem !important; }
+
+.pr-3,
+.px-3 {
+  padding-right: 1rem !important; }
+
+.pb-3,
+.py-3 {
+  padding-bottom: 1rem !important; }
+
+.pl-3,
+.px-3 {
+  padding-left: 1rem !important; }
+
+.p-4 {
+  padding: 1.5rem !important; }
+
+.pt-4,
+.py-4 {
+  padding-top: 1.5rem !important; }
+
+.pr-4,
+.px-4 {
+  padding-right: 1.5rem !important; }
+
+.pb-4,
+.py-4 {
+  padding-bottom: 1.5rem !important; }
+
+.pl-4,
+.px-4 {
+  padding-left: 1.5rem !important; }
+
+.p-5 {
+  padding: 3rem !important; }
+
+.pt-5,
+.py-5 {
+  padding-top: 3rem !important; }
+
+.pr-5,
+.px-5 {
+  padding-right: 3rem !important; }
+
+.pb-5,
+.py-5 {
+  padding-bottom: 3rem !important; }
+
+.pl-5,
+.px-5 {
+  padding-left: 3rem !important; }
+
+.m-n1 {
+  margin: -0.25rem !important; }
+
+.mt-n1,
+.my-n1 {
+  margin-top: -0.25rem !important; }
+
+.mr-n1,
+.mx-n1 {
+  margin-right: -0.25rem !important; }
+
+.mb-n1,
+.my-n1 {
+  margin-bottom: -0.25rem !important; }
+
+.ml-n1,
+.mx-n1 {
+  margin-left: -0.25rem !important; }
+
+.m-n2 {
+  margin: -0.5rem !important; }
+
+.mt-n2,
+.my-n2 {
+  margin-top: -0.5rem !important; }
+
+.mr-n2,
+.mx-n2 {
+  margin-right: -0.5rem !important; }
+
+.mb-n2,
+.my-n2 {
+  margin-bottom: -0.5rem !important; }
+
+.ml-n2,
+.mx-n2 {
+  margin-left: -0.5rem !important; }
+
+.m-n3 {
+  margin: -1rem !important; }
+
+.mt-n3,
+.my-n3 {
+  margin-top: -1rem !important; }
+
+.mr-n3,
+.mx-n3 {
+  margin-right: -1rem !important; }
+
+.mb-n3,
+.my-n3 {
+  margin-bottom: -1rem !important; }
+
+.ml-n3,
+.mx-n3 {
+  margin-left: -1rem !important; }
+
+.m-n4 {
+  margin: -1.5rem !important; }
+
+.mt-n4,
+.my-n4 {
+  margin-top: -1.5rem !important; }
+
+.mr-n4,
+.mx-n4 {
+  margin-right: -1.5rem !important; }
+
+.mb-n4,
+.my-n4 {
+  margin-bottom: -1.5rem !important; }
+
+.ml-n4,
+.mx-n4 {
+  margin-left: -1.5rem !important; }
+
+.m-n5 {
+  margin: -3rem !important; }
+
+.mt-n5,
+.my-n5 {
+  margin-top: -3rem !important; }
+
+.mr-n5,
+.mx-n5 {
+  margin-right: -3rem !important; }
+
+.mb-n5,
+.my-n5 {
+  margin-bottom: -3rem !important; }
+
+.ml-n5,
+.mx-n5 {
+  margin-left: -3rem !important; }
+
+.m-auto {
+  margin: auto !important; }
+
+.mt-auto,
+.my-auto {
+  margin-top: auto !important; }
+
+.mr-auto,
+.mx-auto {
+  margin-right: auto !important; }
+
+.mb-auto,
+.my-auto {
+  margin-bottom: auto !important; }
+
+.ml-auto,
+.mx-auto {
+  margin-left: auto !important; }
+
+@media (min-width: 576px) {
+  .m-sm-0 {
+    margin: 0 !important; }
+  .mt-sm-0,
+  .my-sm-0 {
+    margin-top: 0 !important; }
+  .mr-sm-0,
+  .mx-sm-0 {
+    margin-right: 0 !important; }
+  .mb-sm-0,
+  .my-sm-0 {
+    margin-bottom: 0 !important; }
+  .ml-sm-0,
+  .mx-sm-0 {
+    margin-left: 0 !important; }
+  .m-sm-1 {
+    margin: 0.25rem !important; }
+  .mt-sm-1,
+  .my-sm-1 {
+    margin-top: 0.25rem !important; }
+  .mr-sm-1,
+  .mx-sm-1 {
+    margin-right: 0.25rem !important; }
+  .mb-sm-1,
+  .my-sm-1 {
+    margin-bottom: 0.25rem !important; }
+  .ml-sm-1,
+  .mx-sm-1 {
+    margin-left: 0.25rem !important; }
+  .m-sm-2 {
+    margin: 0.5rem !important; }
+  .mt-sm-2,
+  .my-sm-2 {
+    margin-top: 0.5rem !important; }
+  .mr-sm-2,
+  .mx-sm-2 {
+    margin-right: 0.5rem !important; }
+  .mb-sm-2,
+  .my-sm-2 {
+    margin-bottom: 0.5rem !important; }
+  .ml-sm-2,
+  .mx-sm-2 {
+    margin-left: 0.5rem !important; }
+  .m-sm-3 {
+    margin: 1rem !important; }
+  .mt-sm-3,
+  .my-sm-3 {
+    margin-top: 1rem !important; }
+  .mr-sm-3,
+  .mx-sm-3 {
+    margin-right: 1rem !important; }
+  .mb-sm-3,
+  .my-sm-3 {
+    margin-bottom: 1rem !important; }
+  .ml-sm-3,
+  .mx-sm-3 {
+    margin-left: 1rem !important; }
+  .m-sm-4 {
+    margin: 1.5rem !important; }
+  .mt-sm-4,
+  .my-sm-4 {
+    margin-top: 1.5rem !important; }
+  .mr-sm-4,
+  .mx-sm-4 {
+    margin-right: 1.5rem !important; }
+  .mb-sm-4,
+  .my-sm-4 {
+    margin-bottom: 1.5rem !important; }
+  .ml-sm-4,
+  .mx-sm-4 {
+    margin-left: 1.5rem !important; }
+  .m-sm-5 {
+    margin: 3rem !important; }
+  .mt-sm-5,
+  .my-sm-5 {
+    margin-top: 3rem !important; }
+  .mr-sm-5,
+  .mx-sm-5 {
+    margin-right: 3rem !important; }
+  .mb-sm-5,
+  .my-sm-5 {
+    margin-bottom: 3rem !important; }
+  .ml-sm-5,
+  .mx-sm-5 {
+    margin-left: 3rem !important; }
+  .p-sm-0 {
+    padding: 0 !important; }
+  .pt-sm-0,
+  .py-sm-0 {
+    padding-top: 0 !important; }
+  .pr-sm-0,
+  .px-sm-0 {
+    padding-right: 0 !important; }
+  .pb-sm-0,
+  .py-sm-0 {
+    padding-bottom: 0 !important; }
+  .pl-sm-0,
+  .px-sm-0 {
+    padding-left: 0 !important; }
+  .p-sm-1 {
+    padding: 0.25rem !important; }
+  .pt-sm-1,
+  .py-sm-1 {
+    padding-top: 0.25rem !important; }
+  .pr-sm-1,
+  .px-sm-1 {
+    padding-right: 0.25rem !important; }
+  .pb-sm-1,
+  .py-sm-1 {
+    padding-bottom: 0.25rem !important; }
+  .pl-sm-1,
+  .px-sm-1 {
+    padding-left: 0.25rem !important; }
+  .p-sm-2 {
+    padding: 0.5rem !important; }
+  .pt-sm-2,
+  .py-sm-2 {
+    padding-top: 0.5rem !important; }
+  .pr-sm-2,
+  .px-sm-2 {
+    padding-right: 0.5rem !important; }
+  .pb-sm-2,
+  .py-sm-2 {
+    padding-bottom: 0.5rem !important; }
+  .pl-sm-2,
+  .px-sm-2 {
+    padding-left: 0.5rem !important; }
+  .p-sm-3 {
+    padding: 1rem !important; }
+  .pt-sm-3,
+  .py-sm-3 {
+    padding-top: 1rem !important; }
+  .pr-sm-3,
+  .px-sm-3 {
+    padding-right: 1rem !important; }
+  .pb-sm-3,
+  .py-sm-3 {
+    padding-bottom: 1rem !important; }
+  .pl-sm-3,
+  .px-sm-3 {
+    padding-left: 1rem !important; }
+  .p-sm-4 {
+    padding: 1.5rem !important; }
+  .pt-sm-4,
+  .py-sm-4 {
+    padding-top: 1.5rem !important; }
+  .pr-sm-4,
+  .px-sm-4 {
+    padding-right: 1.5rem !important; }
+  .pb-sm-4,
+  .py-sm-4 {
+    padding-bottom: 1.5rem !important; }
+  .pl-sm-4,
+  .px-sm-4 {
+    padding-left: 1.5rem !important; }
+  .p-sm-5 {
+    padding: 3rem !important; }
+  .pt-sm-5,
+  .py-sm-5 {
+    padding-top: 3rem !important; }
+  .pr-sm-5,
+  .px-sm-5 {
+    padding-right: 3rem !important; }
+  .pb-sm-5,
+  .py-sm-5 {
+    padding-bottom: 3rem !important; }
+  .pl-sm-5,
+  .px-sm-5 {
+    padding-left: 3rem !important; }
+  .m-sm-n1 {
+    margin: -0.25rem !important; }
+  .mt-sm-n1,
+  .my-sm-n1 {
+    margin-top: -0.25rem !important; }
+  .mr-sm-n1,
+  .mx-sm-n1 {
+    margin-right: -0.25rem !important; }
+  .mb-sm-n1,
+  .my-sm-n1 {
+    margin-bottom: -0.25rem !important; }
+  .ml-sm-n1,
+  .mx-sm-n1 {
+    margin-left: -0.25rem !important; }
+  .m-sm-n2 {
+    margin: -0.5rem !important; }
+  .mt-sm-n2,
+  .my-sm-n2 {
+    margin-top: -0.5rem !important; }
+  .mr-sm-n2,
+  .mx-sm-n2 {
+    margin-right: -0.5rem !important; }
+  .mb-sm-n2,
+  .my-sm-n2 {
+    margin-bottom: -0.5rem !important; }
+  .ml-sm-n2,
+  .mx-sm-n2 {
+    margin-left: -0.5rem !important; }
+  .m-sm-n3 {
+    margin: -1rem !important; }
+  .mt-sm-n3,
+  .my-sm-n3 {
+    margin-top: -1rem !important; }
+  .mr-sm-n3,
+  .mx-sm-n3 {
+    margin-right: -1rem !important; }
+  .mb-sm-n3,
+  .my-sm-n3 {
+    margin-bottom: -1rem !important; }
+  .ml-sm-n3,
+  .mx-sm-n3 {
+    margin-left: -1rem !important; }
+  .m-sm-n4 {
+    margin: -1.5rem !important; }
+  .mt-sm-n4,
+  .my-sm-n4 {
+    margin-top: -1.5rem !important; }
+  .mr-sm-n4,
+  .mx-sm-n4 {
+    margin-right: -1.5rem !important; }
+  .mb-sm-n4,
+  .my-sm-n4 {
+    margin-bottom: -1.5rem !important; }
+  .ml-sm-n4,
+  .mx-sm-n4 {
+    margin-left: -1.5rem !important; }
+  .m-sm-n5 {
+    margin: -3rem !important; }
+  .mt-sm-n5,
+  .my-sm-n5 {
+    margin-top: -3rem !important; }
+  .mr-sm-n5,
+  .mx-sm-n5 {
+    margin-right: -3rem !important; }
+  .mb-sm-n5,
+  .my-sm-n5 {
+    margin-bottom: -3rem !important; }
+  .ml-sm-n5,
+  .mx-sm-n5 {
+    margin-left: -3rem !important; }
+  .m-sm-auto {
+    margin: auto !important; }
+  .mt-sm-auto,
+  .my-sm-auto {
+    margin-top: auto !important; }
+  .mr-sm-auto,
+  .mx-sm-auto {
+    margin-right: auto !important; }
+  .mb-sm-auto,
+  .my-sm-auto {
+    margin-bottom: auto !important; }
+  .ml-sm-auto,
+  .mx-sm-auto {
+    margin-left: auto !important; } }
+
+@media (min-width: 768px) {
+  .m-md-0 {
+    margin: 0 !important; }
+  .mt-md-0,
+  .my-md-0 {
+    margin-top: 0 !important; }
+  .mr-md-0,
+  .mx-md-0 {
+    margin-right: 0 !important; }
+  .mb-md-0,
+  .my-md-0 {
+    margin-bottom: 0 !important; }
+  .ml-md-0,
+  .mx-md-0 {
+    margin-left: 0 !important; }
+  .m-md-1 {
+    margin: 0.25rem !important; }
+  .mt-md-1,
+  .my-md-1 {
+    margin-top: 0.25rem !important; }
+  .mr-md-1,
+  .mx-md-1 {
+    margin-right: 0.25rem !important; }
+  .mb-md-1,
+  .my-md-1 {
+    margin-bottom: 0.25rem !important; }
+  .ml-md-1,
+  .mx-md-1 {
+    margin-left: 0.25rem !important; }
+  .m-md-2 {
+    margin: 0.5rem !important; }
+  .mt-md-2,
+  .my-md-2 {
+    margin-top: 0.5rem !important; }
+  .mr-md-2,
+  .mx-md-2 {
+    margin-right: 0.5rem !important; }
+  .mb-md-2,
+  .my-md-2 {
+    margin-bottom: 0.5rem !important; }
+  .ml-md-2,
+  .mx-md-2 {
+    margin-left: 0.5rem !important; }
+  .m-md-3 {
+    margin: 1rem !important; }
+  .mt-md-3,
+  .my-md-3 {
+    margin-top: 1rem !important; }
+  .mr-md-3,
+  .mx-md-3 {
+    margin-right: 1rem !important; }
+  .mb-md-3,
+  .my-md-3 {
+    margin-bottom: 1rem !important; }
+  .ml-md-3,
+  .mx-md-3 {
+    margin-left: 1rem !important; }
+  .m-md-4 {
+    margin: 1.5rem !important; }
+  .mt-md-4,
+  .my-md-4 {
+    margin-top: 1.5rem !important; }
+  .mr-md-4,
+  .mx-md-4 {
+    margin-right: 1.5rem !important; }
+  .mb-md-4,
+  .my-md-4 {
+    margin-bottom: 1.5rem !important; }
+  .ml-md-4,
+  .mx-md-4 {
+    margin-left: 1.5rem !important; }
+  .m-md-5 {
+    margin: 3rem !important; }
+  .mt-md-5,
+  .my-md-5 {
+    margin-top: 3rem !important; }
+  .mr-md-5,
+  .mx-md-5 {
+    margin-right: 3rem !important; }
+  .mb-md-5,
+  .my-md-5 {
+    margin-bottom: 3rem !important; }
+  .ml-md-5,
+  .mx-md-5 {
+    margin-left: 3rem !important; }
+  .p-md-0 {
+    padding: 0 !important; }
+  .pt-md-0,
+  .py-md-0 {
+    padding-top: 0 !important; }
+  .pr-md-0,
+  .px-md-0 {
+    padding-right: 0 !important; }
+  .pb-md-0,
+  .py-md-0 {
+    padding-bottom: 0 !important; }
+  .pl-md-0,
+  .px-md-0 {
+    padding-left: 0 !important; }
+  .p-md-1 {
+    padding: 0.25rem !important; }
+  .pt-md-1,
+  .py-md-1 {
+    padding-top: 0.25rem !important; }
+  .pr-md-1,
+  .px-md-1 {
+    padding-right: 0.25rem !important; }
+  .pb-md-1,
+  .py-md-1 {
+    padding-bottom: 0.25rem !important; }
+  .pl-md-1,
+  .px-md-1 {
+    padding-left: 0.25rem !important; }
+  .p-md-2 {
+    padding: 0.5rem !important; }
+  .pt-md-2,
+  .py-md-2 {
+    padding-top: 0.5rem !important; }
+  .pr-md-2,
+  .px-md-2 {
+    padding-right: 0.5rem !important; }
+  .pb-md-2,
+  .py-md-2 {
+    padding-bottom: 0.5rem !important; }
+  .pl-md-2,
+  .px-md-2 {
+    padding-left: 0.5rem !important; }
+  .p-md-3 {
+    padding: 1rem !important; }
+  .pt-md-3,
+  .py-md-3 {
+    padding-top: 1rem !important; }
+  .pr-md-3,
+  .px-md-3 {
+    padding-right: 1rem !important; }
+  .pb-md-3,
+  .py-md-3 {
+    padding-bottom: 1rem !important; }
+  .pl-md-3,
+  .px-md-3 {
+    padding-left: 1rem !important; }
+  .p-md-4 {
+    padding: 1.5rem !important; }
+  .pt-md-4,
+  .py-md-4 {
+    padding-top: 1.5rem !important; }
+  .pr-md-4,
+  .px-md-4 {
+    padding-right: 1.5rem !important; }
+  .pb-md-4,
+  .py-md-4 {
+    padding-bottom: 1.5rem !important; }
+  .pl-md-4,
+  .px-md-4 {
+    padding-left: 1.5rem !important; }
+  .p-md-5 {
+    padding: 3rem !important; }
+  .pt-md-5,
+  .py-md-5 {
+    padding-top: 3rem !important; }
+  .pr-md-5,
+  .px-md-5 {
+    padding-right: 3rem !important; }
+  .pb-md-5,
+  .py-md-5 {
+    padding-bottom: 3rem !important; }
+  .pl-md-5,
+  .px-md-5 {
+    padding-left: 3rem !important; }
+  .m-md-n1 {
+    margin: -0.25rem !important; }
+  .mt-md-n1,
+  .my-md-n1 {
+    margin-top: -0.25rem !important; }
+  .mr-md-n1,
+  .mx-md-n1 {
+    margin-right: -0.25rem !important; }
+  .mb-md-n1,
+  .my-md-n1 {
+    margin-bottom: -0.25rem !important; }
+  .ml-md-n1,
+  .mx-md-n1 {
+    margin-left: -0.25rem !important; }
+  .m-md-n2 {
+    margin: -0.5rem !important; }
+  .mt-md-n2,
+  .my-md-n2 {
+    margin-top: -0.5rem !important; }
+  .mr-md-n2,
+  .mx-md-n2 {
+    margin-right: -0.5rem !important; }
+  .mb-md-n2,
+  .my-md-n2 {
+    margin-bottom: -0.5rem !important; }
+  .ml-md-n2,
+  .mx-md-n2 {
+    margin-left: -0.5rem !important; }
+  .m-md-n3 {
+    margin: -1rem !important; }
+  .mt-md-n3,
+  .my-md-n3 {
+    margin-top: -1rem !important; }
+  .mr-md-n3,
+  .mx-md-n3 {
+    margin-right: -1rem !important; }
+  .mb-md-n3,
+  .my-md-n3 {
+    margin-bottom: -1rem !important; }
+  .ml-md-n3,
+  .mx-md-n3 {
+    margin-left: -1rem !important; }
+  .m-md-n4 {
+    margin: -1.5rem !important; }
+  .mt-md-n4,
+  .my-md-n4 {
+    margin-top: -1.5rem !important; }
+  .mr-md-n4,
+  .mx-md-n4 {
+    margin-right: -1.5rem !important; }
+  .mb-md-n4,
+  .my-md-n4 {
+    margin-bottom: -1.5rem !important; }
+  .ml-md-n4,
+  .mx-md-n4 {
+    margin-left: -1.5rem !important; }
+  .m-md-n5 {
+    margin: -3rem !important; }
+  .mt-md-n5,
+  .my-md-n5 {
+    margin-top: -3rem !important; }
+  .mr-md-n5,
+  .mx-md-n5 {
+    margin-right: -3rem !important; }
+  .mb-md-n5,
+  .my-md-n5 {
+    margin-bottom: -3rem !important; }
+  .ml-md-n5,
+  .mx-md-n5 {
+    margin-left: -3rem !important; }
+  .m-md-auto {
+    margin: auto !important; }
+  .mt-md-auto,
+  .my-md-auto {
+    margin-top: auto !important; }
+  .mr-md-auto,
+  .mx-md-auto {
+    margin-right: auto !important; }
+  .mb-md-auto,
+  .my-md-auto {
+    margin-bottom: auto !important; }
+  .ml-md-auto,
+  .mx-md-auto {
+    margin-left: auto !important; } }
+
+@media (min-width: 992px) {
+  .m-lg-0 {
+    margin: 0 !important; }
+  .mt-lg-0,
+  .my-lg-0 {
+    margin-top: 0 !important; }
+  .mr-lg-0,
+  .mx-lg-0 {
+    margin-right: 0 !important; }
+  .mb-lg-0,
+  .my-lg-0 {
+    margin-bottom: 0 !important; }
+  .ml-lg-0,
+  .mx-lg-0 {
+    margin-left: 0 !important; }
+  .m-lg-1 {
+    margin: 0.25rem !important; }
+  .mt-lg-1,
+  .my-lg-1 {
+    margin-top: 0.25rem !important; }
+  .mr-lg-1,
+  .mx-lg-1 {
+    margin-right: 0.25rem !important; }
+  .mb-lg-1,
+  .my-lg-1 {
+    margin-bottom: 0.25rem !important; }
+  .ml-lg-1,
+  .mx-lg-1 {
+    margin-left: 0.25rem !important; }
+  .m-lg-2 {
+    margin: 0.5rem !important; }
+  .mt-lg-2,
+  .my-lg-2 {
+    margin-top: 0.5rem !important; }
+  .mr-lg-2,
+  .mx-lg-2 {
+    margin-right: 0.5rem !important; }
+  .mb-lg-2,
+  .my-lg-2 {
+    margin-bottom: 0.5rem !important; }
+  .ml-lg-2,
+  .mx-lg-2 {
+    margin-left: 0.5rem !important; }
+  .m-lg-3 {
+    margin: 1rem !important; }
+  .mt-lg-3,
+  .my-lg-3 {
+    margin-top: 1rem !important; }
+  .mr-lg-3,
+  .mx-lg-3 {
+    margin-right: 1rem !important; }
+  .mb-lg-3,
+  .my-lg-3 {
+    margin-bottom: 1rem !important; }
+  .ml-lg-3,
+  .mx-lg-3 {
+    margin-left: 1rem !important; }
+  .m-lg-4 {
+    margin: 1.5rem !important; }
+  .mt-lg-4,
+  .my-lg-4 {
+    margin-top: 1.5rem !important; }
+  .mr-lg-4,
+  .mx-lg-4 {
+    margin-right: 1.5rem !important; }
+  .mb-lg-4,
+  .my-lg-4 {
+    margin-bottom: 1.5rem !important; }
+  .ml-lg-4,
+  .mx-lg-4 {
+    margin-left: 1.5rem !important; }
+  .m-lg-5 {
+    margin: 3rem !important; }
+  .mt-lg-5,
+  .my-lg-5 {
+    margin-top: 3rem !important; }
+  .mr-lg-5,
+  .mx-lg-5 {
+    margin-right: 3rem !important; }
+  .mb-lg-5,
+  .my-lg-5 {
+    margin-bottom: 3rem !important; }
+  .ml-lg-5,
+  .mx-lg-5 {
+    margin-left: 3rem !important; }
+  .p-lg-0 {
+    padding: 0 !important; }
+  .pt-lg-0,
+  .py-lg-0 {
+    padding-top: 0 !important; }
+  .pr-lg-0,
+  .px-lg-0 {
+    padding-right: 0 !important; }
+  .pb-lg-0,
+  .py-lg-0 {
+    padding-bottom: 0 !important; }
+  .pl-lg-0,
+  .px-lg-0 {
+    padding-left: 0 !important; }
+  .p-lg-1 {
+    padding: 0.25rem !important; }
+  .pt-lg-1,
+  .py-lg-1 {
+    padding-top: 0.25rem !important; }
+  .pr-lg-1,
+  .px-lg-1 {
+    padding-right: 0.25rem !important; }
+  .pb-lg-1,
+  .py-lg-1 {
+    padding-bottom: 0.25rem !important; }
+  .pl-lg-1,
+  .px-lg-1 {
+    padding-left: 0.25rem !important; }
+  .p-lg-2 {
+    padding: 0.5rem !important; }
+  .pt-lg-2,
+  .py-lg-2 {
+    padding-top: 0.5rem !important; }
+  .pr-lg-2,
+  .px-lg-2 {
+    padding-right: 0.5rem !important; }
+  .pb-lg-2,
+  .py-lg-2 {
+    padding-bottom: 0.5rem !important; }
+  .pl-lg-2,
+  .px-lg-2 {
+    padding-left: 0.5rem !important; }
+  .p-lg-3 {
+    padding: 1rem !important; }
+  .pt-lg-3,
+  .py-lg-3 {
+    padding-top: 1rem !important; }
+  .pr-lg-3,
+  .px-lg-3 {
+    padding-right: 1rem !important; }
+  .pb-lg-3,
+  .py-lg-3 {
+    padding-bottom: 1rem !important; }
+  .pl-lg-3,
+  .px-lg-3 {
+    padding-left: 1rem !important; }
+  .p-lg-4 {
+    padding: 1.5rem !important; }
+  .pt-lg-4,
+  .py-lg-4 {
+    padding-top: 1.5rem !important; }
+  .pr-lg-4,
+  .px-lg-4 {
+    padding-right: 1.5rem !important; }
+  .pb-lg-4,
+  .py-lg-4 {
+    padding-bottom: 1.5rem !important; }
+  .pl-lg-4,
+  .px-lg-4 {
+    padding-left: 1.5rem !important; }
+  .p-lg-5 {
+    padding: 3rem !important; }
+  .pt-lg-5,
+  .py-lg-5 {
+    padding-top: 3rem !important; }
+  .pr-lg-5,
+  .px-lg-5 {
+    padding-right: 3rem !important; }
+  .pb-lg-5,
+  .py-lg-5 {
+    padding-bottom: 3rem !important; }
+  .pl-lg-5,
+  .px-lg-5 {
+    padding-left: 3rem !important; }
+  .m-lg-n1 {
+    margin: -0.25rem !important; }
+  .mt-lg-n1,
+  .my-lg-n1 {
+    margin-top: -0.25rem !important; }
+  .mr-lg-n1,
+  .mx-lg-n1 {
+    margin-right: -0.25rem !important; }
+  .mb-lg-n1,
+  .my-lg-n1 {
+    margin-bottom: -0.25rem !important; }
+  .ml-lg-n1,
+  .mx-lg-n1 {
+    margin-left: -0.25rem !important; }
+  .m-lg-n2 {
+    margin: -0.5rem !important; }
+  .mt-lg-n2,
+  .my-lg-n2 {
+    margin-top: -0.5rem !important; }
+  .mr-lg-n2,
+  .mx-lg-n2 {
+    margin-right: -0.5rem !important; }
+  .mb-lg-n2,
+  .my-lg-n2 {
+    margin-bottom: -0.5rem !important; }
+  .ml-lg-n2,
+  .mx-lg-n2 {
+    margin-left: -0.5rem !important; }
+  .m-lg-n3 {
+    margin: -1rem !important; }
+  .mt-lg-n3,
+  .my-lg-n3 {
+    margin-top: -1rem !important; }
+  .mr-lg-n3,
+  .mx-lg-n3 {
+    margin-right: -1rem !important; }
+  .mb-lg-n3,
+  .my-lg-n3 {
+    margin-bottom: -1rem !important; }
+  .ml-lg-n3,
+  .mx-lg-n3 {
+    margin-left: -1rem !important; }
+  .m-lg-n4 {
+    margin: -1.5rem !important; }
+  .mt-lg-n4,
+  .my-lg-n4 {
+    margin-top: -1.5rem !important; }
+  .mr-lg-n4,
+  .mx-lg-n4 {
+    margin-right: -1.5rem !important; }
+  .mb-lg-n4,
+  .my-lg-n4 {
+    margin-bottom: -1.5rem !important; }
+  .ml-lg-n4,
+  .mx-lg-n4 {
+    margin-left: -1.5rem !important; }
+  .m-lg-n5 {
+    margin: -3rem !important; }
+  .mt-lg-n5,
+  .my-lg-n5 {
+    margin-top: -3rem !important; }
+  .mr-lg-n5,
+  .mx-lg-n5 {
+    margin-right: -3rem !important; }
+  .mb-lg-n5,
+  .my-lg-n5 {
+    margin-bottom: -3rem !important; }
+  .ml-lg-n5,
+  .mx-lg-n5 {
+    margin-left: -3rem !important; }
+  .m-lg-auto {
+    margin: auto !important; }
+  .mt-lg-auto,
+  .my-lg-auto {
+    margin-top: auto !important; }
+  .mr-lg-auto,
+  .mx-lg-auto {
+    margin-right: auto !important; }
+  .mb-lg-auto,
+  .my-lg-auto {
+    margin-bottom: auto !important; }
+  .ml-lg-auto,
+  .mx-lg-auto {
+    margin-left: auto !important; } }
+
+@media (min-width: 1200px) {
+  .m-xl-0 {
+    margin: 0 !important; }
+  .mt-xl-0,
+  .my-xl-0 {
+    margin-top: 0 !important; }
+  .mr-xl-0,
+  .mx-xl-0 {
+    margin-right: 0 !important; }
+  .mb-xl-0,
+  .my-xl-0 {
+    margin-bottom: 0 !important; }
+  .ml-xl-0,
+  .mx-xl-0 {
+    margin-left: 0 !important; }
+  .m-xl-1 {
+    margin: 0.25rem !important; }
+  .mt-xl-1,
+  .my-xl-1 {
+    margin-top: 0.25rem !important; }
+  .mr-xl-1,
+  .mx-xl-1 {
+    margin-right: 0.25rem !important; }
+  .mb-xl-1,
+  .my-xl-1 {
+    margin-bottom: 0.25rem !important; }
+  .ml-xl-1,
+  .mx-xl-1 {
+    margin-left: 0.25rem !important; }
+  .m-xl-2 {
+    margin: 0.5rem !important; }
+  .mt-xl-2,
+  .my-xl-2 {
+    margin-top: 0.5rem !important; }
+  .mr-xl-2,
+  .mx-xl-2 {
+    margin-right: 0.5rem !important; }
+  .mb-xl-2,
+  .my-xl-2 {
+    margin-bottom: 0.5rem !important; }
+  .ml-xl-2,
+  .mx-xl-2 {
+    margin-left: 0.5rem !important; }
+  .m-xl-3 {
+    margin: 1rem !important; }
+  .mt-xl-3,
+  .my-xl-3 {
+    margin-top: 1rem !important; }
+  .mr-xl-3,
+  .mx-xl-3 {
+    margin-right: 1rem !important; }
+  .mb-xl-3,
+  .my-xl-3 {
+    margin-bottom: 1rem !important; }
+  .ml-xl-3,
+  .mx-xl-3 {
+    margin-left: 1rem !important; }
+  .m-xl-4 {
+    margin: 1.5rem !important; }
+  .mt-xl-4,
+  .my-xl-4 {
+    margin-top: 1.5rem !important; }
+  .mr-xl-4,
+  .mx-xl-4 {
+    margin-right: 1.5rem !important; }
+  .mb-xl-4,
+  .my-xl-4 {
+    margin-bottom: 1.5rem !important; }
+  .ml-xl-4,
+  .mx-xl-4 {
+    margin-left: 1.5rem !important; }
+  .m-xl-5 {
+    margin: 3rem !important; }
+  .mt-xl-5,
+  .my-xl-5 {
+    margin-top: 3rem !important; }
+  .mr-xl-5,
+  .mx-xl-5 {
+    margin-right: 3rem !important; }
+  .mb-xl-5,
+  .my-xl-5 {
+    margin-bottom: 3rem !important; }
+  .ml-xl-5,
+  .mx-xl-5 {
+    margin-left: 3rem !important; }
+  .p-xl-0 {
+    padding: 0 !important; }
+  .pt-xl-0,
+  .py-xl-0 {
+    padding-top: 0 !important; }
+  .pr-xl-0,
+  .px-xl-0 {
+    padding-right: 0 !important; }
+  .pb-xl-0,
+  .py-xl-0 {
+    padding-bottom: 0 !important; }
+  .pl-xl-0,
+  .px-xl-0 {
+    padding-left: 0 !important; }
+  .p-xl-1 {
+    padding: 0.25rem !important; }
+  .pt-xl-1,
+  .py-xl-1 {
+    padding-top: 0.25rem !important; }
+  .pr-xl-1,
+  .px-xl-1 {
+    padding-right: 0.25rem !important; }
+  .pb-xl-1,
+  .py-xl-1 {
+    padding-bottom: 0.25rem !important; }
+  .pl-xl-1,
+  .px-xl-1 {
+    padding-left: 0.25rem !important; }
+  .p-xl-2 {
+    padding: 0.5rem !important; }
+  .pt-xl-2,
+  .py-xl-2 {
+    padding-top: 0.5rem !important; }
+  .pr-xl-2,
+  .px-xl-2 {
+    padding-right: 0.5rem !important; }
+  .pb-xl-2,
+  .py-xl-2 {
+    padding-bottom: 0.5rem !important; }
+  .pl-xl-2,
+  .px-xl-2 {
+    padding-left: 0.5rem !important; }
+  .p-xl-3 {
+    padding: 1rem !important; }
+  .pt-xl-3,
+  .py-xl-3 {
+    padding-top: 1rem !important; }
+  .pr-xl-3,
+  .px-xl-3 {
+    padding-right: 1rem !important; }
+  .pb-xl-3,
+  .py-xl-3 {
+    padding-bottom: 1rem !important; }
+  .pl-xl-3,
+  .px-xl-3 {
+    padding-left: 1rem !important; }
+  .p-xl-4 {
+    padding: 1.5rem !important; }
+  .pt-xl-4,
+  .py-xl-4 {
+    padding-top: 1.5rem !important; }
+  .pr-xl-4,
+  .px-xl-4 {
+    padding-right: 1.5rem !important; }
+  .pb-xl-4,
+  .py-xl-4 {
+    padding-bottom: 1.5rem !important; }
+  .pl-xl-4,
+  .px-xl-4 {
+    padding-left: 1.5rem !important; }
+  .p-xl-5 {
+    padding: 3rem !important; }
+  .pt-xl-5,
+  .py-xl-5 {
+    padding-top: 3rem !important; }
+  .pr-xl-5,
+  .px-xl-5 {
+    padding-right: 3rem !important; }
+  .pb-xl-5,
+  .py-xl-5 {
+    padding-bottom: 3rem !important; }
+  .pl-xl-5,
+  .px-xl-5 {
+    padding-left: 3rem !important; }
+  .m-xl-n1 {
+    margin: -0.25rem !important; }
+  .mt-xl-n1,
+  .my-xl-n1 {
+    margin-top: -0.25rem !important; }
+  .mr-xl-n1,
+  .mx-xl-n1 {
+    margin-right: -0.25rem !important; }
+  .mb-xl-n1,
+  .my-xl-n1 {
+    margin-bottom: -0.25rem !important; }
+  .ml-xl-n1,
+  .mx-xl-n1 {
+    margin-left: -0.25rem !important; }
+  .m-xl-n2 {
+    margin: -0.5rem !important; }
+  .mt-xl-n2,
+  .my-xl-n2 {
+    margin-top: -0.5rem !important; }
+  .mr-xl-n2,
+  .mx-xl-n2 {
+    margin-right: -0.5rem !important; }
+  .mb-xl-n2,
+  .my-xl-n2 {
+    margin-bottom: -0.5rem !important; }
+  .ml-xl-n2,
+  .mx-xl-n2 {
+    margin-left: -0.5rem !important; }
+  .m-xl-n3 {
+    margin: -1rem !important; }
+  .mt-xl-n3,
+  .my-xl-n3 {
+    margin-top: -1rem !important; }
+  .mr-xl-n3,
+  .mx-xl-n3 {
+    margin-right: -1rem !important; }
+  .mb-xl-n3,
+  .my-xl-n3 {
+    margin-bottom: -1rem !important; }
+  .ml-xl-n3,
+  .mx-xl-n3 {
+    margin-left: -1rem !important; }
+  .m-xl-n4 {
+    margin: -1.5rem !important; }
+  .mt-xl-n4,
+  .my-xl-n4 {
+    margin-top: -1.5rem !important; }
+  .mr-xl-n4,
+  .mx-xl-n4 {
+    margin-right: -1.5rem !important; }
+  .mb-xl-n4,
+  .my-xl-n4 {
+    margin-bottom: -1.5rem !important; }
+  .ml-xl-n4,
+  .mx-xl-n4 {
+    margin-left: -1.5rem !important; }
+  .m-xl-n5 {
+    margin: -3rem !important; }
+  .mt-xl-n5,
+  .my-xl-n5 {
+    margin-top: -3rem !important; }
+  .mr-xl-n5,
+  .mx-xl-n5 {
+    margin-right: -3rem !important; }
+  .mb-xl-n5,
+  .my-xl-n5 {
+    margin-bottom: -3rem !important; }
+  .ml-xl-n5,
+  .mx-xl-n5 {
+    margin-left: -3rem !important; }
+  .m-xl-auto {
+    margin: auto !important; }
+  .mt-xl-auto,
+  .my-xl-auto {
+    margin-top: auto !important; }
+  .mr-xl-auto,
+  .mx-xl-auto {
+    margin-right: auto !important; }
+  .mb-xl-auto,
+  .my-xl-auto {
+    margin-bottom: auto !important; }
+  .ml-xl-auto,
+  .mx-xl-auto {
+    margin-left: auto !important; } }
+
+.text-monospace {
+  font-family: "Hack", monospace !important; }
+
+.text-justify {
+  text-align: justify !important; }
+
+.text-wrap {
+  white-space: normal !important; }
+
+.text-nowrap {
+  white-space: nowrap !important; }
+
+.text-truncate {
+  overflow: hidden;
+  text-overflow: ellipsis;
+  white-space: nowrap; }
+
+.text-left {
+  text-align: left !important; }
+
+.text-right {
+  text-align: right !important; }
+
+.text-center {
+  text-align: center !important; }
+
+@media (min-width: 576px) {
+  .text-sm-left {
+    text-align: left !important; }
+  .text-sm-right {
+    text-align: right !important; }
+  .text-sm-center {
+    text-align: center !important; } }
+
+@media (min-width: 768px) {
+  .text-md-left {
+    text-align: left !important; }
+  .text-md-right {
+    text-align: right !important; }
+  .text-md-center {
+    text-align: center !important; } }
+
+@media (min-width: 992px) {
+  .text-lg-left {
+    text-align: left !important; }
+  .text-lg-right {
+    text-align: right !important; }
+  .text-lg-center {
+    text-align: center !important; } }
+
+@media (min-width: 1200px) {
+  .text-xl-left {
+    text-align: left !important; }
+  .text-xl-right {
+    text-align: right !important; }
+  .text-xl-center {
+    text-align: center !important; } }
+
+.text-lowercase {
+  text-transform: lowercase !important; }
+
+.text-uppercase {
+  text-transform: uppercase !important; }
+
+.text-capitalize {
+  text-transform: capitalize !important; }
+
+.font-weight-light {
+  font-weight: 300 !important; }
+
+.font-weight-lighter {
+  font-weight: lighter !important; }
+
+.font-weight-normal {
+  font-weight: 400 !important; }
+
+.font-weight-bold {
+  font-weight: 700 !important; }
+
+.font-weight-bolder {
+  font-weight: bolder !important; }
+
+.font-italic {
+  font-style: italic !important; }
+
+.text-white {
+  color: #fff !important; }
+
+.text-primary {
+  color: #3c6eb4 !important; }
+
+a.text-primary:hover, a.text-primary:focus {
+  color: #294b7b !important; }
+
+.text-secondary {
+  color: #6c757d !important; }
+
+a.text-secondary:hover, a.text-secondary:focus {
+  color: #494f54 !important; }
+
+.text-success {
+  color: #28a745 !important; }
+
+a.text-success:hover, a.text-success:focus {
+  color: #19692c !important; }
+
+.text-info {
+  color: #17a2b8 !important; }
+
+a.text-info:hover, a.text-info:focus {
+  color: #0f6674 !important; }
+
+.text-warning {
+  color: #ffc107 !important; }
+
+a.text-warning:hover, a.text-warning:focus {
+  color: #ba8b00 !important; }
+
+.text-danger {
+  color: #dc3545 !important; }
+
+a.text-danger:hover, a.text-danger:focus {
+  color: #a71d2a !important; }
+
+.text-light {
+  color: #f8f9fa !important; }
+
+a.text-light:hover, a.text-light:focus {
+  color: #cbd3da !important; }
+
+.text-dark {
+  color: #343a40 !important; }
+
+a.text-dark:hover, a.text-dark:focus {
+  color: #121416 !important; }
+
+.text-body {
+  color: #373a3c !important; }
+
+.text-muted {
+  color: #6c757d !important; }
+
+.text-black-50 {
+  color: rgba(0, 0, 0, 0.5) !important; }
+
+.text-white-50 {
+  color: rgba(255, 255, 255, 0.5) !important; }
+
+.text-hide {
+  font: 0/0 a;
+  color: transparent;
+  text-shadow: none;
+  background-color: transparent;
+  border: 0; }
+
+.text-decoration-none {
+  text-decoration: none !important; }
+
+.text-break {
+  word-break: break-word !important;
+  overflow-wrap: break-word !important; }
+
+.text-reset {
+  color: inherit !important; }
+
+.visible {
+  visibility: visible !important; }
+
+.invisible {
+  visibility: hidden !important; }
+
+@media print {
+  *,
+  *::before,
+  *::after {
+    text-shadow: none !important;
+    box-shadow: none !important; }
+  a:not(.btn) {
+    text-decoration: underline; }
+  abbr[title]::after {
+    content: " (" attr(title) ")"; }
+  pre {
+    white-space: pre-wrap !important; }
+  pre,
+  blockquote {
+    border: 1px solid #adb5bd;
+    page-break-inside: avoid; }
+  thead {
+    display: table-header-group; }
+  tr,
+  img {
+    page-break-inside: avoid; }
+  p,
+  h2,
+  h3 {
+    orphans: 3;
+    widows: 3; }
+  h2,
+  h3 {
+    page-break-after: avoid; }
+  @page {
+    size: a3; }
+  body {
+    min-width: 992px !important; }
+  .container {
+    min-width: 992px !important; }
+  .navbar {
+    display: none; }
+  .badge {
+    border: 1px solid #000; }
+  .table {
+    border-collapse: collapse !important; }
+    .table td,
+    .table th {
+      background-color: #fff !important; }
+  .table-bordered th,
+  .table-bordered td {
+    border: 1px solid #dee2e6 !important; }
+  .table-dark {
+    color: inherit; }
+    .table-dark th,
+    .table-dark td,
+    .table-dark thead th,
+    .table-dark tbody + tbody {
+      border-color: #dee2e6; }
+  .table .thead-dark th {
+    color: inherit;
+    border-color: #dee2e6; } }
+
+.container-narrow {
+  width: 100%;
+  padding-right: 15px;
+  padding-left: 15px;
+  margin-right: auto;
+  margin-left: auto; }
+  @media (min-width: 576px) {
+    .container-narrow {
+      max-width: 34rem; } }
+  @media (min-width: 768px) {
+    .container-narrow {
+      max-width: 45rem; } }
+  @media (min-width: 992px) {
+    .container-narrow {
+      max-width: 45rem; } }
+  @media (min-width: 1200px) {
+    .container-narrow {
+      max-width: 45rem; } }
+
+/*------------------------------------*\
+    #LISTS
+\*------------------------------------*/
+/**
+ * Inline list
+ */
+.inline-list li {
+  display: inline-block; }
+
+/**
+ * Social list
+ */
+.social-list li {
+  margin: 0 0.4rem 1em 0; }
+
+.social-list a {
+  font-size: 1.6em; }
+
+/**
+ * Headline list
+ */
+.headline-list {
+  margin-bottom: 1em; }
+  .headline-list.flush {
+    margin: 0; }
+  .headline-list h4 {
+    font-weight: normal; }
+  .headline-list li {
+    padding: 1em/4 0;
+    border-top: 1px solid #d5d5d5; }
+
+/**
+ * Post list
+ */
+.post-list li {
+  margin-bottom: 1em; }
+
+/**
+ * Bullet list
+ */
+.bullet-list {
+  list-style: square;
+  margin: 0 0 1em 1.2em;
+  line-height: 1.3; }
+  .bullet-list li {
+    margin-bottom: 1em; }
+
+/**
+ * Text list
+ */
+.text-list {
+  margin: 0 0 1em;
+  line-height: 1.3; }
+  .text-list li {
+    margin-bottom: 1em; }
+
+/**
+ * Media List
+ */
+.c-media-list__item {
+  margin-bottom: 1.5em; }
+
+/**
+ * Tile list
+ */
+.c-tile-list {
+  display: flex;
+  flex-direction: column; }
+  @media all and (min-width: 55rem) {
+    .c-tile-list {
+      flex-direction: row;
+      flex-wrap: wrap; } }
+
+/**
+ * Tile list item
+ */
+.c-tile-list__item {
+  width: 100%;
+  margin-bottom: 1em;
+  position: relative; }
+  .c-tile-list__item:nth-child(2n) {
+    padding-right: 0; }
+  @media all and (min-width: 55rem) {
+    .c-tile-list__item {
+      width: 50%;
+      margin: 0;
+      padding: 0 1em 1em 0; } }
+
+/** Thumbnail list
+ *
+ */
+.c-thumbnail-list li {
+  margin-bottom: 1.5em; }
+
+.c-thumbnail-list .c-block-media__media {
+  width: 80px; }
+
+.c-thumbnail-list .c-block-media__headline {
+  text-transform: none !important;
+  font-size: 1.5em; }
+
+/**
+ * Color bars list
+ */
+.c-color-bars-list li {
+  max-width: 480px;
+  position: relative;
+  height: 80px;
+  padding-top: 15px;
+  padding-left: 20px;
+  border: 1px solid #d5d5d5;
+  border-top: 0;
+  color: #55595c;
+  font-size: 1.3rem;
+  font-weight: bold; }
+  .c-color-bars-list li:first-child {
+    border-top: 1px solid #d5d5d5; }
+  .c-color-bars-list li.cur {
+    height: 120px; }
+    .c-color-bars-list li.cur:before {
+      position: absolute;
+      height: 100%;
+      width: 10px;
+      bottom: 0px;
+      left: 0px;
+      content: "";
+      background: #3c6eb4; }
+  .c-color-bars-list li.prev:before {
+    position: absolute;
+    height: 100%;
+    width: 10px;
+    bottom: 0px;
+    left: 0px;
+    content: "";
+    background: #79db32; }
+  .c-color-bars-list li.old {
+    color: #d5d5d5; }
+
+/**
+ * Ticket list
+ */
+.c-ticket-list {
+  max-width: 480px; }
+  .c-ticket-list li {
+    border: 1px solid #d5d5d5;
+    border-top: 0;
+    padding: 15px 20px;
+    color: #808080; }
+  .c-ticket-list:first-child {
+    border-top: 1px solid #d5d5d5; }
+  .c-ticket-list .list-item-title, .c-ticket-list .list-item-data {
+    float: left; }
+  .c-ticket-list .list-item-title {
+    border-radius: 20px;
+    padding: 4px 10px;
+    background: #808080;
+    color: white;
+    font-size: 1.2rem;
+    font-weight: bold; }
+  .c-ticket-list .origin {
+    float: right;
+    margin-top: 3px; }
+    .c-ticket-list .origin p {
+      display: inline-block;
+      margin-right: 2px; }
+    .c-ticket-list .origin img {
+      margin-bottom: 5px; }
+  .c-ticket-list .c-widget-action-btn.btn {
+    float: right;
+    padding: 3px 15px; }
+    .c-ticket-list .c-widget-action-btn.btn img {
+      display: block; }
+  .c-ticket-list .list-subheader {
+    font-size: 1.2rem;
+    font-weight: bold; }
+  .c-ticket-list .list-item-info, .c-ticket-list .list-item-data {
+    margin: 0;
+    font-size: 1.2rem; }
+
+.nav-underline .nav-item.active, .nav-underline .nav-item.active:hover {
+  box-shadow: 0px -3px 0 0 #3c6eb4 inset; }
+  .nav-underline .nav-item.active .nav-link, .nav-underline .nav-item.active:hover .nav-link {
+    color: #3c6eb4; }
+
+.nav-underline li:hover {
+  box-shadow: 0px -3px 0 0 #ddd inset; }
+
+.nav-underline li {
+  padding-top: 0.2rem;
+  padding-bottom: 0.2rem; }
+
+.navbar-underline {
+  background-color: #d5d5d5;
+  border-top: 1px solid #c8c8c8; }
+
+pre {
+  background-color: #fdf6e3;
+  padding: 1rem; }
+
+.table-expand-col {
+  min-width: 100%; }
+
+body {
+  background-color: #495057; }
+
+/*.card-success {
+  @include alert-variant($alert-success-bg, $alert-success-border, $alert-success-text);
+  .card-header{
+    background-color:darken($alert-success-bg, 5%);
+    border-bottom:1px solid darken($alert-success-bg, 10%)
+  }
+}
+
+.card-info {
+  @include alert-variant($alert-info-bg, $alert-info-border, $alert-info-text);
+  .card-header{
+    background-color:darken($alert-info-bg, 5%);
+    border-bottom:1px solid darken($alert-info-bg, 10%)
+  }
+}
+
+.card-primary {
+  @include alert-variant($alert-info-bg, $alert-info-border, $alert-info-text);
+  .card-header{
+    background-color:darken($alert-info-bg, 5%);
+    border-bottom:1px solid darken($alert-info-bg, 10%)
+  }
+}
+
+.card-warning {
+  @include alert-variant($alert-warning-bg, $alert-warning-border, $alert-warning-text);
+  .card-header{
+    background-color:darken($alert-warning-bg, 5%);
+    border-bottom:1px solid darken($alert-warning-bg, 10%)
+  }
+}
+
+.card-danger {
+  @include alert-variant($alert-danger-bg, $alert-danger-border, $alert-danger-text);
+  .card-header{
+    background-color:darken($alert-danger-bg, 5%);
+    border-bottom:1px solid darken($alert-danger-bg, 10%)
+  }
+}*/
+.modal-header {
+  background-color: #eceeef; }
+
+.modal-footer {
+  border-top: 0px !important; }
+
+.modal h4 {
+  text-transform: none !important; }
+
+.modal-card {
+  background-color: #d5d5d5;
+  padding: 15px; }
+
+.modal-body h4 {
+  font-weight: 600 !important; }
+
+/** TODO
+
+* work with inkscape design and get .c-widget-header h5 style overrides matching it better
+* fine-tune positioning of c-widget-header-btns
+
+**/
+/**
+ * Widget header
+ */
+.c-widget-header.card-header {
+  padding: 10px 10px 5px 10px;
+  max-width: 480px;
+  border: 1px solid #d5d5d5;
+  border-radius: 0 !important;
+  background: #f7f7f9; }
+
+.c-widget-header h6 {
+  font-family: "Open Sans";
+  font-size: 1.3rem;
+  font-weight: normal; }
+
+.c-widget-header-btn {
+  margin-top: -29px;
+  float: right; }
+
+/**
+ * Widget action button
+ */
+.c-widget-action-btn.btn {
+  padding: 5px 10px;
+  color: #a07cbc;
+  font-weight: bold; }
+  .c-widget-action-btn.btn:hover, .c-widget-action-btn.btn:focus, .c-widget-action-btn.btn:active, .c-widget-action-btn.btn:active:focus {
+    color: #a07cbc; }
+
+/**
+ * Widget view more button
+ */
+.c-widget-view-more-btn button {
+  padding: 0px;
+  margin-right: 5px;
+  color: #808080;
+  font-size: 1.2rem; }
+  .c-widget-view-more-btn button:hover, .c-widget-view-more-btn button:focus {
+    color: #55595c; }
+
+.c-widget-view-more-btn img {
+  margin-top: 2px; }
+
+/**
+ * Widget meeting event
+ */
+.c-widget-meeting-event {
+  max-width: 480px;
+  border: 1px solid #d5d5d5;
+  padding: 15px 20px; }
+  .c-widget-meeting-event h6, .c-widget-meeting-event h5, .c-widget-meeting-event p {
+    color: #55595c;
+    font-family: "Open Sans"; }
+  .c-widget-meeting-event h5 {
+    font-weight: bold;
+    font-size: 2rem; }
+  .c-widget-meeting-event h6 {
+    margin-top: 2px;
+    margin-bottom: 10px;
+    font-size: 1.1rem; }
+  .c-widget-meeting-event .date, .c-widget-meeting-event .time-ch {
+    font-size: 0.9rem;
+    float: left; }
+  .c-widget-meeting-event button {
+    float: right; }
+  .c-widget-meeting-event .date {
+    margin-right: 20px; }
+  .c-widget-meeting-event .time-ch p, .c-widget-meeting-event .time-ch a {
+    padding: 0;
+    margin: 0; }
+
+/**
+ * Widget meeting request
+ */
+.c-widget-meeting-request {
+  max-width: 480px;
+  border: 1px solid #d5d5d5;
+  padding: 15px 20px; }
+  .c-widget-meeting-request h6, .c-widget-meeting-request h5 {
+    color: #55595c;
+    font-family: "Open Sans"; }
+  .c-widget-meeting-request h5 {
+    float: left;
+    font-weight: bold;
+    font-size: 2rem; }
+  .c-widget-meeting-request h6 {
+    margin-top: 2px;
+    margin-bottom: 10px;
+    font-size: 1.1rem; }
+  .c-widget-meeting-request .meeting-request-btn {
+    float: right; }
+
+.masthead {
+  background-image: linear-gradient(to bottom, #eee 0%, #ddd 100%);
+  background-repeat: repeat-x;
+  padding-top: 10px;
+  padding-bottom: 10px; }
+
+.subheader {
+  background: #f8f9fa;
+  border-bottom: 1px solid #dee2e6; }
+  .subheader .nav-tabs {
+    margin-bottom: -1px; }
+
+.footer {
+  background-color: #495057; }
+
+.bodycontent {
+  background: #fff; }
+
+/*Overrides for content generated by python docutils*/
+.document-docutils > .section {
+  padding-bottom: 1rem; }
+
+.document-docutils pre {
+  /* Comment */
+  /* Error */
+  /* Generic */
+  /* Keyword */
+  /* Literal */
+  /* Name */
+  /* Operator */
+  /* Other */
+  /* Punctuation */
+  /* Comment.Multiline */
+  /* Comment.Preproc */
+  /* Comment.Single */
+  /* Comment.Special */
+  /* Generic.Deleted */
+  /* Generic.Emph */
+  /* Generic.Error */
+  /* Generic.Heading */
+  /* Generic.Inserted */
+  /* Generic.Output */
+  /* Generic.Prompt */
+  /* Generic.Strong */
+  /* Generic.Subheading */
+  /* Generic.Traceback */
+  /* Keyword.Constant */
+  /* Keyword.Declaration */
+  /* Keyword.Namespace */
+  /* Keyword.Pseudo */
+  /* Keyword.Reserved */
+  /* Keyword.Type */
+  /* Literal.Date */
+  /* Literal.Number */
+  /* Literal.String */
+  /* Name.Attribute */
+  /* Name.Builtin */
+  /* Name.Class */
+  /* Name.Constant */
+  /* Name.Decorator */
+  /* Name.Entity */
+  /* Name.Exception */
+  /* Name.Function */
+  /* Name.Label */
+  /* Name.Namespace */
+  /* Name.Other */
+  /* Name.Property */
+  /* Name.Tag */
+  /* Name.Variable */
+  /* Operator.Word */
+  /* Text.Whitespace */
+  /* Literal.Number.Float */
+  /* Literal.Number.Hex */
+  /* Literal.Number.Integer */
+  /* Literal.Number.Oct */
+  /* Literal.String.Backtick */
+  /* Literal.String.Char */
+  /* Literal.String.Doc */
+  /* Literal.String.Double */
+  /* Literal.String.Escape */
+  /* Literal.String.Heredoc */
+  /* Literal.String.Interpol */
+  /* Literal.String.Other */
+  /* Literal.String.Regex */
+  /* Literal.String.Single */
+  /* Literal.String.Symbol */
+  /* Name.Builtin.Pseudo */
+  /* Name.Variable.Class */
+  /* Name.Variable.Global */
+  /* Name.Variable.Instance */
+  /* Literal.Number.Integer.Long */ }
+  .document-docutils pre .comment {
+    color: #586e75; }
+  .document-docutils pre .error {
+    color: #93a1a1; }
+  .document-docutils pre .generic {
+    color: #93a1a1; }
+  .document-docutils pre .keyword {
+    color: #859900; }
+  .document-docutils pre .literal {
+    color: #93a1a1; }
+  .document-docutils pre .name {
+    color: #93a1a1; }
+  .document-docutils pre .operator {
+    color: #859900; }
+  .document-docutils pre .other {
+    color: #cb4b16; }
+  .document-docutils pre .punctuation {
+    color: #93a1a1; }
+  .document-docutils pre .comment.multiline {
+    color: #586e75; }
+  .document-docutils pre .comment.preproc {
+    color: #859900; }
+  .document-docutils pre .comment.single {
+    color: #586e75; }
+  .document-docutils pre .comment.special {
+    color: #859900; }
+  .document-docutils pre .generic.deleted {
+    color: #2aa198; }
+  .document-docutils pre .generic.emph {
+    color: #93a1a1;
+    font-style: italic; }
+  .document-docutils pre .generic.error {
+    color: #dc322f; }
+  .document-docutils pre .generic.heading {
+    color: #cb4b16; }
+  .document-docutils pre .generic.inserted {
+    color: #859900; }
+  .document-docutils pre .generic.output {
+    color: #93a1a1; }
+  .document-docutils pre .generic.prompt {
+    color: #93a1a1; }
+  .document-docutils pre .generic.strong {
+    color: #93a1a1;
+    font-weight: bold; }
+  .document-docutils pre .generic.subheading {
+    color: #cb4b16; }
+  .document-docutils pre .generic.traceback {
+    color: #93a1a1; }
+  .document-docutils pre .keyword.constant {
+    color: #cb4b16; }
+  .document-docutils pre .keyword.declaration {
+    color: #268bd2; }
+  .document-docutils pre .keyword.namespace {
+    color: #859900; }
+  .document-docutils pre .keyword.pseudo {
+    color: #859900; }
+  .document-docutils pre .keyword.reserved {
+    color: #268bd2; }
+  .document-docutils pre .keyword.type {
+    color: #dc322f; }
+  .document-docutils pre .literal.date {
+    color: #93a1a1; }
+  .document-docutils pre .literal.number {
+    color: #2aa198; }
+  .document-docutils pre .literal.string {
+    color: #2aa198; }
+  .document-docutils pre .name.attribute {
+    color: #93a1a1; }
+  .document-docutils pre .name.builtin {
+    color: #B58900; }
+  .document-docutils pre .name.class {
+    color: #268bd2; }
+  .document-docutils pre .name.constant {
+    color: #cb4b16; }
+  .document-docutils pre .name.decorator {
+    color: #268bd2; }
+  .document-docutils pre .name.entity {
+    color: #cb4b16; }
+  .document-docutils pre .name.exception {
+    color: #cb4b16; }
+  .document-docutils pre .name.function {
+    color: #268bd2; }
+  .document-docutils pre .name.label {
+    color: #93a1a1; }
+  .document-docutils pre .name.namespace {
+    color: #93a1a1; }
+  .document-docutils pre .name.other {
+    color: #93a1a1; }
+  .document-docutils pre .name.property {
+    color: #93a1a1; }
+  .document-docutils pre .name.tag {
+    color: #268bd2; }
+  .document-docutils pre .name.variable {
+    color: #268bd2; }
+  .document-docutils pre .operator.word {
+    color: #859900; }
+  .document-docutils pre .text.whitespace {
+    color: #93a1a1; }
+  .document-docutils pre .literal.number.float {
+    color: #2aa198; }
+  .document-docutils pre .literal.number.hex {
+    color: #2aa198; }
+  .document-docutils pre .literal.number.integer {
+    color: #2aa198; }
+  .document-docutils pre .literal.number.oct {
+    color: #2aa198; }
+  .document-docutils pre .literal.string.backtick {
+    color: #586e75; }
+  .document-docutils pre .literal.string.char {
+    color: #2aa198; }
+  .document-docutils pre .literal.string.doc {
+    color: #93a1a1; }
+  .document-docutils pre .literal.string.double {
+    color: #2aa198; }
+  .document-docutils pre .literal.string.escape {
+    color: #cb4b16; }
+  .document-docutils pre .literal.string.heredoc {
+    color: #93a1a1; }
+  .document-docutils pre .literal.string.interpol {
+    color: #2aa198; }
+  .document-docutils pre .literal.string.other {
+    color: #2aa198; }
+  .document-docutils pre .literal.string.regex {
+    color: #dc322f; }
+  .document-docutils pre .literal.string.single {
+    color: #2aa198; }
+  .document-docutils pre .literal.string.symbol {
+    color: #2aa198; }
+  .document-docutils pre .name.builtin.pseudo {
+    color: #268bd2; }
+  .document-docutils pre .name.variable.class {
+    color: #268bd2; }
+  .document-docutils pre .name.variable.global {
+    color: #268bd2; }
+  .document-docutils pre .name.variable.instance {
+    color: #268bd2; }
+  .document-docutils pre .literal.number.integer.long {
+    color: #2aa198; }
+
+.markdown blockquote {
+  margin: 0 1rem;
+  color: #6a737d;
+  border-left: 0.25rem solid #dfe2e5; }
diff --git a/roles/apps-fp-o/files/global/fedora-bootstrap-1.5.0/fedora-bootstrap.js b/roles/apps-fp-o/files/global/fedora-bootstrap-1.5.0/fedora-bootstrap.js
new file mode 100644
index 000000000..f4f23ead2
--- /dev/null
+++ b/roles/apps-fp-o/files/global/fedora-bootstrap-1.5.0/fedora-bootstrap.js
@@ -0,0 +1,7013 @@
+/*!
+  * Bootstrap v4.3.1 (https://getbootstrap.com/)
+  * Copyright 2011-2019 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors)
+  * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+  */
+(function (global, factory) {
+  typeof exports === 'object' && typeof module !== 'undefined' ? factory(exports, require('jquery')) :
+  typeof define === 'function' && define.amd ? define(['exports', 'jquery'], factory) :
+  (global = global || self, factory(global.bootstrap = {}, global.jQuery));
+}(this, function (exports, $) { 'use strict';
+
+  $ = $ && $.hasOwnProperty('default') ? $['default'] : $;
+
+  function _defineProperties(target, props) {
+    for (var i = 0; i < props.length; i++) {
+      var descriptor = props[i];
+      descriptor.enumerable = descriptor.enumerable || false;
+      descriptor.configurable = true;
+      if ("value" in descriptor) descriptor.writable = true;
+      Object.defineProperty(target, descriptor.key, descriptor);
+    }
+  }
+
+  function _createClass(Constructor, protoProps, staticProps) {
+    if (protoProps) _defineProperties(Constructor.prototype, protoProps);
+    if (staticProps) _defineProperties(Constructor, staticProps);
+    return Constructor;
+  }
+
+  function _defineProperty(obj, key, value) {
+    if (key in obj) {
+      Object.defineProperty(obj, key, {
+        value: value,
+        enumerable: true,
+        configurable: true,
+        writable: true
+      });
+    } else {
+      obj[key] = value;
+    }
+
+    return obj;
+  }
+
+  function _objectSpread(target) {
+    for (var i = 1; i < arguments.length; i++) {
+      var source = arguments[i] != null ? arguments[i] : {};
+      var ownKeys = Object.keys(source);
+
+      if (typeof Object.getOwnPropertySymbols === 'function') {
+        ownKeys = ownKeys.concat(Object.getOwnPropertySymbols(source).filter(function (sym) {
+          return Object.getOwnPropertyDescriptor(source, sym).enumerable;
+        }));
+      }
+
+      ownKeys.forEach(function (key) {
+        _defineProperty(target, key, source[key]);
+      });
+    }
+
+    return target;
+  }
+
+  function _inheritsLoose(subClass, superClass) {
+    subClass.prototype = Object.create(superClass.prototype);
+    subClass.prototype.constructor = subClass;
+    subClass.__proto__ = superClass;
+  }
+
+  /**
+   * --------------------------------------------------------------------------
+   * Bootstrap (v4.3.1): util.js
+   * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+   * --------------------------------------------------------------------------
+   */
+  /**
+   * ------------------------------------------------------------------------
+   * Private TransitionEnd Helpers
+   * ------------------------------------------------------------------------
+   */
+
+  var TRANSITION_END = 'transitionend';
+  var MAX_UID = 1000000;
+  var MILLISECONDS_MULTIPLIER = 1000; // Shoutout AngusCroll (https://goo.gl/pxwQGp)
+
+  function toType(obj) {
+    return {}.toString.call(obj).match(/\s([a-z]+)/i)[1].toLowerCase();
+  }
+
+  function getSpecialTransitionEndEvent() {
+    return {
+      bindType: TRANSITION_END,
+      delegateType: TRANSITION_END,
+      handle: function handle(event) {
+        if ($(event.target).is(this)) {
+          return event.handleObj.handler.apply(this, arguments); // eslint-disable-line prefer-rest-params
+        }
+
+        return undefined; // eslint-disable-line no-undefined
+      }
+    };
+  }
+
+  function transitionEndEmulator(duration) {
+    var _this = this;
+
+    var called = false;
+    $(this).one(Util.TRANSITION_END, function () {
+      called = true;
+    });
+    setTimeout(function () {
+      if (!called) {
+        Util.triggerTransitionEnd(_this);
+      }
+    }, duration);
+    return this;
+  }
+
+  function setTransitionEndSupport() {
+    $.fn.emulateTransitionEnd = transitionEndEmulator;
+    $.event.special[Util.TRANSITION_END] = getSpecialTransitionEndEvent();
+  }
+  /**
+   * --------------------------------------------------------------------------
+   * Public Util Api
+   * --------------------------------------------------------------------------
+   */
+
+
+  var Util = {
+    TRANSITION_END: 'bsTransitionEnd',
+    getUID: function getUID(prefix) {
+      do {
+        // eslint-disable-next-line no-bitwise
+        prefix += ~~(Math.random() * MAX_UID); // "~~" acts like a faster Math.floor() here
+      } while (document.getElementById(prefix));
+
+      return prefix;
+    },
+    getSelectorFromElement: function getSelectorFromElement(element) {
+      var selector = element.getAttribute('data-target');
+
+      if (!selector || selector === '#') {
+        var hrefAttr = element.getAttribute('href');
+        selector = hrefAttr && hrefAttr !== '#' ? hrefAttr.trim() : '';
+      }
+
+      try {
+        return document.querySelector(selector) ? selector : null;
+      } catch (err) {
+        return null;
+      }
+    },
+    getTransitionDurationFromElement: function getTransitionDurationFromElement(element) {
+      if (!element) {
+        return 0;
+      } // Get transition-duration of the element
+
+
+      var transitionDuration = $(element).css('transition-duration');
+      var transitionDelay = $(element).css('transition-delay');
+      var floatTransitionDuration = parseFloat(transitionDuration);
+      var floatTransitionDelay = parseFloat(transitionDelay); // Return 0 if element or transition duration is not found
+
+      if (!floatTransitionDuration && !floatTransitionDelay) {
+        return 0;
+      } // If multiple durations are defined, take the first
+
+
+      transitionDuration = transitionDuration.split(',')[0];
+      transitionDelay = transitionDelay.split(',')[0];
+      return (parseFloat(transitionDuration) + parseFloat(transitionDelay)) * MILLISECONDS_MULTIPLIER;
+    },
+    reflow: function reflow(element) {
+      return element.offsetHeight;
+    },
+    triggerTransitionEnd: function triggerTransitionEnd(element) {
+      $(element).trigger(TRANSITION_END);
+    },
+    // TODO: Remove in v5
+    supportsTransitionEnd: function supportsTransitionEnd() {
+      return Boolean(TRANSITION_END);
+    },
+    isElement: function isElement(obj) {
+      return (obj[0] || obj).nodeType;
+    },
+    typeCheckConfig: function typeCheckConfig(componentName, config, configTypes) {
+      for (var property in configTypes) {
+        if (Object.prototype.hasOwnProperty.call(configTypes, property)) {
+          var expectedTypes = configTypes[property];
+          var value = config[property];
+          var valueType = value && Util.isElement(value) ? 'element' : toType(value);
+
+          if (!new RegExp(expectedTypes).test(valueType)) {
+            throw new Error(componentName.toUpperCase() + ": " + ("Option \"" + property + "\" provided type \"" + valueType + "\" ") + ("but expected type \"" + expectedTypes + "\"."));
+          }
+        }
+      }
+    },
+    findShadowRoot: function findShadowRoot(element) {
+      if (!document.documentElement.attachShadow) {
+        return null;
+      } // Can find the shadow root otherwise it'll return the document
+
+
+      if (typeof element.getRootNode === 'function') {
+        var root = element.getRootNode();
+        return root instanceof ShadowRoot ? root : null;
+      }
+
+      if (element instanceof ShadowRoot) {
+        return element;
+      } // when we don't find a shadow root
+
+
+      if (!element.parentNode) {
+        return null;
+      }
+
+      return Util.findShadowRoot(element.parentNode);
+    }
+  };
+  setTransitionEndSupport();
+
+  /**
+   * ------------------------------------------------------------------------
+   * Constants
+   * ------------------------------------------------------------------------
+   */
+
+  var NAME = 'alert';
+  var VERSION = '4.3.1';
+  var DATA_KEY = 'bs.alert';
+  var EVENT_KEY = "." + DATA_KEY;
+  var DATA_API_KEY = '.data-api';
+  var JQUERY_NO_CONFLICT = $.fn[NAME];
+  var Selector = {
+    DISMISS: '[data-dismiss="alert"]'
+  };
+  var Event = {
+    CLOSE: "close" + EVENT_KEY,
+    CLOSED: "closed" + EVENT_KEY,
+    CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY
+  };
+  var ClassName = {
+    ALERT: 'alert',
+    FADE: 'fade',
+    SHOW: 'show'
+    /**
+     * ------------------------------------------------------------------------
+     * Class Definition
+     * ------------------------------------------------------------------------
+     */
+
+  };
+
+  var Alert =
+  /*#__PURE__*/
+  function () {
+    function Alert(element) {
+      this._element = element;
+    } // Getters
+
+
+    var _proto = Alert.prototype;
+
+    // Public
+    _proto.close = function close(element) {
+      var rootElement = this._element;
+
+      if (element) {
+        rootElement = this._getRootElement(element);
+      }
+
+      var customEvent = this._triggerCloseEvent(rootElement);
+
+      if (customEvent.isDefaultPrevented()) {
+        return;
+      }
+
+      this._removeElement(rootElement);
+    };
+
+    _proto.dispose = function dispose() {
+      $.removeData(this._element, DATA_KEY);
+      this._element = null;
+    } // Private
+    ;
+
+    _proto._getRootElement = function _getRootElement(element) {
+      var selector = Util.getSelectorFromElement(element);
+      var parent = false;
+
+      if (selector) {
+        parent = document.querySelector(selector);
+      }
+
+      if (!parent) {
+        parent = $(element).closest("." + ClassName.ALERT)[0];
+      }
+
+      return parent;
+    };
+
+    _proto._triggerCloseEvent = function _triggerCloseEvent(element) {
+      var closeEvent = $.Event(Event.CLOSE);
+      $(element).trigger(closeEvent);
+      return closeEvent;
+    };
+
+    _proto._removeElement = function _removeElement(element) {
+      var _this = this;
+
+      $(element).removeClass(ClassName.SHOW);
+
+      if (!$(element).hasClass(ClassName.FADE)) {
+        this._destroyElement(element);
+
+        return;
+      }
+
+      var transitionDuration = Util.getTransitionDurationFromElement(element);
+      $(element).one(Util.TRANSITION_END, function (event) {
+        return _this._destroyElement(element, event);
+      }).emulateTransitionEnd(transitionDuration);
+    };
+
+    _proto._destroyElement = function _destroyElement(element) {
+      $(element).detach().trigger(Event.CLOSED).remove();
+    } // Static
+    ;
+
+    Alert._jQueryInterface = function _jQueryInterface(config) {
+      return this.each(function () {
+        var $element = $(this);
+        var data = $element.data(DATA_KEY);
+
+        if (!data) {
+          data = new Alert(this);
+          $element.data(DATA_KEY, data);
+        }
+
+        if (config === 'close') {
+          data[config](this);
+        }
+      });
+    };
+
+    Alert._handleDismiss = function _handleDismiss(alertInstance) {
+      return function (event) {
+        if (event) {
+          event.preventDefault();
+        }
+
+        alertInstance.close(this);
+      };
+    };
+
+    _createClass(Alert, null, [{
+      key: "VERSION",
+      get: function get() {
+        return VERSION;
+      }
+    }]);
+
+    return Alert;
+  }();
+  /**
+   * ------------------------------------------------------------------------
+   * Data Api implementation
+   * ------------------------------------------------------------------------
+   */
+
+
+  $(document).on(Event.CLICK_DATA_API, Selector.DISMISS, Alert._handleDismiss(new Alert()));
+  /**
+   * ------------------------------------------------------------------------
+   * jQuery
+   * ------------------------------------------------------------------------
+   */
+
+  $.fn[NAME] = Alert._jQueryInterface;
+  $.fn[NAME].Constructor = Alert;
+
+  $.fn[NAME].noConflict = function () {
+    $.fn[NAME] = JQUERY_NO_CONFLICT;
+    return Alert._jQueryInterface;
+  };
+
+  /**
+   * ------------------------------------------------------------------------
+   * Constants
+   * ------------------------------------------------------------------------
+   */
+
+  var NAME$1 = 'button';
+  var VERSION$1 = '4.3.1';
+  var DATA_KEY$1 = 'bs.button';
+  var EVENT_KEY$1 = "." + DATA_KEY$1;
+  var DATA_API_KEY$1 = '.data-api';
+  var JQUERY_NO_CONFLICT$1 = $.fn[NAME$1];
+  var ClassName$1 = {
+    ACTIVE: 'active',
+    BUTTON: 'btn',
+    FOCUS: 'focus'
+  };
+  var Selector$1 = {
+    DATA_TOGGLE_CARROT: '[data-toggle^="button"]',
+    DATA_TOGGLE: '[data-toggle="buttons"]',
+    INPUT: 'input:not([type="hidden"])',
+    ACTIVE: '.active',
+    BUTTON: '.btn'
+  };
+  var Event$1 = {
+    CLICK_DATA_API: "click" + EVENT_KEY$1 + DATA_API_KEY$1,
+    FOCUS_BLUR_DATA_API: "focus" + EVENT_KEY$1 + DATA_API_KEY$1 + " " + ("blur" + EVENT_KEY$1 + DATA_API_KEY$1)
+    /**
+     * ------------------------------------------------------------------------
+     * Class Definition
+     * ------------------------------------------------------------------------
+     */
+
+  };
+
+  var Button =
+  /*#__PURE__*/
+  function () {
+    function Button(element) {
+      this._element = element;
+    } // Getters
+
+
+    var _proto = Button.prototype;
+
+    // Public
+    _proto.toggle = function toggle() {
+      var triggerChangeEvent = true;
+      var addAriaPressed = true;
+      var rootElement = $(this._element).closest(Selector$1.DATA_TOGGLE)[0];
+
+      if (rootElement) {
+        var input = this._element.querySelector(Selector$1.INPUT);
+
+        if (input) {
+          if (input.type === 'radio') {
+            if (input.checked && this._element.classList.contains(ClassName$1.ACTIVE)) {
+              triggerChangeEvent = false;
+            } else {
+              var activeElement = rootElement.querySelector(Selector$1.ACTIVE);
+
+              if (activeElement) {
+                $(activeElement).removeClass(ClassName$1.ACTIVE);
+              }
+            }
+          }
+
+          if (triggerChangeEvent) {
+            if (input.hasAttribute('disabled') || rootElement.hasAttribute('disabled') || input.classList.contains('disabled') || rootElement.classList.contains('disabled')) {
+              return;
+            }
+
+            input.checked = !this._element.classList.contains(ClassName$1.ACTIVE);
+            $(input).trigger('change');
+          }
+
+          input.focus();
+          addAriaPressed = false;
+        }
+      }
+
+      if (addAriaPressed) {
+        this._element.setAttribute('aria-pressed', !this._element.classList.contains(ClassName$1.ACTIVE));
+      }
+
+      if (triggerChangeEvent) {
+        $(this._element).toggleClass(ClassName$1.ACTIVE);
+      }
+    };
+
+    _proto.dispose = function dispose() {
+      $.removeData(this._element, DATA_KEY$1);
+      this._element = null;
+    } // Static
+    ;
+
+    Button._jQueryInterface = function _jQueryInterface(config) {
+      return this.each(function () {
+        var data = $(this).data(DATA_KEY$1);
+
+        if (!data) {
+          data = new Button(this);
+          $(this).data(DATA_KEY$1, data);
+        }
+
+        if (config === 'toggle') {
+          data[config]();
+        }
+      });
+    };
+
+    _createClass(Button, null, [{
+      key: "VERSION",
+      get: function get() {
+        return VERSION$1;
+      }
+    }]);
+
+    return Button;
+  }();
+  /**
+   * ------------------------------------------------------------------------
+   * Data Api implementation
+   * ------------------------------------------------------------------------
+   */
+
+
+  $(document).on(Event$1.CLICK_DATA_API, Selector$1.DATA_TOGGLE_CARROT, function (event) {
+    event.preventDefault();
+    var button = event.target;
+
+    if (!$(button).hasClass(ClassName$1.BUTTON)) {
+      button = $(button).closest(Selector$1.BUTTON);
+    }
+
+    Button._jQueryInterface.call($(button), 'toggle');
+  }).on(Event$1.FOCUS_BLUR_DATA_API, Selector$1.DATA_TOGGLE_CARROT, function (event) {
+    var button = $(event.target).closest(Selector$1.BUTTON)[0];
+    $(button).toggleClass(ClassName$1.FOCUS, /^focus(in)?$/.test(event.type));
+  });
+  /**
+   * ------------------------------------------------------------------------
+   * jQuery
+   * ------------------------------------------------------------------------
+   */
+
+  $.fn[NAME$1] = Button._jQueryInterface;
+  $.fn[NAME$1].Constructor = Button;
+
+  $.fn[NAME$1].noConflict = function () {
+    $.fn[NAME$1] = JQUERY_NO_CONFLICT$1;
+    return Button._jQueryInterface;
+  };
+
+  /**
+   * ------------------------------------------------------------------------
+   * Constants
+   * ------------------------------------------------------------------------
+   */
+
+  var NAME$2 = 'carousel';
+  var VERSION$2 = '4.3.1';
+  var DATA_KEY$2 = 'bs.carousel';
+  var EVENT_KEY$2 = "." + DATA_KEY$2;
+  var DATA_API_KEY$2 = '.data-api';
+  var JQUERY_NO_CONFLICT$2 = $.fn[NAME$2];
+  var ARROW_LEFT_KEYCODE = 37; // KeyboardEvent.which value for left arrow key
+
+  var ARROW_RIGHT_KEYCODE = 39; // KeyboardEvent.which value for right arrow key
+
+  var TOUCHEVENT_COMPAT_WAIT = 500; // Time for mouse compat events to fire after touch
+
+  var SWIPE_THRESHOLD = 40;
+  var Default = {
+    interval: 5000,
+    keyboard: true,
+    slide: false,
+    pause: 'hover',
+    wrap: true,
+    touch: true
+  };
+  var DefaultType = {
+    interval: '(number|boolean)',
+    keyboard: 'boolean',
+    slide: '(boolean|string)',
+    pause: '(string|boolean)',
+    wrap: 'boolean',
+    touch: 'boolean'
+  };
+  var Direction = {
+    NEXT: 'next',
+    PREV: 'prev',
+    LEFT: 'left',
+    RIGHT: 'right'
+  };
+  var Event$2 = {
+    SLIDE: "slide" + EVENT_KEY$2,
+    SLID: "slid" + EVENT_KEY$2,
+    KEYDOWN: "keydown" + EVENT_KEY$2,
+    MOUSEENTER: "mouseenter" + EVENT_KEY$2,
+    MOUSELEAVE: "mouseleave" + EVENT_KEY$2,
+    TOUCHSTART: "touchstart" + EVENT_KEY$2,
+    TOUCHMOVE: "touchmove" + EVENT_KEY$2,
+    TOUCHEND: "touchend" + EVENT_KEY$2,
+    POINTERDOWN: "pointerdown" + EVENT_KEY$2,
+    POINTERUP: "pointerup" + EVENT_KEY$2,
+    DRAG_START: "dragstart" + EVENT_KEY$2,
+    LOAD_DATA_API: "load" + EVENT_KEY$2 + DATA_API_KEY$2,
+    CLICK_DATA_API: "click" + EVENT_KEY$2 + DATA_API_KEY$2
+  };
+  var ClassName$2 = {
+    CAROUSEL: 'carousel',
+    ACTIVE: 'active',
+    SLIDE: 'slide',
+    RIGHT: 'carousel-item-right',
+    LEFT: 'carousel-item-left',
+    NEXT: 'carousel-item-next',
+    PREV: 'carousel-item-prev',
+    ITEM: 'carousel-item',
+    POINTER_EVENT: 'pointer-event'
+  };
+  var Selector$2 = {
+    ACTIVE: '.active',
+    ACTIVE_ITEM: '.active.carousel-item',
+    ITEM: '.carousel-item',
+    ITEM_IMG: '.carousel-item img',
+    NEXT_PREV: '.carousel-item-next, .carousel-item-prev',
+    INDICATORS: '.carousel-indicators',
+    DATA_SLIDE: '[data-slide], [data-slide-to]',
+    DATA_RIDE: '[data-ride="carousel"]'
+  };
+  var PointerType = {
+    TOUCH: 'touch',
+    PEN: 'pen'
+    /**
+     * ------------------------------------------------------------------------
+     * Class Definition
+     * ------------------------------------------------------------------------
+     */
+
+  };
+
+  var Carousel =
+  /*#__PURE__*/
+  function () {
+    function Carousel(element, config) {
+      this._items = null;
+      this._interval = null;
+      this._activeElement = null;
+      this._isPaused = false;
+      this._isSliding = false;
+      this.touchTimeout = null;
+      this.touchStartX = 0;
+      this.touchDeltaX = 0;
+      this._config = this._getConfig(config);
+      this._element = element;
+      this._indicatorsElement = this._element.querySelector(Selector$2.INDICATORS);
+      this._touchSupported = 'ontouchstart' in document.documentElement || navigator.maxTouchPoints > 0;
+      this._pointerEvent = Boolean(window.PointerEvent || window.MSPointerEvent);
+
+      this._addEventListeners();
+    } // Getters
+
+
+    var _proto = Carousel.prototype;
+
+    // Public
+    _proto.next = function next() {
+      if (!this._isSliding) {
+        this._slide(Direction.NEXT);
+      }
+    };
+
+    _proto.nextWhenVisible = function nextWhenVisible() {
+      // Don't call next when the page isn't visible
+      // or the carousel or its parent isn't visible
+      if (!document.hidden && $(this._element).is(':visible') && $(this._element).css('visibility') !== 'hidden') {
+        this.next();
+      }
+    };
+
+    _proto.prev = function prev() {
+      if (!this._isSliding) {
+        this._slide(Direction.PREV);
+      }
+    };
+
+    _proto.pause = function pause(event) {
+      if (!event) {
+        this._isPaused = true;
+      }
+
+      if (this._element.querySelector(Selector$2.NEXT_PREV)) {
+        Util.triggerTransitionEnd(this._element);
+        this.cycle(true);
+      }
+
+      clearInterval(this._interval);
+      this._interval = null;
+    };
+
+    _proto.cycle = function cycle(event) {
+      if (!event) {
+        this._isPaused = false;
+      }
+
+      if (this._interval) {
+        clearInterval(this._interval);
+        this._interval = null;
+      }
+
+      if (this._config.interval && !this._isPaused) {
+        this._interval = setInterval((document.visibilityState ? this.nextWhenVisible : this.next).bind(this), this._config.interval);
+      }
+    };
+
+    _proto.to = function to(index) {
+      var _this = this;
+
+      this._activeElement = this._element.querySelector(Selector$2.ACTIVE_ITEM);
+
+      var activeIndex = this._getItemIndex(this._activeElement);
+
+      if (index > this._items.length - 1 || index < 0) {
+        return;
+      }
+
+      if (this._isSliding) {
+        $(this._element).one(Event$2.SLID, function () {
+          return _this.to(index);
+        });
+        return;
+      }
+
+      if (activeIndex === index) {
+        this.pause();
+        this.cycle();
+        return;
+      }
+
+      var direction = index > activeIndex ? Direction.NEXT : Direction.PREV;
+
+      this._slide(direction, this._items[index]);
+    };
+
+    _proto.dispose = function dispose() {
+      $(this._element).off(EVENT_KEY$2);
+      $.removeData(this._element, DATA_KEY$2);
+      this._items = null;
+      this._config = null;
+      this._element = null;
+      this._interval = null;
+      this._isPaused = null;
+      this._isSliding = null;
+      this._activeElement = null;
+      this._indicatorsElement = null;
+    } // Private
+    ;
+
+    _proto._getConfig = function _getConfig(config) {
+      config = _objectSpread({}, Default, config);
+      Util.typeCheckConfig(NAME$2, config, DefaultType);
+      return config;
+    };
+
+    _proto._handleSwipe = function _handleSwipe() {
+      var absDeltax = Math.abs(this.touchDeltaX);
+
+      if (absDeltax <= SWIPE_THRESHOLD) {
+        return;
+      }
+
+      var direction = absDeltax / this.touchDeltaX; // swipe left
+
+      if (direction > 0) {
+        this.prev();
+      } // swipe right
+
+
+      if (direction < 0) {
+        this.next();
+      }
+    };
+
+    _proto._addEventListeners = function _addEventListeners() {
+      var _this2 = this;
+
+      if (this._config.keyboard) {
+        $(this._element).on(Event$2.KEYDOWN, function (event) {
+          return _this2._keydown(event);
+        });
+      }
+
+      if (this._config.pause === 'hover') {
+        $(this._element).on(Event$2.MOUSEENTER, function (event) {
+          return _this2.pause(event);
+        }).on(Event$2.MOUSELEAVE, function (event) {
+          return _this2.cycle(event);
+        });
+      }
+
+      if (this._config.touch) {
+        this._addTouchEventListeners();
+      }
+    };
+
+    _proto._addTouchEventListeners = function _addTouchEventListeners() {
+      var _this3 = this;
+
+      if (!this._touchSupported) {
+        return;
+      }
+
+      var start = function start(event) {
+        if (_this3._pointerEvent && PointerType[event.originalEvent.pointerType.toUpperCase()]) {
+          _this3.touchStartX = event.originalEvent.clientX;
+        } else if (!_this3._pointerEvent) {
+          _this3.touchStartX = event.originalEvent.touches[0].clientX;
+        }
+      };
+
+      var move = function move(event) {
+        // ensure swiping with one touch and not pinching
+        if (event.originalEvent.touches && event.originalEvent.touches.length > 1) {
+          _this3.touchDeltaX = 0;
+        } else {
+          _this3.touchDeltaX = event.originalEvent.touches[0].clientX - _this3.touchStartX;
+        }
+      };
+
+      var end = function end(event) {
+        if (_this3._pointerEvent && PointerType[event.originalEvent.pointerType.toUpperCase()]) {
+          _this3.touchDeltaX = event.originalEvent.clientX - _this3.touchStartX;
+        }
+
+        _this3._handleSwipe();
+
+        if (_this3._config.pause === 'hover') {
+          // If it's a touch-enabled device, mouseenter/leave are fired as
+          // part of the mouse compatibility events on first tap - the carousel
+          // would stop cycling until user tapped out of it;
+          // here, we listen for touchend, explicitly pause the carousel
+          // (as if it's the second time we tap on it, mouseenter compat event
+          // is NOT fired) and after a timeout (to allow for mouse compatibility
+          // events to fire) we explicitly restart cycling
+          _this3.pause();
+
+          if (_this3.touchTimeout) {
+            clearTimeout(_this3.touchTimeout);
+          }
+
+          _this3.touchTimeout = setTimeout(function (event) {
+            return _this3.cycle(event);
+          }, TOUCHEVENT_COMPAT_WAIT + _this3._config.interval);
+        }
+      };
+
+      $(this._element.querySelectorAll(Selector$2.ITEM_IMG)).on(Event$2.DRAG_START, function (e) {
+        return e.preventDefault();
+      });
+
+      if (this._pointerEvent) {
+        $(this._element).on(Event$2.POINTERDOWN, function (event) {
+          return start(event);
+        });
+        $(this._element).on(Event$2.POINTERUP, function (event) {
+          return end(event);
+        });
+
+        this._element.classList.add(ClassName$2.POINTER_EVENT);
+      } else {
+        $(this._element).on(Event$2.TOUCHSTART, function (event) {
+          return start(event);
+        });
+        $(this._element).on(Event$2.TOUCHMOVE, function (event) {
+          return move(event);
+        });
+        $(this._element).on(Event$2.TOUCHEND, function (event) {
+          return end(event);
+        });
+      }
+    };
+
+    _proto._keydown = function _keydown(event) {
+      if (/input|textarea/i.test(event.target.tagName)) {
+        return;
+      }
+
+      switch (event.which) {
+        case ARROW_LEFT_KEYCODE:
+          event.preventDefault();
+          this.prev();
+          break;
+
+        case ARROW_RIGHT_KEYCODE:
+          event.preventDefault();
+          this.next();
+          break;
+
+        default:
+      }
+    };
+
+    _proto._getItemIndex = function _getItemIndex(element) {
+      this._items = element && element.parentNode ? [].slice.call(element.parentNode.querySelectorAll(Selector$2.ITEM)) : [];
+      return this._items.indexOf(element);
+    };
+
+    _proto._getItemByDirection = function _getItemByDirection(direction, activeElement) {
+      var isNextDirection = direction === Direction.NEXT;
+      var isPrevDirection = direction === Direction.PREV;
+
+      var activeIndex = this._getItemIndex(activeElement);
+
+      var lastItemIndex = this._items.length - 1;
+      var isGoingToWrap = isPrevDirection && activeIndex === 0 || isNextDirection && activeIndex === lastItemIndex;
+
+      if (isGoingToWrap && !this._config.wrap) {
+        return activeElement;
+      }
+
+      var delta = direction === Direction.PREV ? -1 : 1;
+      var itemIndex = (activeIndex + delta) % this._items.length;
+      return itemIndex === -1 ? this._items[this._items.length - 1] : this._items[itemIndex];
+    };
+
+    _proto._triggerSlideEvent = function _triggerSlideEvent(relatedTarget, eventDirectionName) {
+      var targetIndex = this._getItemIndex(relatedTarget);
+
+      var fromIndex = this._getItemIndex(this._element.querySelector(Selector$2.ACTIVE_ITEM));
+
+      var slideEvent = $.Event(Event$2.SLIDE, {
+        relatedTarget: relatedTarget,
+        direction: eventDirectionName,
+        from: fromIndex,
+        to: targetIndex
+      });
+      $(this._element).trigger(slideEvent);
+      return slideEvent;
+    };
+
+    _proto._setActiveIndicatorElement = function _setActiveIndicatorElement(element) {
+      if (this._indicatorsElement) {
+        var indicators = [].slice.call(this._indicatorsElement.querySelectorAll(Selector$2.ACTIVE));
+        $(indicators).removeClass(ClassName$2.ACTIVE);
+
+        var nextIndicator = this._indicatorsElement.children[this._getItemIndex(element)];
+
+        if (nextIndicator) {
+          $(nextIndicator).addClass(ClassName$2.ACTIVE);
+        }
+      }
+    };
+
+    _proto._slide = function _slide(direction, element) {
+      var _this4 = this;
+
+      var activeElement = this._element.querySelector(Selector$2.ACTIVE_ITEM);
+
+      var activeElementIndex = this._getItemIndex(activeElement);
+
+      var nextElement = element || activeElement && this._getItemByDirection(direction, activeElement);
+
+      var nextElementIndex = this._getItemIndex(nextElement);
+
+      var isCycling = Boolean(this._interval);
+      var directionalClassName;
+      var orderClassName;
+      var eventDirectionName;
+
+      if (direction === Direction.NEXT) {
+        directionalClassName = ClassName$2.LEFT;
+        orderClassName = ClassName$2.NEXT;
+        eventDirectionName = Direction.LEFT;
+      } else {
+        directionalClassName = ClassName$2.RIGHT;
+        orderClassName = ClassName$2.PREV;
+        eventDirectionName = Direction.RIGHT;
+      }
+
+      if (nextElement && $(nextElement).hasClass(ClassName$2.ACTIVE)) {
+        this._isSliding = false;
+        return;
+      }
+
+      var slideEvent = this._triggerSlideEvent(nextElement, eventDirectionName);
+
+      if (slideEvent.isDefaultPrevented()) {
+        return;
+      }
+
+      if (!activeElement || !nextElement) {
+        // Some weirdness is happening, so we bail
+        return;
+      }
+
+      this._isSliding = true;
+
+      if (isCycling) {
+        this.pause();
+      }
+
+      this._setActiveIndicatorElement(nextElement);
+
+      var slidEvent = $.Event(Event$2.SLID, {
+        relatedTarget: nextElement,
+        direction: eventDirectionName,
+        from: activeElementIndex,
+        to: nextElementIndex
+      });
+
+      if ($(this._element).hasClass(ClassName$2.SLIDE)) {
+        $(nextElement).addClass(orderClassName);
+        Util.reflow(nextElement);
+        $(activeElement).addClass(directionalClassName);
+        $(nextElement).addClass(directionalClassName);
+        var nextElementInterval = parseInt(nextElement.getAttribute('data-interval'), 10);
+
+        if (nextElementInterval) {
+          this._config.defaultInterval = this._config.defaultInterval || this._config.interval;
+          this._config.interval = nextElementInterval;
+        } else {
+          this._config.interval = this._config.defaultInterval || this._config.interval;
+        }
+
+        var transitionDuration = Util.getTransitionDurationFromElement(activeElement);
+        $(activeElement).one(Util.TRANSITION_END, function () {
+          $(nextElement).removeClass(directionalClassName + " " + orderClassName).addClass(ClassName$2.ACTIVE);
+          $(activeElement).removeClass(ClassName$2.ACTIVE + " " + orderClassName + " " + directionalClassName);
+          _this4._isSliding = false;
+          setTimeout(function () {
+            return $(_this4._element).trigger(slidEvent);
+          }, 0);
+        }).emulateTransitionEnd(transitionDuration);
+      } else {
+        $(activeElement).removeClass(ClassName$2.ACTIVE);
+        $(nextElement).addClass(ClassName$2.ACTIVE);
+        this._isSliding = false;
+        $(this._element).trigger(slidEvent);
+      }
+
+      if (isCycling) {
+        this.cycle();
+      }
+    } // Static
+    ;
+
+    Carousel._jQueryInterface = function _jQueryInterface(config) {
+      return this.each(function () {
+        var data = $(this).data(DATA_KEY$2);
+
+        var _config = _objectSpread({}, Default, $(this).data());
+
+        if (typeof config === 'object') {
+          _config = _objectSpread({}, _config, config);
+        }
+
+        var action = typeof config === 'string' ? config : _config.slide;
+
+        if (!data) {
+          data = new Carousel(this, _config);
+          $(this).data(DATA_KEY$2, data);
+        }
+
+        if (typeof config === 'number') {
+          data.to(config);
+        } else if (typeof action === 'string') {
+          if (typeof data[action] === 'undefined') {
+            throw new TypeError("No method named \"" + action + "\"");
+          }
+
+          data[action]();
+        } else if (_config.interval && _config.ride) {
+          data.pause();
+          data.cycle();
+        }
+      });
+    };
+
+    Carousel._dataApiClickHandler = function _dataApiClickHandler(event) {
+      var selector = Util.getSelectorFromElement(this);
+
+      if (!selector) {
+        return;
+      }
+
+      var target = $(selector)[0];
+
+      if (!target || !$(target).hasClass(ClassName$2.CAROUSEL)) {
+        return;
+      }
+
+      var config = _objectSpread({}, $(target).data(), $(this).data());
+
+      var slideIndex = this.getAttribute('data-slide-to');
+
+      if (slideIndex) {
+        config.interval = false;
+      }
+
+      Carousel._jQueryInterface.call($(target), config);
+
+      if (slideIndex) {
+        $(target).data(DATA_KEY$2).to(slideIndex);
+      }
+
+      event.preventDefault();
+    };
+
+    _createClass(Carousel, null, [{
+      key: "VERSION",
+      get: function get() {
+        return VERSION$2;
+      }
+    }, {
+      key: "Default",
+      get: function get() {
+        return Default;
+      }
+    }]);
+
+    return Carousel;
+  }();
+  /**
+   * ------------------------------------------------------------------------
+   * Data Api implementation
+   * ------------------------------------------------------------------------
+   */
+
+
+  $(document).on(Event$2.CLICK_DATA_API, Selector$2.DATA_SLIDE, Carousel._dataApiClickHandler);
+  $(window).on(Event$2.LOAD_DATA_API, function () {
+    var carousels = [].slice.call(document.querySelectorAll(Selector$2.DATA_RIDE));
+
+    for (var i = 0, len = carousels.length; i < len; i++) {
+      var $carousel = $(carousels[i]);
+
+      Carousel._jQueryInterface.call($carousel, $carousel.data());
+    }
+  });
+  /**
+   * ------------------------------------------------------------------------
+   * jQuery
+   * ------------------------------------------------------------------------
+   */
+
+  $.fn[NAME$2] = Carousel._jQueryInterface;
+  $.fn[NAME$2].Constructor = Carousel;
+
+  $.fn[NAME$2].noConflict = function () {
+    $.fn[NAME$2] = JQUERY_NO_CONFLICT$2;
+    return Carousel._jQueryInterface;
+  };
+
+  /**
+   * ------------------------------------------------------------------------
+   * Constants
+   * ------------------------------------------------------------------------
+   */
+
+  var NAME$3 = 'collapse';
+  var VERSION$3 = '4.3.1';
+  var DATA_KEY$3 = 'bs.collapse';
+  var EVENT_KEY$3 = "." + DATA_KEY$3;
+  var DATA_API_KEY$3 = '.data-api';
+  var JQUERY_NO_CONFLICT$3 = $.fn[NAME$3];
+  var Default$1 = {
+    toggle: true,
+    parent: ''
+  };
+  var DefaultType$1 = {
+    toggle: 'boolean',
+    parent: '(string|element)'
+  };
+  var Event$3 = {
+    SHOW: "show" + EVENT_KEY$3,
+    SHOWN: "shown" + EVENT_KEY$3,
+    HIDE: "hide" + EVENT_KEY$3,
+    HIDDEN: "hidden" + EVENT_KEY$3,
+    CLICK_DATA_API: "click" + EVENT_KEY$3 + DATA_API_KEY$3
+  };
+  var ClassName$3 = {
+    SHOW: 'show',
+    COLLAPSE: 'collapse',
+    COLLAPSING: 'collapsing',
+    COLLAPSED: 'collapsed'
+  };
+  var Dimension = {
+    WIDTH: 'width',
+    HEIGHT: 'height'
+  };
+  var Selector$3 = {
+    ACTIVES: '.show, .collapsing',
+    DATA_TOGGLE: '[data-toggle="collapse"]'
+    /**
+     * ------------------------------------------------------------------------
+     * Class Definition
+     * ------------------------------------------------------------------------
+     */
+
+  };
+
+  var Collapse =
+  /*#__PURE__*/
+  function () {
+    function Collapse(element, config) {
+      this._isTransitioning = false;
+      this._element = element;
+      this._config = this._getConfig(config);
+      this._triggerArray = [].slice.call(document.querySelectorAll("[data-toggle=\"collapse\"][href=\"#" + element.id + "\"]," + ("[data-toggle=\"collapse\"][data-target=\"#" + element.id + "\"]")));
+      var toggleList = [].slice.call(document.querySelectorAll(Selector$3.DATA_TOGGLE));
+
+      for (var i = 0, len = toggleList.length; i < len; i++) {
+        var elem = toggleList[i];
+        var selector = Util.getSelectorFromElement(elem);
+        var filterElement = [].slice.call(document.querySelectorAll(selector)).filter(function (foundElem) {
+          return foundElem === element;
+        });
+
+        if (selector !== null && filterElement.length > 0) {
+          this._selector = selector;
+
+          this._triggerArray.push(elem);
+        }
+      }
+
+      this._parent = this._config.parent ? this._getParent() : null;
+
+      if (!this._config.parent) {
+        this._addAriaAndCollapsedClass(this._element, this._triggerArray);
+      }
+
+      if (this._config.toggle) {
+        this.toggle();
+      }
+    } // Getters
+
+
+    var _proto = Collapse.prototype;
+
+    // Public
+    _proto.toggle = function toggle() {
+      if ($(this._element).hasClass(ClassName$3.SHOW)) {
+        this.hide();
+      } else {
+        this.show();
+      }
+    };
+
+    _proto.show = function show() {
+      var _this = this;
+
+      if (this._isTransitioning || $(this._element).hasClass(ClassName$3.SHOW)) {
+        return;
+      }
+
+      var actives;
+      var activesData;
+
+      if (this._parent) {
+        actives = [].slice.call(this._parent.querySelectorAll(Selector$3.ACTIVES)).filter(function (elem) {
+          if (typeof _this._config.parent === 'string') {
+            return elem.getAttribute('data-parent') === _this._config.parent;
+          }
+
+          return elem.classList.contains(ClassName$3.COLLAPSE);
+        });
+
+        if (actives.length === 0) {
+          actives = null;
+        }
+      }
+
+      if (actives) {
+        activesData = $(actives).not(this._selector).data(DATA_KEY$3);
+
+        if (activesData && activesData._isTransitioning) {
+          return;
+        }
+      }
+
+      var startEvent = $.Event(Event$3.SHOW);
+      $(this._element).trigger(startEvent);
+
+      if (startEvent.isDefaultPrevented()) {
+        return;
+      }
+
+      if (actives) {
+        Collapse._jQueryInterface.call($(actives).not(this._selector), 'hide');
+
+        if (!activesData) {
+          $(actives).data(DATA_KEY$3, null);
+        }
+      }
+
+      var dimension = this._getDimension();
+
+      $(this._element).removeClass(ClassName$3.COLLAPSE).addClass(ClassName$3.COLLAPSING);
+      this._element.style[dimension] = 0;
+
+      if (this._triggerArray.length) {
+        $(this._triggerArray).removeClass(ClassName$3.COLLAPSED).attr('aria-expanded', true);
+      }
+
+      this.setTransitioning(true);
+
+      var complete = function complete() {
+        $(_this._element).removeClass(ClassName$3.COLLAPSING).addClass(ClassName$3.COLLAPSE).addClass(ClassName$3.SHOW);
+        _this._element.style[dimension] = '';
+
+        _this.setTransitioning(false);
+
+        $(_this._element).trigger(Event$3.SHOWN);
+      };
+
+      var capitalizedDimension = dimension[0].toUpperCase() + dimension.slice(1);
+      var scrollSize = "scroll" + capitalizedDimension;
+      var transitionDuration = Util.getTransitionDurationFromElement(this._element);
+      $(this._element).one(Util.TRANSITION_END, complete).emulateTransitionEnd(transitionDuration);
+      this._element.style[dimension] = this._element[scrollSize] + "px";
+    };
+
+    _proto.hide = function hide() {
+      var _this2 = this;
+
+      if (this._isTransitioning || !$(this._element).hasClass(ClassName$3.SHOW)) {
+        return;
+      }
+
+      var startEvent = $.Event(Event$3.HIDE);
+      $(this._element).trigger(startEvent);
+
+      if (startEvent.isDefaultPrevented()) {
+        return;
+      }
+
+      var dimension = this._getDimension();
+
+      this._element.style[dimension] = this._element.getBoundingClientRect()[dimension] + "px";
+      Util.reflow(this._element);
+      $(this._element).addClass(ClassName$3.COLLAPSING).removeClass(ClassName$3.COLLAPSE).removeClass(ClassName$3.SHOW);
+      var triggerArrayLength = this._triggerArray.length;
+
+      if (triggerArrayLength > 0) {
+        for (var i = 0; i < triggerArrayLength; i++) {
+          var trigger = this._triggerArray[i];
+          var selector = Util.getSelectorFromElement(trigger);
+
+          if (selector !== null) {
+            var $elem = $([].slice.call(document.querySelectorAll(selector)));
+
+            if (!$elem.hasClass(ClassName$3.SHOW)) {
+              $(trigger).addClass(ClassName$3.COLLAPSED).attr('aria-expanded', false);
+            }
+          }
+        }
+      }
+
+      this.setTransitioning(true);
+
+      var complete = function complete() {
+        _this2.setTransitioning(false);
+
+        $(_this2._element).removeClass(ClassName$3.COLLAPSING).addClass(ClassName$3.COLLAPSE).trigger(Event$3.HIDDEN);
+      };
+
+      this._element.style[dimension] = '';
+      var transitionDuration = Util.getTransitionDurationFromElement(this._element);
+      $(this._element).one(Util.TRANSITION_END, complete).emulateTransitionEnd(transitionDuration);
+    };
+
+    _proto.setTransitioning = function setTransitioning(isTransitioning) {
+      this._isTransitioning = isTransitioning;
+    };
+
+    _proto.dispose = function dispose() {
+      $.removeData(this._element, DATA_KEY$3);
+      this._config = null;
+      this._parent = null;
+      this._element = null;
+      this._triggerArray = null;
+      this._isTransitioning = null;
+    } // Private
+    ;
+
+    _proto._getConfig = function _getConfig(config) {
+      config = _objectSpread({}, Default$1, config);
+      config.toggle = Boolean(config.toggle); // Coerce string values
+
+      Util.typeCheckConfig(NAME$3, config, DefaultType$1);
+      return config;
+    };
+
+    _proto._getDimension = function _getDimension() {
+      var hasWidth = $(this._element).hasClass(Dimension.WIDTH);
+      return hasWidth ? Dimension.WIDTH : Dimension.HEIGHT;
+    };
+
+    _proto._getParent = function _getParent() {
+      var _this3 = this;
+
+      var parent;
+
+      if (Util.isElement(this._config.parent)) {
+        parent = this._config.parent; // It's a jQuery object
+
+        if (typeof this._config.parent.jquery !== 'undefined') {
+          parent = this._config.parent[0];
+        }
+      } else {
+        parent = document.querySelector(this._config.parent);
+      }
+
+      var selector = "[data-toggle=\"collapse\"][data-parent=\"" + this._config.parent + "\"]";
+      var children = [].slice.call(parent.querySelectorAll(selector));
+      $(children).each(function (i, element) {
+        _this3._addAriaAndCollapsedClass(Collapse._getTargetFromElement(element), [element]);
+      });
+      return parent;
+    };
+
+    _proto._addAriaAndCollapsedClass = function _addAriaAndCollapsedClass(element, triggerArray) {
+      var isOpen = $(element).hasClass(ClassName$3.SHOW);
+
+      if (triggerArray.length) {
+        $(triggerArray).toggleClass(ClassName$3.COLLAPSED, !isOpen).attr('aria-expanded', isOpen);
+      }
+    } // Static
+    ;
+
+    Collapse._getTargetFromElement = function _getTargetFromElement(element) {
+      var selector = Util.getSelectorFromElement(element);
+      return selector ? document.querySelector(selector) : null;
+    };
+
+    Collapse._jQueryInterface = function _jQueryInterface(config) {
+      return this.each(function () {
+        var $this = $(this);
+        var data = $this.data(DATA_KEY$3);
+
+        var _config = _objectSpread({}, Default$1, $this.data(), typeof config === 'object' && config ? config : {});
+
+        if (!data && _config.toggle && /show|hide/.test(config)) {
+          _config.toggle = false;
+        }
+
+        if (!data) {
+          data = new Collapse(this, _config);
+          $this.data(DATA_KEY$3, data);
+        }
+
+        if (typeof config === 'string') {
+          if (typeof data[config] === 'undefined') {
+            throw new TypeError("No method named \"" + config + "\"");
+          }
+
+          data[config]();
+        }
+      });
+    };
+
+    _createClass(Collapse, null, [{
+      key: "VERSION",
+      get: function get() {
+        return VERSION$3;
+      }
+    }, {
+      key: "Default",
+      get: function get() {
+        return Default$1;
+      }
+    }]);
+
+    return Collapse;
+  }();
+  /**
+   * ------------------------------------------------------------------------
+   * Data Api implementation
+   * ------------------------------------------------------------------------
+   */
+
+
+  $(document).on(Event$3.CLICK_DATA_API, Selector$3.DATA_TOGGLE, function (event) {
+    // preventDefault only for <a> elements (which change the URL) not inside the collapsible element
+    if (event.currentTarget.tagName === 'A') {
+      event.preventDefault();
+    }
+
+    var $trigger = $(this);
+    var selector = Util.getSelectorFromElement(this);
+    var selectors = [].slice.call(document.querySelectorAll(selector));
+    $(selectors).each(function () {
+      var $target = $(this);
+      var data = $target.data(DATA_KEY$3);
+      var config = data ? 'toggle' : $trigger.data();
+
+      Collapse._jQueryInterface.call($target, config);
+    });
+  });
+  /**
+   * ------------------------------------------------------------------------
+   * jQuery
+   * ------------------------------------------------------------------------
+   */
+
+  $.fn[NAME$3] = Collapse._jQueryInterface;
+  $.fn[NAME$3].Constructor = Collapse;
+
+  $.fn[NAME$3].noConflict = function () {
+    $.fn[NAME$3] = JQUERY_NO_CONFLICT$3;
+    return Collapse._jQueryInterface;
+  };
+
+  /**!
+   * @fileOverview Kickass library to create and place poppers near their reference elements.
+   * @version 1.14.7
+   * @license
+   * Copyright (c) 2016 Federico Zivolo and contributors
+   *
+   * Permission is hereby granted, free of charge, to any person obtaining a copy
+   * of this software and associated documentation files (the "Software"), to deal
+   * in the Software without restriction, including without limitation the rights
+   * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+   * copies of the Software, and to permit persons to whom the Software is
+   * furnished to do so, subject to the following conditions:
+   *
+   * The above copyright notice and this permission notice shall be included in all
+   * copies or substantial portions of the Software.
+   *
+   * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+   * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+   * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+   * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+   * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+   * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+   * SOFTWARE.
+   */
+  var isBrowser = typeof window !== 'undefined' && typeof document !== 'undefined';
+
+  var longerTimeoutBrowsers = ['Edge', 'Trident', 'Firefox'];
+  var timeoutDuration = 0;
+  for (var i = 0; i < longerTimeoutBrowsers.length; i += 1) {
+    if (isBrowser && navigator.userAgent.indexOf(longerTimeoutBrowsers[i]) >= 0) {
+      timeoutDuration = 1;
+      break;
+    }
+  }
+
+  function microtaskDebounce(fn) {
+    var called = false;
+    return function () {
+      if (called) {
+        return;
+      }
+      called = true;
+      window.Promise.resolve().then(function () {
+        called = false;
+        fn();
+      });
+    };
+  }
+
+  function taskDebounce(fn) {
+    var scheduled = false;
+    return function () {
+      if (!scheduled) {
+        scheduled = true;
+        setTimeout(function () {
+          scheduled = false;
+          fn();
+        }, timeoutDuration);
+      }
+    };
+  }
+
+  var supportsMicroTasks = isBrowser && window.Promise;
+
+  /**
+  * Create a debounced version of a method, that's asynchronously deferred
+  * but called in the minimum time possible.
+  *
+  * @method
+  * @memberof Popper.Utils
+  * @argument {Function} fn
+  * @returns {Function}
+  */
+  var debounce = supportsMicroTasks ? microtaskDebounce : taskDebounce;
+
+  /**
+   * Check if the given variable is a function
+   * @method
+   * @memberof Popper.Utils
+   * @argument {Any} functionToCheck - variable to check
+   * @returns {Boolean} answer to: is a function?
+   */
+  function isFunction(functionToCheck) {
+    var getType = {};
+    return functionToCheck && getType.toString.call(functionToCheck) === '[object Function]';
+  }
+
+  /**
+   * Get CSS computed property of the given element
+   * @method
+   * @memberof Popper.Utils
+   * @argument {Eement} element
+   * @argument {String} property
+   */
+  function getStyleComputedProperty(element, property) {
+    if (element.nodeType !== 1) {
+      return [];
+    }
+    // NOTE: 1 DOM access here
+    var window = element.ownerDocument.defaultView;
+    var css = window.getComputedStyle(element, null);
+    return property ? css[property] : css;
+  }
+
+  /**
+   * Returns the parentNode or the host of the element
+   * @method
+   * @memberof Popper.Utils
+   * @argument {Element} element
+   * @returns {Element} parent
+   */
+  function getParentNode(element) {
+    if (element.nodeName === 'HTML') {
+      return element;
+    }
+    return element.parentNode || element.host;
+  }
+
+  /**
+   * Returns the scrolling parent of the given element
+   * @method
+   * @memberof Popper.Utils
+   * @argument {Element} element
+   * @returns {Element} scroll parent
+   */
+  function getScrollParent(element) {
+    // Return body, `getScroll` will take care to get the correct `scrollTop` from it
+    if (!element) {
+      return document.body;
+    }
+
+    switch (element.nodeName) {
+      case 'HTML':
+      case 'BODY':
+        return element.ownerDocument.body;
+      case '#document':
+        return element.body;
+    }
+
+    // Firefox want us to check `-x` and `-y` variations as well
+
+    var _getStyleComputedProp = getStyleComputedProperty(element),
+        overflow = _getStyleComputedProp.overflow,
+        overflowX = _getStyleComputedProp.overflowX,
+        overflowY = _getStyleComputedProp.overflowY;
+
+    if (/(auto|scroll|overlay)/.test(overflow + overflowY + overflowX)) {
+      return element;
+    }
+
+    return getScrollParent(getParentNode(element));
+  }
+
+  var isIE11 = isBrowser && !!(window.MSInputMethodContext && document.documentMode);
+  var isIE10 = isBrowser && /MSIE 10/.test(navigator.userAgent);
+
+  /**
+   * Determines if the browser is Internet Explorer
+   * @method
+   * @memberof Popper.Utils
+   * @param {Number} version to check
+   * @returns {Boolean} isIE
+   */
+  function isIE(version) {
+    if (version === 11) {
+      return isIE11;
+    }
+    if (version === 10) {
+      return isIE10;
+    }
+    return isIE11 || isIE10;
+  }
+
+  /**
+   * Returns the offset parent of the given element
+   * @method
+   * @memberof Popper.Utils
+   * @argument {Element} element
+   * @returns {Element} offset parent
+   */
+  function getOffsetParent(element) {
+    if (!element) {
+      return document.documentElement;
+    }
+
+    var noOffsetParent = isIE(10) ? document.body : null;
+
+    // NOTE: 1 DOM access here
+    var offsetParent = element.offsetParent || null;
+    // Skip hidden elements which don't have an offsetParent
+    while (offsetParent === noOffsetParent && element.nextElementSibling) {
+      offsetParent = (element = element.nextElementSibling).offsetParent;
+    }
+
+    var nodeName = offsetParent && offsetParent.nodeName;
+
+    if (!nodeName || nodeName === 'BODY' || nodeName === 'HTML') {
+      return element ? element.ownerDocument.documentElement : document.documentElement;
+    }
+
+    // .offsetParent will return the closest TH, TD or TABLE in case
+    // no offsetParent is present, I hate this job...
+    if (['TH', 'TD', 'TABLE'].indexOf(offsetParent.nodeName) !== -1 && getStyleComputedProperty(offsetParent, 'position') === 'static') {
+      return getOffsetParent(offsetParent);
+    }
+
+    return offsetParent;
+  }
+
+  function isOffsetContainer(element) {
+    var nodeName = element.nodeName;
+
+    if (nodeName === 'BODY') {
+      return false;
+    }
+    return nodeName === 'HTML' || getOffsetParent(element.firstElementChild) === element;
+  }
+
+  /**
+   * Finds the root node (document, shadowDOM root) of the given element
+   * @method
+   * @memberof Popper.Utils
+   * @argument {Element} node
+   * @returns {Element} root node
+   */
+  function getRoot(node) {
+    if (node.parentNode !== null) {
+      return getRoot(node.parentNode);
+    }
+
+    return node;
+  }
+
+  /**
+   * Finds the offset parent common to the two provided nodes
+   * @method
+   * @memberof Popper.Utils
+   * @argument {Element} element1
+   * @argument {Element} element2
+   * @returns {Element} common offset parent
+   */
+  function findCommonOffsetParent(element1, element2) {
+    // This check is needed to avoid errors in case one of the elements isn't defined for any reason
+    if (!element1 || !element1.nodeType || !element2 || !element2.nodeType) {
+      return document.documentElement;
+    }
+
+    // Here we make sure to give as "start" the element that comes first in the DOM
+    var order = element1.compareDocumentPosition(element2) & Node.DOCUMENT_POSITION_FOLLOWING;
+    var start = order ? element1 : element2;
+    var end = order ? element2 : element1;
+
+    // Get common ancestor container
+    var range = document.createRange();
+    range.setStart(start, 0);
+    range.setEnd(end, 0);
+    var commonAncestorContainer = range.commonAncestorContainer;
+
+    // Both nodes are inside #document
+
+    if (element1 !== commonAncestorContainer && element2 !== commonAncestorContainer || start.contains(end)) {
+      if (isOffsetContainer(commonAncestorContainer)) {
+        return commonAncestorContainer;
+      }
+
+      return getOffsetParent(commonAncestorContainer);
+    }
+
+    // one of the nodes is inside shadowDOM, find which one
+    var element1root = getRoot(element1);
+    if (element1root.host) {
+      return findCommonOffsetParent(element1root.host, element2);
+    } else {
+      return findCommonOffsetParent(element1, getRoot(element2).host);
+    }
+  }
+
+  /**
+   * Gets the scroll value of the given element in the given side (top and left)
+   * @method
+   * @memberof Popper.Utils
+   * @argument {Element} element
+   * @argument {String} side `top` or `left`
+   * @returns {number} amount of scrolled pixels
+   */
+  function getScroll(element) {
+    var side = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 'top';
+
+    var upperSide = side === 'top' ? 'scrollTop' : 'scrollLeft';
+    var nodeName = element.nodeName;
+
+    if (nodeName === 'BODY' || nodeName === 'HTML') {
+      var html = element.ownerDocument.documentElement;
+      var scrollingElement = element.ownerDocument.scrollingElement || html;
+      return scrollingElement[upperSide];
+    }
+
+    return element[upperSide];
+  }
+
+  /*
+   * Sum or subtract the element scroll values (left and top) from a given rect object
+   * @method
+   * @memberof Popper.Utils
+   * @param {Object} rect - Rect object you want to change
+   * @param {HTMLElement} element - The element from the function reads the scroll values
+   * @param {Boolean} subtract - set to true if you want to subtract the scroll values
+   * @return {Object} rect - The modifier rect object
+   */
+  function includeScroll(rect, element) {
+    var subtract = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : false;
+
+    var scrollTop = getScroll(element, 'top');
+    var scrollLeft = getScroll(element, 'left');
+    var modifier = subtract ? -1 : 1;
+    rect.top += scrollTop * modifier;
+    rect.bottom += scrollTop * modifier;
+    rect.left += scrollLeft * modifier;
+    rect.right += scrollLeft * modifier;
+    return rect;
+  }
+
+  /*
+   * Helper to detect borders of a given element
+   * @method
+   * @memberof Popper.Utils
+   * @param {CSSStyleDeclaration} styles
+   * Result of `getStyleComputedProperty` on the given element
+   * @param {String} axis - `x` or `y`
+   * @return {number} borders - The borders size of the given axis
+   */
+
+  function getBordersSize(styles, axis) {
+    var sideA = axis === 'x' ? 'Left' : 'Top';
+    var sideB = sideA === 'Left' ? 'Right' : 'Bottom';
+
+    return parseFloat(styles['border' + sideA + 'Width'], 10) + parseFloat(styles['border' + sideB + 'Width'], 10);
+  }
+
+  function getSize(axis, body, html, computedStyle) {
+    return Math.max(body['offset' + axis], body['scroll' + axis], html['client' + axis], html['offset' + axis], html['scroll' + axis], isIE(10) ? parseInt(html['offset' + axis]) + parseInt(computedStyle['margin' + (axis === 'Height' ? 'Top' : 'Left')]) + parseInt(computedStyle['margin' + (axis === 'Height' ? 'Bottom' : 'Right')]) : 0);
+  }
+
+  function getWindowSizes(document) {
+    var body = document.body;
+    var html = document.documentElement;
+    var computedStyle = isIE(10) && getComputedStyle(html);
+
+    return {
+      height: getSize('Height', body, html, computedStyle),
+      width: getSize('Width', body, html, computedStyle)
+    };
+  }
+
+  var classCallCheck = function (instance, Constructor) {
+    if (!(instance instanceof Constructor)) {
+      throw new TypeError("Cannot call a class as a function");
+    }
+  };
+
+  var createClass = function () {
+    function defineProperties(target, props) {
+      for (var i = 0; i < props.length; i++) {
+        var descriptor = props[i];
+        descriptor.enumerable = descriptor.enumerable || false;
+        descriptor.configurable = true;
+        if ("value" in descriptor) descriptor.writable = true;
+        Object.defineProperty(target, descriptor.key, descriptor);
+      }
+    }
+
+    return function (Constructor, protoProps, staticProps) {
+      if (protoProps) defineProperties(Constructor.prototype, protoProps);
+      if (staticProps) defineProperties(Constructor, staticProps);
+      return Constructor;
+    };
+  }();
+
+
+
+
+
+  var defineProperty = function (obj, key, value) {
+    if (key in obj) {
+      Object.defineProperty(obj, key, {
+        value: value,
+        enumerable: true,
+        configurable: true,
+        writable: true
+      });
+    } else {
+      obj[key] = value;
+    }
+
+    return obj;
+  };
+
+  var _extends = Object.assign || function (target) {
+    for (var i = 1; i < arguments.length; i++) {
+      var source = arguments[i];
+
+      for (var key in source) {
+        if (Object.prototype.hasOwnProperty.call(source, key)) {
+          target[key] = source[key];
+        }
+      }
+    }
+
+    return target;
+  };
+
+  /**
+   * Given element offsets, generate an output similar to getBoundingClientRect
+   * @method
+   * @memberof Popper.Utils
+   * @argument {Object} offsets
+   * @returns {Object} ClientRect like output
+   */
+  function getClientRect(offsets) {
+    return _extends({}, offsets, {
+      right: offsets.left + offsets.width,
+      bottom: offsets.top + offsets.height
+    });
+  }
+
+  /**
+   * Get bounding client rect of given element
+   * @method
+   * @memberof Popper.Utils
+   * @param {HTMLElement} element
+   * @return {Object} client rect
+   */
+  function getBoundingClientRect(element) {
+    var rect = {};
+
+    // IE10 10 FIX: Please, don't ask, the element isn't
+    // considered in DOM in some circumstances...
+    // This isn't reproducible in IE10 compatibility mode of IE11
+    try {
+      if (isIE(10)) {
+        rect = element.getBoundingClientRect();
+        var scrollTop = getScroll(element, 'top');
+        var scrollLeft = getScroll(element, 'left');
+        rect.top += scrollTop;
+        rect.left += scrollLeft;
+        rect.bottom += scrollTop;
+        rect.right += scrollLeft;
+      } else {
+        rect = element.getBoundingClientRect();
+      }
+    } catch (e) {}
+
+    var result = {
+      left: rect.left,
+      top: rect.top,
+      width: rect.right - rect.left,
+      height: rect.bottom - rect.top
+    };
+
+    // subtract scrollbar size from sizes
+    var sizes = element.nodeName === 'HTML' ? getWindowSizes(element.ownerDocument) : {};
+    var width = sizes.width || element.clientWidth || result.right - result.left;
+    var height = sizes.height || element.clientHeight || result.bottom - result.top;
+
+    var horizScrollbar = element.offsetWidth - width;
+    var vertScrollbar = element.offsetHeight - height;
+
+    // if an hypothetical scrollbar is detected, we must be sure it's not a `border`
+    // we make this check conditional for performance reasons
+    if (horizScrollbar || vertScrollbar) {
+      var styles = getStyleComputedProperty(element);
+      horizScrollbar -= getBordersSize(styles, 'x');
+      vertScrollbar -= getBordersSize(styles, 'y');
+
+      result.width -= horizScrollbar;
+      result.height -= vertScrollbar;
+    }
+
+    return getClientRect(result);
+  }
+
+  function getOffsetRectRelativeToArbitraryNode(children, parent) {
+    var fixedPosition = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : false;
+
+    var isIE10 = isIE(10);
+    var isHTML = parent.nodeName === 'HTML';
+    var childrenRect = getBoundingClientRect(children);
+    var parentRect = getBoundingClientRect(parent);
+    var scrollParent = getScrollParent(children);
+
+    var styles = getStyleComputedProperty(parent);
+    var borderTopWidth = parseFloat(styles.borderTopWidth, 10);
+    var borderLeftWidth = parseFloat(styles.borderLeftWidth, 10);
+
+    // In cases where the parent is fixed, we must ignore negative scroll in offset calc
+    if (fixedPosition && isHTML) {
+      parentRect.top = Math.max(parentRect.top, 0);
+      parentRect.left = Math.max(parentRect.left, 0);
+    }
+    var offsets = getClientRect({
+      top: childrenRect.top - parentRect.top - borderTopWidth,
+      left: childrenRect.left - parentRect.left - borderLeftWidth,
+      width: childrenRect.width,
+      height: childrenRect.height
+    });
+    offsets.marginTop = 0;
+    offsets.marginLeft = 0;
+
+    // Subtract margins of documentElement in case it's being used as parent
+    // we do this only on HTML because it's the only element that behaves
+    // differently when margins are applied to it. The margins are included in
+    // the box of the documentElement, in the other cases not.
+    if (!isIE10 && isHTML) {
+      var marginTop = parseFloat(styles.marginTop, 10);
+      var marginLeft = parseFloat(styles.marginLeft, 10);
+
+      offsets.top -= borderTopWidth - marginTop;
+      offsets.bottom -= borderTopWidth - marginTop;
+      offsets.left -= borderLeftWidth - marginLeft;
+      offsets.right -= borderLeftWidth - marginLeft;
+
+      // Attach marginTop and marginLeft because in some circumstances we may need them
+      offsets.marginTop = marginTop;
+      offsets.marginLeft = marginLeft;
+    }
+
+    if (isIE10 && !fixedPosition ? parent.contains(scrollParent) : parent === scrollParent && scrollParent.nodeName !== 'BODY') {
+      offsets = includeScroll(offsets, parent);
+    }
+
+    return offsets;
+  }
+
+  function getViewportOffsetRectRelativeToArtbitraryNode(element) {
+    var excludeScroll = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false;
+
+    var html = element.ownerDocument.documentElement;
+    var relativeOffset = getOffsetRectRelativeToArbitraryNode(element, html);
+    var width = Math.max(html.clientWidth, window.innerWidth || 0);
+    var height = Math.max(html.clientHeight, window.innerHeight || 0);
+
+    var scrollTop = !excludeScroll ? getScroll(html) : 0;
+    var scrollLeft = !excludeScroll ? getScroll(html, 'left') : 0;
+
+    var offset = {
+      top: scrollTop - relativeOffset.top + relativeOffset.marginTop,
+      left: scrollLeft - relativeOffset.left + relativeOffset.marginLeft,
+      width: width,
+      height: height
+    };
+
+    return getClientRect(offset);
+  }
+
+  /**
+   * Check if the given element is fixed or is inside a fixed parent
+   * @method
+   * @memberof Popper.Utils
+   * @argument {Element} element
+   * @argument {Element} customContainer
+   * @returns {Boolean} answer to "isFixed?"
+   */
+  function isFixed(element) {
+    var nodeName = element.nodeName;
+    if (nodeName === 'BODY' || nodeName === 'HTML') {
+      return false;
+    }
+    if (getStyleComputedProperty(element, 'position') === 'fixed') {
+      return true;
+    }
+    var parentNode = getParentNode(element);
+    if (!parentNode) {
+      return false;
+    }
+    return isFixed(parentNode);
+  }
+
+  /**
+   * Finds the first parent of an element that has a transformed property defined
+   * @method
+   * @memberof Popper.Utils
+   * @argument {Element} element
+   * @returns {Element} first transformed parent or documentElement
+   */
+
+  function getFixedPositionOffsetParent(element) {
+    // This check is needed to avoid errors in case one of the elements isn't defined for any reason
+    if (!element || !element.parentElement || isIE()) {
+      return document.documentElement;
+    }
+    var el = element.parentElement;
+    while (el && getStyleComputedProperty(el, 'transform') === 'none') {
+      el = el.parentElement;
+    }
+    return el || document.documentElement;
+  }
+
+  /**
+   * Computed the boundaries limits and return them
+   * @method
+   * @memberof Popper.Utils
+   * @param {HTMLElement} popper
+   * @param {HTMLElement} reference
+   * @param {number} padding
+   * @param {HTMLElement} boundariesElement - Element used to define the boundaries
+   * @param {Boolean} fixedPosition - Is in fixed position mode
+   * @returns {Object} Coordinates of the boundaries
+   */
+  function getBoundaries(popper, reference, padding, boundariesElement) {
+    var fixedPosition = arguments.length > 4 && arguments[4] !== undefined ? arguments[4] : false;
+
+    // NOTE: 1 DOM access here
+
+    var boundaries = { top: 0, left: 0 };
+    var offsetParent = fixedPosition ? getFixedPositionOffsetParent(popper) : findCommonOffsetParent(popper, reference);
+
+    // Handle viewport case
+    if (boundariesElement === 'viewport') {
+      boundaries = getViewportOffsetRectRelativeToArtbitraryNode(offsetParent, fixedPosition);
+    } else {
+      // Handle other cases based on DOM element used as boundaries
+      var boundariesNode = void 0;
+      if (boundariesElement === 'scrollParent') {
+        boundariesNode = getScrollParent(getParentNode(reference));
+        if (boundariesNode.nodeName === 'BODY') {
+          boundariesNode = popper.ownerDocument.documentElement;
+        }
+      } else if (boundariesElement === 'window') {
+        boundariesNode = popper.ownerDocument.documentElement;
+      } else {
+        boundariesNode = boundariesElement;
+      }
+
+      var offsets = getOffsetRectRelativeToArbitraryNode(boundariesNode, offsetParent, fixedPosition);
+
+      // In case of HTML, we need a different computation
+      if (boundariesNode.nodeName === 'HTML' && !isFixed(offsetParent)) {
+        var _getWindowSizes = getWindowSizes(popper.ownerDocument),
+            height = _getWindowSizes.height,
+            width = _getWindowSizes.width;
+
+        boundaries.top += offsets.top - offsets.marginTop;
+        boundaries.bottom = height + offsets.top;
+        boundaries.left += offsets.left - offsets.marginLeft;
+        boundaries.right = width + offsets.left;
+      } else {
+        // for all the other DOM elements, this one is good
+        boundaries = offsets;
+      }
+    }
+
+    // Add paddings
+    padding = padding || 0;
+    var isPaddingNumber = typeof padding === 'number';
+    boundaries.left += isPaddingNumber ? padding : padding.left || 0;
+    boundaries.top += isPaddingNumber ? padding : padding.top || 0;
+    boundaries.right -= isPaddingNumber ? padding : padding.right || 0;
+    boundaries.bottom -= isPaddingNumber ? padding : padding.bottom || 0;
+
+    return boundaries;
+  }
+
+  function getArea(_ref) {
+    var width = _ref.width,
+        height = _ref.height;
+
+    return width * height;
+  }
+
+  /**
+   * Utility used to transform the `auto` placement to the placement with more
+   * available space.
+   * @method
+   * @memberof Popper.Utils
+   * @argument {Object} data - The data object generated by update method
+   * @argument {Object} options - Modifiers configuration and options
+   * @returns {Object} The data object, properly modified
+   */
+  function computeAutoPlacement(placement, refRect, popper, reference, boundariesElement) {
+    var padding = arguments.length > 5 && arguments[5] !== undefined ? arguments[5] : 0;
+
+    if (placement.indexOf('auto') === -1) {
+      return placement;
+    }
+
+    var boundaries = getBoundaries(popper, reference, padding, boundariesElement);
+
+    var rects = {
+      top: {
+        width: boundaries.width,
+        height: refRect.top - boundaries.top
+      },
+      right: {
+        width: boundaries.right - refRect.right,
+        height: boundaries.height
+      },
+      bottom: {
+        width: boundaries.width,
+        height: boundaries.bottom - refRect.bottom
+      },
+      left: {
+        width: refRect.left - boundaries.left,
+        height: boundaries.height
+      }
+    };
+
+    var sortedAreas = Object.keys(rects).map(function (key) {
+      return _extends({
+        key: key
+      }, rects[key], {
+        area: getArea(rects[key])
+      });
+    }).sort(function (a, b) {
+      return b.area - a.area;
+    });
+
+    var filteredAreas = sortedAreas.filter(function (_ref2) {
+      var width = _ref2.width,
+          height = _ref2.height;
+      return width >= popper.clientWidth && height >= popper.clientHeight;
+    });
+
+    var computedPlacement = filteredAreas.length > 0 ? filteredAreas[0].key : sortedAreas[0].key;
+
+    var variation = placement.split('-')[1];
+
+    return computedPlacement + (variation ? '-' + variation : '');
+  }
+
+  /**
+   * Get offsets to the reference element
+   * @method
+   * @memberof Popper.Utils
+   * @param {Object} state
+   * @param {Element} popper - the popper element
+   * @param {Element} reference - the reference element (the popper will be relative to this)
+   * @param {Element} fixedPosition - is in fixed position mode
+   * @returns {Object} An object containing the offsets which will be applied to the popper
+   */
+  function getReferenceOffsets(state, popper, reference) {
+    var fixedPosition = arguments.length > 3 && arguments[3] !== undefined ? arguments[3] : null;
+
+    var commonOffsetParent = fixedPosition ? getFixedPositionOffsetParent(popper) : findCommonOffsetParent(popper, reference);
+    return getOffsetRectRelativeToArbitraryNode(reference, commonOffsetParent, fixedPosition);
+  }
+
+  /**
+   * Get the outer sizes of the given element (offset size + margins)
+   * @method
+   * @memberof Popper.Utils
+   * @argument {Element} element
+   * @returns {Object} object containing width and height properties
+   */
+  function getOuterSizes(element) {
+    var window = element.ownerDocument.defaultView;
+    var styles = window.getComputedStyle(element);
+    var x = parseFloat(styles.marginTop || 0) + parseFloat(styles.marginBottom || 0);
+    var y = parseFloat(styles.marginLeft || 0) + parseFloat(styles.marginRight || 0);
+    var result = {
+      width: element.offsetWidth + y,
+      height: element.offsetHeight + x
+    };
+    return result;
+  }
+
+  /**
+   * Get the opposite placement of the given one
+   * @method
+   * @memberof Popper.Utils
+   * @argument {String} placement
+   * @returns {String} flipped placement
+   */
+  function getOppositePlacement(placement) {
+    var hash = { left: 'right', right: 'left', bottom: 'top', top: 'bottom' };
+    return placement.replace(/left|right|bottom|top/g, function (matched) {
+      return hash[matched];
+    });
+  }
+
+  /**
+   * Get offsets to the popper
+   * @method
+   * @memberof Popper.Utils
+   * @param {Object} position - CSS position the Popper will get applied
+   * @param {HTMLElement} popper - the popper element
+   * @param {Object} referenceOffsets - the reference offsets (the popper will be relative to this)
+   * @param {String} placement - one of the valid placement options
+   * @returns {Object} popperOffsets - An object containing the offsets which will be applied to the popper
+   */
+  function getPopperOffsets(popper, referenceOffsets, placement) {
+    placement = placement.split('-')[0];
+
+    // Get popper node sizes
+    var popperRect = getOuterSizes(popper);
+
+    // Add position, width and height to our offsets object
+    var popperOffsets = {
+      width: popperRect.width,
+      height: popperRect.height
+    };
+
+    // depending by the popper placement we have to compute its offsets slightly differently
+    var isHoriz = ['right', 'left'].indexOf(placement) !== -1;
+    var mainSide = isHoriz ? 'top' : 'left';
+    var secondarySide = isHoriz ? 'left' : 'top';
+    var measurement = isHoriz ? 'height' : 'width';
+    var secondaryMeasurement = !isHoriz ? 'height' : 'width';
+
+    popperOffsets[mainSide] = referenceOffsets[mainSide] + referenceOffsets[measurement] / 2 - popperRect[measurement] / 2;
+    if (placement === secondarySide) {
+      popperOffsets[secondarySide] = referenceOffsets[secondarySide] - popperRect[secondaryMeasurement];
+    } else {
+      popperOffsets[secondarySide] = referenceOffsets[getOppositePlacement(secondarySide)];
+    }
+
+    return popperOffsets;
+  }
+
+  /**
+   * Mimics the `find` method of Array
+   * @method
+   * @memberof Popper.Utils
+   * @argument {Array} arr
+   * @argument prop
+   * @argument value
+   * @returns index or -1
+   */
+  function find(arr, check) {
+    // use native find if supported
+    if (Array.prototype.find) {
+      return arr.find(check);
+    }
+
+    // use `filter` to obtain the same behavior of `find`
+    return arr.filter(check)[0];
+  }
+
+  /**
+   * Return the index of the matching object
+   * @method
+   * @memberof Popper.Utils
+   * @argument {Array} arr
+   * @argument prop
+   * @argument value
+   * @returns index or -1
+   */
+  function findIndex(arr, prop, value) {
+    // use native findIndex if supported
+    if (Array.prototype.findIndex) {
+      return arr.findIndex(function (cur) {
+        return cur[prop] === value;
+      });
+    }
+
+    // use `find` + `indexOf` if `findIndex` isn't supported
+    var match = find(arr, function (obj) {
+      return obj[prop] === value;
+    });
+    return arr.indexOf(match);
+  }
+
+  /**
+   * Loop trough the list of modifiers and run them in order,
+   * each of them will then edit the data object.
+   * @method
+   * @memberof Popper.Utils
+   * @param {dataObject} data
+   * @param {Array} modifiers
+   * @param {String} ends - Optional modifier name used as stopper
+   * @returns {dataObject}
+   */
+  function runModifiers(modifiers, data, ends) {
+    var modifiersToRun = ends === undefined ? modifiers : modifiers.slice(0, findIndex(modifiers, 'name', ends));
+
+    modifiersToRun.forEach(function (modifier) {
+      if (modifier['function']) {
+        // eslint-disable-line dot-notation
+        console.warn('`modifier.function` is deprecated, use `modifier.fn`!');
+      }
+      var fn = modifier['function'] || modifier.fn; // eslint-disable-line dot-notation
+      if (modifier.enabled && isFunction(fn)) {
+        // Add properties to offsets to make them a complete clientRect object
+        // we do this before each modifier to make sure the previous one doesn't
+        // mess with these values
+        data.offsets.popper = getClientRect(data.offsets.popper);
+        data.offsets.reference = getClientRect(data.offsets.reference);
+
+        data = fn(data, modifier);
+      }
+    });
+
+    return data;
+  }
+
+  /**
+   * Updates the position of the popper, computing the new offsets and applying
+   * the new style.<br />
+   * Prefer `scheduleUpdate` over `update` because of performance reasons.
+   * @method
+   * @memberof Popper
+   */
+  function update() {
+    // if popper is destroyed, don't perform any further update
+    if (this.state.isDestroyed) {
+      return;
+    }
+
+    var data = {
+      instance: this,
+      styles: {},
+      arrowStyles: {},
+      attributes: {},
+      flipped: false,
+      offsets: {}
+    };
+
+    // compute reference element offsets
+    data.offsets.reference = getReferenceOffsets(this.state, this.popper, this.reference, this.options.positionFixed);
+
+    // compute auto placement, store placement inside the data object,
+    // modifiers will be able to edit `placement` if needed
+    // and refer to originalPlacement to know the original value
+    data.placement = computeAutoPlacement(this.options.placement, data.offsets.reference, this.popper, this.reference, this.options.modifiers.flip.boundariesElement, this.options.modifiers.flip.padding);
+
+    // store the computed placement inside `originalPlacement`
+    data.originalPlacement = data.placement;
+
+    data.positionFixed = this.options.positionFixed;
+
+    // compute the popper offsets
+    data.offsets.popper = getPopperOffsets(this.popper, data.offsets.reference, data.placement);
+
+    data.offsets.popper.position = this.options.positionFixed ? 'fixed' : 'absolute';
+
+    // run the modifiers
+    data = runModifiers(this.modifiers, data);
+
+    // the first `update` will call `onCreate` callback
+    // the other ones will call `onUpdate` callback
+    if (!this.state.isCreated) {
+      this.state.isCreated = true;
+      this.options.onCreate(data);
+    } else {
+      this.options.onUpdate(data);
+    }
+  }
+
+  /**
+   * Helper used to know if the given modifier is enabled.
+   * @method
+   * @memberof Popper.Utils
+   * @returns {Boolean}
+   */
+  function isModifierEnabled(modifiers, modifierName) {
+    return modifiers.some(function (_ref) {
+      var name = _ref.name,
+          enabled = _ref.enabled;
+      return enabled && name === modifierName;
+    });
+  }
+
+  /**
+   * Get the prefixed supported property name
+   * @method
+   * @memberof Popper.Utils
+   * @argument {String} property (camelCase)
+   * @returns {String} prefixed property (camelCase or PascalCase, depending on the vendor prefix)
+   */
+  function getSupportedPropertyName(property) {
+    var prefixes = [false, 'ms', 'Webkit', 'Moz', 'O'];
+    var upperProp = property.charAt(0).toUpperCase() + property.slice(1);
+
+    for (var i = 0; i < prefixes.length; i++) {
+      var prefix = prefixes[i];
+      var toCheck = prefix ? '' + prefix + upperProp : property;
+      if (typeof document.body.style[toCheck] !== 'undefined') {
+        return toCheck;
+      }
+    }
+    return null;
+  }
+
+  /**
+   * Destroys the popper.
+   * @method
+   * @memberof Popper
+   */
+  function destroy() {
+    this.state.isDestroyed = true;
+
+    // touch DOM only if `applyStyle` modifier is enabled
+    if (isModifierEnabled(this.modifiers, 'applyStyle')) {
+      this.popper.removeAttribute('x-placement');
+      this.popper.style.position = '';
+      this.popper.style.top = '';
+      this.popper.style.left = '';
+      this.popper.style.right = '';
+      this.popper.style.bottom = '';
+      this.popper.style.willChange = '';
+      this.popper.style[getSupportedPropertyName('transform')] = '';
+    }
+
+    this.disableEventListeners();
+
+    // remove the popper if user explicity asked for the deletion on destroy
+    // do not use `remove` because IE11 doesn't support it
+    if (this.options.removeOnDestroy) {
+      this.popper.parentNode.removeChild(this.popper);
+    }
+    return this;
+  }
+
+  /**
+   * Get the window associated with the element
+   * @argument {Element} element
+   * @returns {Window}
+   */
+  function getWindow(element) {
+    var ownerDocument = element.ownerDocument;
+    return ownerDocument ? ownerDocument.defaultView : window;
+  }
+
+  function attachToScrollParents(scrollParent, event, callback, scrollParents) {
+    var isBody = scrollParent.nodeName === 'BODY';
+    var target = isBody ? scrollParent.ownerDocument.defaultView : scrollParent;
+    target.addEventListener(event, callback, { passive: true });
+
+    if (!isBody) {
+      attachToScrollParents(getScrollParent(target.parentNode), event, callback, scrollParents);
+    }
+    scrollParents.push(target);
+  }
+
+  /**
+   * Setup needed event listeners used to update the popper position
+   * @method
+   * @memberof Popper.Utils
+   * @private
+   */
+  function setupEventListeners(reference, options, state, updateBound) {
+    // Resize event listener on window
+    state.updateBound = updateBound;
+    getWindow(reference).addEventListener('resize', state.updateBound, { passive: true });
+
+    // Scroll event listener on scroll parents
+    var scrollElement = getScrollParent(reference);
+    attachToScrollParents(scrollElement, 'scroll', state.updateBound, state.scrollParents);
+    state.scrollElement = scrollElement;
+    state.eventsEnabled = true;
+
+    return state;
+  }
+
+  /**
+   * It will add resize/scroll events and start recalculating
+   * position of the popper element when they are triggered.
+   * @method
+   * @memberof Popper
+   */
+  function enableEventListeners() {
+    if (!this.state.eventsEnabled) {
+      this.state = setupEventListeners(this.reference, this.options, this.state, this.scheduleUpdate);
+    }
+  }
+
+  /**
+   * Remove event listeners used to update the popper position
+   * @method
+   * @memberof Popper.Utils
+   * @private
+   */
+  function removeEventListeners(reference, state) {
+    // Remove resize event listener on window
+    getWindow(reference).removeEventListener('resize', state.updateBound);
+
+    // Remove scroll event listener on scroll parents
+    state.scrollParents.forEach(function (target) {
+      target.removeEventListener('scroll', state.updateBound);
+    });
+
+    // Reset state
+    state.updateBound = null;
+    state.scrollParents = [];
+    state.scrollElement = null;
+    state.eventsEnabled = false;
+    return state;
+  }
+
+  /**
+   * It will remove resize/scroll events and won't recalculate popper position
+   * when they are triggered. It also won't trigger `onUpdate` callback anymore,
+   * unless you call `update` method manually.
+   * @method
+   * @memberof Popper
+   */
+  function disableEventListeners() {
+    if (this.state.eventsEnabled) {
+      cancelAnimationFrame(this.scheduleUpdate);
+      this.state = removeEventListeners(this.reference, this.state);
+    }
+  }
+
+  /**
+   * Tells if a given input is a number
+   * @method
+   * @memberof Popper.Utils
+   * @param {*} input to check
+   * @return {Boolean}
+   */
+  function isNumeric(n) {
+    return n !== '' && !isNaN(parseFloat(n)) && isFinite(n);
+  }
+
+  /**
+   * Set the style to the given popper
+   * @method
+   * @memberof Popper.Utils
+   * @argument {Element} element - Element to apply the style to
+   * @argument {Object} styles
+   * Object with a list of properties and values which will be applied to the element
+   */
+  function setStyles(element, styles) {
+    Object.keys(styles).forEach(function (prop) {
+      var unit = '';
+      // add unit if the value is numeric and is one of the following
+      if (['width', 'height', 'top', 'right', 'bottom', 'left'].indexOf(prop) !== -1 && isNumeric(styles[prop])) {
+        unit = 'px';
+      }
+      element.style[prop] = styles[prop] + unit;
+    });
+  }
+
+  /**
+   * Set the attributes to the given popper
+   * @method
+   * @memberof Popper.Utils
+   * @argument {Element} element - Element to apply the attributes to
+   * @argument {Object} styles
+   * Object with a list of properties and values which will be applied to the element
+   */
+  function setAttributes(element, attributes) {
+    Object.keys(attributes).forEach(function (prop) {
+      var value = attributes[prop];
+      if (value !== false) {
+        element.setAttribute(prop, attributes[prop]);
+      } else {
+        element.removeAttribute(prop);
+      }
+    });
+  }
+
+  /**
+   * @function
+   * @memberof Modifiers
+   * @argument {Object} data - The data object generated by `update` method
+   * @argument {Object} data.styles - List of style properties - values to apply to popper element
+   * @argument {Object} data.attributes - List of attribute properties - values to apply to popper element
+   * @argument {Object} options - Modifiers configuration and options
+   * @returns {Object} The same data object
+   */
+  function applyStyle(data) {
+    // any property present in `data.styles` will be applied to the popper,
+    // in this way we can make the 3rd party modifiers add custom styles to it
+    // Be aware, modifiers could override the properties defined in the previous
+    // lines of this modifier!
+    setStyles(data.instance.popper, data.styles);
+
+    // any property present in `data.attributes` will be applied to the popper,
+    // they will be set as HTML attributes of the element
+    setAttributes(data.instance.popper, data.attributes);
+
+    // if arrowElement is defined and arrowStyles has some properties
+    if (data.arrowElement && Object.keys(data.arrowStyles).length) {
+      setStyles(data.arrowElement, data.arrowStyles);
+    }
+
+    return data;
+  }
+
+  /**
+   * Set the x-placement attribute before everything else because it could be used
+   * to add margins to the popper margins needs to be calculated to get the
+   * correct popper offsets.
+   * @method
+   * @memberof Popper.modifiers
+   * @param {HTMLElement} reference - The reference element used to position the popper
+   * @param {HTMLElement} popper - The HTML element used as popper
+   * @param {Object} options - Popper.js options
+   */
+  function applyStyleOnLoad(reference, popper, options, modifierOptions, state) {
+    // compute reference element offsets
+    var referenceOffsets = getReferenceOffsets(state, popper, reference, options.positionFixed);
+
+    // compute auto placement, store placement inside the data object,
+    // modifiers will be able to edit `placement` if needed
+    // and refer to originalPlacement to know the original value
+    var placement = computeAutoPlacement(options.placement, referenceOffsets, popper, reference, options.modifiers.flip.boundariesElement, options.modifiers.flip.padding);
+
+    popper.setAttribute('x-placement', placement);
+
+    // Apply `position` to popper before anything else because
+    // without the position applied we can't guarantee correct computations
+    setStyles(popper, { position: options.positionFixed ? 'fixed' : 'absolute' });
+
+    return options;
+  }
+
+  /**
+   * @function
+   * @memberof Popper.Utils
+   * @argument {Object} data - The data object generated by `update` method
+   * @argument {Boolean} shouldRound - If the offsets should be rounded at all
+   * @returns {Object} The popper's position offsets rounded
+   *
+   * The tale of pixel-perfect positioning. It's still not 100% perfect, but as
+   * good as it can be within reason.
+   * Discussion here: https://github.com/FezVrasta/popper.js/pull/715
+   *
+   * Low DPI screens cause a popper to be blurry if not using full pixels (Safari
+   * as well on High DPI screens).
+   *
+   * Firefox prefers no rounding for positioning and does not have blurriness on
+   * high DPI screens.
+   *
+   * Only horizontal placement and left/right values need to be considered.
+   */
+  function getRoundedOffsets(data, shouldRound) {
+    var _data$offsets = data.offsets,
+        popper = _data$offsets.popper,
+        reference = _data$offsets.reference;
+    var round = Math.round,
+        floor = Math.floor;
+
+    var noRound = function noRound(v) {
+      return v;
+    };
+
+    var referenceWidth = round(reference.width);
+    var popperWidth = round(popper.width);
+
+    var isVertical = ['left', 'right'].indexOf(data.placement) !== -1;
+    var isVariation = data.placement.indexOf('-') !== -1;
+    var sameWidthParity = referenceWidth % 2 === popperWidth % 2;
+    var bothOddWidth = referenceWidth % 2 === 1 && popperWidth % 2 === 1;
+
+    var horizontalToInteger = !shouldRound ? noRound : isVertical || isVariation || sameWidthParity ? round : floor;
+    var verticalToInteger = !shouldRound ? noRound : round;
+
+    return {
+      left: horizontalToInteger(bothOddWidth && !isVariation && shouldRound ? popper.left - 1 : popper.left),
+      top: verticalToInteger(popper.top),
+      bottom: verticalToInteger(popper.bottom),
+      right: horizontalToInteger(popper.right)
+    };
+  }
+
+  var isFirefox = isBrowser && /Firefox/i.test(navigator.userAgent);
+
+  /**
+   * @function
+   * @memberof Modifiers
+   * @argument {Object} data - The data object generated by `update` method
+   * @argument {Object} options - Modifiers configuration and options
+   * @returns {Object} The data object, properly modified
+   */
+  function computeStyle(data, options) {
+    var x = options.x,
+        y = options.y;
+    var popper = data.offsets.popper;
+
+    // Remove this legacy support in Popper.js v2
+
+    var legacyGpuAccelerationOption = find(data.instance.modifiers, function (modifier) {
+      return modifier.name === 'applyStyle';
+    }).gpuAcceleration;
+    if (legacyGpuAccelerationOption !== undefined) {
+      console.warn('WARNING: `gpuAcceleration` option moved to `computeStyle` modifier and will not be supported in future versions of Popper.js!');
+    }
+    var gpuAcceleration = legacyGpuAccelerationOption !== undefined ? legacyGpuAccelerationOption : options.gpuAcceleration;
+
+    var offsetParent = getOffsetParent(data.instance.popper);
+    var offsetParentRect = getBoundingClientRect(offsetParent);
+
+    // Styles
+    var styles = {
+      position: popper.position
+    };
+
+    var offsets = getRoundedOffsets(data, window.devicePixelRatio < 2 || !isFirefox);
+
+    var sideA = x === 'bottom' ? 'top' : 'bottom';
+    var sideB = y === 'right' ? 'left' : 'right';
+
+    // if gpuAcceleration is set to `true` and transform is supported,
+    //  we use `translate3d` to apply the position to the popper we
+    // automatically use the supported prefixed version if needed
+    var prefixedProperty = getSupportedPropertyName('transform');
+
+    // now, let's make a step back and look at this code closely (wtf?)
+    // If the content of the popper grows once it's been positioned, it
+    // may happen that the popper gets misplaced because of the new content
+    // overflowing its reference element
+    // To avoid this problem, we provide two options (x and y), which allow
+    // the consumer to define the offset origin.
+    // If we position a popper on top of a reference element, we can set
+    // `x` to `top` to make the popper grow towards its top instead of
+    // its bottom.
+    var left = void 0,
+        top = void 0;
+    if (sideA === 'bottom') {
+      // when offsetParent is <html> the positioning is relative to the bottom of the screen (excluding the scrollbar)
+      // and not the bottom of the html element
+      if (offsetParent.nodeName === 'HTML') {
+        top = -offsetParent.clientHeight + offsets.bottom;
+      } else {
+        top = -offsetParentRect.height + offsets.bottom;
+      }
+    } else {
+      top = offsets.top;
+    }
+    if (sideB === 'right') {
+      if (offsetParent.nodeName === 'HTML') {
+        left = -offsetParent.clientWidth + offsets.right;
+      } else {
+        left = -offsetParentRect.width + offsets.right;
+      }
+    } else {
+      left = offsets.left;
+    }
+    if (gpuAcceleration && prefixedProperty) {
+      styles[prefixedProperty] = 'translate3d(' + left + 'px, ' + top + 'px, 0)';
+      styles[sideA] = 0;
+      styles[sideB] = 0;
+      styles.willChange = 'transform';
+    } else {
+      // othwerise, we use the standard `top`, `left`, `bottom` and `right` properties
+      var invertTop = sideA === 'bottom' ? -1 : 1;
+      var invertLeft = sideB === 'right' ? -1 : 1;
+      styles[sideA] = top * invertTop;
+      styles[sideB] = left * invertLeft;
+      styles.willChange = sideA + ', ' + sideB;
+    }
+
+    // Attributes
+    var attributes = {
+      'x-placement': data.placement
+    };
+
+    // Update `data` attributes, styles and arrowStyles
+    data.attributes = _extends({}, attributes, data.attributes);
+    data.styles = _extends({}, styles, data.styles);
+    data.arrowStyles = _extends({}, data.offsets.arrow, data.arrowStyles);
+
+    return data;
+  }
+
+  /**
+   * Helper used to know if the given modifier depends from another one.<br />
+   * It checks if the needed modifier is listed and enabled.
+   * @method
+   * @memberof Popper.Utils
+   * @param {Array} modifiers - list of modifiers
+   * @param {String} requestingName - name of requesting modifier
+   * @param {String} requestedName - name of requested modifier
+   * @returns {Boolean}
+   */
+  function isModifierRequired(modifiers, requestingName, requestedName) {
+    var requesting = find(modifiers, function (_ref) {
+      var name = _ref.name;
+      return name === requestingName;
+    });
+
+    var isRequired = !!requesting && modifiers.some(function (modifier) {
+      return modifier.name === requestedName && modifier.enabled && modifier.order < requesting.order;
+    });
+
+    if (!isRequired) {
+      var _requesting = '`' + requestingName + '`';
+      var requested = '`' + requestedName + '`';
+      console.warn(requested + ' modifier is required by ' + _requesting + ' modifier in order to work, be sure to include it before ' + _requesting + '!');
+    }
+    return isRequired;
+  }
+
+  /**
+   * @function
+   * @memberof Modifiers
+   * @argument {Object} data - The data object generated by update method
+   * @argument {Object} options - Modifiers configuration and options
+   * @returns {Object} The data object, properly modified
+   */
+  function arrow(data, options) {
+    var _data$offsets$arrow;
+
+    // arrow depends on keepTogether in order to work
+    if (!isModifierRequired(data.instance.modifiers, 'arrow', 'keepTogether')) {
+      return data;
+    }
+
+    var arrowElement = options.element;
+
+    // if arrowElement is a string, suppose it's a CSS selector
+    if (typeof arrowElement === 'string') {
+      arrowElement = data.instance.popper.querySelector(arrowElement);
+
+      // if arrowElement is not found, don't run the modifier
+      if (!arrowElement) {
+        return data;
+      }
+    } else {
+      // if the arrowElement isn't a query selector we must check that the
+      // provided DOM node is child of its popper node
+      if (!data.instance.popper.contains(arrowElement)) {
+        console.warn('WARNING: `arrow.element` must be child of its popper element!');
+        return data;
+      }
+    }
+
+    var placement = data.placement.split('-')[0];
+    var _data$offsets = data.offsets,
+        popper = _data$offsets.popper,
+        reference = _data$offsets.reference;
+
+    var isVertical = ['left', 'right'].indexOf(placement) !== -1;
+
+    var len = isVertical ? 'height' : 'width';
+    var sideCapitalized = isVertical ? 'Top' : 'Left';
+    var side = sideCapitalized.toLowerCase();
+    var altSide = isVertical ? 'left' : 'top';
+    var opSide = isVertical ? 'bottom' : 'right';
+    var arrowElementSize = getOuterSizes(arrowElement)[len];
+
+    //
+    // extends keepTogether behavior making sure the popper and its
+    // reference have enough pixels in conjunction
+    //
+
+    // top/left side
+    if (reference[opSide] - arrowElementSize < popper[side]) {
+      data.offsets.popper[side] -= popper[side] - (reference[opSide] - arrowElementSize);
+    }
+    // bottom/right side
+    if (reference[side] + arrowElementSize > popper[opSide]) {
+      data.offsets.popper[side] += reference[side] + arrowElementSize - popper[opSide];
+    }
+    data.offsets.popper = getClientRect(data.offsets.popper);
+
+    // compute center of the popper
+    var center = reference[side] + reference[len] / 2 - arrowElementSize / 2;
+
+    // Compute the sideValue using the updated popper offsets
+    // take popper margin in account because we don't have this info available
+    var css = getStyleComputedProperty(data.instance.popper);
+    var popperMarginSide = parseFloat(css['margin' + sideCapitalized], 10);
+    var popperBorderSide = parseFloat(css['border' + sideCapitalized + 'Width'], 10);
+    var sideValue = center - data.offsets.popper[side] - popperMarginSide - popperBorderSide;
+
+    // prevent arrowElement from being placed not contiguously to its popper
+    sideValue = Math.max(Math.min(popper[len] - arrowElementSize, sideValue), 0);
+
+    data.arrowElement = arrowElement;
+    data.offsets.arrow = (_data$offsets$arrow = {}, defineProperty(_data$offsets$arrow, side, Math.round(sideValue)), defineProperty(_data$offsets$arrow, altSide, ''), _data$offsets$arrow);
+
+    return data;
+  }
+
+  /**
+   * Get the opposite placement variation of the given one
+   * @method
+   * @memberof Popper.Utils
+   * @argument {String} placement variation
+   * @returns {String} flipped placement variation
+   */
+  function getOppositeVariation(variation) {
+    if (variation === 'end') {
+      return 'start';
+    } else if (variation === 'start') {
+      return 'end';
+    }
+    return variation;
+  }
+
+  /**
+   * List of accepted placements to use as values of the `placement` option.<br />
+   * Valid placements are:
+   * - `auto`
+   * - `top`
+   * - `right`
+   * - `bottom`
+   * - `left`
+   *
+   * Each placement can have a variation from this list:
+   * - `-start`
+   * - `-end`
+   *
+   * Variations are interpreted easily if you think of them as the left to right
+   * written languages. Horizontally (`top` and `bottom`), `start` is left and `end`
+   * is right.<br />
+   * Vertically (`left` and `right`), `start` is top and `end` is bottom.
+   *
+   * Some valid examples are:
+   * - `top-end` (on top of reference, right aligned)
+   * - `right-start` (on right of reference, top aligned)
+   * - `bottom` (on bottom, centered)
+   * - `auto-end` (on the side with more space available, alignment depends by placement)
+   *
+   * @static
+   * @type {Array}
+   * @enum {String}
+   * @readonly
+   * @method placements
+   * @memberof Popper
+   */
+  var placements = ['auto-start', 'auto', 'auto-end', 'top-start', 'top', 'top-end', 'right-start', 'right', 'right-end', 'bottom-end', 'bottom', 'bottom-start', 'left-end', 'left', 'left-start'];
+
+  // Get rid of `auto` `auto-start` and `auto-end`
+  var validPlacements = placements.slice(3);
+
+  /**
+   * Given an initial placement, returns all the subsequent placements
+   * clockwise (or counter-clockwise).
+   *
+   * @method
+   * @memberof Popper.Utils
+   * @argument {String} placement - A valid placement (it accepts variations)
+   * @argument {Boolean} counter - Set to true to walk the placements counterclockwise
+   * @returns {Array} placements including their variations
+   */
+  function clockwise(placement) {
+    var counter = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false;
+
+    var index = validPlacements.indexOf(placement);
+    var arr = validPlacements.slice(index + 1).concat(validPlacements.slice(0, index));
+    return counter ? arr.reverse() : arr;
+  }
+
+  var BEHAVIORS = {
+    FLIP: 'flip',
+    CLOCKWISE: 'clockwise',
+    COUNTERCLOCKWISE: 'counterclockwise'
+  };
+
+  /**
+   * @function
+   * @memberof Modifiers
+   * @argument {Object} data - The data object generated by update method
+   * @argument {Object} options - Modifiers configuration and options
+   * @returns {Object} The data object, properly modified
+   */
+  function flip(data, options) {
+    // if `inner` modifier is enabled, we can't use the `flip` modifier
+    if (isModifierEnabled(data.instance.modifiers, 'inner')) {
+      return data;
+    }
+
+    if (data.flipped && data.placement === data.originalPlacement) {
+      // seems like flip is trying to loop, probably there's not enough space on any of the flippable sides
+      return data;
+    }
+
+    var boundaries = getBoundaries(data.instance.popper, data.instance.reference, options.padding, options.boundariesElement, data.positionFixed);
+
+    var placement = data.placement.split('-')[0];
+    var placementOpposite = getOppositePlacement(placement);
+    var variation = data.placement.split('-')[1] || '';
+
+    var flipOrder = [];
+
+    switch (options.behavior) {
+      case BEHAVIORS.FLIP:
+        flipOrder = [placement, placementOpposite];
+        break;
+      case BEHAVIORS.CLOCKWISE:
+        flipOrder = clockwise(placement);
+        break;
+      case BEHAVIORS.COUNTERCLOCKWISE:
+        flipOrder = clockwise(placement, true);
+        break;
+      default:
+        flipOrder = options.behavior;
+    }
+
+    flipOrder.forEach(function (step, index) {
+      if (placement !== step || flipOrder.length === index + 1) {
+        return data;
+      }
+
+      placement = data.placement.split('-')[0];
+      placementOpposite = getOppositePlacement(placement);
+
+      var popperOffsets = data.offsets.popper;
+      var refOffsets = data.offsets.reference;
+
+      // using floor because the reference offsets may contain decimals we are not going to consider here
+      var floor = Math.floor;
+      var overlapsRef = placement === 'left' && floor(popperOffsets.right) > floor(refOffsets.left) || placement === 'right' && floor(popperOffsets.left) < floor(refOffsets.right) || placement === 'top' && floor(popperOffsets.bottom) > floor(refOffsets.top) || placement === 'bottom' && floor(popperOffsets.top) < floor(refOffsets.bottom);
+
+      var overflowsLeft = floor(popperOffsets.left) < floor(boundaries.left);
+      var overflowsRight = floor(popperOffsets.right) > floor(boundaries.right);
+      var overflowsTop = floor(popperOffsets.top) < floor(boundaries.top);
+      var overflowsBottom = floor(popperOffsets.bottom) > floor(boundaries.bottom);
+
+      var overflowsBoundaries = placement === 'left' && overflowsLeft || placement === 'right' && overflowsRight || placement === 'top' && overflowsTop || placement === 'bottom' && overflowsBottom;
+
+      // flip the variation if required
+      var isVertical = ['top', 'bottom'].indexOf(placement) !== -1;
+      var flippedVariation = !!options.flipVariations && (isVertical && variation === 'start' && overflowsLeft || isVertical && variation === 'end' && overflowsRight || !isVertical && variation === 'start' && overflowsTop || !isVertical && variation === 'end' && overflowsBottom);
+
+      if (overlapsRef || overflowsBoundaries || flippedVariation) {
+        // this boolean to detect any flip loop
+        data.flipped = true;
+
+        if (overlapsRef || overflowsBoundaries) {
+          placement = flipOrder[index + 1];
+        }
+
+        if (flippedVariation) {
+          variation = getOppositeVariation(variation);
+        }
+
+        data.placement = placement + (variation ? '-' + variation : '');
+
+        // this object contains `position`, we want to preserve it along with
+        // any additional property we may add in the future
+        data.offsets.popper = _extends({}, data.offsets.popper, getPopperOffsets(data.instance.popper, data.offsets.reference, data.placement));
+
+        data = runModifiers(data.instance.modifiers, data, 'flip');
+      }
+    });
+    return data;
+  }
+
+  /**
+   * @function
+   * @memberof Modifiers
+   * @argument {Object} data - The data object generated by update method
+   * @argument {Object} options - Modifiers configuration and options
+   * @returns {Object} The data object, properly modified
+   */
+  function keepTogether(data) {
+    var _data$offsets = data.offsets,
+        popper = _data$offsets.popper,
+        reference = _data$offsets.reference;
+
+    var placement = data.placement.split('-')[0];
+    var floor = Math.floor;
+    var isVertical = ['top', 'bottom'].indexOf(placement) !== -1;
+    var side = isVertical ? 'right' : 'bottom';
+    var opSide = isVertical ? 'left' : 'top';
+    var measurement = isVertical ? 'width' : 'height';
+
+    if (popper[side] < floor(reference[opSide])) {
+      data.offsets.popper[opSide] = floor(reference[opSide]) - popper[measurement];
+    }
+    if (popper[opSide] > floor(reference[side])) {
+      data.offsets.popper[opSide] = floor(reference[side]);
+    }
+
+    return data;
+  }
+
+  /**
+   * Converts a string containing value + unit into a px value number
+   * @function
+   * @memberof {modifiers~offset}
+   * @private
+   * @argument {String} str - Value + unit string
+   * @argument {String} measurement - `height` or `width`
+   * @argument {Object} popperOffsets
+   * @argument {Object} referenceOffsets
+   * @returns {Number|String}
+   * Value in pixels, or original string if no values were extracted
+   */
+  function toValue(str, measurement, popperOffsets, referenceOffsets) {
+    // separate value from unit
+    var split = str.match(/((?:\-|\+)?\d*\.?\d*)(.*)/);
+    var value = +split[1];
+    var unit = split[2];
+
+    // If it's not a number it's an operator, I guess
+    if (!value) {
+      return str;
+    }
+
+    if (unit.indexOf('%') === 0) {
+      var element = void 0;
+      switch (unit) {
+        case '%p':
+          element = popperOffsets;
+          break;
+        case '%':
+        case '%r':
+        default:
+          element = referenceOffsets;
+      }
+
+      var rect = getClientRect(element);
+      return rect[measurement] / 100 * value;
+    } else if (unit === 'vh' || unit === 'vw') {
+      // if is a vh or vw, we calculate the size based on the viewport
+      var size = void 0;
+      if (unit === 'vh') {
+        size = Math.max(document.documentElement.clientHeight, window.innerHeight || 0);
+      } else {
+        size = Math.max(document.documentElement.clientWidth, window.innerWidth || 0);
+      }
+      return size / 100 * value;
+    } else {
+      // if is an explicit pixel unit, we get rid of the unit and keep the value
+      // if is an implicit unit, it's px, and we return just the value
+      return value;
+    }
+  }
+
+  /**
+   * Parse an `offset` string to extrapolate `x` and `y` numeric offsets.
+   * @function
+   * @memberof {modifiers~offset}
+   * @private
+   * @argument {String} offset
+   * @argument {Object} popperOffsets
+   * @argument {Object} referenceOffsets
+   * @argument {String} basePlacement
+   * @returns {Array} a two cells array with x and y offsets in numbers
+   */
+  function parseOffset(offset, popperOffsets, referenceOffsets, basePlacement) {
+    var offsets = [0, 0];
+
+    // Use height if placement is left or right and index is 0 otherwise use width
+    // in this way the first offset will use an axis and the second one
+    // will use the other one
+    var useHeight = ['right', 'left'].indexOf(basePlacement) !== -1;
+
+    // Split the offset string to obtain a list of values and operands
+    // The regex addresses values with the plus or minus sign in front (+10, -20, etc)
+    var fragments = offset.split(/(\+|\-)/).map(function (frag) {
+      return frag.trim();
+    });
+
+    // Detect if the offset string contains a pair of values or a single one
+    // they could be separated by comma or space
+    var divider = fragments.indexOf(find(fragments, function (frag) {
+      return frag.search(/,|\s/) !== -1;
+    }));
+
+    if (fragments[divider] && fragments[divider].indexOf(',') === -1) {
+      console.warn('Offsets separated by white space(s) are deprecated, use a comma (,) instead.');
+    }
+
+    // If divider is found, we divide the list of values and operands to divide
+    // them by ofset X and Y.
+    var splitRegex = /\s*,\s*|\s+/;
+    var ops = divider !== -1 ? [fragments.slice(0, divider).concat([fragments[divider].split(splitRegex)[0]]), [fragments[divider].split(splitRegex)[1]].concat(fragments.slice(divider + 1))] : [fragments];
+
+    // Convert the values with units to absolute pixels to allow our computations
+    ops = ops.map(function (op, index) {
+      // Most of the units rely on the orientation of the popper
+      var measurement = (index === 1 ? !useHeight : useHeight) ? 'height' : 'width';
+      var mergeWithPrevious = false;
+      return op
+      // This aggregates any `+` or `-` sign that aren't considered operators
+      // e.g.: 10 + +5 => [10, +, +5]
+      .reduce(function (a, b) {
+        if (a[a.length - 1] === '' && ['+', '-'].indexOf(b) !== -1) {
+          a[a.length - 1] = b;
+          mergeWithPrevious = true;
+          return a;
+        } else if (mergeWithPrevious) {
+          a[a.length - 1] += b;
+          mergeWithPrevious = false;
+          return a;
+        } else {
+          return a.concat(b);
+        }
+      }, [])
+      // Here we convert the string values into number values (in px)
+      .map(function (str) {
+        return toValue(str, measurement, popperOffsets, referenceOffsets);
+      });
+    });
+
+    // Loop trough the offsets arrays and execute the operations
+    ops.forEach(function (op, index) {
+      op.forEach(function (frag, index2) {
+        if (isNumeric(frag)) {
+          offsets[index] += frag * (op[index2 - 1] === '-' ? -1 : 1);
+        }
+      });
+    });
+    return offsets;
+  }
+
+  /**
+   * @function
+   * @memberof Modifiers
+   * @argument {Object} data - The data object generated by update method
+   * @argument {Object} options - Modifiers configuration and options
+   * @argument {Number|String} options.offset=0
+   * The offset value as described in the modifier description
+   * @returns {Object} The data object, properly modified
+   */
+  function offset(data, _ref) {
+    var offset = _ref.offset;
+    var placement = data.placement,
+        _data$offsets = data.offsets,
+        popper = _data$offsets.popper,
+        reference = _data$offsets.reference;
+
+    var basePlacement = placement.split('-')[0];
+
+    var offsets = void 0;
+    if (isNumeric(+offset)) {
+      offsets = [+offset, 0];
+    } else {
+      offsets = parseOffset(offset, popper, reference, basePlacement);
+    }
+
+    if (basePlacement === 'left') {
+      popper.top += offsets[0];
+      popper.left -= offsets[1];
+    } else if (basePlacement === 'right') {
+      popper.top += offsets[0];
+      popper.left += offsets[1];
+    } else if (basePlacement === 'top') {
+      popper.left += offsets[0];
+      popper.top -= offsets[1];
+    } else if (basePlacement === 'bottom') {
+      popper.left += offsets[0];
+      popper.top += offsets[1];
+    }
+
+    data.popper = popper;
+    return data;
+  }
+
+  /**
+   * @function
+   * @memberof Modifiers
+   * @argument {Object} data - The data object generated by `update` method
+   * @argument {Object} options - Modifiers configuration and options
+   * @returns {Object} The data object, properly modified
+   */
+  function preventOverflow(data, options) {
+    var boundariesElement = options.boundariesElement || getOffsetParent(data.instance.popper);
+
+    // If offsetParent is the reference element, we really want to
+    // go one step up and use the next offsetParent as reference to
+    // avoid to make this modifier completely useless and look like broken
+    if (data.instance.reference === boundariesElement) {
+      boundariesElement = getOffsetParent(boundariesElement);
+    }
+
+    // NOTE: DOM access here
+    // resets the popper's position so that the document size can be calculated excluding
+    // the size of the popper element itself
+    var transformProp = getSupportedPropertyName('transform');
+    var popperStyles = data.instance.popper.style; // assignment to help minification
+    var top = popperStyles.top,
+        left = popperStyles.left,
+        transform = popperStyles[transformProp];
+
+    popperStyles.top = '';
+    popperStyles.left = '';
+    popperStyles[transformProp] = '';
+
+    var boundaries = getBoundaries(data.instance.popper, data.instance.reference, options.padding, boundariesElement, data.positionFixed);
+
+    // NOTE: DOM access here
+    // restores the original style properties after the offsets have been computed
+    popperStyles.top = top;
+    popperStyles.left = left;
+    popperStyles[transformProp] = transform;
+
+    options.boundaries = boundaries;
+
+    var order = options.priority;
+    var popper = data.offsets.popper;
+
+    var check = {
+      primary: function primary(placement) {
+        var value = popper[placement];
+        if (popper[placement] < boundaries[placement] && !options.escapeWithReference) {
+          value = Math.max(popper[placement], boundaries[placement]);
+        }
+        return defineProperty({}, placement, value);
+      },
+      secondary: function secondary(placement) {
+        var mainSide = placement === 'right' ? 'left' : 'top';
+        var value = popper[mainSide];
+        if (popper[placement] > boundaries[placement] && !options.escapeWithReference) {
+          value = Math.min(popper[mainSide], boundaries[placement] - (placement === 'right' ? popper.width : popper.height));
+        }
+        return defineProperty({}, mainSide, value);
+      }
+    };
+
+    order.forEach(function (placement) {
+      var side = ['left', 'top'].indexOf(placement) !== -1 ? 'primary' : 'secondary';
+      popper = _extends({}, popper, check[side](placement));
+    });
+
+    data.offsets.popper = popper;
+
+    return data;
+  }
+
+  /**
+   * @function
+   * @memberof Modifiers
+   * @argument {Object} data - The data object generated by `update` method
+   * @argument {Object} options - Modifiers configuration and options
+   * @returns {Object} The data object, properly modified
+   */
+  function shift(data) {
+    var placement = data.placement;
+    var basePlacement = placement.split('-')[0];
+    var shiftvariation = placement.split('-')[1];
+
+    // if shift shiftvariation is specified, run the modifier
+    if (shiftvariation) {
+      var _data$offsets = data.offsets,
+          reference = _data$offsets.reference,
+          popper = _data$offsets.popper;
+
+      var isVertical = ['bottom', 'top'].indexOf(basePlacement) !== -1;
+      var side = isVertical ? 'left' : 'top';
+      var measurement = isVertical ? 'width' : 'height';
+
+      var shiftOffsets = {
+        start: defineProperty({}, side, reference[side]),
+        end: defineProperty({}, side, reference[side] + reference[measurement] - popper[measurement])
+      };
+
+      data.offsets.popper = _extends({}, popper, shiftOffsets[shiftvariation]);
+    }
+
+    return data;
+  }
+
+  /**
+   * @function
+   * @memberof Modifiers
+   * @argument {Object} data - The data object generated by update method
+   * @argument {Object} options - Modifiers configuration and options
+   * @returns {Object} The data object, properly modified
+   */
+  function hide(data) {
+    if (!isModifierRequired(data.instance.modifiers, 'hide', 'preventOverflow')) {
+      return data;
+    }
+
+    var refRect = data.offsets.reference;
+    var bound = find(data.instance.modifiers, function (modifier) {
+      return modifier.name === 'preventOverflow';
+    }).boundaries;
+
+    if (refRect.bottom < bound.top || refRect.left > bound.right || refRect.top > bound.bottom || refRect.right < bound.left) {
+      // Avoid unnecessary DOM access if visibility hasn't changed
+      if (data.hide === true) {
+        return data;
+      }
+
+      data.hide = true;
+      data.attributes['x-out-of-boundaries'] = '';
+    } else {
+      // Avoid unnecessary DOM access if visibility hasn't changed
+      if (data.hide === false) {
+        return data;
+      }
+
+      data.hide = false;
+      data.attributes['x-out-of-boundaries'] = false;
+    }
+
+    return data;
+  }
+
+  /**
+   * @function
+   * @memberof Modifiers
+   * @argument {Object} data - The data object generated by `update` method
+   * @argument {Object} options - Modifiers configuration and options
+   * @returns {Object} The data object, properly modified
+   */
+  function inner(data) {
+    var placement = data.placement;
+    var basePlacement = placement.split('-')[0];
+    var _data$offsets = data.offsets,
+        popper = _data$offsets.popper,
+        reference = _data$offsets.reference;
+
+    var isHoriz = ['left', 'right'].indexOf(basePlacement) !== -1;
+
+    var subtractLength = ['top', 'left'].indexOf(basePlacement) === -1;
+
+    popper[isHoriz ? 'left' : 'top'] = reference[basePlacement] - (subtractLength ? popper[isHoriz ? 'width' : 'height'] : 0);
+
+    data.placement = getOppositePlacement(placement);
+    data.offsets.popper = getClientRect(popper);
+
+    return data;
+  }
+
+  /**
+   * Modifier function, each modifier can have a function of this type assigned
+   * to its `fn` property.<br />
+   * These functions will be called on each update, this means that you must
+   * make sure they are performant enough to avoid performance bottlenecks.
+   *
+   * @function ModifierFn
+   * @argument {dataObject} data - The data object generated by `update` method
+   * @argument {Object} options - Modifiers configuration and options
+   * @returns {dataObject} The data object, properly modified
+   */
+
+  /**
+   * Modifiers are plugins used to alter the behavior of your poppers.<br />
+   * Popper.js uses a set of 9 modifiers to provide all the basic functionalities
+   * needed by the library.
+   *
+   * Usually you don't want to override the `order`, `fn` and `onLoad` props.
+   * All the other properties are configurations that could be tweaked.
+   * @namespace modifiers
+   */
+  var modifiers = {
+    /**
+     * Modifier used to shift the popper on the start or end of its reference
+     * element.<br />
+     * It will read the variation of the `placement` property.<br />
+     * It can be one either `-end` or `-start`.
+     * @memberof modifiers
+     * @inner
+     */
+    shift: {
+      /** @prop {number} order=100 - Index used to define the order of execution */
+      order: 100,
+      /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */
+      enabled: true,
+      /** @prop {ModifierFn} */
+      fn: shift
+    },
+
+    /**
+     * The `offset` modifier can shift your popper on both its axis.
+     *
+     * It accepts the following units:
+     * - `px` or unit-less, interpreted as pixels
+     * - `%` or `%r`, percentage relative to the length of the reference element
+     * - `%p`, percentage relative to the length of the popper element
+     * - `vw`, CSS viewport width unit
+     * - `vh`, CSS viewport height unit
+     *
+     * For length is intended the main axis relative to the placement of the popper.<br />
+     * This means that if the placement is `top` or `bottom`, the length will be the
+     * `width`. In case of `left` or `right`, it will be the `height`.
+     *
+     * You can provide a single value (as `Number` or `String`), or a pair of values
+     * as `String` divided by a comma or one (or more) white spaces.<br />
+     * The latter is a deprecated method because it leads to confusion and will be
+     * removed in v2.<br />
+     * Additionally, it accepts additions and subtractions between different units.
+     * Note that multiplications and divisions aren't supported.
+     *
+     * Valid examples are:
+     * ```
+     * 10
+     * '10%'
+     * '10, 10'
+     * '10%, 10'
+     * '10 + 10%'
+     * '10 - 5vh + 3%'
+     * '-10px + 5vh, 5px - 6%'
+     * ```
+     * > **NB**: If you desire to apply offsets to your poppers in a way that may make them overlap
+     * > with their reference element, unfortunately, you will have to disable the `flip` modifier.
+     * > You can read more on this at this [issue](https://github.com/FezVrasta/popper.js/issues/373).
+     *
+     * @memberof modifiers
+     * @inner
+     */
+    offset: {
+      /** @prop {number} order=200 - Index used to define the order of execution */
+      order: 200,
+      /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */
+      enabled: true,
+      /** @prop {ModifierFn} */
+      fn: offset,
+      /** @prop {Number|String} offset=0
+       * The offset value as described in the modifier description
+       */
+      offset: 0
+    },
+
+    /**
+     * Modifier used to prevent the popper from being positioned outside the boundary.
+     *
+     * A scenario exists where the reference itself is not within the boundaries.<br />
+     * We can say it has "escaped the boundaries" â?? or just "escaped".<br />
+     * In this case we need to decide whether the popper should either:
+     *
+     * - detach from the reference and remain "trapped" in the boundaries, or
+     * - if it should ignore the boundary and "escape with its reference"
+     *
+     * When `escapeWithReference` is set to`true` and reference is completely
+     * outside its boundaries, the popper will overflow (or completely leave)
+     * the boundaries in order to remain attached to the edge of the reference.
+     *
+     * @memberof modifiers
+     * @inner
+     */
+    preventOverflow: {
+      /** @prop {number} order=300 - Index used to define the order of execution */
+      order: 300,
+      /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */
+      enabled: true,
+      /** @prop {ModifierFn} */
+      fn: preventOverflow,
+      /**
+       * @prop {Array} [priority=['left','right','top','bottom']]
+       * Popper will try to prevent overflow following these priorities by default,
+       * then, it could overflow on the left and on top of the `boundariesElement`
+       */
+      priority: ['left', 'right', 'top', 'bottom'],
+      /**
+       * @prop {number} padding=5
+       * Amount of pixel used to define a minimum distance between the boundaries
+       * and the popper. This makes sure the popper always has a little padding
+       * between the edges of its container
+       */
+      padding: 5,
+      /**
+       * @prop {String|HTMLElement} boundariesElement='scrollParent'
+       * Boundaries used by the modifier. Can be `scrollParent`, `window`,
+       * `viewport` or any DOM element.
+       */
+      boundariesElement: 'scrollParent'
+    },
+
+    /**
+     * Modifier used to make sure the reference and its popper stay near each other
+     * without leaving any gap between the two. Especially useful when the arrow is
+     * enabled and you want to ensure that it points to its reference element.
+     * It cares only about the first axis. You can still have poppers with margin
+     * between the popper and its reference element.
+     * @memberof modifiers
+     * @inner
+     */
+    keepTogether: {
+      /** @prop {number} order=400 - Index used to define the order of execution */
+      order: 400,
+      /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */
+      enabled: true,
+      /** @prop {ModifierFn} */
+      fn: keepTogether
+    },
+
+    /**
+     * This modifier is used to move the `arrowElement` of the popper to make
+     * sure it is positioned between the reference element and its popper element.
+     * It will read the outer size of the `arrowElement` node to detect how many
+     * pixels of conjunction are needed.
+     *
+     * It has no effect if no `arrowElement` is provided.
+     * @memberof modifiers
+     * @inner
+     */
+    arrow: {
+      /** @prop {number} order=500 - Index used to define the order of execution */
+      order: 500,
+      /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */
+      enabled: true,
+      /** @prop {ModifierFn} */
+      fn: arrow,
+      /** @prop {String|HTMLElement} element='[x-arrow]' - Selector or node used as arrow */
+      element: '[x-arrow]'
+    },
+
+    /**
+     * Modifier used to flip the popper's placement when it starts to overlap its
+     * reference element.
+     *
+     * Requires the `preventOverflow` modifier before it in order to work.
+     *
+     * **NOTE:** this modifier will interrupt the current update cycle and will
+     * restart it if it detects the need to flip the placement.
+     * @memberof modifiers
+     * @inner
+     */
+    flip: {
+      /** @prop {number} order=600 - Index used to define the order of execution */
+      order: 600,
+      /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */
+      enabled: true,
+      /** @prop {ModifierFn} */
+      fn: flip,
+      /**
+       * @prop {String|Array} behavior='flip'
+       * The behavior used to change the popper's placement. It can be one of
+       * `flip`, `clockwise`, `counterclockwise` or an array with a list of valid
+       * placements (with optional variations)
+       */
+      behavior: 'flip',
+      /**
+       * @prop {number} padding=5
+       * The popper will flip if it hits the edges of the `boundariesElement`
+       */
+      padding: 5,
+      /**
+       * @prop {String|HTMLElement} boundariesElement='viewport'
+       * The element which will define the boundaries of the popper position.
+       * The popper will never be placed outside of the defined boundaries
+       * (except if `keepTogether` is enabled)
+       */
+      boundariesElement: 'viewport'
+    },
+
+    /**
+     * Modifier used to make the popper flow toward the inner of the reference element.
+     * By default, when this modifier is disabled, the popper will be placed outside
+     * the reference element.
+     * @memberof modifiers
+     * @inner
+     */
+    inner: {
+      /** @prop {number} order=700 - Index used to define the order of execution */
+      order: 700,
+      /** @prop {Boolean} enabled=false - Whether the modifier is enabled or not */
+      enabled: false,
+      /** @prop {ModifierFn} */
+      fn: inner
+    },
+
+    /**
+     * Modifier used to hide the popper when its reference element is outside of the
+     * popper boundaries. It will set a `x-out-of-boundaries` attribute which can
+     * be used to hide with a CSS selector the popper when its reference is
+     * out of boundaries.
+     *
+     * Requires the `preventOverflow` modifier before it in order to work.
+     * @memberof modifiers
+     * @inner
+     */
+    hide: {
+      /** @prop {number} order=800 - Index used to define the order of execution */
+      order: 800,
+      /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */
+      enabled: true,
+      /** @prop {ModifierFn} */
+      fn: hide
+    },
+
+    /**
+     * Computes the style that will be applied to the popper element to gets
+     * properly positioned.
+     *
+     * Note that this modifier will not touch the DOM, it just prepares the styles
+     * so that `applyStyle` modifier can apply it. This separation is useful
+     * in case you need to replace `applyStyle` with a custom implementation.
+     *
+     * This modifier has `850` as `order` value to maintain backward compatibility
+     * with previous versions of Popper.js. Expect the modifiers ordering method
+     * to change in future major versions of the library.
+     *
+     * @memberof modifiers
+     * @inner
+     */
+    computeStyle: {
+      /** @prop {number} order=850 - Index used to define the order of execution */
+      order: 850,
+      /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */
+      enabled: true,
+      /** @prop {ModifierFn} */
+      fn: computeStyle,
+      /**
+       * @prop {Boolean} gpuAcceleration=true
+       * If true, it uses the CSS 3D transformation to position the popper.
+       * Otherwise, it will use the `top` and `left` properties
+       */
+      gpuAcceleration: true,
+      /**
+       * @prop {string} [x='bottom']
+       * Where to anchor the X axis (`bottom` or `top`). AKA X offset origin.
+       * Change this if your popper should grow in a direction different from `bottom`
+       */
+      x: 'bottom',
+      /**
+       * @prop {string} [x='left']
+       * Where to anchor the Y axis (`left` or `right`). AKA Y offset origin.
+       * Change this if your popper should grow in a direction different from `right`
+       */
+      y: 'right'
+    },
+
+    /**
+     * Applies the computed styles to the popper element.
+     *
+     * All the DOM manipulations are limited to this modifier. This is useful in case
+     * you want to integrate Popper.js inside a framework or view library and you
+     * want to delegate all the DOM manipulations to it.
+     *
+     * Note that if you disable this modifier, you must make sure the popper element
+     * has its position set to `absolute` before Popper.js can do its work!
+     *
+     * Just disable this modifier and define your own to achieve the desired effect.
+     *
+     * @memberof modifiers
+     * @inner
+     */
+    applyStyle: {
+      /** @prop {number} order=900 - Index used to define the order of execution */
+      order: 900,
+      /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */
+      enabled: true,
+      /** @prop {ModifierFn} */
+      fn: applyStyle,
+      /** @prop {Function} */
+      onLoad: applyStyleOnLoad,
+      /**
+       * @deprecated since version 1.10.0, the property moved to `computeStyle` modifier
+       * @prop {Boolean} gpuAcceleration=true
+       * If true, it uses the CSS 3D transformation to position the popper.
+       * Otherwise, it will use the `top` and `left` properties
+       */
+      gpuAcceleration: undefined
+    }
+  };
+
+  /**
+   * The `dataObject` is an object containing all the information used by Popper.js.
+   * This object is passed to modifiers and to the `onCreate` and `onUpdate` callbacks.
+   * @name dataObject
+   * @property {Object} data.instance The Popper.js instance
+   * @property {String} data.placement Placement applied to popper
+   * @property {String} data.originalPlacement Placement originally defined on init
+   * @property {Boolean} data.flipped True if popper has been flipped by flip modifier
+   * @property {Boolean} data.hide True if the reference element is out of boundaries, useful to know when to hide the popper
+   * @property {HTMLElement} data.arrowElement Node used as arrow by arrow modifier
+   * @property {Object} data.styles Any CSS property defined here will be applied to the popper. It expects the JavaScript nomenclature (eg. `marginBottom`)
+   * @property {Object} data.arrowStyles Any CSS property defined here will be applied to the popper arrow. It expects the JavaScript nomenclature (eg. `marginBottom`)
+   * @property {Object} data.boundaries Offsets of the popper boundaries
+   * @property {Object} data.offsets The measurements of popper, reference and arrow elements
+   * @property {Object} data.offsets.popper `top`, `left`, `width`, `height` values
+   * @property {Object} data.offsets.reference `top`, `left`, `width`, `height` values
+   * @property {Object} data.offsets.arrow] `top` and `left` offsets, only one of them will be different from 0
+   */
+
+  /**
+   * Default options provided to Popper.js constructor.<br />
+   * These can be overridden using the `options` argument of Popper.js.<br />
+   * To override an option, simply pass an object with the same
+   * structure of the `options` object, as the 3rd argument. For example:
+   * ```
+   * new Popper(ref, pop, {
+   *   modifiers: {
+   *     preventOverflow: { enabled: false }
+   *   }
+   * })
+   * ```
+   * @type {Object}
+   * @static
+   * @memberof Popper
+   */
+  var Defaults = {
+    /**
+     * Popper's placement.
+     * @prop {Popper.placements} placement='bottom'
+     */
+    placement: 'bottom',
+
+    /**
+     * Set this to true if you want popper to position it self in 'fixed' mode
+     * @prop {Boolean} positionFixed=false
+     */
+    positionFixed: false,
+
+    /**
+     * Whether events (resize, scroll) are initially enabled.
+     * @prop {Boolean} eventsEnabled=true
+     */
+    eventsEnabled: true,
+
+    /**
+     * Set to true if you want to automatically remove the popper when
+     * you call the `destroy` method.
+     * @prop {Boolean} removeOnDestroy=false
+     */
+    removeOnDestroy: false,
+
+    /**
+     * Callback called when the popper is created.<br />
+     * By default, it is set to no-op.<br />
+     * Access Popper.js instance with `data.instance`.
+     * @prop {onCreate}
+     */
+    onCreate: function onCreate() {},
+
+    /**
+     * Callback called when the popper is updated. This callback is not called
+     * on the initialization/creation of the popper, but only on subsequent
+     * updates.<br />
+     * By default, it is set to no-op.<br />
+     * Access Popper.js instance with `data.instance`.
+     * @prop {onUpdate}
+     */
+    onUpdate: function onUpdate() {},
+
+    /**
+     * List of modifiers used to modify the offsets before they are applied to the popper.
+     * They provide most of the functionalities of Popper.js.
+     * @prop {modifiers}
+     */
+    modifiers: modifiers
+  };
+
+  /**
+   * @callback onCreate
+   * @param {dataObject} data
+   */
+
+  /**
+   * @callback onUpdate
+   * @param {dataObject} data
+   */
+
+  // Utils
+  // Methods
+  var Popper = function () {
+    /**
+     * Creates a new Popper.js instance.
+     * @class Popper
+     * @param {HTMLElement|referenceObject} reference - The reference element used to position the popper
+     * @param {HTMLElement} popper - The HTML element used as the popper
+     * @param {Object} options - Your custom options to override the ones defined in [Defaults](#defaults)
+     * @return {Object} instance - The generated Popper.js instance
+     */
+    function Popper(reference, popper) {
+      var _this = this;
+
+      var options = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : {};
+      classCallCheck(this, Popper);
+
+      this.scheduleUpdate = function () {
+        return requestAnimationFrame(_this.update);
+      };
+
+      // make update() debounced, so that it only runs at most once-per-tick
+      this.update = debounce(this.update.bind(this));
+
+      // with {} we create a new object with the options inside it
+      this.options = _extends({}, Popper.Defaults, options);
+
+      // init state
+      this.state = {
+        isDestroyed: false,
+        isCreated: false,
+        scrollParents: []
+      };
+
+      // get reference and popper elements (allow jQuery wrappers)
+      this.reference = reference && reference.jquery ? reference[0] : reference;
+      this.popper = popper && popper.jquery ? popper[0] : popper;
+
+      // Deep merge modifiers options
+      this.options.modifiers = {};
+      Object.keys(_extends({}, Popper.Defaults.modifiers, options.modifiers)).forEach(function (name) {
+        _this.options.modifiers[name] = _extends({}, Popper.Defaults.modifiers[name] || {}, options.modifiers ? options.modifiers[name] : {});
+      });
+
+      // Refactoring modifiers' list (Object => Array)
+      this.modifiers = Object.keys(this.options.modifiers).map(function (name) {
+        return _extends({
+          name: name
+        }, _this.options.modifiers[name]);
+      })
+      // sort the modifiers by order
+      .sort(function (a, b) {
+        return a.order - b.order;
+      });
+
+      // modifiers have the ability to execute arbitrary code when Popper.js get inited
+      // such code is executed in the same order of its modifier
+      // they could add new properties to their options configuration
+      // BE AWARE: don't add options to `options.modifiers.name` but to `modifierOptions`!
+      this.modifiers.forEach(function (modifierOptions) {
+        if (modifierOptions.enabled && isFunction(modifierOptions.onLoad)) {
+          modifierOptions.onLoad(_this.reference, _this.popper, _this.options, modifierOptions, _this.state);
+        }
+      });
+
+      // fire the first update to position the popper in the right place
+      this.update();
+
+      var eventsEnabled = this.options.eventsEnabled;
+      if (eventsEnabled) {
+        // setup event listeners, they will take care of update the position in specific situations
+        this.enableEventListeners();
+      }
+
+      this.state.eventsEnabled = eventsEnabled;
+    }
+
+    // We can't use class properties because they don't get listed in the
+    // class prototype and break stuff like Sinon stubs
+
+
+    createClass(Popper, [{
+      key: 'update',
+      value: function update$$1() {
+        return update.call(this);
+      }
+    }, {
+      key: 'destroy',
+      value: function destroy$$1() {
+        return destroy.call(this);
+      }
+    }, {
+      key: 'enableEventListeners',
+      value: function enableEventListeners$$1() {
+        return enableEventListeners.call(this);
+      }
+    }, {
+      key: 'disableEventListeners',
+      value: function disableEventListeners$$1() {
+        return disableEventListeners.call(this);
+      }
+
+      /**
+       * Schedules an update. It will run on the next UI update available.
+       * @method scheduleUpdate
+       * @memberof Popper
+       */
+
+
+      /**
+       * Collection of utilities useful when writing custom modifiers.
+       * Starting from version 1.7, this method is available only if you
+       * include `popper-utils.js` before `popper.js`.
+       *
+       * **DEPRECATION**: This way to access PopperUtils is deprecated
+       * and will be removed in v2! Use the PopperUtils module directly instead.
+       * Due to the high instability of the methods contained in Utils, we can't
+       * guarantee them to follow semver. Use them at your own risk!
+       * @static
+       * @private
+       * @type {Object}
+       * @deprecated since version 1.8
+       * @member Utils
+       * @memberof Popper
+       */
+
+    }]);
+    return Popper;
+  }();
+
+  /**
+   * The `referenceObject` is an object that provides an interface compatible with Popper.js
+   * and lets you use it as replacement of a real DOM node.<br />
+   * You can use this method to position a popper relatively to a set of coordinates
+   * in case you don't have a DOM node to use as reference.
+   *
+   * ```
+   * new Popper(referenceObject, popperNode);
+   * ```
+   *
+   * NB: This feature isn't supported in Internet Explorer 10.
+   * @name referenceObject
+   * @property {Function} data.getBoundingClientRect
+   * A function that returns a set of coordinates compatible with the native `getBoundingClientRect` method.
+   * @property {number} data.clientWidth
+   * An ES6 getter that will return the width of the virtual reference element.
+   * @property {number} data.clientHeight
+   * An ES6 getter that will return the height of the virtual reference element.
+   */
+
+
+  Popper.Utils = (typeof window !== 'undefined' ? window : global).PopperUtils;
+  Popper.placements = placements;
+  Popper.Defaults = Defaults;
+
+  /**
+   * ------------------------------------------------------------------------
+   * Constants
+   * ------------------------------------------------------------------------
+   */
+
+  var NAME$4 = 'dropdown';
+  var VERSION$4 = '4.3.1';
+  var DATA_KEY$4 = 'bs.dropdown';
+  var EVENT_KEY$4 = "." + DATA_KEY$4;
+  var DATA_API_KEY$4 = '.data-api';
+  var JQUERY_NO_CONFLICT$4 = $.fn[NAME$4];
+  var ESCAPE_KEYCODE = 27; // KeyboardEvent.which value for Escape (Esc) key
+
+  var SPACE_KEYCODE = 32; // KeyboardEvent.which value for space key
+
+  var TAB_KEYCODE = 9; // KeyboardEvent.which value for tab key
+
+  var ARROW_UP_KEYCODE = 38; // KeyboardEvent.which value for up arrow key
+
+  var ARROW_DOWN_KEYCODE = 40; // KeyboardEvent.which value for down arrow key
+
+  var RIGHT_MOUSE_BUTTON_WHICH = 3; // MouseEvent.which value for the right button (assuming a right-handed mouse)
+
+  var REGEXP_KEYDOWN = new RegExp(ARROW_UP_KEYCODE + "|" + ARROW_DOWN_KEYCODE + "|" + ESCAPE_KEYCODE);
+  var Event$4 = {
+    HIDE: "hide" + EVENT_KEY$4,
+    HIDDEN: "hidden" + EVENT_KEY$4,
+    SHOW: "show" + EVENT_KEY$4,
+    SHOWN: "shown" + EVENT_KEY$4,
+    CLICK: "click" + EVENT_KEY$4,
+    CLICK_DATA_API: "click" + EVENT_KEY$4 + DATA_API_KEY$4,
+    KEYDOWN_DATA_API: "keydown" + EVENT_KEY$4 + DATA_API_KEY$4,
+    KEYUP_DATA_API: "keyup" + EVENT_KEY$4 + DATA_API_KEY$4
+  };
+  var ClassName$4 = {
+    DISABLED: 'disabled',
+    SHOW: 'show',
+    DROPUP: 'dropup',
+    DROPRIGHT: 'dropright',
+    DROPLEFT: 'dropleft',
+    MENURIGHT: 'dropdown-menu-right',
+    MENULEFT: 'dropdown-menu-left',
+    POSITION_STATIC: 'position-static'
+  };
+  var Selector$4 = {
+    DATA_TOGGLE: '[data-toggle="dropdown"]',
+    FORM_CHILD: '.dropdown form',
+    MENU: '.dropdown-menu',
+    NAVBAR_NAV: '.navbar-nav',
+    VISIBLE_ITEMS: '.dropdown-menu .dropdown-item:not(.disabled):not(:disabled)'
+  };
+  var AttachmentMap = {
+    TOP: 'top-start',
+    TOPEND: 'top-end',
+    BOTTOM: 'bottom-start',
+    BOTTOMEND: 'bottom-end',
+    RIGHT: 'right-start',
+    RIGHTEND: 'right-end',
+    LEFT: 'left-start',
+    LEFTEND: 'left-end'
+  };
+  var Default$2 = {
+    offset: 0,
+    flip: true,
+    boundary: 'scrollParent',
+    reference: 'toggle',
+    display: 'dynamic'
+  };
+  var DefaultType$2 = {
+    offset: '(number|string|function)',
+    flip: 'boolean',
+    boundary: '(string|element)',
+    reference: '(string|element)',
+    display: 'string'
+    /**
+     * ------------------------------------------------------------------------
+     * Class Definition
+     * ------------------------------------------------------------------------
+     */
+
+  };
+
+  var Dropdown =
+  /*#__PURE__*/
+  function () {
+    function Dropdown(element, config) {
+      this._element = element;
+      this._popper = null;
+      this._config = this._getConfig(config);
+      this._menu = this._getMenuElement();
+      this._inNavbar = this._detectNavbar();
+
+      this._addEventListeners();
+    } // Getters
+
+
+    var _proto = Dropdown.prototype;
+
+    // Public
+    _proto.toggle = function toggle() {
+      if (this._element.disabled || $(this._element).hasClass(ClassName$4.DISABLED)) {
+        return;
+      }
+
+      var parent = Dropdown._getParentFromElement(this._element);
+
+      var isActive = $(this._menu).hasClass(ClassName$4.SHOW);
+
+      Dropdown._clearMenus();
+
+      if (isActive) {
+        return;
+      }
+
+      var relatedTarget = {
+        relatedTarget: this._element
+      };
+      var showEvent = $.Event(Event$4.SHOW, relatedTarget);
+      $(parent).trigger(showEvent);
+
+      if (showEvent.isDefaultPrevented()) {
+        return;
+      } // Disable totally Popper.js for Dropdown in Navbar
+
+
+      if (!this._inNavbar) {
+        /**
+         * Check for Popper dependency
+         * Popper - https://popper.js.org
+         */
+        if (typeof Popper === 'undefined') {
+          throw new TypeError('Bootstrap\'s dropdowns require Popper.js (https://popper.js.org/)');
+        }
+
+        var referenceElement = this._element;
+
+        if (this._config.reference === 'parent') {
+          referenceElement = parent;
+        } else if (Util.isElement(this._config.reference)) {
+          referenceElement = this._config.reference; // Check if it's jQuery element
+
+          if (typeof this._config.reference.jquery !== 'undefined') {
+            referenceElement = this._config.reference[0];
+          }
+        } // If boundary is not `scrollParent`, then set position to `static`
+        // to allow the menu to "escape" the scroll parent's boundaries
+        // https://github.com/twbs/bootstrap/issues/24251
+
+
+        if (this._config.boundary !== 'scrollParent') {
+          $(parent).addClass(ClassName$4.POSITION_STATIC);
+        }
+
+        this._popper = new Popper(referenceElement, this._menu, this._getPopperConfig());
+      } // If this is a touch-enabled device we add extra
+      // empty mouseover listeners to the body's immediate children;
+      // only needed because of broken event delegation on iOS
+      // https://www.quirksmode.org/blog/archives/2014/02/mouse_event_bub.html
+
+
+      if ('ontouchstart' in document.documentElement && $(parent).closest(Selector$4.NAVBAR_NAV).length === 0) {
+        $(document.body).children().on('mouseover', null, $.noop);
+      }
+
+      this._element.focus();
+
+      this._element.setAttribute('aria-expanded', true);
+
+      $(this._menu).toggleClass(ClassName$4.SHOW);
+      $(parent).toggleClass(ClassName$4.SHOW).trigger($.Event(Event$4.SHOWN, relatedTarget));
+    };
+
+    _proto.show = function show() {
+      if (this._element.disabled || $(this._element).hasClass(ClassName$4.DISABLED) || $(this._menu).hasClass(ClassName$4.SHOW)) {
+        return;
+      }
+
+      var relatedTarget = {
+        relatedTarget: this._element
+      };
+      var showEvent = $.Event(Event$4.SHOW, relatedTarget);
+
+      var parent = Dropdown._getParentFromElement(this._element);
+
+      $(parent).trigger(showEvent);
+
+      if (showEvent.isDefaultPrevented()) {
+        return;
+      }
+
+      $(this._menu).toggleClass(ClassName$4.SHOW);
+      $(parent).toggleClass(ClassName$4.SHOW).trigger($.Event(Event$4.SHOWN, relatedTarget));
+    };
+
+    _proto.hide = function hide() {
+      if (this._element.disabled || $(this._element).hasClass(ClassName$4.DISABLED) || !$(this._menu).hasClass(ClassName$4.SHOW)) {
+        return;
+      }
+
+      var relatedTarget = {
+        relatedTarget: this._element
+      };
+      var hideEvent = $.Event(Event$4.HIDE, relatedTarget);
+
+      var parent = Dropdown._getParentFromElement(this._element);
+
+      $(parent).trigger(hideEvent);
+
+      if (hideEvent.isDefaultPrevented()) {
+        return;
+      }
+
+      $(this._menu).toggleClass(ClassName$4.SHOW);
+      $(parent).toggleClass(ClassName$4.SHOW).trigger($.Event(Event$4.HIDDEN, relatedTarget));
+    };
+
+    _proto.dispose = function dispose() {
+      $.removeData(this._element, DATA_KEY$4);
+      $(this._element).off(EVENT_KEY$4);
+      this._element = null;
+      this._menu = null;
+
+      if (this._popper !== null) {
+        this._popper.destroy();
+
+        this._popper = null;
+      }
+    };
+
+    _proto.update = function update() {
+      this._inNavbar = this._detectNavbar();
+
+      if (this._popper !== null) {
+        this._popper.scheduleUpdate();
+      }
+    } // Private
+    ;
+
+    _proto._addEventListeners = function _addEventListeners() {
+      var _this = this;
+
+      $(this._element).on(Event$4.CLICK, function (event) {
+        event.preventDefault();
+        event.stopPropagation();
+
+        _this.toggle();
+      });
+    };
+
+    _proto._getConfig = function _getConfig(config) {
+      config = _objectSpread({}, this.constructor.Default, $(this._element).data(), config);
+      Util.typeCheckConfig(NAME$4, config, this.constructor.DefaultType);
+      return config;
+    };
+
+    _proto._getMenuElement = function _getMenuElement() {
+      if (!this._menu) {
+        var parent = Dropdown._getParentFromElement(this._element);
+
+        if (parent) {
+          this._menu = parent.querySelector(Selector$4.MENU);
+        }
+      }
+
+      return this._menu;
+    };
+
+    _proto._getPlacement = function _getPlacement() {
+      var $parentDropdown = $(this._element.parentNode);
+      var placement = AttachmentMap.BOTTOM; // Handle dropup
+
+      if ($parentDropdown.hasClass(ClassName$4.DROPUP)) {
+        placement = AttachmentMap.TOP;
+
+        if ($(this._menu).hasClass(ClassName$4.MENURIGHT)) {
+          placement = AttachmentMap.TOPEND;
+        }
+      } else if ($parentDropdown.hasClass(ClassName$4.DROPRIGHT)) {
+        placement = AttachmentMap.RIGHT;
+      } else if ($parentDropdown.hasClass(ClassName$4.DROPLEFT)) {
+        placement = AttachmentMap.LEFT;
+      } else if ($(this._menu).hasClass(ClassName$4.MENURIGHT)) {
+        placement = AttachmentMap.BOTTOMEND;
+      }
+
+      return placement;
+    };
+
+    _proto._detectNavbar = function _detectNavbar() {
+      return $(this._element).closest('.navbar').length > 0;
+    };
+
+    _proto._getOffset = function _getOffset() {
+      var _this2 = this;
+
+      var offset = {};
+
+      if (typeof this._config.offset === 'function') {
+        offset.fn = function (data) {
+          data.offsets = _objectSpread({}, data.offsets, _this2._config.offset(data.offsets, _this2._element) || {});
+          return data;
+        };
+      } else {
+        offset.offset = this._config.offset;
+      }
+
+      return offset;
+    };
+
+    _proto._getPopperConfig = function _getPopperConfig() {
+      var popperConfig = {
+        placement: this._getPlacement(),
+        modifiers: {
+          offset: this._getOffset(),
+          flip: {
+            enabled: this._config.flip
+          },
+          preventOverflow: {
+            boundariesElement: this._config.boundary
+          }
+        } // Disable Popper.js if we have a static display
+
+      };
+
+      if (this._config.display === 'static') {
+        popperConfig.modifiers.applyStyle = {
+          enabled: false
+        };
+      }
+
+      return popperConfig;
+    } // Static
+    ;
+
+    Dropdown._jQueryInterface = function _jQueryInterface(config) {
+      return this.each(function () {
+        var data = $(this).data(DATA_KEY$4);
+
+        var _config = typeof config === 'object' ? config : null;
+
+        if (!data) {
+          data = new Dropdown(this, _config);
+          $(this).data(DATA_KEY$4, data);
+        }
+
+        if (typeof config === 'string') {
+          if (typeof data[config] === 'undefined') {
+            throw new TypeError("No method named \"" + config + "\"");
+          }
+
+          data[config]();
+        }
+      });
+    };
+
+    Dropdown._clearMenus = function _clearMenus(event) {
+      if (event && (event.which === RIGHT_MOUSE_BUTTON_WHICH || event.type === 'keyup' && event.which !== TAB_KEYCODE)) {
+        return;
+      }
+
+      var toggles = [].slice.call(document.querySelectorAll(Selector$4.DATA_TOGGLE));
+
+      for (var i = 0, len = toggles.length; i < len; i++) {
+        var parent = Dropdown._getParentFromElement(toggles[i]);
+
+        var context = $(toggles[i]).data(DATA_KEY$4);
+        var relatedTarget = {
+          relatedTarget: toggles[i]
+        };
+
+        if (event && event.type === 'click') {
+          relatedTarget.clickEvent = event;
+        }
+
+        if (!context) {
+          continue;
+        }
+
+        var dropdownMenu = context._menu;
+
+        if (!$(parent).hasClass(ClassName$4.SHOW)) {
+          continue;
+        }
+
+        if (event && (event.type === 'click' && /input|textarea/i.test(event.target.tagName) || event.type === 'keyup' && event.which === TAB_KEYCODE) && $.contains(parent, event.target)) {
+          continue;
+        }
+
+        var hideEvent = $.Event(Event$4.HIDE, relatedTarget);
+        $(parent).trigger(hideEvent);
+
+        if (hideEvent.isDefaultPrevented()) {
+          continue;
+        } // If this is a touch-enabled device we remove the extra
+        // empty mouseover listeners we added for iOS support
+
+
+        if ('ontouchstart' in document.documentElement) {
+          $(document.body).children().off('mouseover', null, $.noop);
+        }
+
+        toggles[i].setAttribute('aria-expanded', 'false');
+        $(dropdownMenu).removeClass(ClassName$4.SHOW);
+        $(parent).removeClass(ClassName$4.SHOW).trigger($.Event(Event$4.HIDDEN, relatedTarget));
+      }
+    };
+
+    Dropdown._getParentFromElement = function _getParentFromElement(element) {
+      var parent;
+      var selector = Util.getSelectorFromElement(element);
+
+      if (selector) {
+        parent = document.querySelector(selector);
+      }
+
+      return parent || element.parentNode;
+    } // eslint-disable-next-line complexity
+    ;
+
+    Dropdown._dataApiKeydownHandler = function _dataApiKeydownHandler(event) {
+      // If not input/textarea:
+      //  - And not a key in REGEXP_KEYDOWN => not a dropdown command
+      // If input/textarea:
+      //  - If space key => not a dropdown command
+      //  - If key is other than escape
+      //    - If key is not up or down => not a dropdown command
+      //    - If trigger inside the menu => not a dropdown command
+      if (/input|textarea/i.test(event.target.tagName) ? event.which === SPACE_KEYCODE || event.which !== ESCAPE_KEYCODE && (event.which !== ARROW_DOWN_KEYCODE && event.which !== ARROW_UP_KEYCODE || $(event.target).closest(Selector$4.MENU).length) : !REGEXP_KEYDOWN.test(event.which)) {
+        return;
+      }
+
+      event.preventDefault();
+      event.stopPropagation();
+
+      if (this.disabled || $(this).hasClass(ClassName$4.DISABLED)) {
+        return;
+      }
+
+      var parent = Dropdown._getParentFromElement(this);
+
+      var isActive = $(parent).hasClass(ClassName$4.SHOW);
+
+      if (!isActive || isActive && (event.which === ESCAPE_KEYCODE || event.which === SPACE_KEYCODE)) {
+        if (event.which === ESCAPE_KEYCODE) {
+          var toggle = parent.querySelector(Selector$4.DATA_TOGGLE);
+          $(toggle).trigger('focus');
+        }
+
+        $(this).trigger('click');
+        return;
+      }
+
+      var items = [].slice.call(parent.querySelectorAll(Selector$4.VISIBLE_ITEMS));
+
+      if (items.length === 0) {
+        return;
+      }
+
+      var index = items.indexOf(event.target);
+
+      if (event.which === ARROW_UP_KEYCODE && index > 0) {
+        // Up
+        index--;
+      }
+
+      if (event.which === ARROW_DOWN_KEYCODE && index < items.length - 1) {
+        // Down
+        index++;
+      }
+
+      if (index < 0) {
+        index = 0;
+      }
+
+      items[index].focus();
+    };
+
+    _createClass(Dropdown, null, [{
+      key: "VERSION",
+      get: function get() {
+        return VERSION$4;
+      }
+    }, {
+      key: "Default",
+      get: function get() {
+        return Default$2;
+      }
+    }, {
+      key: "DefaultType",
+      get: function get() {
+        return DefaultType$2;
+      }
+    }]);
+
+    return Dropdown;
+  }();
+  /**
+   * ------------------------------------------------------------------------
+   * Data Api implementation
+   * ------------------------------------------------------------------------
+   */
+
+
+  $(document).on(Event$4.KEYDOWN_DATA_API, Selector$4.DATA_TOGGLE, Dropdown._dataApiKeydownHandler).on(Event$4.KEYDOWN_DATA_API, Selector$4.MENU, Dropdown._dataApiKeydownHandler).on(Event$4.CLICK_DATA_API + " " + Event$4.KEYUP_DATA_API, Dropdown._clearMenus).on(Event$4.CLICK_DATA_API, Selector$4.DATA_TOGGLE, function (event) {
+    event.preventDefault();
+    event.stopPropagation();
+
+    Dropdown._jQueryInterface.call($(this), 'toggle');
+  }).on(Event$4.CLICK_DATA_API, Selector$4.FORM_CHILD, function (e) {
+    e.stopPropagation();
+  });
+  /**
+   * ------------------------------------------------------------------------
+   * jQuery
+   * ------------------------------------------------------------------------
+   */
+
+  $.fn[NAME$4] = Dropdown._jQueryInterface;
+  $.fn[NAME$4].Constructor = Dropdown;
+
+  $.fn[NAME$4].noConflict = function () {
+    $.fn[NAME$4] = JQUERY_NO_CONFLICT$4;
+    return Dropdown._jQueryInterface;
+  };
+
+  /**
+   * ------------------------------------------------------------------------
+   * Constants
+   * ------------------------------------------------------------------------
+   */
+
+  var NAME$5 = 'modal';
+  var VERSION$5 = '4.3.1';
+  var DATA_KEY$5 = 'bs.modal';
+  var EVENT_KEY$5 = "." + DATA_KEY$5;
+  var DATA_API_KEY$5 = '.data-api';
+  var JQUERY_NO_CONFLICT$5 = $.fn[NAME$5];
+  var ESCAPE_KEYCODE$1 = 27; // KeyboardEvent.which value for Escape (Esc) key
+
+  var Default$3 = {
+    backdrop: true,
+    keyboard: true,
+    focus: true,
+    show: true
+  };
+  var DefaultType$3 = {
+    backdrop: '(boolean|string)',
+    keyboard: 'boolean',
+    focus: 'boolean',
+    show: 'boolean'
+  };
+  var Event$5 = {
+    HIDE: "hide" + EVENT_KEY$5,
+    HIDDEN: "hidden" + EVENT_KEY$5,
+    SHOW: "show" + EVENT_KEY$5,
+    SHOWN: "shown" + EVENT_KEY$5,
+    FOCUSIN: "focusin" + EVENT_KEY$5,
+    RESIZE: "resize" + EVENT_KEY$5,
+    CLICK_DISMISS: "click.dismiss" + EVENT_KEY$5,
+    KEYDOWN_DISMISS: "keydown.dismiss" + EVENT_KEY$5,
+    MOUSEUP_DISMISS: "mouseup.dismiss" + EVENT_KEY$5,
+    MOUSEDOWN_DISMISS: "mousedown.dismiss" + EVENT_KEY$5,
+    CLICK_DATA_API: "click" + EVENT_KEY$5 + DATA_API_KEY$5
+  };
+  var ClassName$5 = {
+    SCROLLABLE: 'modal-dialog-scrollable',
+    SCROLLBAR_MEASURER: 'modal-scrollbar-measure',
+    BACKDROP: 'modal-backdrop',
+    OPEN: 'modal-open',
+    FADE: 'fade',
+    SHOW: 'show'
+  };
+  var Selector$5 = {
+    DIALOG: '.modal-dialog',
+    MODAL_BODY: '.modal-body',
+    DATA_TOGGLE: '[data-toggle="modal"]',
+    DATA_DISMISS: '[data-dismiss="modal"]',
+    FIXED_CONTENT: '.fixed-top, .fixed-bottom, .is-fixed, .sticky-top',
+    STICKY_CONTENT: '.sticky-top'
+    /**
+     * ------------------------------------------------------------------------
+     * Class Definition
+     * ------------------------------------------------------------------------
+     */
+
+  };
+
+  var Modal =
+  /*#__PURE__*/
+  function () {
+    function Modal(element, config) {
+      this._config = this._getConfig(config);
+      this._element = element;
+      this._dialog = element.querySelector(Selector$5.DIALOG);
+      this._backdrop = null;
+      this._isShown = false;
+      this._isBodyOverflowing = false;
+      this._ignoreBackdropClick = false;
+      this._isTransitioning = false;
+      this._scrollbarWidth = 0;
+    } // Getters
+
+
+    var _proto = Modal.prototype;
+
+    // Public
+    _proto.toggle = function toggle(relatedTarget) {
+      return this._isShown ? this.hide() : this.show(relatedTarget);
+    };
+
+    _proto.show = function show(relatedTarget) {
+      var _this = this;
+
+      if (this._isShown || this._isTransitioning) {
+        return;
+      }
+
+      if ($(this._element).hasClass(ClassName$5.FADE)) {
+        this._isTransitioning = true;
+      }
+
+      var showEvent = $.Event(Event$5.SHOW, {
+        relatedTarget: relatedTarget
+      });
+      $(this._element).trigger(showEvent);
+
+      if (this._isShown || showEvent.isDefaultPrevented()) {
+        return;
+      }
+
+      this._isShown = true;
+
+      this._checkScrollbar();
+
+      this._setScrollbar();
+
+      this._adjustDialog();
+
+      this._setEscapeEvent();
+
+      this._setResizeEvent();
+
+      $(this._element).on(Event$5.CLICK_DISMISS, Selector$5.DATA_DISMISS, function (event) {
+        return _this.hide(event);
+      });
+      $(this._dialog).on(Event$5.MOUSEDOWN_DISMISS, function () {
+        $(_this._element).one(Event$5.MOUSEUP_DISMISS, function (event) {
+          if ($(event.target).is(_this._element)) {
+            _this._ignoreBackdropClick = true;
+          }
+        });
+      });
+
+      this._showBackdrop(function () {
+        return _this._showElement(relatedTarget);
+      });
+    };
+
+    _proto.hide = function hide(event) {
+      var _this2 = this;
+
+      if (event) {
+        event.preventDefault();
+      }
+
+      if (!this._isShown || this._isTransitioning) {
+        return;
+      }
+
+      var hideEvent = $.Event(Event$5.HIDE);
+      $(this._element).trigger(hideEvent);
+
+      if (!this._isShown || hideEvent.isDefaultPrevented()) {
+        return;
+      }
+
+      this._isShown = false;
+      var transition = $(this._element).hasClass(ClassName$5.FADE);
+
+      if (transition) {
+        this._isTransitioning = true;
+      }
+
+      this._setEscapeEvent();
+
+      this._setResizeEvent();
+
+      $(document).off(Event$5.FOCUSIN);
+      $(this._element).removeClass(ClassName$5.SHOW);
+      $(this._element).off(Event$5.CLICK_DISMISS);
+      $(this._dialog).off(Event$5.MOUSEDOWN_DISMISS);
+
+      if (transition) {
+        var transitionDuration = Util.getTransitionDurationFromElement(this._element);
+        $(this._element).one(Util.TRANSITION_END, function (event) {
+          return _this2._hideModal(event);
+        }).emulateTransitionEnd(transitionDuration);
+      } else {
+        this._hideModal();
+      }
+    };
+
+    _proto.dispose = function dispose() {
+      [window, this._element, this._dialog].forEach(function (htmlElement) {
+        return $(htmlElement).off(EVENT_KEY$5);
+      });
+      /**
+       * `document` has 2 events `Event.FOCUSIN` and `Event.CLICK_DATA_API`
+       * Do not move `document` in `htmlElements` array
+       * It will remove `Event.CLICK_DATA_API` event that should remain
+       */
+
+      $(document).off(Event$5.FOCUSIN);
+      $.removeData(this._element, DATA_KEY$5);
+      this._config = null;
+      this._element = null;
+      this._dialog = null;
+      this._backdrop = null;
+      this._isShown = null;
+      this._isBodyOverflowing = null;
+      this._ignoreBackdropClick = null;
+      this._isTransitioning = null;
+      this._scrollbarWidth = null;
+    };
+
+    _proto.handleUpdate = function handleUpdate() {
+      this._adjustDialog();
+    } // Private
+    ;
+
+    _proto._getConfig = function _getConfig(config) {
+      config = _objectSpread({}, Default$3, config);
+      Util.typeCheckConfig(NAME$5, config, DefaultType$3);
+      return config;
+    };
+
+    _proto._showElement = function _showElement(relatedTarget) {
+      var _this3 = this;
+
+      var transition = $(this._element).hasClass(ClassName$5.FADE);
+
+      if (!this._element.parentNode || this._element.parentNode.nodeType !== Node.ELEMENT_NODE) {
+        // Don't move modal's DOM position
+        document.body.appendChild(this._element);
+      }
+
+      this._element.style.display = 'block';
+
+      this._element.removeAttribute('aria-hidden');
+
+      this._element.setAttribute('aria-modal', true);
+
+      if ($(this._dialog).hasClass(ClassName$5.SCROLLABLE)) {
+        this._dialog.querySelector(Selector$5.MODAL_BODY).scrollTop = 0;
+      } else {
+        this._element.scrollTop = 0;
+      }
+
+      if (transition) {
+        Util.reflow(this._element);
+      }
+
+      $(this._element).addClass(ClassName$5.SHOW);
+
+      if (this._config.focus) {
+        this._enforceFocus();
+      }
+
+      var shownEvent = $.Event(Event$5.SHOWN, {
+        relatedTarget: relatedTarget
+      });
+
+      var transitionComplete = function transitionComplete() {
+        if (_this3._config.focus) {
+          _this3._element.focus();
+        }
+
+        _this3._isTransitioning = false;
+        $(_this3._element).trigger(shownEvent);
+      };
+
+      if (transition) {
+        var transitionDuration = Util.getTransitionDurationFromElement(this._dialog);
+        $(this._dialog).one(Util.TRANSITION_END, transitionComplete).emulateTransitionEnd(transitionDuration);
+      } else {
+        transitionComplete();
+      }
+    };
+
+    _proto._enforceFocus = function _enforceFocus() {
+      var _this4 = this;
+
+      $(document).off(Event$5.FOCUSIN) // Guard against infinite focus loop
+      .on(Event$5.FOCUSIN, function (event) {
+        if (document !== event.target && _this4._element !== event.target && $(_this4._element).has(event.target).length === 0) {
+          _this4._element.focus();
+        }
+      });
+    };
+
+    _proto._setEscapeEvent = function _setEscapeEvent() {
+      var _this5 = this;
+
+      if (this._isShown && this._config.keyboard) {
+        $(this._element).on(Event$5.KEYDOWN_DISMISS, function (event) {
+          if (event.which === ESCAPE_KEYCODE$1) {
+            event.preventDefault();
+
+            _this5.hide();
+          }
+        });
+      } else if (!this._isShown) {
+        $(this._element).off(Event$5.KEYDOWN_DISMISS);
+      }
+    };
+
+    _proto._setResizeEvent = function _setResizeEvent() {
+      var _this6 = this;
+
+      if (this._isShown) {
+        $(window).on(Event$5.RESIZE, function (event) {
+          return _this6.handleUpdate(event);
+        });
+      } else {
+        $(window).off(Event$5.RESIZE);
+      }
+    };
+
+    _proto._hideModal = function _hideModal() {
+      var _this7 = this;
+
+      this._element.style.display = 'none';
+
+      this._element.setAttribute('aria-hidden', true);
+
+      this._element.removeAttribute('aria-modal');
+
+      this._isTransitioning = false;
+
+      this._showBackdrop(function () {
+        $(document.body).removeClass(ClassName$5.OPEN);
+
+        _this7._resetAdjustments();
+
+        _this7._resetScrollbar();
+
+        $(_this7._element).trigger(Event$5.HIDDEN);
+      });
+    };
+
+    _proto._removeBackdrop = function _removeBackdrop() {
+      if (this._backdrop) {
+        $(this._backdrop).remove();
+        this._backdrop = null;
+      }
+    };
+
+    _proto._showBackdrop = function _showBackdrop(callback) {
+      var _this8 = this;
+
+      var animate = $(this._element).hasClass(ClassName$5.FADE) ? ClassName$5.FADE : '';
+
+      if (this._isShown && this._config.backdrop) {
+        this._backdrop = document.createElement('div');
+        this._backdrop.className = ClassName$5.BACKDROP;
+
+        if (animate) {
+          this._backdrop.classList.add(animate);
+        }
+
+        $(this._backdrop).appendTo(document.body);
+        $(this._element).on(Event$5.CLICK_DISMISS, function (event) {
+          if (_this8._ignoreBackdropClick) {
+            _this8._ignoreBackdropClick = false;
+            return;
+          }
+
+          if (event.target !== event.currentTarget) {
+            return;
+          }
+
+          if (_this8._config.backdrop === 'static') {
+            _this8._element.focus();
+          } else {
+            _this8.hide();
+          }
+        });
+
+        if (animate) {
+          Util.reflow(this._backdrop);
+        }
+
+        $(this._backdrop).addClass(ClassName$5.SHOW);
+
+        if (!callback) {
+          return;
+        }
+
+        if (!animate) {
+          callback();
+          return;
+        }
+
+        var backdropTransitionDuration = Util.getTransitionDurationFromElement(this._backdrop);
+        $(this._backdrop).one(Util.TRANSITION_END, callback).emulateTransitionEnd(backdropTransitionDuration);
+      } else if (!this._isShown && this._backdrop) {
+        $(this._backdrop).removeClass(ClassName$5.SHOW);
+
+        var callbackRemove = function callbackRemove() {
+          _this8._removeBackdrop();
+
+          if (callback) {
+            callback();
+          }
+        };
+
+        if ($(this._element).hasClass(ClassName$5.FADE)) {
+          var _backdropTransitionDuration = Util.getTransitionDurationFromElement(this._backdrop);
+
+          $(this._backdrop).one(Util.TRANSITION_END, callbackRemove).emulateTransitionEnd(_backdropTransitionDuration);
+        } else {
+          callbackRemove();
+        }
+      } else if (callback) {
+        callback();
+      }
+    } // ----------------------------------------------------------------------
+    // the following methods are used to handle overflowing modals
+    // todo (fat): these should probably be refactored out of modal.js
+    // ----------------------------------------------------------------------
+    ;
+
+    _proto._adjustDialog = function _adjustDialog() {
+      var isModalOverflowing = this._element.scrollHeight > document.documentElement.clientHeight;
+
+      if (!this._isBodyOverflowing && isModalOverflowing) {
+        this._element.style.paddingLeft = this._scrollbarWidth + "px";
+      }
+
+      if (this._isBodyOverflowing && !isModalOverflowing) {
+        this._element.style.paddingRight = this._scrollbarWidth + "px";
+      }
+    };
+
+    _proto._resetAdjustments = function _resetAdjustments() {
+      this._element.style.paddingLeft = '';
+      this._element.style.paddingRight = '';
+    };
+
+    _proto._checkScrollbar = function _checkScrollbar() {
+      var rect = document.body.getBoundingClientRect();
+      this._isBodyOverflowing = rect.left + rect.right < window.innerWidth;
+      this._scrollbarWidth = this._getScrollbarWidth();
+    };
+
+    _proto._setScrollbar = function _setScrollbar() {
+      var _this9 = this;
+
+      if (this._isBodyOverflowing) {
+        // Note: DOMNode.style.paddingRight returns the actual value or '' if not set
+        //   while $(DOMNode).css('padding-right') returns the calculated value or 0 if not set
+        var fixedContent = [].slice.call(document.querySelectorAll(Selector$5.FIXED_CONTENT));
+        var stickyContent = [].slice.call(document.querySelectorAll(Selector$5.STICKY_CONTENT)); // Adjust fixed content padding
+
+        $(fixedContent).each(function (index, element) {
+          var actualPadding = element.style.paddingRight;
+          var calculatedPadding = $(element).css('padding-right');
+          $(element).data('padding-right', actualPadding).css('padding-right', parseFloat(calculatedPadding) + _this9._scrollbarWidth + "px");
+        }); // Adjust sticky content margin
+
+        $(stickyContent).each(function (index, element) {
+          var actualMargin = element.style.marginRight;
+          var calculatedMargin = $(element).css('margin-right');
+          $(element).data('margin-right', actualMargin).css('margin-right', parseFloat(calculatedMargin) - _this9._scrollbarWidth + "px");
+        }); // Adjust body padding
+
+        var actualPadding = document.body.style.paddingRight;
+        var calculatedPadding = $(document.body).css('padding-right');
+        $(document.body).data('padding-right', actualPadding).css('padding-right', parseFloat(calculatedPadding) + this._scrollbarWidth + "px");
+      }
+
+      $(document.body).addClass(ClassName$5.OPEN);
+    };
+
+    _proto._resetScrollbar = function _resetScrollbar() {
+      // Restore fixed content padding
+      var fixedContent = [].slice.call(document.querySelectorAll(Selector$5.FIXED_CONTENT));
+      $(fixedContent).each(function (index, element) {
+        var padding = $(element).data('padding-right');
+        $(element).removeData('padding-right');
+        element.style.paddingRight = padding ? padding : '';
+      }); // Restore sticky content
+
+      var elements = [].slice.call(document.querySelectorAll("" + Selector$5.STICKY_CONTENT));
+      $(elements).each(function (index, element) {
+        var margin = $(element).data('margin-right');
+
+        if (typeof margin !== 'undefined') {
+          $(element).css('margin-right', margin).removeData('margin-right');
+        }
+      }); // Restore body padding
+
+      var padding = $(document.body).data('padding-right');
+      $(document.body).removeData('padding-right');
+      document.body.style.paddingRight = padding ? padding : '';
+    };
+
+    _proto._getScrollbarWidth = function _getScrollbarWidth() {
+      // thx d.walsh
+      var scrollDiv = document.createElement('div');
+      scrollDiv.className = ClassName$5.SCROLLBAR_MEASURER;
+      document.body.appendChild(scrollDiv);
+      var scrollbarWidth = scrollDiv.getBoundingClientRect().width - scrollDiv.clientWidth;
+      document.body.removeChild(scrollDiv);
+      return scrollbarWidth;
+    } // Static
+    ;
+
+    Modal._jQueryInterface = function _jQueryInterface(config, relatedTarget) {
+      return this.each(function () {
+        var data = $(this).data(DATA_KEY$5);
+
+        var _config = _objectSpread({}, Default$3, $(this).data(), typeof config === 'object' && config ? config : {});
+
+        if (!data) {
+          data = new Modal(this, _config);
+          $(this).data(DATA_KEY$5, data);
+        }
+
+        if (typeof config === 'string') {
+          if (typeof data[config] === 'undefined') {
+            throw new TypeError("No method named \"" + config + "\"");
+          }
+
+          data[config](relatedTarget);
+        } else if (_config.show) {
+          data.show(relatedTarget);
+        }
+      });
+    };
+
+    _createClass(Modal, null, [{
+      key: "VERSION",
+      get: function get() {
+        return VERSION$5;
+      }
+    }, {
+      key: "Default",
+      get: function get() {
+        return Default$3;
+      }
+    }]);
+
+    return Modal;
+  }();
+  /**
+   * ------------------------------------------------------------------------
+   * Data Api implementation
+   * ------------------------------------------------------------------------
+   */
+
+
+  $(document).on(Event$5.CLICK_DATA_API, Selector$5.DATA_TOGGLE, function (event) {
+    var _this10 = this;
+
+    var target;
+    var selector = Util.getSelectorFromElement(this);
+
+    if (selector) {
+      target = document.querySelector(selector);
+    }
+
+    var config = $(target).data(DATA_KEY$5) ? 'toggle' : _objectSpread({}, $(target).data(), $(this).data());
+
+    if (this.tagName === 'A' || this.tagName === 'AREA') {
+      event.preventDefault();
+    }
+
+    var $target = $(target).one(Event$5.SHOW, function (showEvent) {
+      if (showEvent.isDefaultPrevented()) {
+        // Only register focus restorer if modal will actually get shown
+        return;
+      }
+
+      $target.one(Event$5.HIDDEN, function () {
+        if ($(_this10).is(':visible')) {
+          _this10.focus();
+        }
+      });
+    });
+
+    Modal._jQueryInterface.call($(target), config, this);
+  });
+  /**
+   * ------------------------------------------------------------------------
+   * jQuery
+   * ------------------------------------------------------------------------
+   */
+
+  $.fn[NAME$5] = Modal._jQueryInterface;
+  $.fn[NAME$5].Constructor = Modal;
+
+  $.fn[NAME$5].noConflict = function () {
+    $.fn[NAME$5] = JQUERY_NO_CONFLICT$5;
+    return Modal._jQueryInterface;
+  };
+
+  /**
+   * --------------------------------------------------------------------------
+   * Bootstrap (v4.3.1): tools/sanitizer.js
+   * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+   * --------------------------------------------------------------------------
+   */
+  var uriAttrs = ['background', 'cite', 'href', 'itemtype', 'longdesc', 'poster', 'src', 'xlink:href'];
+  var ARIA_ATTRIBUTE_PATTERN = /^aria-[\w-]*$/i;
+  var DefaultWhitelist = {
+    // Global attributes allowed on any supplied element below.
+    '*': ['class', 'dir', 'id', 'lang', 'role', ARIA_ATTRIBUTE_PATTERN],
+    a: ['target', 'href', 'title', 'rel'],
+    area: [],
+    b: [],
+    br: [],
+    col: [],
+    code: [],
+    div: [],
+    em: [],
+    hr: [],
+    h1: [],
+    h2: [],
+    h3: [],
+    h4: [],
+    h5: [],
+    h6: [],
+    i: [],
+    img: ['src', 'alt', 'title', 'width', 'height'],
+    li: [],
+    ol: [],
+    p: [],
+    pre: [],
+    s: [],
+    small: [],
+    span: [],
+    sub: [],
+    sup: [],
+    strong: [],
+    u: [],
+    ul: []
+    /**
+     * A pattern that recognizes a commonly useful subset of URLs that are safe.
+     *
+     * Shoutout to Angular 7 https://github.com/angular/angular/blob/7.2.4/packages/core/src/sanitization/url_sanitizer.ts
+     */
+
+  };
+  var SAFE_URL_PATTERN = /^(?:(?:https?|mailto|ftp|tel|file):|[^&:/?#]*(?:[/?#]|$))/gi;
+  /**
+   * A pattern that matches safe data URLs. Only matches image, video and audio types.
+   *
+   * Shoutout to Angular 7 https://github.com/angular/angular/blob/7.2.4/packages/core/src/sanitization/url_sanitizer.ts
+   */
+
+  var DATA_URL_PATTERN = /^data:(?:image\/(?:bmp|gif|jpeg|jpg|png|tiff|webp)|video\/(?:mpeg|mp4|ogg|webm)|audio\/(?:mp3|oga|ogg|opus));base64,[a-z0-9+/]+=*$/i;
+
+  function allowedAttribute(attr, allowedAttributeList) {
+    var attrName = attr.nodeName.toLowerCase();
+
+    if (allowedAttributeList.indexOf(attrName) !== -1) {
+      if (uriAttrs.indexOf(attrName) !== -1) {
+        return Boolean(attr.nodeValue.match(SAFE_URL_PATTERN) || attr.nodeValue.match(DATA_URL_PATTERN));
+      }
+
+      return true;
+    }
+
+    var regExp = allowedAttributeList.filter(function (attrRegex) {
+      return attrRegex instanceof RegExp;
+    }); // Check if a regular expression validates the attribute.
+
+    for (var i = 0, l = regExp.length; i < l; i++) {
+      if (attrName.match(regExp[i])) {
+        return true;
+      }
+    }
+
+    return false;
+  }
+
+  function sanitizeHtml(unsafeHtml, whiteList, sanitizeFn) {
+    if (unsafeHtml.length === 0) {
+      return unsafeHtml;
+    }
+
+    if (sanitizeFn && typeof sanitizeFn === 'function') {
+      return sanitizeFn(unsafeHtml);
+    }
+
+    var domParser = new window.DOMParser();
+    var createdDocument = domParser.parseFromString(unsafeHtml, 'text/html');
+    var whitelistKeys = Object.keys(whiteList);
+    var elements = [].slice.call(createdDocument.body.querySelectorAll('*'));
+
+    var _loop = function _loop(i, len) {
+      var el = elements[i];
+      var elName = el.nodeName.toLowerCase();
+
+      if (whitelistKeys.indexOf(el.nodeName.toLowerCase()) === -1) {
+        el.parentNode.removeChild(el);
+        return "continue";
+      }
+
+      var attributeList = [].slice.call(el.attributes);
+      var whitelistedAttributes = [].concat(whiteList['*'] || [], whiteList[elName] || []);
+      attributeList.forEach(function (attr) {
+        if (!allowedAttribute(attr, whitelistedAttributes)) {
+          el.removeAttribute(attr.nodeName);
+        }
+      });
+    };
+
+    for (var i = 0, len = elements.length; i < len; i++) {
+      var _ret = _loop(i, len);
+
+      if (_ret === "continue") continue;
+    }
+
+    return createdDocument.body.innerHTML;
+  }
+
+  /**
+   * ------------------------------------------------------------------------
+   * Constants
+   * ------------------------------------------------------------------------
+   */
+
+  var NAME$6 = 'tooltip';
+  var VERSION$6 = '4.3.1';
+  var DATA_KEY$6 = 'bs.tooltip';
+  var EVENT_KEY$6 = "." + DATA_KEY$6;
+  var JQUERY_NO_CONFLICT$6 = $.fn[NAME$6];
+  var CLASS_PREFIX = 'bs-tooltip';
+  var BSCLS_PREFIX_REGEX = new RegExp("(^|\\s)" + CLASS_PREFIX + "\\S+", 'g');
+  var DISALLOWED_ATTRIBUTES = ['sanitize', 'whiteList', 'sanitizeFn'];
+  var DefaultType$4 = {
+    animation: 'boolean',
+    template: 'string',
+    title: '(string|element|function)',
+    trigger: 'string',
+    delay: '(number|object)',
+    html: 'boolean',
+    selector: '(string|boolean)',
+    placement: '(string|function)',
+    offset: '(number|string|function)',
+    container: '(string|element|boolean)',
+    fallbackPlacement: '(string|array)',
+    boundary: '(string|element)',
+    sanitize: 'boolean',
+    sanitizeFn: '(null|function)',
+    whiteList: 'object'
+  };
+  var AttachmentMap$1 = {
+    AUTO: 'auto',
+    TOP: 'top',
+    RIGHT: 'right',
+    BOTTOM: 'bottom',
+    LEFT: 'left'
+  };
+  var Default$4 = {
+    animation: true,
+    template: '<div class="tooltip" role="tooltip">' + '<div class="arrow"></div>' + '<div class="tooltip-inner"></div></div>',
+    trigger: 'hover focus',
+    title: '',
+    delay: 0,
+    html: false,
+    selector: false,
+    placement: 'top',
+    offset: 0,
+    container: false,
+    fallbackPlacement: 'flip',
+    boundary: 'scrollParent',
+    sanitize: true,
+    sanitizeFn: null,
+    whiteList: DefaultWhitelist
+  };
+  var HoverState = {
+    SHOW: 'show',
+    OUT: 'out'
+  };
+  var Event$6 = {
+    HIDE: "hide" + EVENT_KEY$6,
+    HIDDEN: "hidden" + EVENT_KEY$6,
+    SHOW: "show" + EVENT_KEY$6,
+    SHOWN: "shown" + EVENT_KEY$6,
+    INSERTED: "inserted" + EVENT_KEY$6,
+    CLICK: "click" + EVENT_KEY$6,
+    FOCUSIN: "focusin" + EVENT_KEY$6,
+    FOCUSOUT: "focusout" + EVENT_KEY$6,
+    MOUSEENTER: "mouseenter" + EVENT_KEY$6,
+    MOUSELEAVE: "mouseleave" + EVENT_KEY$6
+  };
+  var ClassName$6 = {
+    FADE: 'fade',
+    SHOW: 'show'
+  };
+  var Selector$6 = {
+    TOOLTIP: '.tooltip',
+    TOOLTIP_INNER: '.tooltip-inner',
+    ARROW: '.arrow'
+  };
+  var Trigger = {
+    HOVER: 'hover',
+    FOCUS: 'focus',
+    CLICK: 'click',
+    MANUAL: 'manual'
+    /**
+     * ------------------------------------------------------------------------
+     * Class Definition
+     * ------------------------------------------------------------------------
+     */
+
+  };
+
+  var Tooltip =
+  /*#__PURE__*/
+  function () {
+    function Tooltip(element, config) {
+      /**
+       * Check for Popper dependency
+       * Popper - https://popper.js.org
+       */
+      if (typeof Popper === 'undefined') {
+        throw new TypeError('Bootstrap\'s tooltips require Popper.js (https://popper.js.org/)');
+      } // private
+
+
+      this._isEnabled = true;
+      this._timeout = 0;
+      this._hoverState = '';
+      this._activeTrigger = {};
+      this._popper = null; // Protected
+
+      this.element = element;
+      this.config = this._getConfig(config);
+      this.tip = null;
+
+      this._setListeners();
+    } // Getters
+
+
+    var _proto = Tooltip.prototype;
+
+    // Public
+    _proto.enable = function enable() {
+      this._isEnabled = true;
+    };
+
+    _proto.disable = function disable() {
+      this._isEnabled = false;
+    };
+
+    _proto.toggleEnabled = function toggleEnabled() {
+      this._isEnabled = !this._isEnabled;
+    };
+
+    _proto.toggle = function toggle(event) {
+      if (!this._isEnabled) {
+        return;
+      }
+
+      if (event) {
+        var dataKey = this.constructor.DATA_KEY;
+        var context = $(event.currentTarget).data(dataKey);
+
+        if (!context) {
+          context = new this.constructor(event.currentTarget, this._getDelegateConfig());
+          $(event.currentTarget).data(dataKey, context);
+        }
+
+        context._activeTrigger.click = !context._activeTrigger.click;
+
+        if (context._isWithActiveTrigger()) {
+          context._enter(null, context);
+        } else {
+          context._leave(null, context);
+        }
+      } else {
+        if ($(this.getTipElement()).hasClass(ClassName$6.SHOW)) {
+          this._leave(null, this);
+
+          return;
+        }
+
+        this._enter(null, this);
+      }
+    };
+
+    _proto.dispose = function dispose() {
+      clearTimeout(this._timeout);
+      $.removeData(this.element, this.constructor.DATA_KEY);
+      $(this.element).off(this.constructor.EVENT_KEY);
+      $(this.element).closest('.modal').off('hide.bs.modal');
+
+      if (this.tip) {
+        $(this.tip).remove();
+      }
+
+      this._isEnabled = null;
+      this._timeout = null;
+      this._hoverState = null;
+      this._activeTrigger = null;
+
+      if (this._popper !== null) {
+        this._popper.destroy();
+      }
+
+      this._popper = null;
+      this.element = null;
+      this.config = null;
+      this.tip = null;
+    };
+
+    _proto.show = function show() {
+      var _this = this;
+
+      if ($(this.element).css('display') === 'none') {
+        throw new Error('Please use show on visible elements');
+      }
+
+      var showEvent = $.Event(this.constructor.Event.SHOW);
+
+      if (this.isWithContent() && this._isEnabled) {
+        $(this.element).trigger(showEvent);
+        var shadowRoot = Util.findShadowRoot(this.element);
+        var isInTheDom = $.contains(shadowRoot !== null ? shadowRoot : this.element.ownerDocument.documentElement, this.element);
+
+        if (showEvent.isDefaultPrevented() || !isInTheDom) {
+          return;
+        }
+
+        var tip = this.getTipElement();
+        var tipId = Util.getUID(this.constructor.NAME);
+        tip.setAttribute('id', tipId);
+        this.element.setAttribute('aria-describedby', tipId);
+        this.setContent();
+
+        if (this.config.animation) {
+          $(tip).addClass(ClassName$6.FADE);
+        }
+
+        var placement = typeof this.config.placement === 'function' ? this.config.placement.call(this, tip, this.element) : this.config.placement;
+
+        var attachment = this._getAttachment(placement);
+
+        this.addAttachmentClass(attachment);
+
+        var container = this._getContainer();
+
+        $(tip).data(this.constructor.DATA_KEY, this);
+
+        if (!$.contains(this.element.ownerDocument.documentElement, this.tip)) {
+          $(tip).appendTo(container);
+        }
+
+        $(this.element).trigger(this.constructor.Event.INSERTED);
+        this._popper = new Popper(this.element, tip, {
+          placement: attachment,
+          modifiers: {
+            offset: this._getOffset(),
+            flip: {
+              behavior: this.config.fallbackPlacement
+            },
+            arrow: {
+              element: Selector$6.ARROW
+            },
+            preventOverflow: {
+              boundariesElement: this.config.boundary
+            }
+          },
+          onCreate: function onCreate(data) {
+            if (data.originalPlacement !== data.placement) {
+              _this._handlePopperPlacementChange(data);
+            }
+          },
+          onUpdate: function onUpdate(data) {
+            return _this._handlePopperPlacementChange(data);
+          }
+        });
+        $(tip).addClass(ClassName$6.SHOW); // If this is a touch-enabled device we add extra
+        // empty mouseover listeners to the body's immediate children;
+        // only needed because of broken event delegation on iOS
+        // https://www.quirksmode.org/blog/archives/2014/02/mouse_event_bub.html
+
+        if ('ontouchstart' in document.documentElement) {
+          $(document.body).children().on('mouseover', null, $.noop);
+        }
+
+        var complete = function complete() {
+          if (_this.config.animation) {
+            _this._fixTransition();
+          }
+
+          var prevHoverState = _this._hoverState;
+          _this._hoverState = null;
+          $(_this.element).trigger(_this.constructor.Event.SHOWN);
+
+          if (prevHoverState === HoverState.OUT) {
+            _this._leave(null, _this);
+          }
+        };
+
+        if ($(this.tip).hasClass(ClassName$6.FADE)) {
+          var transitionDuration = Util.getTransitionDurationFromElement(this.tip);
+          $(this.tip).one(Util.TRANSITION_END, complete).emulateTransitionEnd(transitionDuration);
+        } else {
+          complete();
+        }
+      }
+    };
+
+    _proto.hide = function hide(callback) {
+      var _this2 = this;
+
+      var tip = this.getTipElement();
+      var hideEvent = $.Event(this.constructor.Event.HIDE);
+
+      var complete = function complete() {
+        if (_this2._hoverState !== HoverState.SHOW && tip.parentNode) {
+          tip.parentNode.removeChild(tip);
+        }
+
+        _this2._cleanTipClass();
+
+        _this2.element.removeAttribute('aria-describedby');
+
+        $(_this2.element).trigger(_this2.constructor.Event.HIDDEN);
+
+        if (_this2._popper !== null) {
+          _this2._popper.destroy();
+        }
+
+        if (callback) {
+          callback();
+        }
+      };
+
+      $(this.element).trigger(hideEvent);
+
+      if (hideEvent.isDefaultPrevented()) {
+        return;
+      }
+
+      $(tip).removeClass(ClassName$6.SHOW); // If this is a touch-enabled device we remove the extra
+      // empty mouseover listeners we added for iOS support
+
+      if ('ontouchstart' in document.documentElement) {
+        $(document.body).children().off('mouseover', null, $.noop);
+      }
+
+      this._activeTrigger[Trigger.CLICK] = false;
+      this._activeTrigger[Trigger.FOCUS] = false;
+      this._activeTrigger[Trigger.HOVER] = false;
+
+      if ($(this.tip).hasClass(ClassName$6.FADE)) {
+        var transitionDuration = Util.getTransitionDurationFromElement(tip);
+        $(tip).one(Util.TRANSITION_END, complete).emulateTransitionEnd(transitionDuration);
+      } else {
+        complete();
+      }
+
+      this._hoverState = '';
+    };
+
+    _proto.update = function update() {
+      if (this._popper !== null) {
+        this._popper.scheduleUpdate();
+      }
+    } // Protected
+    ;
+
+    _proto.isWithContent = function isWithContent() {
+      return Boolean(this.getTitle());
+    };
+
+    _proto.addAttachmentClass = function addAttachmentClass(attachment) {
+      $(this.getTipElement()).addClass(CLASS_PREFIX + "-" + attachment);
+    };
+
+    _proto.getTipElement = function getTipElement() {
+      this.tip = this.tip || $(this.config.template)[0];
+      return this.tip;
+    };
+
+    _proto.setContent = function setContent() {
+      var tip = this.getTipElement();
+      this.setElementContent($(tip.querySelectorAll(Selector$6.TOOLTIP_INNER)), this.getTitle());
+      $(tip).removeClass(ClassName$6.FADE + " " + ClassName$6.SHOW);
+    };
+
+    _proto.setElementContent = function setElementContent($element, content) {
+      if (typeof content === 'object' && (content.nodeType || content.jquery)) {
+        // Content is a DOM node or a jQuery
+        if (this.config.html) {
+          if (!$(content).parent().is($element)) {
+            $element.empty().append(content);
+          }
+        } else {
+          $element.text($(content).text());
+        }
+
+        return;
+      }
+
+      if (this.config.html) {
+        if (this.config.sanitize) {
+          content = sanitizeHtml(content, this.config.whiteList, this.config.sanitizeFn);
+        }
+
+        $element.html(content);
+      } else {
+        $element.text(content);
+      }
+    };
+
+    _proto.getTitle = function getTitle() {
+      var title = this.element.getAttribute('data-original-title');
+
+      if (!title) {
+        title = typeof this.config.title === 'function' ? this.config.title.call(this.element) : this.config.title;
+      }
+
+      return title;
+    } // Private
+    ;
+
+    _proto._getOffset = function _getOffset() {
+      var _this3 = this;
+
+      var offset = {};
+
+      if (typeof this.config.offset === 'function') {
+        offset.fn = function (data) {
+          data.offsets = _objectSpread({}, data.offsets, _this3.config.offset(data.offsets, _this3.element) || {});
+          return data;
+        };
+      } else {
+        offset.offset = this.config.offset;
+      }
+
+      return offset;
+    };
+
+    _proto._getContainer = function _getContainer() {
+      if (this.config.container === false) {
+        return document.body;
+      }
+
+      if (Util.isElement(this.config.container)) {
+        return $(this.config.container);
+      }
+
+      return $(document).find(this.config.container);
+    };
+
+    _proto._getAttachment = function _getAttachment(placement) {
+      return AttachmentMap$1[placement.toUpperCase()];
+    };
+
+    _proto._setListeners = function _setListeners() {
+      var _this4 = this;
+
+      var triggers = this.config.trigger.split(' ');
+      triggers.forEach(function (trigger) {
+        if (trigger === 'click') {
+          $(_this4.element).on(_this4.constructor.Event.CLICK, _this4.config.selector, function (event) {
+            return _this4.toggle(event);
+          });
+        } else if (trigger !== Trigger.MANUAL) {
+          var eventIn = trigger === Trigger.HOVER ? _this4.constructor.Event.MOUSEENTER : _this4.constructor.Event.FOCUSIN;
+          var eventOut = trigger === Trigger.HOVER ? _this4.constructor.Event.MOUSELEAVE : _this4.constructor.Event.FOCUSOUT;
+          $(_this4.element).on(eventIn, _this4.config.selector, function (event) {
+            return _this4._enter(event);
+          }).on(eventOut, _this4.config.selector, function (event) {
+            return _this4._leave(event);
+          });
+        }
+      });
+      $(this.element).closest('.modal').on('hide.bs.modal', function () {
+        if (_this4.element) {
+          _this4.hide();
+        }
+      });
+
+      if (this.config.selector) {
+        this.config = _objectSpread({}, this.config, {
+          trigger: 'manual',
+          selector: ''
+        });
+      } else {
+        this._fixTitle();
+      }
+    };
+
+    _proto._fixTitle = function _fixTitle() {
+      var titleType = typeof this.element.getAttribute('data-original-title');
+
+      if (this.element.getAttribute('title') || titleType !== 'string') {
+        this.element.setAttribute('data-original-title', this.element.getAttribute('title') || '');
+        this.element.setAttribute('title', '');
+      }
+    };
+
+    _proto._enter = function _enter(event, context) {
+      var dataKey = this.constructor.DATA_KEY;
+      context = context || $(event.currentTarget).data(dataKey);
+
+      if (!context) {
+        context = new this.constructor(event.currentTarget, this._getDelegateConfig());
+        $(event.currentTarget).data(dataKey, context);
+      }
+
+      if (event) {
+        context._activeTrigger[event.type === 'focusin' ? Trigger.FOCUS : Trigger.HOVER] = true;
+      }
+
+      if ($(context.getTipElement()).hasClass(ClassName$6.SHOW) || context._hoverState === HoverState.SHOW) {
+        context._hoverState = HoverState.SHOW;
+        return;
+      }
+
+      clearTimeout(context._timeout);
+      context._hoverState = HoverState.SHOW;
+
+      if (!context.config.delay || !context.config.delay.show) {
+        context.show();
+        return;
+      }
+
+      context._timeout = setTimeout(function () {
+        if (context._hoverState === HoverState.SHOW) {
+          context.show();
+        }
+      }, context.config.delay.show);
+    };
+
+    _proto._leave = function _leave(event, context) {
+      var dataKey = this.constructor.DATA_KEY;
+      context = context || $(event.currentTarget).data(dataKey);
+
+      if (!context) {
+        context = new this.constructor(event.currentTarget, this._getDelegateConfig());
+        $(event.currentTarget).data(dataKey, context);
+      }
+
+      if (event) {
+        context._activeTrigger[event.type === 'focusout' ? Trigger.FOCUS : Trigger.HOVER] = false;
+      }
+
+      if (context._isWithActiveTrigger()) {
+        return;
+      }
+
+      clearTimeout(context._timeout);
+      context._hoverState = HoverState.OUT;
+
+      if (!context.config.delay || !context.config.delay.hide) {
+        context.hide();
+        return;
+      }
+
+      context._timeout = setTimeout(function () {
+        if (context._hoverState === HoverState.OUT) {
+          context.hide();
+        }
+      }, context.config.delay.hide);
+    };
+
+    _proto._isWithActiveTrigger = function _isWithActiveTrigger() {
+      for (var trigger in this._activeTrigger) {
+        if (this._activeTrigger[trigger]) {
+          return true;
+        }
+      }
+
+      return false;
+    };
+
+    _proto._getConfig = function _getConfig(config) {
+      var dataAttributes = $(this.element).data();
+      Object.keys(dataAttributes).forEach(function (dataAttr) {
+        if (DISALLOWED_ATTRIBUTES.indexOf(dataAttr) !== -1) {
+          delete dataAttributes[dataAttr];
+        }
+      });
+      config = _objectSpread({}, this.constructor.Default, dataAttributes, typeof config === 'object' && config ? config : {});
+
+      if (typeof config.delay === 'number') {
+        config.delay = {
+          show: config.delay,
+          hide: config.delay
+        };
+      }
+
+      if (typeof config.title === 'number') {
+        config.title = config.title.toString();
+      }
+
+      if (typeof config.content === 'number') {
+        config.content = config.content.toString();
+      }
+
+      Util.typeCheckConfig(NAME$6, config, this.constructor.DefaultType);
+
+      if (config.sanitize) {
+        config.template = sanitizeHtml(config.template, config.whiteList, config.sanitizeFn);
+      }
+
+      return config;
+    };
+
+    _proto._getDelegateConfig = function _getDelegateConfig() {
+      var config = {};
+
+      if (this.config) {
+        for (var key in this.config) {
+          if (this.constructor.Default[key] !== this.config[key]) {
+            config[key] = this.config[key];
+          }
+        }
+      }
+
+      return config;
+    };
+
+    _proto._cleanTipClass = function _cleanTipClass() {
+      var $tip = $(this.getTipElement());
+      var tabClass = $tip.attr('class').match(BSCLS_PREFIX_REGEX);
+
+      if (tabClass !== null && tabClass.length) {
+        $tip.removeClass(tabClass.join(''));
+      }
+    };
+
+    _proto._handlePopperPlacementChange = function _handlePopperPlacementChange(popperData) {
+      var popperInstance = popperData.instance;
+      this.tip = popperInstance.popper;
+
+      this._cleanTipClass();
+
+      this.addAttachmentClass(this._getAttachment(popperData.placement));
+    };
+
+    _proto._fixTransition = function _fixTransition() {
+      var tip = this.getTipElement();
+      var initConfigAnimation = this.config.animation;
+
+      if (tip.getAttribute('x-placement') !== null) {
+        return;
+      }
+
+      $(tip).removeClass(ClassName$6.FADE);
+      this.config.animation = false;
+      this.hide();
+      this.show();
+      this.config.animation = initConfigAnimation;
+    } // Static
+    ;
+
+    Tooltip._jQueryInterface = function _jQueryInterface(config) {
+      return this.each(function () {
+        var data = $(this).data(DATA_KEY$6);
+
+        var _config = typeof config === 'object' && config;
+
+        if (!data && /dispose|hide/.test(config)) {
+          return;
+        }
+
+        if (!data) {
+          data = new Tooltip(this, _config);
+          $(this).data(DATA_KEY$6, data);
+        }
+
+        if (typeof config === 'string') {
+          if (typeof data[config] === 'undefined') {
+            throw new TypeError("No method named \"" + config + "\"");
+          }
+
+          data[config]();
+        }
+      });
+    };
+
+    _createClass(Tooltip, null, [{
+      key: "VERSION",
+      get: function get() {
+        return VERSION$6;
+      }
+    }, {
+      key: "Default",
+      get: function get() {
+        return Default$4;
+      }
+    }, {
+      key: "NAME",
+      get: function get() {
+        return NAME$6;
+      }
+    }, {
+      key: "DATA_KEY",
+      get: function get() {
+        return DATA_KEY$6;
+      }
+    }, {
+      key: "Event",
+      get: function get() {
+        return Event$6;
+      }
+    }, {
+      key: "EVENT_KEY",
+      get: function get() {
+        return EVENT_KEY$6;
+      }
+    }, {
+      key: "DefaultType",
+      get: function get() {
+        return DefaultType$4;
+      }
+    }]);
+
+    return Tooltip;
+  }();
+  /**
+   * ------------------------------------------------------------------------
+   * jQuery
+   * ------------------------------------------------------------------------
+   */
+
+
+  $.fn[NAME$6] = Tooltip._jQueryInterface;
+  $.fn[NAME$6].Constructor = Tooltip;
+
+  $.fn[NAME$6].noConflict = function () {
+    $.fn[NAME$6] = JQUERY_NO_CONFLICT$6;
+    return Tooltip._jQueryInterface;
+  };
+
+  /**
+   * ------------------------------------------------------------------------
+   * Constants
+   * ------------------------------------------------------------------------
+   */
+
+  var NAME$7 = 'popover';
+  var VERSION$7 = '4.3.1';
+  var DATA_KEY$7 = 'bs.popover';
+  var EVENT_KEY$7 = "." + DATA_KEY$7;
+  var JQUERY_NO_CONFLICT$7 = $.fn[NAME$7];
+  var CLASS_PREFIX$1 = 'bs-popover';
+  var BSCLS_PREFIX_REGEX$1 = new RegExp("(^|\\s)" + CLASS_PREFIX$1 + "\\S+", 'g');
+
+  var Default$5 = _objectSpread({}, Tooltip.Default, {
+    placement: 'right',
+    trigger: 'click',
+    content: '',
+    template: '<div class="popover" role="tooltip">' + '<div class="arrow"></div>' + '<h3 class="popover-header"></h3>' + '<div class="popover-body"></div></div>'
+  });
+
+  var DefaultType$5 = _objectSpread({}, Tooltip.DefaultType, {
+    content: '(string|element|function)'
+  });
+
+  var ClassName$7 = {
+    FADE: 'fade',
+    SHOW: 'show'
+  };
+  var Selector$7 = {
+    TITLE: '.popover-header',
+    CONTENT: '.popover-body'
+  };
+  var Event$7 = {
+    HIDE: "hide" + EVENT_KEY$7,
+    HIDDEN: "hidden" + EVENT_KEY$7,
+    SHOW: "show" + EVENT_KEY$7,
+    SHOWN: "shown" + EVENT_KEY$7,
+    INSERTED: "inserted" + EVENT_KEY$7,
+    CLICK: "click" + EVENT_KEY$7,
+    FOCUSIN: "focusin" + EVENT_KEY$7,
+    FOCUSOUT: "focusout" + EVENT_KEY$7,
+    MOUSEENTER: "mouseenter" + EVENT_KEY$7,
+    MOUSELEAVE: "mouseleave" + EVENT_KEY$7
+    /**
+     * ------------------------------------------------------------------------
+     * Class Definition
+     * ------------------------------------------------------------------------
+     */
+
+  };
+
+  var Popover =
+  /*#__PURE__*/
+  function (_Tooltip) {
+    _inheritsLoose(Popover, _Tooltip);
+
+    function Popover() {
+      return _Tooltip.apply(this, arguments) || this;
+    }
+
+    var _proto = Popover.prototype;
+
+    // Overrides
+    _proto.isWithContent = function isWithContent() {
+      return this.getTitle() || this._getContent();
+    };
+
+    _proto.addAttachmentClass = function addAttachmentClass(attachment) {
+      $(this.getTipElement()).addClass(CLASS_PREFIX$1 + "-" + attachment);
+    };
+
+    _proto.getTipElement = function getTipElement() {
+      this.tip = this.tip || $(this.config.template)[0];
+      return this.tip;
+    };
+
+    _proto.setContent = function setContent() {
+      var $tip = $(this.getTipElement()); // We use append for html objects to maintain js events
+
+      this.setElementContent($tip.find(Selector$7.TITLE), this.getTitle());
+
+      var content = this._getContent();
+
+      if (typeof content === 'function') {
+        content = content.call(this.element);
+      }
+
+      this.setElementContent($tip.find(Selector$7.CONTENT), content);
+      $tip.removeClass(ClassName$7.FADE + " " + ClassName$7.SHOW);
+    } // Private
+    ;
+
+    _proto._getContent = function _getContent() {
+      return this.element.getAttribute('data-content') || this.config.content;
+    };
+
+    _proto._cleanTipClass = function _cleanTipClass() {
+      var $tip = $(this.getTipElement());
+      var tabClass = $tip.attr('class').match(BSCLS_PREFIX_REGEX$1);
+
+      if (tabClass !== null && tabClass.length > 0) {
+        $tip.removeClass(tabClass.join(''));
+      }
+    } // Static
+    ;
+
+    Popover._jQueryInterface = function _jQueryInterface(config) {
+      return this.each(function () {
+        var data = $(this).data(DATA_KEY$7);
+
+        var _config = typeof config === 'object' ? config : null;
+
+        if (!data && /dispose|hide/.test(config)) {
+          return;
+        }
+
+        if (!data) {
+          data = new Popover(this, _config);
+          $(this).data(DATA_KEY$7, data);
+        }
+
+        if (typeof config === 'string') {
+          if (typeof data[config] === 'undefined') {
+            throw new TypeError("No method named \"" + config + "\"");
+          }
+
+          data[config]();
+        }
+      });
+    };
+
+    _createClass(Popover, null, [{
+      key: "VERSION",
+      // Getters
+      get: function get() {
+        return VERSION$7;
+      }
+    }, {
+      key: "Default",
+      get: function get() {
+        return Default$5;
+      }
+    }, {
+      key: "NAME",
+      get: function get() {
+        return NAME$7;
+      }
+    }, {
+      key: "DATA_KEY",
+      get: function get() {
+        return DATA_KEY$7;
+      }
+    }, {
+      key: "Event",
+      get: function get() {
+        return Event$7;
+      }
+    }, {
+      key: "EVENT_KEY",
+      get: function get() {
+        return EVENT_KEY$7;
+      }
+    }, {
+      key: "DefaultType",
+      get: function get() {
+        return DefaultType$5;
+      }
+    }]);
+
+    return Popover;
+  }(Tooltip);
+  /**
+   * ------------------------------------------------------------------------
+   * jQuery
+   * ------------------------------------------------------------------------
+   */
+
+
+  $.fn[NAME$7] = Popover._jQueryInterface;
+  $.fn[NAME$7].Constructor = Popover;
+
+  $.fn[NAME$7].noConflict = function () {
+    $.fn[NAME$7] = JQUERY_NO_CONFLICT$7;
+    return Popover._jQueryInterface;
+  };
+
+  /**
+   * ------------------------------------------------------------------------
+   * Constants
+   * ------------------------------------------------------------------------
+   */
+
+  var NAME$8 = 'scrollspy';
+  var VERSION$8 = '4.3.1';
+  var DATA_KEY$8 = 'bs.scrollspy';
+  var EVENT_KEY$8 = "." + DATA_KEY$8;
+  var DATA_API_KEY$6 = '.data-api';
+  var JQUERY_NO_CONFLICT$8 = $.fn[NAME$8];
+  var Default$6 = {
+    offset: 10,
+    method: 'auto',
+    target: ''
+  };
+  var DefaultType$6 = {
+    offset: 'number',
+    method: 'string',
+    target: '(string|element)'
+  };
+  var Event$8 = {
+    ACTIVATE: "activate" + EVENT_KEY$8,
+    SCROLL: "scroll" + EVENT_KEY$8,
+    LOAD_DATA_API: "load" + EVENT_KEY$8 + DATA_API_KEY$6
+  };
+  var ClassName$8 = {
+    DROPDOWN_ITEM: 'dropdown-item',
+    DROPDOWN_MENU: 'dropdown-menu',
+    ACTIVE: 'active'
+  };
+  var Selector$8 = {
+    DATA_SPY: '[data-spy="scroll"]',
+    ACTIVE: '.active',
+    NAV_LIST_GROUP: '.nav, .list-group',
+    NAV_LINKS: '.nav-link',
+    NAV_ITEMS: '.nav-item',
+    LIST_ITEMS: '.list-group-item',
+    DROPDOWN: '.dropdown',
+    DROPDOWN_ITEMS: '.dropdown-item',
+    DROPDOWN_TOGGLE: '.dropdown-toggle'
+  };
+  var OffsetMethod = {
+    OFFSET: 'offset',
+    POSITION: 'position'
+    /**
+     * ------------------------------------------------------------------------
+     * Class Definition
+     * ------------------------------------------------------------------------
+     */
+
+  };
+
+  var ScrollSpy =
+  /*#__PURE__*/
+  function () {
+    function ScrollSpy(element, config) {
+      var _this = this;
+
+      this._element = element;
+      this._scrollElement = element.tagName === 'BODY' ? window : element;
+      this._config = this._getConfig(config);
+      this._selector = this._config.target + " " + Selector$8.NAV_LINKS + "," + (this._config.target + " " + Selector$8.LIST_ITEMS + ",") + (this._config.target + " " + Selector$8.DROPDOWN_ITEMS);
+      this._offsets = [];
+      this._targets = [];
+      this._activeTarget = null;
+      this._scrollHeight = 0;
+      $(this._scrollElement).on(Event$8.SCROLL, function (event) {
+        return _this._process(event);
+      });
+      this.refresh();
+
+      this._process();
+    } // Getters
+
+
+    var _proto = ScrollSpy.prototype;
+
+    // Public
+    _proto.refresh = function refresh() {
+      var _this2 = this;
+
+      var autoMethod = this._scrollElement === this._scrollElement.window ? OffsetMethod.OFFSET : OffsetMethod.POSITION;
+      var offsetMethod = this._config.method === 'auto' ? autoMethod : this._config.method;
+      var offsetBase = offsetMethod === OffsetMethod.POSITION ? this._getScrollTop() : 0;
+      this._offsets = [];
+      this._targets = [];
+      this._scrollHeight = this._getScrollHeight();
+      var targets = [].slice.call(document.querySelectorAll(this._selector));
+      targets.map(function (element) {
+        var target;
+        var targetSelector = Util.getSelectorFromElement(element);
+
+        if (targetSelector) {
+          target = document.querySelector(targetSelector);
+        }
+
+        if (target) {
+          var targetBCR = target.getBoundingClientRect();
+
+          if (targetBCR.width || targetBCR.height) {
+            // TODO (fat): remove sketch reliance on jQuery position/offset
+            return [$(target)[offsetMethod]().top + offsetBase, targetSelector];
+          }
+        }
+
+        return null;
+      }).filter(function (item) {
+        return item;
+      }).sort(function (a, b) {
+        return a[0] - b[0];
+      }).forEach(function (item) {
+        _this2._offsets.push(item[0]);
+
+        _this2._targets.push(item[1]);
+      });
+    };
+
+    _proto.dispose = function dispose() {
+      $.removeData(this._element, DATA_KEY$8);
+      $(this._scrollElement).off(EVENT_KEY$8);
+      this._element = null;
+      this._scrollElement = null;
+      this._config = null;
+      this._selector = null;
+      this._offsets = null;
+      this._targets = null;
+      this._activeTarget = null;
+      this._scrollHeight = null;
+    } // Private
+    ;
+
+    _proto._getConfig = function _getConfig(config) {
+      config = _objectSpread({}, Default$6, typeof config === 'object' && config ? config : {});
+
+      if (typeof config.target !== 'string') {
+        var id = $(config.target).attr('id');
+
+        if (!id) {
+          id = Util.getUID(NAME$8);
+          $(config.target).attr('id', id);
+        }
+
+        config.target = "#" + id;
+      }
+
+      Util.typeCheckConfig(NAME$8, config, DefaultType$6);
+      return config;
+    };
+
+    _proto._getScrollTop = function _getScrollTop() {
+      return this._scrollElement === window ? this._scrollElement.pageYOffset : this._scrollElement.scrollTop;
+    };
+
+    _proto._getScrollHeight = function _getScrollHeight() {
+      return this._scrollElement.scrollHeight || Math.max(document.body.scrollHeight, document.documentElement.scrollHeight);
+    };
+
+    _proto._getOffsetHeight = function _getOffsetHeight() {
+      return this._scrollElement === window ? window.innerHeight : this._scrollElement.getBoundingClientRect().height;
+    };
+
+    _proto._process = function _process() {
+      var scrollTop = this._getScrollTop() + this._config.offset;
+
+      var scrollHeight = this._getScrollHeight();
+
+      var maxScroll = this._config.offset + scrollHeight - this._getOffsetHeight();
+
+      if (this._scrollHeight !== scrollHeight) {
+        this.refresh();
+      }
+
+      if (scrollTop >= maxScroll) {
+        var target = this._targets[this._targets.length - 1];
+
+        if (this._activeTarget !== target) {
+          this._activate(target);
+        }
+
+        return;
+      }
+
+      if (this._activeTarget && scrollTop < this._offsets[0] && this._offsets[0] > 0) {
+        this._activeTarget = null;
+
+        this._clear();
+
+        return;
+      }
+
+      var offsetLength = this._offsets.length;
+
+      for (var i = offsetLength; i--;) {
+        var isActiveTarget = this._activeTarget !== this._targets[i] && scrollTop >= this._offsets[i] && (typeof this._offsets[i + 1] === 'undefined' || scrollTop < this._offsets[i + 1]);
+
+        if (isActiveTarget) {
+          this._activate(this._targets[i]);
+        }
+      }
+    };
+
+    _proto._activate = function _activate(target) {
+      this._activeTarget = target;
+
+      this._clear();
+
+      var queries = this._selector.split(',').map(function (selector) {
+        return selector + "[data-target=\"" + target + "\"]," + selector + "[href=\"" + target + "\"]";
+      });
+
+      var $link = $([].slice.call(document.querySelectorAll(queries.join(','))));
+
+      if ($link.hasClass(ClassName$8.DROPDOWN_ITEM)) {
+        $link.closest(Selector$8.DROPDOWN).find(Selector$8.DROPDOWN_TOGGLE).addClass(ClassName$8.ACTIVE);
+        $link.addClass(ClassName$8.ACTIVE);
+      } else {
+        // Set triggered link as active
+        $link.addClass(ClassName$8.ACTIVE); // Set triggered links parents as active
+        // With both <ul> and <nav> markup a parent is the previous sibling of any nav ancestor
+
+        $link.parents(Selector$8.NAV_LIST_GROUP).prev(Selector$8.NAV_LINKS + ", " + Selector$8.LIST_ITEMS).addClass(ClassName$8.ACTIVE); // Handle special case when .nav-link is inside .nav-item
+
+        $link.parents(Selector$8.NAV_LIST_GROUP).prev(Selector$8.NAV_ITEMS).children(Selector$8.NAV_LINKS).addClass(ClassName$8.ACTIVE);
+      }
+
+      $(this._scrollElement).trigger(Event$8.ACTIVATE, {
+        relatedTarget: target
+      });
+    };
+
+    _proto._clear = function _clear() {
+      [].slice.call(document.querySelectorAll(this._selector)).filter(function (node) {
+        return node.classList.contains(ClassName$8.ACTIVE);
+      }).forEach(function (node) {
+        return node.classList.remove(ClassName$8.ACTIVE);
+      });
+    } // Static
+    ;
+
+    ScrollSpy._jQueryInterface = function _jQueryInterface(config) {
+      return this.each(function () {
+        var data = $(this).data(DATA_KEY$8);
+
+        var _config = typeof config === 'object' && config;
+
+        if (!data) {
+          data = new ScrollSpy(this, _config);
+          $(this).data(DATA_KEY$8, data);
+        }
+
+        if (typeof config === 'string') {
+          if (typeof data[config] === 'undefined') {
+            throw new TypeError("No method named \"" + config + "\"");
+          }
+
+          data[config]();
+        }
+      });
+    };
+
+    _createClass(ScrollSpy, null, [{
+      key: "VERSION",
+      get: function get() {
+        return VERSION$8;
+      }
+    }, {
+      key: "Default",
+      get: function get() {
+        return Default$6;
+      }
+    }]);
+
+    return ScrollSpy;
+  }();
+  /**
+   * ------------------------------------------------------------------------
+   * Data Api implementation
+   * ------------------------------------------------------------------------
+   */
+
+
+  $(window).on(Event$8.LOAD_DATA_API, function () {
+    var scrollSpys = [].slice.call(document.querySelectorAll(Selector$8.DATA_SPY));
+    var scrollSpysLength = scrollSpys.length;
+
+    for (var i = scrollSpysLength; i--;) {
+      var $spy = $(scrollSpys[i]);
+
+      ScrollSpy._jQueryInterface.call($spy, $spy.data());
+    }
+  });
+  /**
+   * ------------------------------------------------------------------------
+   * jQuery
+   * ------------------------------------------------------------------------
+   */
+
+  $.fn[NAME$8] = ScrollSpy._jQueryInterface;
+  $.fn[NAME$8].Constructor = ScrollSpy;
+
+  $.fn[NAME$8].noConflict = function () {
+    $.fn[NAME$8] = JQUERY_NO_CONFLICT$8;
+    return ScrollSpy._jQueryInterface;
+  };
+
+  /**
+   * ------------------------------------------------------------------------
+   * Constants
+   * ------------------------------------------------------------------------
+   */
+
+  var NAME$9 = 'tab';
+  var VERSION$9 = '4.3.1';
+  var DATA_KEY$9 = 'bs.tab';
+  var EVENT_KEY$9 = "." + DATA_KEY$9;
+  var DATA_API_KEY$7 = '.data-api';
+  var JQUERY_NO_CONFLICT$9 = $.fn[NAME$9];
+  var Event$9 = {
+    HIDE: "hide" + EVENT_KEY$9,
+    HIDDEN: "hidden" + EVENT_KEY$9,
+    SHOW: "show" + EVENT_KEY$9,
+    SHOWN: "shown" + EVENT_KEY$9,
+    CLICK_DATA_API: "click" + EVENT_KEY$9 + DATA_API_KEY$7
+  };
+  var ClassName$9 = {
+    DROPDOWN_MENU: 'dropdown-menu',
+    ACTIVE: 'active',
+    DISABLED: 'disabled',
+    FADE: 'fade',
+    SHOW: 'show'
+  };
+  var Selector$9 = {
+    DROPDOWN: '.dropdown',
+    NAV_LIST_GROUP: '.nav, .list-group',
+    ACTIVE: '.active',
+    ACTIVE_UL: '> li > .active',
+    DATA_TOGGLE: '[data-toggle="tab"], [data-toggle="pill"], [data-toggle="list"]',
+    DROPDOWN_TOGGLE: '.dropdown-toggle',
+    DROPDOWN_ACTIVE_CHILD: '> .dropdown-menu .active'
+    /**
+     * ------------------------------------------------------------------------
+     * Class Definition
+     * ------------------------------------------------------------------------
+     */
+
+  };
+
+  var Tab =
+  /*#__PURE__*/
+  function () {
+    function Tab(element) {
+      this._element = element;
+    } // Getters
+
+
+    var _proto = Tab.prototype;
+
+    // Public
+    _proto.show = function show() {
+      var _this = this;
+
+      if (this._element.parentNode && this._element.parentNode.nodeType === Node.ELEMENT_NODE && $(this._element).hasClass(ClassName$9.ACTIVE) || $(this._element).hasClass(ClassName$9.DISABLED)) {
+        return;
+      }
+
+      var target;
+      var previous;
+      var listElement = $(this._element).closest(Selector$9.NAV_LIST_GROUP)[0];
+      var selector = Util.getSelectorFromElement(this._element);
+
+      if (listElement) {
+        var itemSelector = listElement.nodeName === 'UL' || listElement.nodeName === 'OL' ? Selector$9.ACTIVE_UL : Selector$9.ACTIVE;
+        previous = $.makeArray($(listElement).find(itemSelector));
+        previous = previous[previous.length - 1];
+      }
+
+      var hideEvent = $.Event(Event$9.HIDE, {
+        relatedTarget: this._element
+      });
+      var showEvent = $.Event(Event$9.SHOW, {
+        relatedTarget: previous
+      });
+
+      if (previous) {
+        $(previous).trigger(hideEvent);
+      }
+
+      $(this._element).trigger(showEvent);
+
+      if (showEvent.isDefaultPrevented() || hideEvent.isDefaultPrevented()) {
+        return;
+      }
+
+      if (selector) {
+        target = document.querySelector(selector);
+      }
+
+      this._activate(this._element, listElement);
+
+      var complete = function complete() {
+        var hiddenEvent = $.Event(Event$9.HIDDEN, {
+          relatedTarget: _this._element
+        });
+        var shownEvent = $.Event(Event$9.SHOWN, {
+          relatedTarget: previous
+        });
+        $(previous).trigger(hiddenEvent);
+        $(_this._element).trigger(shownEvent);
+      };
+
+      if (target) {
+        this._activate(target, target.parentNode, complete);
+      } else {
+        complete();
+      }
+    };
+
+    _proto.dispose = function dispose() {
+      $.removeData(this._element, DATA_KEY$9);
+      this._element = null;
+    } // Private
+    ;
+
+    _proto._activate = function _activate(element, container, callback) {
+      var _this2 = this;
+
+      var activeElements = container && (container.nodeName === 'UL' || container.nodeName === 'OL') ? $(container).find(Selector$9.ACTIVE_UL) : $(container).children(Selector$9.ACTIVE);
+      var active = activeElements[0];
+      var isTransitioning = callback && active && $(active).hasClass(ClassName$9.FADE);
+
+      var complete = function complete() {
+        return _this2._transitionComplete(element, active, callback);
+      };
+
+      if (active && isTransitioning) {
+        var transitionDuration = Util.getTransitionDurationFromElement(active);
+        $(active).removeClass(ClassName$9.SHOW).one(Util.TRANSITION_END, complete).emulateTransitionEnd(transitionDuration);
+      } else {
+        complete();
+      }
+    };
+
+    _proto._transitionComplete = function _transitionComplete(element, active, callback) {
+      if (active) {
+        $(active).removeClass(ClassName$9.ACTIVE);
+        var dropdownChild = $(active.parentNode).find(Selector$9.DROPDOWN_ACTIVE_CHILD)[0];
+
+        if (dropdownChild) {
+          $(dropdownChild).removeClass(ClassName$9.ACTIVE);
+        }
+
+        if (active.getAttribute('role') === 'tab') {
+          active.setAttribute('aria-selected', false);
+        }
+      }
+
+      $(element).addClass(ClassName$9.ACTIVE);
+
+      if (element.getAttribute('role') === 'tab') {
+        element.setAttribute('aria-selected', true);
+      }
+
+      Util.reflow(element);
+
+      if (element.classList.contains(ClassName$9.FADE)) {
+        element.classList.add(ClassName$9.SHOW);
+      }
+
+      if (element.parentNode && $(element.parentNode).hasClass(ClassName$9.DROPDOWN_MENU)) {
+        var dropdownElement = $(element).closest(Selector$9.DROPDOWN)[0];
+
+        if (dropdownElement) {
+          var dropdownToggleList = [].slice.call(dropdownElement.querySelectorAll(Selector$9.DROPDOWN_TOGGLE));
+          $(dropdownToggleList).addClass(ClassName$9.ACTIVE);
+        }
+
+        element.setAttribute('aria-expanded', true);
+      }
+
+      if (callback) {
+        callback();
+      }
+    } // Static
+    ;
+
+    Tab._jQueryInterface = function _jQueryInterface(config) {
+      return this.each(function () {
+        var $this = $(this);
+        var data = $this.data(DATA_KEY$9);
+
+        if (!data) {
+          data = new Tab(this);
+          $this.data(DATA_KEY$9, data);
+        }
+
+        if (typeof config === 'string') {
+          if (typeof data[config] === 'undefined') {
+            throw new TypeError("No method named \"" + config + "\"");
+          }
+
+          data[config]();
+        }
+      });
+    };
+
+    _createClass(Tab, null, [{
+      key: "VERSION",
+      get: function get() {
+        return VERSION$9;
+      }
+    }]);
+
+    return Tab;
+  }();
+  /**
+   * ------------------------------------------------------------------------
+   * Data Api implementation
+   * ------------------------------------------------------------------------
+   */
+
+
+  $(document).on(Event$9.CLICK_DATA_API, Selector$9.DATA_TOGGLE, function (event) {
+    event.preventDefault();
+
+    Tab._jQueryInterface.call($(this), 'show');
+  });
+  /**
+   * ------------------------------------------------------------------------
+   * jQuery
+   * ------------------------------------------------------------------------
+   */
+
+  $.fn[NAME$9] = Tab._jQueryInterface;
+  $.fn[NAME$9].Constructor = Tab;
+
+  $.fn[NAME$9].noConflict = function () {
+    $.fn[NAME$9] = JQUERY_NO_CONFLICT$9;
+    return Tab._jQueryInterface;
+  };
+
+  /**
+   * ------------------------------------------------------------------------
+   * Constants
+   * ------------------------------------------------------------------------
+   */
+
+  var NAME$a = 'toast';
+  var VERSION$a = '4.3.1';
+  var DATA_KEY$a = 'bs.toast';
+  var EVENT_KEY$a = "." + DATA_KEY$a;
+  var JQUERY_NO_CONFLICT$a = $.fn[NAME$a];
+  var Event$a = {
+    CLICK_DISMISS: "click.dismiss" + EVENT_KEY$a,
+    HIDE: "hide" + EVENT_KEY$a,
+    HIDDEN: "hidden" + EVENT_KEY$a,
+    SHOW: "show" + EVENT_KEY$a,
+    SHOWN: "shown" + EVENT_KEY$a
+  };
+  var ClassName$a = {
+    FADE: 'fade',
+    HIDE: 'hide',
+    SHOW: 'show',
+    SHOWING: 'showing'
+  };
+  var DefaultType$7 = {
+    animation: 'boolean',
+    autohide: 'boolean',
+    delay: 'number'
+  };
+  var Default$7 = {
+    animation: true,
+    autohide: true,
+    delay: 500
+  };
+  var Selector$a = {
+    DATA_DISMISS: '[data-dismiss="toast"]'
+    /**
+     * ------------------------------------------------------------------------
+     * Class Definition
+     * ------------------------------------------------------------------------
+     */
+
+  };
+
+  var Toast =
+  /*#__PURE__*/
+  function () {
+    function Toast(element, config) {
+      this._element = element;
+      this._config = this._getConfig(config);
+      this._timeout = null;
+
+      this._setListeners();
+    } // Getters
+
+
+    var _proto = Toast.prototype;
+
+    // Public
+    _proto.show = function show() {
+      var _this = this;
+
+      $(this._element).trigger(Event$a.SHOW);
+
+      if (this._config.animation) {
+        this._element.classList.add(ClassName$a.FADE);
+      }
+
+      var complete = function complete() {
+        _this._element.classList.remove(ClassName$a.SHOWING);
+
+        _this._element.classList.add(ClassName$a.SHOW);
+
+        $(_this._element).trigger(Event$a.SHOWN);
+
+        if (_this._config.autohide) {
+          _this.hide();
+        }
+      };
+
+      this._element.classList.remove(ClassName$a.HIDE);
+
+      this._element.classList.add(ClassName$a.SHOWING);
+
+      if (this._config.animation) {
+        var transitionDuration = Util.getTransitionDurationFromElement(this._element);
+        $(this._element).one(Util.TRANSITION_END, complete).emulateTransitionEnd(transitionDuration);
+      } else {
+        complete();
+      }
+    };
+
+    _proto.hide = function hide(withoutTimeout) {
+      var _this2 = this;
+
+      if (!this._element.classList.contains(ClassName$a.SHOW)) {
+        return;
+      }
+
+      $(this._element).trigger(Event$a.HIDE);
+
+      if (withoutTimeout) {
+        this._close();
+      } else {
+        this._timeout = setTimeout(function () {
+          _this2._close();
+        }, this._config.delay);
+      }
+    };
+
+    _proto.dispose = function dispose() {
+      clearTimeout(this._timeout);
+      this._timeout = null;
+
+      if (this._element.classList.contains(ClassName$a.SHOW)) {
+        this._element.classList.remove(ClassName$a.SHOW);
+      }
+
+      $(this._element).off(Event$a.CLICK_DISMISS);
+      $.removeData(this._element, DATA_KEY$a);
+      this._element = null;
+      this._config = null;
+    } // Private
+    ;
+
+    _proto._getConfig = function _getConfig(config) {
+      config = _objectSpread({}, Default$7, $(this._element).data(), typeof config === 'object' && config ? config : {});
+      Util.typeCheckConfig(NAME$a, config, this.constructor.DefaultType);
+      return config;
+    };
+
+    _proto._setListeners = function _setListeners() {
+      var _this3 = this;
+
+      $(this._element).on(Event$a.CLICK_DISMISS, Selector$a.DATA_DISMISS, function () {
+        return _this3.hide(true);
+      });
+    };
+
+    _proto._close = function _close() {
+      var _this4 = this;
+
+      var complete = function complete() {
+        _this4._element.classList.add(ClassName$a.HIDE);
+
+        $(_this4._element).trigger(Event$a.HIDDEN);
+      };
+
+      this._element.classList.remove(ClassName$a.SHOW);
+
+      if (this._config.animation) {
+        var transitionDuration = Util.getTransitionDurationFromElement(this._element);
+        $(this._element).one(Util.TRANSITION_END, complete).emulateTransitionEnd(transitionDuration);
+      } else {
+        complete();
+      }
+    } // Static
+    ;
+
+    Toast._jQueryInterface = function _jQueryInterface(config) {
+      return this.each(function () {
+        var $element = $(this);
+        var data = $element.data(DATA_KEY$a);
+
+        var _config = typeof config === 'object' && config;
+
+        if (!data) {
+          data = new Toast(this, _config);
+          $element.data(DATA_KEY$a, data);
+        }
+
+        if (typeof config === 'string') {
+          if (typeof data[config] === 'undefined') {
+            throw new TypeError("No method named \"" + config + "\"");
+          }
+
+          data[config](this);
+        }
+      });
+    };
+
+    _createClass(Toast, null, [{
+      key: "VERSION",
+      get: function get() {
+        return VERSION$a;
+      }
+    }, {
+      key: "DefaultType",
+      get: function get() {
+        return DefaultType$7;
+      }
+    }, {
+      key: "Default",
+      get: function get() {
+        return Default$7;
+      }
+    }]);
+
+    return Toast;
+  }();
+  /**
+   * ------------------------------------------------------------------------
+   * jQuery
+   * ------------------------------------------------------------------------
+   */
+
+
+  $.fn[NAME$a] = Toast._jQueryInterface;
+  $.fn[NAME$a].Constructor = Toast;
+
+  $.fn[NAME$a].noConflict = function () {
+    $.fn[NAME$a] = JQUERY_NO_CONFLICT$a;
+    return Toast._jQueryInterface;
+  };
+
+  /**
+   * --------------------------------------------------------------------------
+   * Bootstrap (v4.3.1): index.js
+   * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+   * --------------------------------------------------------------------------
+   */
+
+  (function () {
+    if (typeof $ === 'undefined') {
+      throw new TypeError('Bootstrap\'s JavaScript requires jQuery. jQuery must be included before Bootstrap\'s JavaScript.');
+    }
+
+    var version = $.fn.jquery.split(' ')[0].split('.');
+    var minMajor = 1;
+    var ltMajor = 2;
+    var minMinor = 9;
+    var minPatch = 1;
+    var maxMajor = 4;
+
+    if (version[0] < ltMajor && version[1] < minMinor || version[0] === minMajor && version[1] === minMinor && version[2] < minPatch || version[0] >= maxMajor) {
+      throw new Error('Bootstrap\'s JavaScript requires at least jQuery v1.9.1 but less than v4.0.0');
+    }
+  })();
+
+  exports.Util = Util;
+  exports.Alert = Alert;
+  exports.Button = Button;
+  exports.Carousel = Carousel;
+  exports.Collapse = Collapse;
+  exports.Dropdown = Dropdown;
+  exports.Modal = Modal;
+  exports.Popover = Popover;
+  exports.Scrollspy = ScrollSpy;
+  exports.Tab = Tab;
+  exports.Toast = Toast;
+  exports.Tooltip = Tooltip;
+
+  Object.defineProperty(exports, '__esModule', { value: true });
+
+}));
+//# sourceMappingURL=bootstrap.bundle.js.map
diff --git a/roles/apps-fp-o/files/global/fedora-bootstrap-1.5.0/fedora-bootstrap.min.css b/roles/apps-fp-o/files/global/fedora-bootstrap-1.5.0/fedora-bootstrap.min.css
new file mode 100644
index 000000000..08d450926
--- /dev/null
+++ b/roles/apps-fp-o/files/global/fedora-bootstrap-1.5.0/fedora-bootstrap.min.css
@@ -0,0 +1,6 @@
+/*!fedora-bootstrap v1.5.0 -- https://pagure.io/fedora-bootstrap *//*!
+ * Bootstrap v4.3.1 (https://getbootstrap.com/)
+ * Copyright 2011-2019 The Bootstrap Authors
+ * Copyright 2011-2019 Twitter, Inc.
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+ */:root{--blue: #3c6eb4;--indigo: #6610f2;--purple: #6f42c1;--pink: #e83e8c;--red: #dc3545;--orange: #fd7e14;--yellow: #ffc107;--green: #28a745;--teal: #20c997;--cyan: #17a2b8;--white: #fff;--gray: #6c757d;--gray-dark: #343a40;--primary: #3c6eb4;--secondary: #6c757d;--success: #28a745;--info: #17a2b8;--warning: #ffc107;--danger: #dc3545;--light: #f8f9fa;--dark: #343a40;--breakpoint-xs: 0;--breakpoint-sm: 576px;--breakpoint-md: 768px;--breakpoint-lg: 992px;--breakpoint-xl: 1200px;--font-family-sans-serif: Open Sans;--font-family-monospace: "Hack", monospace}*,*::before,*::after{box-sizing:border-box}html{font-family:sans-serif;line-height:1.15;-webkit-text-size-adjust:100%;-webkit-tap-highlight-color:rgba(0,0,0,0)}article,aside,figcaption,figure,footer,header,hgroup,main,nav,section{display:block}body{margin:0;font-family:"Open Sans";font-size:.875rem;font-weight:400;line-height:1.5;color:#373a3c;text-align:left;background-color:#fff}[tabindex="-1"]:focus{outline:0 !important}hr{box-sizing:content-box;height:0;overflow:visible}h1,h2,h3,h4,h5,h6{margin-top:0;margin-bottom:.5rem}p{margin-top:0;margin-bottom:1rem}abbr[title],abbr[data-original-title]{text-decoration:underline;text-decoration:underline dotted;cursor:help;border-bottom:0;text-decoration-skip-ink:none}address{margin-bottom:1rem;font-style:normal;line-height:inherit}ol,ul,dl{margin-top:0;margin-bottom:1rem}ol ol,ul ul,ol ul,ul ol{margin-bottom:0}dt{font-weight:700}dd{margin-bottom:.5rem;margin-left:0}blockquote{margin:0 0 1rem}b,strong{font-weight:bolder}small{font-size:80%}sub,sup{position:relative;font-size:75%;line-height:0;vertical-align:baseline}sub{bottom:-.25em}sup{top:-.5em}a{color:#3c6eb4;text-decoration:none;background-color:transparent}a:hover{color:#294b7b;text-decoration:underline}a:not([href]):not([tabindex]){color:inherit;text-decoration:none}a:not([href]):not([tabindex]):hover,a:not([href]):not([tabindex]):focus{color:inherit;text-decoration:none}a:not([href]):not([tabindex]):focus{outline:0}pre,code,kbd,samp{font-family:"Hack",monospace;font-size:1em}pre{margin-top:0;margin-bottom:1rem;overflow:auto}figure{margin:0 0 1rem}img{vertical-align:middle;border-style:none}svg{overflow:hidden;vertical-align:middle}table{border-collapse:collapse}caption{padding-top:.75rem;padding-bottom:.75rem;color:#6c757d;text-align:left;caption-side:bottom}th{text-align:inherit}label{display:inline-block;margin-bottom:.5rem}button{border-radius:0}button:focus{outline:1px dotted;outline:5px auto -webkit-focus-ring-color}input,button,select,optgroup,textarea{margin:0;font-family:inherit;font-size:inherit;line-height:inherit}button,input{overflow:visible}button,select{text-transform:none}select{word-wrap:normal}button,[type="button"],[type="reset"],[type="submit"]{-webkit-appearance:button}button:not(:disabled),[type="button"]:not(:disabled),[type="reset"]:not(:disabled),[type="submit"]:not(:disabled){cursor:pointer}button::-moz-focus-inner,[type="button"]::-moz-focus-inner,[type="reset"]::-moz-focus-inner,[type="submit"]::-moz-focus-inner{padding:0;border-style:none}input[type="radio"],input[type="checkbox"]{box-sizing:border-box;padding:0}input[type="date"],input[type="time"],input[type="datetime-local"],input[type="month"]{-webkit-appearance:listbox}textarea{overflow:auto;resize:vertical}fieldset{min-width:0;padding:0;margin:0;border:0}legend{display:block;width:100%;max-width:100%;padding:0;margin-bottom:.5rem;font-size:1.5rem;line-height:inherit;color:inherit;white-space:normal}progress{vertical-align:baseline}[type="number"]::-webkit-inner-spin-button,[type="number"]::-webkit-outer-spin-button{height:auto}[type="search"]{outline-offset:-2px;-webkit-appearance:none}[type="search"]::-webkit-search-decoration{-webkit-appearance:none}::-webkit-file-upload-button{font:inherit;-webkit-appearance:button}output{display:inline-block}summary{display:list-item;cursor:pointer}template{display:none}[hidden]{display:none !important}h1,h2,h3,h4,h5,h6,.h1,.h2,.h3,.h4,.h5,.h6{margin-bottom:.5rem;font-weight:500;line-height:1.1}h1,.h1{font-size:1.75rem}h2,.h2{font-size:1.53125rem}h3,.h3{font-size:1.3125rem}h4,.h4{font-size:1.09375rem}h5,.h5{font-size:.875rem}h6,.h6{font-size:.875rem}.lead{font-size:1.09375rem;font-weight:300}.display-1{font-size:6rem;font-weight:300;line-height:1.1}.display-2{font-size:5.5rem;font-weight:300;line-height:1.1}.display-3{font-size:4.5rem;font-weight:300;line-height:1.1}.display-4{font-size:3.5rem;font-weight:300;line-height:1.1}hr{margin-top:1rem;margin-bottom:1rem;border:0;border-top:1px solid rgba(0,0,0,0.1)}small,.small{font-size:80%;font-weight:400}mark,.mark{padding:.2em;background-color:#fcf8e3}.list-unstyled{padding-left:0;list-style:none}.list-inline{padding-left:0;list-style:none}.list-inline-item{display:inline-block}.list-inline-item:not(:last-child){margin-right:.5rem}.initialism{font-size:90%;text-transform:uppercase}.blockquote{margin-bottom:1rem;font-size:1.09375rem}.blockquote-footer{display:block;font-size:80%;color:#6c757d}.blockquote-footer::before{content:"\2014\00A0"}.img-fluid{max-width:100%;height:auto}.img-thumbnail{padding:.25rem;background-color:#fff;border:1px solid #dee2e6;border-radius:.25rem;max-width:100%;height:auto}.figure{display:inline-block}.figure-img{margin-bottom:.5rem;line-height:1}.figure-caption{font-size:90%;color:#6c757d}code{font-size:87.5%;color:#e83e8c;word-break:break-word}a>code{color:inherit}kbd{padding:.2rem .4rem;font-size:87.5%;color:#fff;background-color:#212529;border-radius:.2rem}kbd kbd{padding:0;font-size:100%;font-weight:700}pre{display:block;font-size:87.5%;color:#586e75}pre code{font-size:inherit;color:inherit;word-break:normal}.pre-scrollable{max-height:340px;overflow-y:scroll}.container{width:100%;padding-right:15px;padding-left:15px;margin-right:auto;margin-left:auto}@media (min-width: 576px){.container{max-width:540px}}@media (min-width: 768px){.container{max-width:720px}}@media (min-width: 992px){.container{max-width:960px}}@media (min-width: 1200px){.container{max-width:1140px}}.container-fluid{width:100%;padding-right:15px;padding-left:15px;margin-right:auto;margin-left:auto}.row{display:flex;flex-wrap:wrap;margin-right:-15px;margin-left:-15px}.no-gutters{margin-right:0;margin-left:0}.no-gutters>.col,.no-gutters>[class*="col-"]{padding-right:0;padding-left:0}.col-1,.col-2,.col-3,.col-4,.col-5,.col-6,.col-7,.col-8,.col-9,.col-10,.col-11,.col-12,.col,.col-auto,.col-sm-1,.col-sm-2,.col-sm-3,.col-sm-4,.col-sm-5,.col-sm-6,.col-sm-7,.col-sm-8,.col-sm-9,.col-sm-10,.col-sm-11,.col-sm-12,.col-sm,.col-sm-auto,.col-md-1,.col-md-2,.col-md-3,.col-md-4,.col-md-5,.col-md-6,.col-md-7,.col-md-8,.col-md-9,.col-md-10,.col-md-11,.col-md-12,.col-md,.col-md-auto,.col-lg-1,.col-lg-2,.col-lg-3,.col-lg-4,.col-lg-5,.col-lg-6,.col-lg-7,.col-lg-8,.col-lg-9,.col-lg-10,.col-lg-11,.col-lg-12,.col-lg,.col-lg-auto,.col-xl-1,.col-xl-2,.col-xl-3,.col-xl-4,.col-xl-5,.col-xl-6,.col-xl-7,.col-xl-8,.col-xl-9,.col-xl-10,.col-xl-11,.col-xl-12,.col-xl,.col-xl-auto{position:relative;width:100%;padding-right:15px;padding-left:15px}.col{flex-basis:0;flex-grow:1;max-width:100%}.col-auto{flex:0 0 auto;width:auto;max-width:100%}.col-1{flex:0 0 8.33333%;max-width:8.33333%}.col-2{flex:0 0 16.66667%;max-width:16.66667%}.col-3{flex:0 0 25%;max-width:25%}.col-4{flex:0 0 33.33333%;max-width:33.33333%}.col-5{flex:0 0 41.66667%;max-width:41.66667%}.col-6{flex:0 0 50%;max-width:50%}.col-7{flex:0 0 58.33333%;max-width:58.33333%}.col-8{flex:0 0 66.66667%;max-width:66.66667%}.col-9{flex:0 0 75%;max-width:75%}.col-10{flex:0 0 83.33333%;max-width:83.33333%}.col-11{flex:0 0 91.66667%;max-width:91.66667%}.col-12{flex:0 0 100%;max-width:100%}.order-first{order:-1}.order-last{order:13}.order-0{order:0}.order-1{order:1}.order-2{order:2}.order-3{order:3}.order-4{order:4}.order-5{order:5}.order-6{order:6}.order-7{order:7}.order-8{order:8}.order-9{order:9}.order-10{order:10}.order-11{order:11}.order-12{order:12}.offset-1{margin-left:8.33333%}.offset-2{margin-left:16.66667%}.offset-3{margin-left:25%}.offset-4{margin-left:33.33333%}.offset-5{margin-left:41.66667%}.offset-6{margin-left:50%}.offset-7{margin-left:58.33333%}.offset-8{margin-left:66.66667%}.offset-9{margin-left:75%}.offset-10{margin-left:83.33333%}.offset-11{margin-left:91.66667%}@media (min-width: 576px){.col-sm{flex-basis:0;flex-grow:1;max-width:100%}.col-sm-auto{flex:0 0 auto;width:auto;max-width:100%}.col-sm-1{flex:0 0 8.33333%;max-width:8.33333%}.col-sm-2{flex:0 0 16.66667%;max-width:16.66667%}.col-sm-3{flex:0 0 25%;max-width:25%}.col-sm-4{flex:0 0 33.33333%;max-width:33.33333%}.col-sm-5{flex:0 0 41.66667%;max-width:41.66667%}.col-sm-6{flex:0 0 50%;max-width:50%}.col-sm-7{flex:0 0 58.33333%;max-width:58.33333%}.col-sm-8{flex:0 0 66.66667%;max-width:66.66667%}.col-sm-9{flex:0 0 75%;max-width:75%}.col-sm-10{flex:0 0 83.33333%;max-width:83.33333%}.col-sm-11{flex:0 0 91.66667%;max-width:91.66667%}.col-sm-12{flex:0 0 100%;max-width:100%}.order-sm-first{order:-1}.order-sm-last{order:13}.order-sm-0{order:0}.order-sm-1{order:1}.order-sm-2{order:2}.order-sm-3{order:3}.order-sm-4{order:4}.order-sm-5{order:5}.order-sm-6{order:6}.order-sm-7{order:7}.order-sm-8{order:8}.order-sm-9{order:9}.order-sm-10{order:10}.order-sm-11{order:11}.order-sm-12{order:12}.offset-sm-0{margin-left:0}.offset-sm-1{margin-left:8.33333%}.offset-sm-2{margin-left:16.66667%}.offset-sm-3{margin-left:25%}.offset-sm-4{margin-left:33.33333%}.offset-sm-5{margin-left:41.66667%}.offset-sm-6{margin-left:50%}.offset-sm-7{margin-left:58.33333%}.offset-sm-8{margin-left:66.66667%}.offset-sm-9{margin-left:75%}.offset-sm-10{margin-left:83.33333%}.offset-sm-11{margin-left:91.66667%}}@media (min-width: 768px){.col-md{flex-basis:0;flex-grow:1;max-width:100%}.col-md-auto{flex:0 0 auto;width:auto;max-width:100%}.col-md-1{flex:0 0 8.33333%;max-width:8.33333%}.col-md-2{flex:0 0 16.66667%;max-width:16.66667%}.col-md-3{flex:0 0 25%;max-width:25%}.col-md-4{flex:0 0 33.33333%;max-width:33.33333%}.col-md-5{flex:0 0 41.66667%;max-width:41.66667%}.col-md-6{flex:0 0 50%;max-width:50%}.col-md-7{flex:0 0 58.33333%;max-width:58.33333%}.col-md-8{flex:0 0 66.66667%;max-width:66.66667%}.col-md-9{flex:0 0 75%;max-width:75%}.col-md-10{flex:0 0 83.33333%;max-width:83.33333%}.col-md-11{flex:0 0 91.66667%;max-width:91.66667%}.col-md-12{flex:0 0 100%;max-width:100%}.order-md-first{order:-1}.order-md-last{order:13}.order-md-0{order:0}.order-md-1{order:1}.order-md-2{order:2}.order-md-3{order:3}.order-md-4{order:4}.order-md-5{order:5}.order-md-6{order:6}.order-md-7{order:7}.order-md-8{order:8}.order-md-9{order:9}.order-md-10{order:10}.order-md-11{order:11}.order-md-12{order:12}.offset-md-0{margin-left:0}.offset-md-1{margin-left:8.33333%}.offset-md-2{margin-left:16.66667%}.offset-md-3{margin-left:25%}.offset-md-4{margin-left:33.33333%}.offset-md-5{margin-left:41.66667%}.offset-md-6{margin-left:50%}.offset-md-7{margin-left:58.33333%}.offset-md-8{margin-left:66.66667%}.offset-md-9{margin-left:75%}.offset-md-10{margin-left:83.33333%}.offset-md-11{margin-left:91.66667%}}@media (min-width: 992px){.col-lg{flex-basis:0;flex-grow:1;max-width:100%}.col-lg-auto{flex:0 0 auto;width:auto;max-width:100%}.col-lg-1{flex:0 0 8.33333%;max-width:8.33333%}.col-lg-2{flex:0 0 16.66667%;max-width:16.66667%}.col-lg-3{flex:0 0 25%;max-width:25%}.col-lg-4{flex:0 0 33.33333%;max-width:33.33333%}.col-lg-5{flex:0 0 41.66667%;max-width:41.66667%}.col-lg-6{flex:0 0 50%;max-width:50%}.col-lg-7{flex:0 0 58.33333%;max-width:58.33333%}.col-lg-8{flex:0 0 66.66667%;max-width:66.66667%}.col-lg-9{flex:0 0 75%;max-width:75%}.col-lg-10{flex:0 0 83.33333%;max-width:83.33333%}.col-lg-11{flex:0 0 91.66667%;max-width:91.66667%}.col-lg-12{flex:0 0 100%;max-width:100%}.order-lg-first{order:-1}.order-lg-last{order:13}.order-lg-0{order:0}.order-lg-1{order:1}.order-lg-2{order:2}.order-lg-3{order:3}.order-lg-4{order:4}.order-lg-5{order:5}.order-lg-6{order:6}.order-lg-7{order:7}.order-lg-8{order:8}.order-lg-9{order:9}.order-lg-10{order:10}.order-lg-11{order:11}.order-lg-12{order:12}.offset-lg-0{margin-left:0}.offset-lg-1{margin-left:8.33333%}.offset-lg-2{margin-left:16.66667%}.offset-lg-3{margin-left:25%}.offset-lg-4{margin-left:33.33333%}.offset-lg-5{margin-left:41.66667%}.offset-lg-6{margin-left:50%}.offset-lg-7{margin-left:58.33333%}.offset-lg-8{margin-left:66.66667%}.offset-lg-9{margin-left:75%}.offset-lg-10{margin-left:83.33333%}.offset-lg-11{margin-left:91.66667%}}@media (min-width: 1200px){.col-xl{flex-basis:0;flex-grow:1;max-width:100%}.col-xl-auto{flex:0 0 auto;width:auto;max-width:100%}.col-xl-1{flex:0 0 8.33333%;max-width:8.33333%}.col-xl-2{flex:0 0 16.66667%;max-width:16.66667%}.col-xl-3{flex:0 0 25%;max-width:25%}.col-xl-4{flex:0 0 33.33333%;max-width:33.33333%}.col-xl-5{flex:0 0 41.66667%;max-width:41.66667%}.col-xl-6{flex:0 0 50%;max-width:50%}.col-xl-7{flex:0 0 58.33333%;max-width:58.33333%}.col-xl-8{flex:0 0 66.66667%;max-width:66.66667%}.col-xl-9{flex:0 0 75%;max-width:75%}.col-xl-10{flex:0 0 83.33333%;max-width:83.33333%}.col-xl-11{flex:0 0 91.66667%;max-width:91.66667%}.col-xl-12{flex:0 0 100%;max-width:100%}.order-xl-first{order:-1}.order-xl-last{order:13}.order-xl-0{order:0}.order-xl-1{order:1}.order-xl-2{order:2}.order-xl-3{order:3}.order-xl-4{order:4}.order-xl-5{order:5}.order-xl-6{order:6}.order-xl-7{order:7}.order-xl-8{order:8}.order-xl-9{order:9}.order-xl-10{order:10}.order-xl-11{order:11}.order-xl-12{order:12}.offset-xl-0{margin-left:0}.offset-xl-1{margin-left:8.33333%}.offset-xl-2{margin-left:16.66667%}.offset-xl-3{margin-left:25%}.offset-xl-4{margin-left:33.33333%}.offset-xl-5{margin-left:41.66667%}.offset-xl-6{margin-left:50%}.offset-xl-7{margin-left:58.33333%}.offset-xl-8{margin-left:66.66667%}.offset-xl-9{margin-left:75%}.offset-xl-10{margin-left:83.33333%}.offset-xl-11{margin-left:91.66667%}}.table{width:100%;margin-bottom:1rem;color:#373a3c}.table th,.table td{padding:.75rem;vertical-align:top;border-top:1px solid #dee2e6}.table thead th{vertical-align:bottom;border-bottom:2px solid #dee2e6}.table tbody+tbody{border-top:2px solid #dee2e6}.table-sm th,.table-sm td{padding:.3rem}.table-bordered{border:1px solid #dee2e6}.table-bordered th,.table-bordered td{border:1px solid #dee2e6}.table-bordered thead th,.table-bordered thead td{border-bottom-width:2px}.table-borderless th,.table-borderless td,.table-borderless thead th,.table-borderless tbody+tbody{border:0}.table-striped tbody tr:nth-of-type(odd){background-color:rgba(0,0,0,0.05)}.table-hover tbody tr:hover{color:#373a3c;background-color:rgba(0,0,0,0.075)}.table-primary,.table-primary>th,.table-primary>td{background-color:#c8d6ea}.table-primary th,.table-primary td,.table-primary thead th,.table-primary tbody+tbody{border-color:#9ab4d8}.table-hover .table-primary:hover{background-color:#b6c8e3}.table-hover .table-primary:hover>td,.table-hover .table-primary:hover>th{background-color:#b6c8e3}.table-secondary,.table-secondary>th,.table-secondary>td{background-color:#d6d8db}.table-secondary th,.table-secondary td,.table-secondary thead th,.table-secondary tbody+tbody{border-color:#b3b7bb}.table-hover .table-secondary:hover{background-color:#c8cbcf}.table-hover .table-secondary:hover>td,.table-hover .table-secondary:hover>th{background-color:#c8cbcf}.table-success,.table-success>th,.table-success>td{background-color:#c3e6cb}.table-success th,.table-success td,.table-success thead th,.table-success tbody+tbody{border-color:#8fd19e}.table-hover .table-success:hover{background-color:#b1dfbb}.table-hover .table-success:hover>td,.table-hover .table-success:hover>th{background-color:#b1dfbb}.table-info,.table-info>th,.table-info>td{background-color:#bee5eb}.table-info th,.table-info td,.table-info thead th,.table-info tbody+tbody{border-color:#86cfda}.table-hover .table-info:hover{background-color:#abdde5}.table-hover .table-info:hover>td,.table-hover .table-info:hover>th{background-color:#abdde5}.table-warning,.table-warning>th,.table-warning>td{background-color:#ffeeba}.table-warning th,.table-warning td,.table-warning thead th,.table-warning tbody+tbody{border-color:#ffdf7e}.table-hover .table-warning:hover{background-color:#ffe8a1}.table-hover .table-warning:hover>td,.table-hover .table-warning:hover>th{background-color:#ffe8a1}.table-danger,.table-danger>th,.table-danger>td{background-color:#f5c6cb}.table-danger th,.table-danger td,.table-danger thead th,.table-danger tbody+tbody{border-color:#ed969e}.table-hover .table-danger:hover{background-color:#f1b0b7}.table-hover .table-danger:hover>td,.table-hover .table-danger:hover>th{background-color:#f1b0b7}.table-light,.table-light>th,.table-light>td{background-color:#fdfdfe}.table-light th,.table-light td,.table-light thead th,.table-light tbody+tbody{border-color:#fbfcfc}.table-hover .table-light:hover{background-color:#ececf6}.table-hover .table-light:hover>td,.table-hover .table-light:hover>th{background-color:#ececf6}.table-dark,.table-dark>th,.table-dark>td{background-color:#c6c8ca}.table-dark th,.table-dark td,.table-dark thead th,.table-dark tbody+tbody{border-color:#95999c}.table-hover .table-dark:hover{background-color:#b9bbbe}.table-hover .table-dark:hover>td,.table-hover .table-dark:hover>th{background-color:#b9bbbe}.table-active,.table-active>th,.table-active>td{background-color:rgba(0,0,0,0.075)}.table-hover .table-active:hover{background-color:rgba(0,0,0,0.075)}.table-hover .table-active:hover>td,.table-hover .table-active:hover>th{background-color:rgba(0,0,0,0.075)}.table .thead-dark th{color:#fff;background-color:#343a40;border-color:#454d55}.table .thead-light th{color:#495057;background-color:#e9ecef;border-color:#dee2e6}.table-dark{color:#fff;background-color:#343a40}.table-dark th,.table-dark td,.table-dark thead th{border-color:#454d55}.table-dark.table-bordered{border:0}.table-dark.table-striped tbody tr:nth-of-type(odd){background-color:rgba(255,255,255,0.05)}.table-dark.table-hover tbody tr:hover{color:#fff;background-color:rgba(255,255,255,0.075)}@media (max-width: 575.98px){.table-responsive-sm{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch}.table-responsive-sm>.table-bordered{border:0}}@media (max-width: 767.98px){.table-responsive-md{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch}.table-responsive-md>.table-bordered{border:0}}@media (max-width: 991.98px){.table-responsive-lg{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch}.table-responsive-lg>.table-bordered{border:0}}@media (max-width: 1199.98px){.table-responsive-xl{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch}.table-responsive-xl>.table-bordered{border:0}}.table-responsive{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch}.table-responsive>.table-bordered{border:0}.form-control{display:block;width:100%;height:calc(1.5em + .75rem + 2px);padding:.375rem .75rem;font-size:.875rem;font-weight:400;line-height:1.5;color:#495057;background-color:#fff;background-clip:padding-box;border:1px solid #ced4da;border-radius:.25rem;transition:border-color 0.15s ease-in-out,box-shadow 0.15s ease-in-out}@media (prefers-reduced-motion: reduce){.form-control{transition:none}}.form-control::-ms-expand{background-color:transparent;border:0}.form-control:focus{color:#495057;background-color:#fff;border-color:#94b2db;outline:0;box-shadow:0 0 0 .2rem rgba(60,110,180,0.25)}.form-control::placeholder{color:#6c757d;opacity:1}.form-control:disabled,.form-control[readonly]{background-color:#e9ecef;opacity:1}select.form-control:focus::-ms-value{color:#495057;background-color:#fff}.form-control-file,.form-control-range{display:block;width:100%}.col-form-label{padding-top:calc(.375rem + 1px);padding-bottom:calc(.375rem + 1px);margin-bottom:0;font-size:inherit;line-height:1.5}.col-form-label-lg{padding-top:calc(.5rem + 1px);padding-bottom:calc(.5rem + 1px);font-size:1.09375rem;line-height:1.5}.col-form-label-sm{padding-top:calc(.25rem + 1px);padding-bottom:calc(.25rem + 1px);font-size:.76562rem;line-height:1.5}.form-control-plaintext{display:block;width:100%;padding-top:.375rem;padding-bottom:.375rem;margin-bottom:0;line-height:1.5;color:#373a3c;background-color:transparent;border:solid transparent;border-width:1px 0}.form-control-plaintext.form-control-sm,.form-control-plaintext.form-control-lg{padding-right:0;padding-left:0}.form-control-sm{height:calc(1.5em + .5rem + 2px);padding:.25rem .5rem;font-size:.76562rem;line-height:1.5;border-radius:.2rem}.form-control-lg{height:calc(1.5em + 1rem + 2px);padding:.5rem 1rem;font-size:1.09375rem;line-height:1.5;border-radius:.3rem}select.form-control[size],select.form-control[multiple]{height:auto}textarea.form-control{height:auto}.form-group{margin-bottom:1rem}.form-text{display:block;margin-top:.25rem}.form-row{display:flex;flex-wrap:wrap;margin-right:-5px;margin-left:-5px}.form-row>.col,.form-row>[class*="col-"]{padding-right:5px;padding-left:5px}.form-check{position:relative;display:block;padding-left:1.25rem}.form-check-input{position:absolute;margin-top:.3rem;margin-left:-1.25rem}.form-check-input:disabled ~ .form-check-label{color:#6c757d}.form-check-label{margin-bottom:0}.form-check-inline{display:inline-flex;align-items:center;padding-left:0;margin-right:.75rem}.form-check-inline .form-check-input{position:static;margin-top:0;margin-right:.3125rem;margin-left:0}.valid-feedback{display:none;width:100%;margin-top:.25rem;font-size:80%;color:#28a745}.valid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.25rem .5rem;margin-top:.1rem;font-size:.76562rem;line-height:1.5;color:#fff;background-color:rgba(40,167,69,0.9);border-radius:.25rem}.was-validated .form-control:valid,.form-control.is-valid{border-color:#28a745;padding-right:calc(1.5em + .75rem);background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%2328a745' d='M2.3 6.73L.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e");background-repeat:no-repeat;background-position:center right calc(.375em + .1875rem);background-size:calc(.75em + .375rem) calc(.75em + .375rem)}.was-validated .form-control:valid:focus,.form-control.is-valid:focus{border-color:#28a745;box-shadow:0 0 0 .2rem rgba(40,167,69,0.25)}.was-validated .form-control:valid ~ .valid-feedback,.was-validated .form-control:valid ~ .valid-tooltip,.form-control.is-valid ~ .valid-feedback,.form-control.is-valid ~ .valid-tooltip{display:block}.was-validated textarea.form-control:valid,textarea.form-control.is-valid{padding-right:calc(1.5em + .75rem);background-position:top calc(.375em + .1875rem) right calc(.375em + .1875rem)}.was-validated .custom-select:valid,.custom-select.is-valid{border-color:#28a745;padding-right:calc((1em + .75rem) * 3 / 4 + 1.75rem);background:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 4 5'%3e%3cpath fill='%23343a40' d='M2 0L0 2h4zm0 5L0 3h4z'/%3e%3c/svg%3e") no-repeat right .75rem center/8px 10px,url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%2328a745' d='M2.3 6.73L.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e") #fff no-repeat center right 1.75rem/calc(.75em + .375rem) calc(.75em + .375rem)}.was-validated .custom-select:valid:focus,.custom-select.is-valid:focus{border-color:#28a745;box-shadow:0 0 0 .2rem rgba(40,167,69,0.25)}.was-validated .custom-select:valid ~ .valid-feedback,.was-validated .custom-select:valid ~ .valid-tooltip,.custom-select.is-valid ~ .valid-feedback,.custom-select.is-valid ~ .valid-tooltip{display:block}.was-validated .form-control-file:valid ~ .valid-feedback,.was-validated .form-control-file:valid ~ .valid-tooltip,.form-control-file.is-valid ~ .valid-feedback,.form-control-file.is-valid ~ .valid-tooltip{display:block}.was-validated .form-check-input:valid ~ .form-check-label,.form-check-input.is-valid ~ .form-check-label{color:#28a745}.was-validated .form-check-input:valid ~ .valid-feedback,.was-validated .form-check-input:valid ~ .valid-tooltip,.form-check-input.is-valid ~ .valid-feedback,.form-check-input.is-valid ~ .valid-tooltip{display:block}.was-validated .custom-control-input:valid ~ .custom-control-label,.custom-control-input.is-valid ~ .custom-control-label{color:#28a745}.was-validated .custom-control-input:valid ~ .custom-control-label::before,.custom-control-input.is-valid ~ .custom-control-label::before{border-color:#28a745}.was-validated .custom-control-input:valid ~ .valid-feedback,.was-validated .custom-control-input:valid ~ .valid-tooltip,.custom-control-input.is-valid ~ .valid-feedback,.custom-control-input.is-valid ~ .valid-tooltip{display:block}.was-validated .custom-control-input:valid:checked ~ .custom-control-label::before,.custom-control-input.is-valid:checked ~ .custom-control-label::before{border-color:#34ce57;background-color:#34ce57}.was-validated .custom-control-input:valid:focus ~ .custom-control-label::before,.custom-control-input.is-valid:focus ~ .custom-control-label::before{box-shadow:0 0 0 .2rem rgba(40,167,69,0.25)}.was-validated .custom-control-input:valid:focus:not(:checked) ~ .custom-control-label::before,.custom-control-input.is-valid:focus:not(:checked) ~ .custom-control-label::before{border-color:#28a745}.was-validated .custom-file-input:valid ~ .custom-file-label,.custom-file-input.is-valid ~ .custom-file-label{border-color:#28a745}.was-validated .custom-file-input:valid ~ .valid-feedback,.was-validated .custom-file-input:valid ~ .valid-tooltip,.custom-file-input.is-valid ~ .valid-feedback,.custom-file-input.is-valid ~ .valid-tooltip{display:block}.was-validated .custom-file-input:valid:focus ~ .custom-file-label,.custom-file-input.is-valid:focus ~ .custom-file-label{border-color:#28a745;box-shadow:0 0 0 .2rem rgba(40,167,69,0.25)}.invalid-feedback{display:none;width:100%;margin-top:.25rem;font-size:80%;color:#dc3545}.invalid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.25rem .5rem;margin-top:.1rem;font-size:.76562rem;line-height:1.5;color:#fff;background-color:rgba(220,53,69,0.9);border-radius:.25rem}.was-validated .form-control:invalid,.form-control.is-invalid{border-color:#dc3545;padding-right:calc(1.5em + .75rem);background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' fill='%23dc3545' viewBox='-2 -2 7 7'%3e%3cpath stroke='%23dc3545' d='M0 0l3 3m0-3L0 3'/%3e%3ccircle r='.5'/%3e%3ccircle cx='3' r='.5'/%3e%3ccircle cy='3' r='.5'/%3e%3ccircle cx='3' cy='3' r='.5'/%3e%3c/svg%3E");background-repeat:no-repeat;background-position:center right calc(.375em + .1875rem);background-size:calc(.75em + .375rem) calc(.75em + .375rem)}.was-validated .form-control:invalid:focus,.form-control.is-invalid:focus{border-color:#dc3545;box-shadow:0 0 0 .2rem rgba(220,53,69,0.25)}.was-validated .form-control:invalid ~ .invalid-feedback,.was-validated .form-control:invalid ~ .invalid-tooltip,.form-control.is-invalid ~ .invalid-feedback,.form-control.is-invalid ~ .invalid-tooltip{display:block}.was-validated textarea.form-control:invalid,textarea.form-control.is-invalid{padding-right:calc(1.5em + .75rem);background-position:top calc(.375em + .1875rem) right calc(.375em + .1875rem)}.was-validated .custom-select:invalid,.custom-select.is-invalid{border-color:#dc3545;padding-right:calc((1em + .75rem) * 3 / 4 + 1.75rem);background:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 4 5'%3e%3cpath fill='%23343a40' d='M2 0L0 2h4zm0 5L0 3h4z'/%3e%3c/svg%3e") no-repeat right .75rem center/8px 10px,url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' fill='%23dc3545' viewBox='-2 -2 7 7'%3e%3cpath stroke='%23dc3545' d='M0 0l3 3m0-3L0 3'/%3e%3ccircle r='.5'/%3e%3ccircle cx='3' r='.5'/%3e%3ccircle cy='3' r='.5'/%3e%3ccircle cx='3' cy='3' r='.5'/%3e%3c/svg%3E") #fff no-repeat center right 1.75rem/calc(.75em + .375rem) calc(.75em + .375rem)}.was-validated .custom-select:invalid:focus,.custom-select.is-invalid:focus{border-color:#dc3545;box-shadow:0 0 0 .2rem rgba(220,53,69,0.25)}.was-validated .custom-select:invalid ~ .invalid-feedback,.was-validated .custom-select:invalid ~ .invalid-tooltip,.custom-select.is-invalid ~ .invalid-feedback,.custom-select.is-invalid ~ .invalid-tooltip{display:block}.was-validated .form-control-file:invalid ~ .invalid-feedback,.was-validated .form-control-file:invalid ~ .invalid-tooltip,.form-control-file.is-invalid ~ .invalid-feedback,.form-control-file.is-invalid ~ .invalid-tooltip{display:block}.was-validated .form-check-input:invalid ~ .form-check-label,.form-check-input.is-invalid ~ .form-check-label{color:#dc3545}.was-validated .form-check-input:invalid ~ .invalid-feedback,.was-validated .form-check-input:invalid ~ .invalid-tooltip,.form-check-input.is-invalid ~ .invalid-feedback,.form-check-input.is-invalid ~ .invalid-tooltip{display:block}.was-validated .custom-control-input:invalid ~ .custom-control-label,.custom-control-input.is-invalid ~ .custom-control-label{color:#dc3545}.was-validated .custom-control-input:invalid ~ .custom-control-label::before,.custom-control-input.is-invalid ~ .custom-control-label::before{border-color:#dc3545}.was-validated .custom-control-input:invalid ~ .invalid-feedback,.was-validated .custom-control-input:invalid ~ .invalid-tooltip,.custom-control-input.is-invalid ~ .invalid-feedback,.custom-control-input.is-invalid ~ .invalid-tooltip{display:block}.was-validated .custom-control-input:invalid:checked ~ .custom-control-label::before,.custom-control-input.is-invalid:checked ~ .custom-control-label::before{border-color:#e4606d;background-color:#e4606d}.was-validated .custom-control-input:invalid:focus ~ .custom-control-label::before,.custom-control-input.is-invalid:focus ~ .custom-control-label::before{box-shadow:0 0 0 .2rem rgba(220,53,69,0.25)}.was-validated .custom-control-input:invalid:focus:not(:checked) ~ .custom-control-label::before,.custom-control-input.is-invalid:focus:not(:checked) ~ .custom-control-label::before{border-color:#dc3545}.was-validated .custom-file-input:invalid ~ .custom-file-label,.custom-file-input.is-invalid ~ .custom-file-label{border-color:#dc3545}.was-validated .custom-file-input:invalid ~ .invalid-feedback,.was-validated .custom-file-input:invalid ~ .invalid-tooltip,.custom-file-input.is-invalid ~ .invalid-feedback,.custom-file-input.is-invalid ~ .invalid-tooltip{display:block}.was-validated .custom-file-input:invalid:focus ~ .custom-file-label,.custom-file-input.is-invalid:focus ~ .custom-file-label{border-color:#dc3545;box-shadow:0 0 0 .2rem rgba(220,53,69,0.25)}.form-inline{display:flex;flex-flow:row wrap;align-items:center}.form-inline .form-check{width:100%}@media (min-width: 576px){.form-inline label{display:flex;align-items:center;justify-content:center;margin-bottom:0}.form-inline .form-group{display:flex;flex:0 0 auto;flex-flow:row wrap;align-items:center;margin-bottom:0}.form-inline .form-control{display:inline-block;width:auto;vertical-align:middle}.form-inline .form-control-plaintext{display:inline-block}.form-inline .input-group,.form-inline .custom-select{width:auto}.form-inline .form-check{display:flex;align-items:center;justify-content:center;width:auto;padding-left:0}.form-inline .form-check-input{position:relative;flex-shrink:0;margin-top:0;margin-right:.25rem;margin-left:0}.form-inline .custom-control{align-items:center;justify-content:center}.form-inline .custom-control-label{margin-bottom:0}}.btn{display:inline-block;font-weight:400;color:#373a3c;text-align:center;vertical-align:middle;user-select:none;background-color:transparent;border:1px solid transparent;padding:.375rem .75rem;font-size:.875rem;line-height:1.5;border-radius:.25rem;transition:color 0.15s ease-in-out,background-color 0.15s ease-in-out,border-color 0.15s ease-in-out,box-shadow 0.15s ease-in-out}@media (prefers-reduced-motion: reduce){.btn{transition:none}}.btn:hover{color:#373a3c;text-decoration:none}.btn:focus,.btn.focus{outline:0;box-shadow:0 0 0 .2rem rgba(60,110,180,0.25)}.btn.disabled,.btn:disabled{opacity:.65}a.btn.disabled,fieldset:disabled a.btn{pointer-events:none}.btn-primary{color:#fff;background-color:#3c6eb4;border-color:#3c6eb4}.btn-primary:hover{color:#fff;background-color:#325c97;border-color:#2f578e}.btn-primary:focus,.btn-primary.focus{box-shadow:0 0 0 .2rem rgba(89,132,191,0.5)}.btn-primary.disabled,.btn-primary:disabled{color:#fff;background-color:#3c6eb4;border-color:#3c6eb4}.btn-primary:not(:disabled):not(.disabled):active,.btn-primary:not(:disabled):not(.disabled).active,.show>.btn-primary.dropdown-toggle{color:#fff;background-color:#2f578e;border-color:#2c5184}.btn-primary:not(:disabled):not(.disabled):active:focus,.btn-primary:not(:disabled):not(.disabled).active:focus,.show>.btn-primary.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(89,132,191,0.5)}.btn-secondary{color:#fff;background-color:#6c757d;border-color:#6c757d}.btn-secondary:hover{color:#fff;background-color:#5a6268;border-color:#545b62}.btn-secondary:focus,.btn-secondary.focus{box-shadow:0 0 0 .2rem rgba(130,138,145,0.5)}.btn-secondary.disabled,.btn-secondary:disabled{color:#fff;background-color:#6c757d;border-color:#6c757d}.btn-secondary:not(:disabled):not(.disabled):active,.btn-secondary:not(:disabled):not(.disabled).active,.show>.btn-secondary.dropdown-toggle{color:#fff;background-color:#545b62;border-color:#4e555b}.btn-secondary:not(:disabled):not(.disabled):active:focus,.btn-secondary:not(:disabled):not(.disabled).active:focus,.show>.btn-secondary.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(130,138,145,0.5)}.btn-success{color:#fff;background-color:#28a745;border-color:#28a745}.btn-success:hover{color:#fff;background-color:#218838;border-color:#1e7e34}.btn-success:focus,.btn-success.focus{box-shadow:0 0 0 .2rem rgba(72,180,97,0.5)}.btn-success.disabled,.btn-success:disabled{color:#fff;background-color:#28a745;border-color:#28a745}.btn-success:not(:disabled):not(.disabled):active,.btn-success:not(:disabled):not(.disabled).active,.show>.btn-success.dropdown-toggle{color:#fff;background-color:#1e7e34;border-color:#1c7430}.btn-success:not(:disabled):not(.disabled):active:focus,.btn-success:not(:disabled):not(.disabled).active:focus,.show>.btn-success.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(72,180,97,0.5)}.btn-info{color:#fff;background-color:#17a2b8;border-color:#17a2b8}.btn-info:hover{color:#fff;background-color:#138496;border-color:#117a8b}.btn-info:focus,.btn-info.focus{box-shadow:0 0 0 .2rem rgba(58,176,195,0.5)}.btn-info.disabled,.btn-info:disabled{color:#fff;background-color:#17a2b8;border-color:#17a2b8}.btn-info:not(:disabled):not(.disabled):active,.btn-info:not(:disabled):not(.disabled).active,.show>.btn-info.dropdown-toggle{color:#fff;background-color:#117a8b;border-color:#10707f}.btn-info:not(:disabled):not(.disabled):active:focus,.btn-info:not(:disabled):not(.disabled).active:focus,.show>.btn-info.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(58,176,195,0.5)}.btn-warning{color:#212529;background-color:#ffc107;border-color:#ffc107}.btn-warning:hover{color:#212529;background-color:#e0a800;border-color:#d39e00}.btn-warning:focus,.btn-warning.focus{box-shadow:0 0 0 .2rem rgba(222,170,12,0.5)}.btn-warning.disabled,.btn-warning:disabled{color:#212529;background-color:#ffc107;border-color:#ffc107}.btn-warning:not(:disabled):not(.disabled):active,.btn-warning:not(:disabled):not(.disabled).active,.show>.btn-warning.dropdown-toggle{color:#212529;background-color:#d39e00;border-color:#c69500}.btn-warning:not(:disabled):not(.disabled):active:focus,.btn-warning:not(:disabled):not(.disabled).active:focus,.show>.btn-warning.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(222,170,12,0.5)}.btn-danger{color:#fff;background-color:#dc3545;border-color:#dc3545}.btn-danger:hover{color:#fff;background-color:#c82333;border-color:#bd2130}.btn-danger:focus,.btn-danger.focus{box-shadow:0 0 0 .2rem rgba(225,83,97,0.5)}.btn-danger.disabled,.btn-danger:disabled{color:#fff;background-color:#dc3545;border-color:#dc3545}.btn-danger:not(:disabled):not(.disabled):active,.btn-danger:not(:disabled):not(.disabled).active,.show>.btn-danger.dropdown-toggle{color:#fff;background-color:#bd2130;border-color:#b21f2d}.btn-danger:not(:disabled):not(.disabled):active:focus,.btn-danger:not(:disabled):not(.disabled).active:focus,.show>.btn-danger.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(225,83,97,0.5)}.btn-light{color:#212529;background-color:#f8f9fa;border-color:#f8f9fa}.btn-light:hover{color:#212529;background-color:#e2e6ea;border-color:#dae0e5}.btn-light:focus,.btn-light.focus{box-shadow:0 0 0 .2rem rgba(216,217,219,0.5)}.btn-light.disabled,.btn-light:disabled{color:#212529;background-color:#f8f9fa;border-color:#f8f9fa}.btn-light:not(:disabled):not(.disabled):active,.btn-light:not(:disabled):not(.disabled).active,.show>.btn-light.dropdown-toggle{color:#212529;background-color:#dae0e5;border-color:#d3d9df}.btn-light:not(:disabled):not(.disabled):active:focus,.btn-light:not(:disabled):not(.disabled).active:focus,.show>.btn-light.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(216,217,219,0.5)}.btn-dark{color:#fff;background-color:#343a40;border-color:#343a40}.btn-dark:hover{color:#fff;background-color:#23272b;border-color:#1d2124}.btn-dark:focus,.btn-dark.focus{box-shadow:0 0 0 .2rem rgba(82,88,93,0.5)}.btn-dark.disabled,.btn-dark:disabled{color:#fff;background-color:#343a40;border-color:#343a40}.btn-dark:not(:disabled):not(.disabled):active,.btn-dark:not(:disabled):not(.disabled).active,.show>.btn-dark.dropdown-toggle{color:#fff;background-color:#1d2124;border-color:#171a1d}.btn-dark:not(:disabled):not(.disabled):active:focus,.btn-dark:not(:disabled):not(.disabled).active:focus,.show>.btn-dark.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(82,88,93,0.5)}.btn-outline-primary{color:#3c6eb4;border-color:#3c6eb4}.btn-outline-primary:hover{color:#fff;background-color:#3c6eb4;border-color:#3c6eb4}.btn-outline-primary:focus,.btn-outline-primary.focus{box-shadow:0 0 0 .2rem rgba(60,110,180,0.5)}.btn-outline-primary.disabled,.btn-outline-primary:disabled{color:#3c6eb4;background-color:transparent}.btn-outline-primary:not(:disabled):not(.disabled):active,.btn-outline-primary:not(:disabled):not(.disabled).active,.show>.btn-outline-primary.dropdown-toggle{color:#fff;background-color:#3c6eb4;border-color:#3c6eb4}.btn-outline-primary:not(:disabled):not(.disabled):active:focus,.btn-outline-primary:not(:disabled):not(.disabled).active:focus,.show>.btn-outline-primary.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(60,110,180,0.5)}.btn-outline-secondary{color:#6c757d;border-color:#6c757d}.btn-outline-secondary:hover{color:#fff;background-color:#6c757d;border-color:#6c757d}.btn-outline-secondary:focus,.btn-outline-secondary.focus{box-shadow:0 0 0 .2rem rgba(108,117,125,0.5)}.btn-outline-secondary.disabled,.btn-outline-secondary:disabled{color:#6c757d;background-color:transparent}.btn-outline-secondary:not(:disabled):not(.disabled):active,.btn-outline-secondary:not(:disabled):not(.disabled).active,.show>.btn-outline-secondary.dropdown-toggle{color:#fff;background-color:#6c757d;border-color:#6c757d}.btn-outline-secondary:not(:disabled):not(.disabled):active:focus,.btn-outline-secondary:not(:disabled):not(.disabled).active:focus,.show>.btn-outline-secondary.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(108,117,125,0.5)}.btn-outline-success{color:#28a745;border-color:#28a745}.btn-outline-success:hover{color:#fff;background-color:#28a745;border-color:#28a745}.btn-outline-success:focus,.btn-outline-success.focus{box-shadow:0 0 0 .2rem rgba(40,167,69,0.5)}.btn-outline-success.disabled,.btn-outline-success:disabled{color:#28a745;background-color:transparent}.btn-outline-success:not(:disabled):not(.disabled):active,.btn-outline-success:not(:disabled):not(.disabled).active,.show>.btn-outline-success.dropdown-toggle{color:#fff;background-color:#28a745;border-color:#28a745}.btn-outline-success:not(:disabled):not(.disabled):active:focus,.btn-outline-success:not(:disabled):not(.disabled).active:focus,.show>.btn-outline-success.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(40,167,69,0.5)}.btn-outline-info{color:#17a2b8;border-color:#17a2b8}.btn-outline-info:hover{color:#fff;background-color:#17a2b8;border-color:#17a2b8}.btn-outline-info:focus,.btn-outline-info.focus{box-shadow:0 0 0 .2rem rgba(23,162,184,0.5)}.btn-outline-info.disabled,.btn-outline-info:disabled{color:#17a2b8;background-color:transparent}.btn-outline-info:not(:disabled):not(.disabled):active,.btn-outline-info:not(:disabled):not(.disabled).active,.show>.btn-outline-info.dropdown-toggle{color:#fff;background-color:#17a2b8;border-color:#17a2b8}.btn-outline-info:not(:disabled):not(.disabled):active:focus,.btn-outline-info:not(:disabled):not(.disabled).active:focus,.show>.btn-outline-info.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(23,162,184,0.5)}.btn-outline-warning{color:#ffc107;border-color:#ffc107}.btn-outline-warning:hover{color:#212529;background-color:#ffc107;border-color:#ffc107}.btn-outline-warning:focus,.btn-outline-warning.focus{box-shadow:0 0 0 .2rem rgba(255,193,7,0.5)}.btn-outline-warning.disabled,.btn-outline-warning:disabled{color:#ffc107;background-color:transparent}.btn-outline-warning:not(:disabled):not(.disabled):active,.btn-outline-warning:not(:disabled):not(.disabled).active,.show>.btn-outline-warning.dropdown-toggle{color:#212529;background-color:#ffc107;border-color:#ffc107}.btn-outline-warning:not(:disabled):not(.disabled):active:focus,.btn-outline-warning:not(:disabled):not(.disabled).active:focus,.show>.btn-outline-warning.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(255,193,7,0.5)}.btn-outline-danger{color:#dc3545;border-color:#dc3545}.btn-outline-danger:hover{color:#fff;background-color:#dc3545;border-color:#dc3545}.btn-outline-danger:focus,.btn-outline-danger.focus{box-shadow:0 0 0 .2rem rgba(220,53,69,0.5)}.btn-outline-danger.disabled,.btn-outline-danger:disabled{color:#dc3545;background-color:transparent}.btn-outline-danger:not(:disabled):not(.disabled):active,.btn-outline-danger:not(:disabled):not(.disabled).active,.show>.btn-outline-danger.dropdown-toggle{color:#fff;background-color:#dc3545;border-color:#dc3545}.btn-outline-danger:not(:disabled):not(.disabled):active:focus,.btn-outline-danger:not(:disabled):not(.disabled).active:focus,.show>.btn-outline-danger.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(220,53,69,0.5)}.btn-outline-light{color:#f8f9fa;border-color:#f8f9fa}.btn-outline-light:hover{color:#212529;background-color:#f8f9fa;border-color:#f8f9fa}.btn-outline-light:focus,.btn-outline-light.focus{box-shadow:0 0 0 .2rem rgba(248,249,250,0.5)}.btn-outline-light.disabled,.btn-outline-light:disabled{color:#f8f9fa;background-color:transparent}.btn-outline-light:not(:disabled):not(.disabled):active,.btn-outline-light:not(:disabled):not(.disabled).active,.show>.btn-outline-light.dropdown-toggle{color:#212529;background-color:#f8f9fa;border-color:#f8f9fa}.btn-outline-light:not(:disabled):not(.disabled):active:focus,.btn-outline-light:not(:disabled):not(.disabled).active:focus,.show>.btn-outline-light.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(248,249,250,0.5)}.btn-outline-dark{color:#343a40;border-color:#343a40}.btn-outline-dark:hover{color:#fff;background-color:#343a40;border-color:#343a40}.btn-outline-dark:focus,.btn-outline-dark.focus{box-shadow:0 0 0 .2rem rgba(52,58,64,0.5)}.btn-outline-dark.disabled,.btn-outline-dark:disabled{color:#343a40;background-color:transparent}.btn-outline-dark:not(:disabled):not(.disabled):active,.btn-outline-dark:not(:disabled):not(.disabled).active,.show>.btn-outline-dark.dropdown-toggle{color:#fff;background-color:#343a40;border-color:#343a40}.btn-outline-dark:not(:disabled):not(.disabled):active:focus,.btn-outline-dark:not(:disabled):not(.disabled).active:focus,.show>.btn-outline-dark.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(52,58,64,0.5)}.btn-link{font-weight:400;color:#3c6eb4;text-decoration:none}.btn-link:hover{color:#294b7b;text-decoration:underline}.btn-link:focus,.btn-link.focus{text-decoration:underline;box-shadow:none}.btn-link:disabled,.btn-link.disabled{color:#6c757d;pointer-events:none}.btn-lg,.btn-group-lg>.btn{padding:.5rem 1rem;font-size:1.09375rem;line-height:1.5;border-radius:.3rem}.btn-sm,.btn-group-sm>.btn{padding:.25rem .5rem;font-size:.76562rem;line-height:1.5;border-radius:.2rem}.btn-block{display:block;width:100%}.btn-block+.btn-block{margin-top:.5rem}input[type="submit"].btn-block,input[type="reset"].btn-block,input[type="button"].btn-block{width:100%}.fade{transition:opacity 0.15s linear}@media (prefers-reduced-motion: reduce){.fade{transition:none}}.fade:not(.show){opacity:0}.collapse:not(.show){display:none}.collapsing{position:relative;height:0;overflow:hidden;transition:height 0.35s ease}@media (prefers-reduced-motion: reduce){.collapsing{transition:none}}.dropup,.dropright,.dropdown,.dropleft{position:relative}.dropdown-toggle{white-space:nowrap}.dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid;border-right:.3em solid transparent;border-bottom:0;border-left:.3em solid transparent}.dropdown-toggle:empty::after{margin-left:0}.dropdown-menu{position:absolute;top:100%;left:0;z-index:1000;display:none;float:left;min-width:10rem;padding:.5rem 0;margin:.125rem 0 0;font-size:.875rem;color:#373a3c;text-align:left;list-style:none;background-color:#fff;background-clip:padding-box;border:1px solid rgba(0,0,0,0.15);border-radius:.25rem}.dropdown-menu-left{right:auto;left:0}.dropdown-menu-right{right:0;left:auto}@media (min-width: 576px){.dropdown-menu-sm-left{right:auto;left:0}.dropdown-menu-sm-right{right:0;left:auto}}@media (min-width: 768px){.dropdown-menu-md-left{right:auto;left:0}.dropdown-menu-md-right{right:0;left:auto}}@media (min-width: 992px){.dropdown-menu-lg-left{right:auto;left:0}.dropdown-menu-lg-right{right:0;left:auto}}@media (min-width: 1200px){.dropdown-menu-xl-left{right:auto;left:0}.dropdown-menu-xl-right{right:0;left:auto}}.dropup .dropdown-menu{top:auto;bottom:100%;margin-top:0;margin-bottom:.125rem}.dropup .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:0;border-right:.3em solid transparent;border-bottom:.3em solid;border-left:.3em solid transparent}.dropup .dropdown-toggle:empty::after{margin-left:0}.dropright .dropdown-menu{top:0;right:auto;left:100%;margin-top:0;margin-left:.125rem}.dropright .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-right:0;border-bottom:.3em solid transparent;border-left:.3em solid}.dropright .dropdown-toggle:empty::after{margin-left:0}.dropright .dropdown-toggle::after{vertical-align:0}.dropleft .dropdown-menu{top:0;right:100%;left:auto;margin-top:0;margin-right:.125rem}.dropleft .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:""}.dropleft .dropdown-toggle::after{display:none}.dropleft .dropdown-toggle::before{display:inline-block;margin-right:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-right:.3em solid;border-bottom:.3em solid transparent}.dropleft .dropdown-toggle:empty::after{margin-left:0}.dropleft .dropdown-toggle::before{vertical-align:0}.dropdown-menu[x-placement^="top"],.dropdown-menu[x-placement^="right"],.dropdown-menu[x-placement^="bottom"],.dropdown-menu[x-placement^="left"]{right:auto;bottom:auto}.dropdown-divider{height:0;margin:.5rem 0;overflow:hidden;border-top:1px solid #e9ecef}.dropdown-item{display:block;width:100%;padding:.25rem 1.5rem;clear:both;font-weight:400;color:#212529;text-align:inherit;white-space:nowrap;background-color:transparent;border:0}.dropdown-item:hover,.dropdown-item:focus{color:#16181b;text-decoration:none;background-color:#f8f9fa}.dropdown-item.active,.dropdown-item:active{color:#fff;text-decoration:none;background-color:#3c6eb4}.dropdown-item.disabled,.dropdown-item:disabled{color:#6c757d;pointer-events:none;background-color:transparent}.dropdown-menu.show{display:block}.dropdown-header{display:block;padding:.5rem 1.5rem;margin-bottom:0;font-size:.76562rem;color:#6c757d;white-space:nowrap}.dropdown-item-text{display:block;padding:.25rem 1.5rem;color:#212529}.btn-group,.btn-group-vertical{position:relative;display:inline-flex;vertical-align:middle}.btn-group>.btn,.btn-group-vertical>.btn{position:relative;flex:1 1 auto}.btn-group>.btn:hover,.btn-group-vertical>.btn:hover{z-index:1}.btn-group>.btn:focus,.btn-group>.btn:active,.btn-group>.btn.active,.btn-group-vertical>.btn:focus,.btn-group-vertical>.btn:active,.btn-group-vertical>.btn.active{z-index:1}.btn-toolbar{display:flex;flex-wrap:wrap;justify-content:flex-start}.btn-toolbar .input-group{width:auto}.btn-group>.btn:not(:first-child),.btn-group>.btn-group:not(:first-child){margin-left:-1px}.btn-group>.btn:not(:last-child):not(.dropdown-toggle),.btn-group>.btn-group:not(:last-child)>.btn{border-top-right-radius:0;border-bottom-right-radius:0}.btn-group>.btn:not(:first-child),.btn-group>.btn-group:not(:first-child)>.btn{border-top-left-radius:0;border-bottom-left-radius:0}.dropdown-toggle-split{padding-right:.5625rem;padding-left:.5625rem}.dropdown-toggle-split::after,.dropup .dropdown-toggle-split::after,.dropright .dropdown-toggle-split::after{margin-left:0}.dropleft .dropdown-toggle-split::before{margin-right:0}.btn-sm+.dropdown-toggle-split,.btn-group-sm>.btn+.dropdown-toggle-split{padding-right:.375rem;padding-left:.375rem}.btn-lg+.dropdown-toggle-split,.btn-group-lg>.btn+.dropdown-toggle-split{padding-right:.75rem;padding-left:.75rem}.btn-group-vertical{flex-direction:column;align-items:flex-start;justify-content:center}.btn-group-vertical>.btn,.btn-group-vertical>.btn-group{width:100%}.btn-group-vertical>.btn:not(:first-child),.btn-group-vertical>.btn-group:not(:first-child){margin-top:-1px}.btn-group-vertical>.btn:not(:last-child):not(.dropdown-toggle),.btn-group-vertical>.btn-group:not(:last-child)>.btn{border-bottom-right-radius:0;border-bottom-left-radius:0}.btn-group-vertical>.btn:not(:first-child),.btn-group-vertical>.btn-group:not(:first-child)>.btn{border-top-left-radius:0;border-top-right-radius:0}.btn-group-toggle>.btn,.btn-group-toggle>.btn-group>.btn{margin-bottom:0}.btn-group-toggle>.btn input[type="radio"],.btn-group-toggle>.btn input[type="checkbox"],.btn-group-toggle>.btn-group>.btn input[type="radio"],.btn-group-toggle>.btn-group>.btn input[type="checkbox"]{position:absolute;clip:rect(0, 0, 0, 0);pointer-events:none}.input-group{position:relative;display:flex;flex-wrap:wrap;align-items:stretch;width:100%}.input-group>.form-control,.input-group>.form-control-plaintext,.input-group>.custom-select,.input-group>.custom-file{position:relative;flex:1 1 auto;width:1%;margin-bottom:0}.input-group>.form-control+.form-control,.input-group>.form-control+.custom-select,.input-group>.form-control+.custom-file,.input-group>.form-control-plaintext+.form-control,.input-group>.form-control-plaintext+.custom-select,.input-group>.form-control-plaintext+.custom-file,.input-group>.custom-select+.form-control,.input-group>.custom-select+.custom-select,.input-group>.custom-select+.custom-file,.input-group>.custom-file+.form-control,.input-group>.custom-file+.custom-select,.input-group>.custom-file+.custom-file{margin-left:-1px}.input-group>.form-control:focus,.input-group>.custom-select:focus,.input-group>.custom-file .custom-file-input:focus ~ .custom-file-label{z-index:3}.input-group>.custom-file .custom-file-input:focus{z-index:4}.input-group>.form-control:not(:last-child),.input-group>.custom-select:not(:last-child){border-top-right-radius:0;border-bottom-right-radius:0}.input-group>.form-control:not(:first-child),.input-group>.custom-select:not(:first-child){border-top-left-radius:0;border-bottom-left-radius:0}.input-group>.custom-file{display:flex;align-items:center}.input-group>.custom-file:not(:last-child) .custom-file-label,.input-group>.custom-file:not(:last-child) .custom-file-label::after{border-top-right-radius:0;border-bottom-right-radius:0}.input-group>.custom-file:not(:first-child) .custom-file-label{border-top-left-radius:0;border-bottom-left-radius:0}.input-group-prepend,.input-group-append{display:flex}.input-group-prepend .btn,.input-group-append .btn{position:relative;z-index:2}.input-group-prepend .btn:focus,.input-group-append .btn:focus{z-index:3}.input-group-prepend .btn+.btn,.input-group-prepend .btn+.input-group-text,.input-group-prepend .input-group-text+.input-group-text,.input-group-prepend .input-group-text+.btn,.input-group-append .btn+.btn,.input-group-append .btn+.input-group-text,.input-group-append .input-group-text+.input-group-text,.input-group-append .input-group-text+.btn{margin-left:-1px}.input-group-prepend{margin-right:-1px}.input-group-append{margin-left:-1px}.input-group-text{display:flex;align-items:center;padding:.375rem .75rem;margin-bottom:0;font-size:.875rem;font-weight:400;line-height:1.5;color:#495057;text-align:center;white-space:nowrap;background-color:#e9ecef;border:1px solid #ced4da;border-radius:.25rem}.input-group-text input[type="radio"],.input-group-text input[type="checkbox"]{margin-top:0}.input-group-lg>.form-control:not(textarea),.input-group-lg>.custom-select{height:calc(1.5em + 1rem + 2px)}.input-group-lg>.form-control,.input-group-lg>.custom-select,.input-group-lg>.input-group-prepend>.input-group-text,.input-group-lg>.input-group-append>.input-group-text,.input-group-lg>.input-group-prepend>.btn,.input-group-lg>.input-group-append>.btn{padding:.5rem 1rem;font-size:1.09375rem;line-height:1.5;border-radius:.3rem}.input-group-sm>.form-control:not(textarea),.input-group-sm>.custom-select{height:calc(1.5em + .5rem + 2px)}.input-group-sm>.form-control,.input-group-sm>.custom-select,.input-group-sm>.input-group-prepend>.input-group-text,.input-group-sm>.input-group-append>.input-group-text,.input-group-sm>.input-group-prepend>.btn,.input-group-sm>.input-group-append>.btn{padding:.25rem .5rem;font-size:.76562rem;line-height:1.5;border-radius:.2rem}.input-group-lg>.custom-select,.input-group-sm>.custom-select{padding-right:1.75rem}.input-group>.input-group-prepend>.btn,.input-group>.input-group-prepend>.input-group-text,.input-group>.input-group-append:not(:last-child)>.btn,.input-group>.input-group-append:not(:last-child)>.input-group-text,.input-group>.input-group-append:last-child>.btn:not(:last-child):not(.dropdown-toggle),.input-group>.input-group-append:last-child>.input-group-text:not(:last-child){border-top-right-radius:0;border-bottom-right-radius:0}.input-group>.input-group-append>.btn,.input-group>.input-group-append>.input-group-text,.input-group>.input-group-prepend:not(:first-child)>.btn,.input-group>.input-group-prepend:not(:first-child)>.input-group-text,.input-group>.input-group-prepend:first-child>.btn:not(:first-child),.input-group>.input-group-prepend:first-child>.input-group-text:not(:first-child){border-top-left-radius:0;border-bottom-left-radius:0}.custom-control{position:relative;display:block;min-height:1.3125rem;padding-left:1.5rem}.custom-control-inline{display:inline-flex;margin-right:1rem}.custom-control-input{position:absolute;z-index:-1;opacity:0}.custom-control-input:checked ~ .custom-control-label::before{color:#fff;border-color:#3c6eb4;background-color:#3c6eb4}.custom-control-input:focus ~ .custom-control-label::before{box-shadow:0 0 0 .2rem rgba(60,110,180,0.25)}.custom-control-input:focus:not(:checked) ~ .custom-control-label::before{border-color:#94b2db}.custom-control-input:not(:disabled):active ~ .custom-control-label::before{color:#fff;background-color:#bacde8;border-color:#bacde8}.custom-control-input:disabled ~ .custom-control-label{color:#6c757d}.custom-control-input:disabled ~ .custom-control-label::before{background-color:#e9ecef}.custom-control-label{position:relative;margin-bottom:0;vertical-align:top}.custom-control-label::before{position:absolute;top:.15625rem;left:-1.5rem;display:block;width:1rem;height:1rem;pointer-events:none;content:"";background-color:#fff;border:#adb5bd solid 1px}.custom-control-label::after{position:absolute;top:.15625rem;left:-1.5rem;display:block;width:1rem;height:1rem;content:"";background:no-repeat 50% / 50% 50%}.custom-checkbox .custom-control-label::before{border-radius:.25rem}.custom-checkbox .custom-control-input:checked ~ .custom-control-label::after{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23fff' d='M6.564.75l-3.59 3.612-1.538-1.55L0 4.26 2.974 7.25 8 2.193z'/%3e%3c/svg%3e")}.custom-checkbox .custom-control-input:indeterminate ~ .custom-control-label::before{border-color:#3c6eb4;background-color:#3c6eb4}.custom-checkbox .custom-control-input:indeterminate ~ .custom-control-label::after{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 4 4'%3e%3cpath stroke='%23fff' d='M0 2h4'/%3e%3c/svg%3e")}.custom-checkbox .custom-control-input:disabled:checked ~ .custom-control-label::before{background-color:rgba(60,110,180,0.5)}.custom-checkbox .custom-control-input:disabled:indeterminate ~ .custom-control-label::before{background-color:rgba(60,110,180,0.5)}.custom-radio .custom-control-label::before{border-radius:50%}.custom-radio .custom-control-input:checked ~ .custom-control-label::after{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%23fff'/%3e%3c/svg%3e")}.custom-radio .custom-control-input:disabled:checked ~ .custom-control-label::before{background-color:rgba(60,110,180,0.5)}.custom-switch{padding-left:2.25rem}.custom-switch .custom-control-label::before{left:-2.25rem;width:1.75rem;pointer-events:all;border-radius:.5rem}.custom-switch .custom-control-label::after{top:calc(.15625rem + 2px);left:calc(-2.25rem + 2px);width:calc(1rem - 4px);height:calc(1rem - 4px);background-color:#adb5bd;border-radius:.5rem;transition:transform 0.15s ease-in-out,background-color 0.15s ease-in-out,border-color 0.15s ease-in-out,box-shadow 0.15s ease-in-out}@media (prefers-reduced-motion: reduce){.custom-switch .custom-control-label::after{transition:none}}.custom-switch .custom-control-input:checked ~ .custom-control-label::after{background-color:#fff;transform:translateX(.75rem)}.custom-switch .custom-control-input:disabled:checked ~ .custom-control-label::before{background-color:rgba(60,110,180,0.5)}.custom-select{display:inline-block;width:100%;height:calc(1.5em + .75rem + 2px);padding:.375rem 1.75rem .375rem .75rem;font-size:.875rem;font-weight:400;line-height:1.5;color:#495057;vertical-align:middle;background:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 4 5'%3e%3cpath fill='%23343a40' d='M2 0L0 2h4zm0 5L0 3h4z'/%3e%3c/svg%3e") no-repeat right .75rem center/8px 10px;background-color:#fff;border:1px solid #ced4da;border-radius:.25rem;appearance:none}.custom-select:focus{border-color:#94b2db;outline:0;box-shadow:0 0 0 .2rem rgba(60,110,180,0.25)}.custom-select:focus::-ms-value{color:#495057;background-color:#fff}.custom-select[multiple],.custom-select[size]:not([size="1"]){height:auto;padding-right:.75rem;background-image:none}.custom-select:disabled{color:#6c757d;background-color:#e9ecef}.custom-select::-ms-expand{display:none}.custom-select-sm{height:calc(1.5em + .5rem + 2px);padding-top:.25rem;padding-bottom:.25rem;padding-left:.5rem;font-size:.76562rem}.custom-select-lg{height:calc(1.5em + 1rem + 2px);padding-top:.5rem;padding-bottom:.5rem;padding-left:1rem;font-size:1.09375rem}.custom-file{position:relative;display:inline-block;width:100%;height:calc(1.5em + .75rem + 2px);margin-bottom:0}.custom-file-input{position:relative;z-index:2;width:100%;height:calc(1.5em + .75rem + 2px);margin:0;opacity:0}.custom-file-input:focus ~ .custom-file-label{border-color:#94b2db;box-shadow:0 0 0 .2rem rgba(60,110,180,0.25)}.custom-file-input:disabled ~ .custom-file-label{background-color:#e9ecef}.custom-file-input:lang(en) ~ .custom-file-label::after{content:"Browse"}.custom-file-input ~ .custom-file-label[data-browse]::after{content:attr(data-browse)}.custom-file-label{position:absolute;top:0;right:0;left:0;z-index:1;height:calc(1.5em + .75rem + 2px);padding:.375rem .75rem;font-weight:400;line-height:1.5;color:#495057;background-color:#fff;border:1px solid #ced4da;border-radius:.25rem}.custom-file-label::after{position:absolute;top:0;right:0;bottom:0;z-index:3;display:block;height:calc(1.5em + .75rem);padding:.375rem .75rem;line-height:1.5;color:#495057;content:"Browse";background-color:#e9ecef;border-left:inherit;border-radius:0 .25rem .25rem 0}.custom-range{width:100%;height:calc(1rem + .4rem);padding:0;background-color:transparent;appearance:none}.custom-range:focus{outline:none}.custom-range:focus::-webkit-slider-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(60,110,180,0.25)}.custom-range:focus::-moz-range-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(60,110,180,0.25)}.custom-range:focus::-ms-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(60,110,180,0.25)}.custom-range::-moz-focus-outer{border:0}.custom-range::-webkit-slider-thumb{width:1rem;height:1rem;margin-top:-.25rem;background-color:#3c6eb4;border:0;border-radius:1rem;transition:background-color 0.15s ease-in-out,border-color 0.15s ease-in-out,box-shadow 0.15s ease-in-out;appearance:none}@media (prefers-reduced-motion: reduce){.custom-range::-webkit-slider-thumb{transition:none}}.custom-range::-webkit-slider-thumb:active{background-color:#bacde8}.custom-range::-webkit-slider-runnable-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:#dee2e6;border-color:transparent;border-radius:1rem}.custom-range::-moz-range-thumb{width:1rem;height:1rem;background-color:#3c6eb4;border:0;border-radius:1rem;transition:background-color 0.15s ease-in-out,border-color 0.15s ease-in-out,box-shadow 0.15s ease-in-out;appearance:none}@media (prefers-reduced-motion: reduce){.custom-range::-moz-range-thumb{transition:none}}.custom-range::-moz-range-thumb:active{background-color:#bacde8}.custom-range::-moz-range-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:#dee2e6;border-color:transparent;border-radius:1rem}.custom-range::-ms-thumb{width:1rem;height:1rem;margin-top:0;margin-right:.2rem;margin-left:.2rem;background-color:#3c6eb4;border:0;border-radius:1rem;transition:background-color 0.15s ease-in-out,border-color 0.15s ease-in-out,box-shadow 0.15s ease-in-out;appearance:none}@media (prefers-reduced-motion: reduce){.custom-range::-ms-thumb{transition:none}}.custom-range::-ms-thumb:active{background-color:#bacde8}.custom-range::-ms-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:transparent;border-color:transparent;border-width:.5rem}.custom-range::-ms-fill-lower{background-color:#dee2e6;border-radius:1rem}.custom-range::-ms-fill-upper{margin-right:15px;background-color:#dee2e6;border-radius:1rem}.custom-range:disabled::-webkit-slider-thumb{background-color:#adb5bd}.custom-range:disabled::-webkit-slider-runnable-track{cursor:default}.custom-range:disabled::-moz-range-thumb{background-color:#adb5bd}.custom-range:disabled::-moz-range-track{cursor:default}.custom-range:disabled::-ms-thumb{background-color:#adb5bd}.custom-control-label::before,.custom-file-label,.custom-select{transition:background-color 0.15s ease-in-out,border-color 0.15s ease-in-out,box-shadow 0.15s ease-in-out}@media (prefers-reduced-motion: reduce){.custom-control-label::before,.custom-file-label,.custom-select{transition:none}}.nav{display:flex;flex-wrap:wrap;padding-left:0;margin-bottom:0;list-style:none}.nav-link{display:block;padding:.5rem 1rem}.nav-link:hover,.nav-link:focus{text-decoration:none}.nav-link.disabled{color:#6c757d;pointer-events:none;cursor:default}.nav-tabs{border-bottom:1px solid #dee2e6}.nav-tabs .nav-item{margin-bottom:-1px}.nav-tabs .nav-link{border:1px solid transparent;border-top-left-radius:.25rem;border-top-right-radius:.25rem}.nav-tabs .nav-link:hover,.nav-tabs .nav-link:focus{border-color:#e9ecef #e9ecef #dee2e6}.nav-tabs .nav-link.disabled{color:#6c757d;background-color:transparent;border-color:transparent}.nav-tabs .nav-link.active,.nav-tabs .nav-item.show .nav-link{color:#495057;background-color:#fff;border-color:#dee2e6 #dee2e6 #fff}.nav-tabs .dropdown-menu{margin-top:-1px;border-top-left-radius:0;border-top-right-radius:0}.nav-pills .nav-link{border-radius:.25rem}.nav-pills .nav-link.active,.nav-pills .show>.nav-link{color:#fff;background-color:#3c6eb4}.nav-fill .nav-item{flex:1 1 auto;text-align:center}.nav-justified .nav-item{flex-basis:0;flex-grow:1;text-align:center}.tab-content>.tab-pane{display:none}.tab-content>.active{display:block}.navbar{position:relative;display:flex;flex-wrap:wrap;align-items:center;justify-content:space-between;padding:.5rem 1rem}.navbar>.container,.navbar>.container-fluid{display:flex;flex-wrap:wrap;align-items:center;justify-content:space-between}.navbar-brand{display:inline-block;padding-top:.33594rem;padding-bottom:.33594rem;margin-right:1rem;font-size:1.09375rem;line-height:inherit;white-space:nowrap}.navbar-brand:hover,.navbar-brand:focus{text-decoration:none}.navbar-nav{display:flex;flex-direction:column;padding-left:0;margin-bottom:0;list-style:none}.navbar-nav .nav-link{padding-right:0;padding-left:0}.navbar-nav .dropdown-menu{position:static;float:none}.navbar-text{display:inline-block;padding-top:.5rem;padding-bottom:.5rem}.navbar-collapse{flex-basis:100%;flex-grow:1;align-items:center}.navbar-toggler{padding:.25rem .75rem;font-size:1.09375rem;line-height:1;background-color:transparent;border:1px solid transparent;border-radius:.25rem}.navbar-toggler:hover,.navbar-toggler:focus{text-decoration:none}.navbar-toggler-icon{display:inline-block;width:1.5em;height:1.5em;vertical-align:middle;content:"";background:no-repeat center center;background-size:100% 100%}@media (max-width: 575.98px){.navbar-expand-sm>.container,.navbar-expand-sm>.container-fluid{padding-right:0;padding-left:0}}@media (min-width: 576px){.navbar-expand-sm{flex-flow:row nowrap;justify-content:flex-start}.navbar-expand-sm .navbar-nav{flex-direction:row}.navbar-expand-sm .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-sm .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand-sm>.container,.navbar-expand-sm>.container-fluid{flex-wrap:nowrap}.navbar-expand-sm .navbar-collapse{display:flex !important;flex-basis:auto}.navbar-expand-sm .navbar-toggler{display:none}}@media (max-width: 767.98px){.navbar-expand-md>.container,.navbar-expand-md>.container-fluid{padding-right:0;padding-left:0}}@media (min-width: 768px){.navbar-expand-md{flex-flow:row nowrap;justify-content:flex-start}.navbar-expand-md .navbar-nav{flex-direction:row}.navbar-expand-md .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-md .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand-md>.container,.navbar-expand-md>.container-fluid{flex-wrap:nowrap}.navbar-expand-md .navbar-collapse{display:flex !important;flex-basis:auto}.navbar-expand-md .navbar-toggler{display:none}}@media (max-width: 991.98px){.navbar-expand-lg>.container,.navbar-expand-lg>.container-fluid{padding-right:0;padding-left:0}}@media (min-width: 992px){.navbar-expand-lg{flex-flow:row nowrap;justify-content:flex-start}.navbar-expand-lg .navbar-nav{flex-direction:row}.navbar-expand-lg .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-lg .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand-lg>.container,.navbar-expand-lg>.container-fluid{flex-wrap:nowrap}.navbar-expand-lg .navbar-collapse{display:flex !important;flex-basis:auto}.navbar-expand-lg .navbar-toggler{display:none}}@media (max-width: 1199.98px){.navbar-expand-xl>.container,.navbar-expand-xl>.container-fluid{padding-right:0;padding-left:0}}@media (min-width: 1200px){.navbar-expand-xl{flex-flow:row nowrap;justify-content:flex-start}.navbar-expand-xl .navbar-nav{flex-direction:row}.navbar-expand-xl .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-xl .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand-xl>.container,.navbar-expand-xl>.container-fluid{flex-wrap:nowrap}.navbar-expand-xl .navbar-collapse{display:flex !important;flex-basis:auto}.navbar-expand-xl .navbar-toggler{display:none}}.navbar-expand{flex-flow:row nowrap;justify-content:flex-start}.navbar-expand>.container,.navbar-expand>.container-fluid{padding-right:0;padding-left:0}.navbar-expand .navbar-nav{flex-direction:row}.navbar-expand .navbar-nav .dropdown-menu{position:absolute}.navbar-expand .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand>.container,.navbar-expand>.container-fluid{flex-wrap:nowrap}.navbar-expand .navbar-collapse{display:flex !important;flex-basis:auto}.navbar-expand .navbar-toggler{display:none}.navbar-light .navbar-brand{color:rgba(0,0,0,0.9)}.navbar-light .navbar-brand:hover,.navbar-light .navbar-brand:focus{color:rgba(0,0,0,0.9)}.navbar-light .navbar-nav .nav-link{color:rgba(0,0,0,0.5)}.navbar-light .navbar-nav .nav-link:hover,.navbar-light .navbar-nav .nav-link:focus{color:rgba(0,0,0,0.7)}.navbar-light .navbar-nav .nav-link.disabled{color:rgba(0,0,0,0.3)}.navbar-light .navbar-nav .show>.nav-link,.navbar-light .navbar-nav .active>.nav-link,.navbar-light .navbar-nav .nav-link.show,.navbar-light .navbar-nav .nav-link.active{color:rgba(0,0,0,0.9)}.navbar-light .navbar-toggler{color:rgba(0,0,0,0.5);border-color:rgba(0,0,0,0.1)}.navbar-light .navbar-toggler-icon{background-image:url("data:image/svg+xml,%3csvg viewBox='0 0 30 30' xmlns='http://www.w3.org/2000/svg'%3e%3cpath stroke='rgba(0,0,0,0.5)' stroke-width='2' stroke-linecap='round' stroke-miterlimit='10' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e")}.navbar-light .navbar-text{color:rgba(0,0,0,0.5)}.navbar-light .navbar-text a{color:rgba(0,0,0,0.9)}.navbar-light .navbar-text a:hover,.navbar-light .navbar-text a:focus{color:rgba(0,0,0,0.9)}.navbar-dark .navbar-brand{color:#fff}.navbar-dark .navbar-brand:hover,.navbar-dark .navbar-brand:focus{color:#fff}.navbar-dark .navbar-nav .nav-link{color:rgba(255,255,255,0.5)}.navbar-dark .navbar-nav .nav-link:hover,.navbar-dark .navbar-nav .nav-link:focus{color:rgba(255,255,255,0.75)}.navbar-dark .navbar-nav .nav-link.disabled{color:rgba(255,255,255,0.25)}.navbar-dark .navbar-nav .show>.nav-link,.navbar-dark .navbar-nav .active>.nav-link,.navbar-dark .navbar-nav .nav-link.show,.navbar-dark .navbar-nav .nav-link.active{color:#fff}.navbar-dark .navbar-toggler{color:rgba(255,255,255,0.5);border-color:rgba(255,255,255,0.1)}.navbar-dark .navbar-toggler-icon{background-image:url("data:image/svg+xml,%3csvg viewBox='0 0 30 30' xmlns='http://www.w3.org/2000/svg'%3e%3cpath stroke='rgba(255,255,255,0.5)' stroke-width='2' stroke-linecap='round' stroke-miterlimit='10' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e")}.navbar-dark .navbar-text{color:rgba(255,255,255,0.5)}.navbar-dark .navbar-text a{color:#fff}.navbar-dark .navbar-text a:hover,.navbar-dark .navbar-text a:focus{color:#fff}.card{position:relative;display:flex;flex-direction:column;min-width:0;word-wrap:break-word;background-color:#fff;background-clip:border-box;border:1px solid rgba(0,0,0,0.125);border-radius:.25rem}.card>hr{margin-right:0;margin-left:0}.card>.list-group:first-child .list-group-item:first-child{border-top-left-radius:.25rem;border-top-right-radius:.25rem}.card>.list-group:last-child .list-group-item:last-child{border-bottom-right-radius:.25rem;border-bottom-left-radius:.25rem}.card-body{flex:1 1 auto;padding:1.25rem}.card-title{margin-bottom:.75rem}.card-subtitle{margin-top:-.375rem;margin-bottom:0}.card-text:last-child{margin-bottom:0}.card-link:hover{text-decoration:none}.card-link+.card-link{margin-left:1.25rem}.card-header{padding:.75rem 1.25rem;margin-bottom:0;background-color:rgba(0,0,0,0.03);border-bottom:1px solid rgba(0,0,0,0.125)}.card-header:first-child{border-radius:calc(.25rem - 1px) calc(.25rem - 1px) 0 0}.card-header+.list-group .list-group-item:first-child{border-top:0}.card-footer{padding:.75rem 1.25rem;background-color:rgba(0,0,0,0.03);border-top:1px solid rgba(0,0,0,0.125)}.card-footer:last-child{border-radius:0 0 calc(.25rem - 1px) calc(.25rem - 1px)}.card-header-tabs{margin-right:-.625rem;margin-bottom:-.75rem;margin-left:-.625rem;border-bottom:0}.card-header-pills{margin-right:-.625rem;margin-left:-.625rem}.card-img-overlay{position:absolute;top:0;right:0;bottom:0;left:0;padding:1.25rem}.card-img{width:100%;border-radius:calc(.25rem - 1px)}.card-img-top{width:100%;border-top-left-radius:calc(.25rem - 1px);border-top-right-radius:calc(.25rem - 1px)}.card-img-bottom{width:100%;border-bottom-right-radius:calc(.25rem - 1px);border-bottom-left-radius:calc(.25rem - 1px)}.card-deck{display:flex;flex-direction:column}.card-deck .card{margin-bottom:15px}@media (min-width: 576px){.card-deck{flex-flow:row wrap;margin-right:-15px;margin-left:-15px}.card-deck .card{display:flex;flex:1 0 0%;flex-direction:column;margin-right:15px;margin-bottom:0;margin-left:15px}}.card-group{display:flex;flex-direction:column}.card-group>.card{margin-bottom:15px}@media (min-width: 576px){.card-group{flex-flow:row wrap}.card-group>.card{flex:1 0 0%;margin-bottom:0}.card-group>.card+.card{margin-left:0;border-left:0}.card-group>.card:not(:last-child){border-top-right-radius:0;border-bottom-right-radius:0}.card-group>.card:not(:last-child) .card-img-top,.card-group>.card:not(:last-child) .card-header{border-top-right-radius:0}.card-group>.card:not(:last-child) .card-img-bottom,.card-group>.card:not(:last-child) .card-footer{border-bottom-right-radius:0}.card-group>.card:not(:first-child){border-top-left-radius:0;border-bottom-left-radius:0}.card-group>.card:not(:first-child) .card-img-top,.card-group>.card:not(:first-child) .card-header{border-top-left-radius:0}.card-group>.card:not(:first-child) .card-img-bottom,.card-group>.card:not(:first-child) .card-footer{border-bottom-left-radius:0}}.card-columns .card{margin-bottom:.75rem}@media (min-width: 576px){.card-columns{column-count:3;column-gap:1.25rem;orphans:1;widows:1}.card-columns .card{display:inline-block;width:100%}}.accordion>.card{overflow:hidden}.accordion>.card:not(:first-of-type) .card-header:first-child{border-radius:0}.accordion>.card:not(:first-of-type):not(:last-of-type){border-bottom:0;border-radius:0}.accordion>.card:first-of-type{border-bottom:0;border-bottom-right-radius:0;border-bottom-left-radius:0}.accordion>.card:last-of-type{border-top-left-radius:0;border-top-right-radius:0}.accordion>.card .card-header{margin-bottom:-1px}.breadcrumb{display:flex;flex-wrap:wrap;padding:.75rem 1rem;margin-bottom:1rem;list-style:none;background-color:#e9ecef;border-radius:.25rem}.breadcrumb-item+.breadcrumb-item{padding-left:.5rem}.breadcrumb-item+.breadcrumb-item::before{display:inline-block;padding-right:.5rem;color:#6c757d;content:"/"}.breadcrumb-item+.breadcrumb-item:hover::before{text-decoration:underline}.breadcrumb-item+.breadcrumb-item:hover::before{text-decoration:none}.breadcrumb-item.active{color:#6c757d}.pagination{display:flex;padding-left:0;list-style:none;border-radius:.25rem}.page-link{position:relative;display:block;padding:.5rem .75rem;margin-left:-1px;line-height:1.25;color:#3c6eb4;background-color:#fff;border:1px solid #dee2e6}.page-link:hover{z-index:2;color:#294b7b;text-decoration:none;background-color:#e9ecef;border-color:#dee2e6}.page-link:focus{z-index:2;outline:0;box-shadow:0 0 0 .2rem rgba(60,110,180,0.25)}.page-item:first-child .page-link{margin-left:0;border-top-left-radius:.25rem;border-bottom-left-radius:.25rem}.page-item:last-child .page-link{border-top-right-radius:.25rem;border-bottom-right-radius:.25rem}.page-item.active .page-link{z-index:1;color:#fff;background-color:#3c6eb4;border-color:#3c6eb4}.page-item.disabled .page-link{color:#6c757d;pointer-events:none;cursor:auto;background-color:#fff;border-color:#dee2e6}.pagination-lg .page-link{padding:.75rem 1.5rem;font-size:1.09375rem;line-height:1.5}.pagination-lg .page-item:first-child .page-link{border-top-left-radius:.3rem;border-bottom-left-radius:.3rem}.pagination-lg .page-item:last-child .page-link{border-top-right-radius:.3rem;border-bottom-right-radius:.3rem}.pagination-sm .page-link{padding:.25rem .5rem;font-size:.76562rem;line-height:1.5}.pagination-sm .page-item:first-child .page-link{border-top-left-radius:.2rem;border-bottom-left-radius:.2rem}.pagination-sm .page-item:last-child .page-link{border-top-right-radius:.2rem;border-bottom-right-radius:.2rem}.badge{display:inline-block;padding:.25em .4em;font-size:75%;font-weight:700;line-height:1;text-align:center;white-space:nowrap;vertical-align:baseline;border-radius:.25rem;transition:color 0.15s ease-in-out,background-color 0.15s ease-in-out,border-color 0.15s ease-in-out,box-shadow 0.15s ease-in-out}@media (prefers-reduced-motion: reduce){.badge{transition:none}}a.badge:hover,a.badge:focus{text-decoration:none}.badge:empty{display:none}.btn .badge{position:relative;top:-1px}.badge-pill{padding-right:.6em;padding-left:.6em;border-radius:10rem}.badge-primary{color:#fff;background-color:#3c6eb4}a.badge-primary:hover,a.badge-primary:focus{color:#fff;background-color:#2f578e}a.badge-primary:focus,a.badge-primary.focus{outline:0;box-shadow:0 0 0 .2rem rgba(60,110,180,0.5)}.badge-secondary{color:#fff;background-color:#6c757d}a.badge-secondary:hover,a.badge-secondary:focus{color:#fff;background-color:#545b62}a.badge-secondary:focus,a.badge-secondary.focus{outline:0;box-shadow:0 0 0 .2rem rgba(108,117,125,0.5)}.badge-success{color:#fff;background-color:#28a745}a.badge-success:hover,a.badge-success:focus{color:#fff;background-color:#1e7e34}a.badge-success:focus,a.badge-success.focus{outline:0;box-shadow:0 0 0 .2rem rgba(40,167,69,0.5)}.badge-info{color:#fff;background-color:#17a2b8}a.badge-info:hover,a.badge-info:focus{color:#fff;background-color:#117a8b}a.badge-info:focus,a.badge-info.focus{outline:0;box-shadow:0 0 0 .2rem rgba(23,162,184,0.5)}.badge-warning{color:#212529;background-color:#ffc107}a.badge-warning:hover,a.badge-warning:focus{color:#212529;background-color:#d39e00}a.badge-warning:focus,a.badge-warning.focus{outline:0;box-shadow:0 0 0 .2rem rgba(255,193,7,0.5)}.badge-danger{color:#fff;background-color:#dc3545}a.badge-danger:hover,a.badge-danger:focus{color:#fff;background-color:#bd2130}a.badge-danger:focus,a.badge-danger.focus{outline:0;box-shadow:0 0 0 .2rem rgba(220,53,69,0.5)}.badge-light{color:#212529;background-color:#f8f9fa}a.badge-light:hover,a.badge-light:focus{color:#212529;background-color:#dae0e5}a.badge-light:focus,a.badge-light.focus{outline:0;box-shadow:0 0 0 .2rem rgba(248,249,250,0.5)}.badge-dark{color:#fff;background-color:#343a40}a.badge-dark:hover,a.badge-dark:focus{color:#fff;background-color:#1d2124}a.badge-dark:focus,a.badge-dark.focus{outline:0;box-shadow:0 0 0 .2rem rgba(52,58,64,0.5)}.jumbotron{padding:2rem 1rem;margin-bottom:2rem;background-color:#e9ecef;border-radius:.3rem}@media (min-width: 576px){.jumbotron{padding:4rem 2rem}}.jumbotron-fluid{padding-right:0;padding-left:0;border-radius:0}.alert{position:relative;padding:.75rem 1.25rem;margin-bottom:1rem;border:1px solid transparent;border-radius:.25rem}.alert-heading{color:inherit}.alert-link{font-weight:700}.alert-dismissible{padding-right:3.8125rem}.alert-dismissible .close{position:absolute;top:0;right:0;padding:.75rem 1.25rem;color:inherit}.alert-primary{color:#1f395e;background-color:#d8e2f0;border-color:#c8d6ea}.alert-primary hr{border-top-color:#b6c8e3}.alert-primary .alert-link{color:#122238}.alert-secondary{color:#383d41;background-color:#e2e3e5;border-color:#d6d8db}.alert-secondary hr{border-top-color:#c8cbcf}.alert-secondary .alert-link{color:#202326}.alert-success{color:#155724;background-color:#d4edda;border-color:#c3e6cb}.alert-success hr{border-top-color:#b1dfbb}.alert-success .alert-link{color:#0b2e13}.alert-info{color:#0c5460;background-color:#d1ecf1;border-color:#bee5eb}.alert-info hr{border-top-color:#abdde5}.alert-info .alert-link{color:#062c33}.alert-warning{color:#856404;background-color:#fff3cd;border-color:#ffeeba}.alert-warning hr{border-top-color:#ffe8a1}.alert-warning .alert-link{color:#533f03}.alert-danger{color:#721c24;background-color:#f8d7da;border-color:#f5c6cb}.alert-danger hr{border-top-color:#f1b0b7}.alert-danger .alert-link{color:#491217}.alert-light{color:#818182;background-color:#fefefe;border-color:#fdfdfe}.alert-light hr{border-top-color:#ececf6}.alert-light .alert-link{color:#686868}.alert-dark{color:#1b1e21;background-color:#d6d8d9;border-color:#c6c8ca}.alert-dark hr{border-top-color:#b9bbbe}.alert-dark .alert-link{color:#040505}@keyframes progress-bar-stripes{from{background-position:1rem 0}to{background-position:0 0}}.progress{display:flex;height:1rem;overflow:hidden;font-size:.65625rem;background-color:#e9ecef;border-radius:.25rem}.progress-bar{display:flex;flex-direction:column;justify-content:center;color:#fff;text-align:center;white-space:nowrap;background-color:#3c6eb4;transition:width 0.6s ease}@media (prefers-reduced-motion: reduce){.progress-bar{transition:none}}.progress-bar-striped{background-image:linear-gradient(45deg, rgba(255,255,255,0.15) 25%, transparent 25%, transparent 50%, rgba(255,255,255,0.15) 50%, rgba(255,255,255,0.15) 75%, transparent 75%, transparent);background-size:1rem 1rem}.progress-bar-animated{animation:progress-bar-stripes 1s linear infinite}@media (prefers-reduced-motion: reduce){.progress-bar-animated{animation:none}}.media{display:flex;align-items:flex-start}.media-body{flex:1}.list-group{display:flex;flex-direction:column;padding-left:0;margin-bottom:0}.list-group-item-action{width:100%;color:#495057;text-align:inherit}.list-group-item-action:hover,.list-group-item-action:focus{z-index:1;color:#495057;text-decoration:none;background-color:#f8f9fa}.list-group-item-action:active{color:#373a3c;background-color:#e9ecef}.list-group-item{position:relative;display:block;padding:.75rem 1.25rem;margin-bottom:-1px;background-color:#fff;border:1px solid rgba(0,0,0,0.125)}.list-group-item:first-child{border-top-left-radius:.25rem;border-top-right-radius:.25rem}.list-group-item:last-child{margin-bottom:0;border-bottom-right-radius:.25rem;border-bottom-left-radius:.25rem}.list-group-item.disabled,.list-group-item:disabled{color:#6c757d;pointer-events:none;background-color:#fff}.list-group-item.active{z-index:2;color:#fff;background-color:#3c6eb4;border-color:#3c6eb4}.list-group-horizontal{flex-direction:row}.list-group-horizontal .list-group-item{margin-right:-1px;margin-bottom:0}.list-group-horizontal .list-group-item:first-child{border-top-left-radius:.25rem;border-bottom-left-radius:.25rem;border-top-right-radius:0}.list-group-horizontal .list-group-item:last-child{margin-right:0;border-top-right-radius:.25rem;border-bottom-right-radius:.25rem;border-bottom-left-radius:0}@media (min-width: 576px){.list-group-horizontal-sm{flex-direction:row}.list-group-horizontal-sm .list-group-item{margin-right:-1px;margin-bottom:0}.list-group-horizontal-sm .list-group-item:first-child{border-top-left-radius:.25rem;border-bottom-left-radius:.25rem;border-top-right-radius:0}.list-group-horizontal-sm .list-group-item:last-child{margin-right:0;border-top-right-radius:.25rem;border-bottom-right-radius:.25rem;border-bottom-left-radius:0}}@media (min-width: 768px){.list-group-horizontal-md{flex-direction:row}.list-group-horizontal-md .list-group-item{margin-right:-1px;margin-bottom:0}.list-group-horizontal-md .list-group-item:first-child{border-top-left-radius:.25rem;border-bottom-left-radius:.25rem;border-top-right-radius:0}.list-group-horizontal-md .list-group-item:last-child{margin-right:0;border-top-right-radius:.25rem;border-bottom-right-radius:.25rem;border-bottom-left-radius:0}}@media (min-width: 992px){.list-group-horizontal-lg{flex-direction:row}.list-group-horizontal-lg .list-group-item{margin-right:-1px;margin-bottom:0}.list-group-horizontal-lg .list-group-item:first-child{border-top-left-radius:.25rem;border-bottom-left-radius:.25rem;border-top-right-radius:0}.list-group-horizontal-lg .list-group-item:last-child{margin-right:0;border-top-right-radius:.25rem;border-bottom-right-radius:.25rem;border-bottom-left-radius:0}}@media (min-width: 1200px){.list-group-horizontal-xl{flex-direction:row}.list-group-horizontal-xl .list-group-item{margin-right:-1px;margin-bottom:0}.list-group-horizontal-xl .list-group-item:first-child{border-top-left-radius:.25rem;border-bottom-left-radius:.25rem;border-top-right-radius:0}.list-group-horizontal-xl .list-group-item:last-child{margin-right:0;border-top-right-radius:.25rem;border-bottom-right-radius:.25rem;border-bottom-left-radius:0}}.list-group-flush .list-group-item{border-right:0;border-left:0;border-radius:0}.list-group-flush .list-group-item:last-child{margin-bottom:-1px}.list-group-flush:first-child .list-group-item:first-child{border-top:0}.list-group-flush:last-child .list-group-item:last-child{margin-bottom:0;border-bottom:0}.list-group-item-primary{color:#1f395e;background-color:#c8d6ea}.list-group-item-primary.list-group-item-action:hover,.list-group-item-primary.list-group-item-action:focus{color:#1f395e;background-color:#b6c8e3}.list-group-item-primary.list-group-item-action.active{color:#fff;background-color:#1f395e;border-color:#1f395e}.list-group-item-secondary{color:#383d41;background-color:#d6d8db}.list-group-item-secondary.list-group-item-action:hover,.list-group-item-secondary.list-group-item-action:focus{color:#383d41;background-color:#c8cbcf}.list-group-item-secondary.list-group-item-action.active{color:#fff;background-color:#383d41;border-color:#383d41}.list-group-item-success{color:#155724;background-color:#c3e6cb}.list-group-item-success.list-group-item-action:hover,.list-group-item-success.list-group-item-action:focus{color:#155724;background-color:#b1dfbb}.list-group-item-success.list-group-item-action.active{color:#fff;background-color:#155724;border-color:#155724}.list-group-item-info{color:#0c5460;background-color:#bee5eb}.list-group-item-info.list-group-item-action:hover,.list-group-item-info.list-group-item-action:focus{color:#0c5460;background-color:#abdde5}.list-group-item-info.list-group-item-action.active{color:#fff;background-color:#0c5460;border-color:#0c5460}.list-group-item-warning{color:#856404;background-color:#ffeeba}.list-group-item-warning.list-group-item-action:hover,.list-group-item-warning.list-group-item-action:focus{color:#856404;background-color:#ffe8a1}.list-group-item-warning.list-group-item-action.active{color:#fff;background-color:#856404;border-color:#856404}.list-group-item-danger{color:#721c24;background-color:#f5c6cb}.list-group-item-danger.list-group-item-action:hover,.list-group-item-danger.list-group-item-action:focus{color:#721c24;background-color:#f1b0b7}.list-group-item-danger.list-group-item-action.active{color:#fff;background-color:#721c24;border-color:#721c24}.list-group-item-light{color:#818182;background-color:#fdfdfe}.list-group-item-light.list-group-item-action:hover,.list-group-item-light.list-group-item-action:focus{color:#818182;background-color:#ececf6}.list-group-item-light.list-group-item-action.active{color:#fff;background-color:#818182;border-color:#818182}.list-group-item-dark{color:#1b1e21;background-color:#c6c8ca}.list-group-item-dark.list-group-item-action:hover,.list-group-item-dark.list-group-item-action:focus{color:#1b1e21;background-color:#b9bbbe}.list-group-item-dark.list-group-item-action.active{color:#fff;background-color:#1b1e21;border-color:#1b1e21}.close{float:right;font-size:1.3125rem;font-weight:700;line-height:1;color:#000;text-shadow:0 1px 0 #fff;opacity:.5}.close:hover{color:#000;text-decoration:none}.close:not(:disabled):not(.disabled):hover,.close:not(:disabled):not(.disabled):focus{opacity:.75}button.close{padding:0;background-color:transparent;border:0;appearance:none}a.close.disabled{pointer-events:none}.toast{max-width:350px;overflow:hidden;font-size:.875rem;background-color:rgba(255,255,255,0.85);background-clip:padding-box;border:1px solid rgba(0,0,0,0.1);box-shadow:0 0.25rem 0.75rem rgba(0,0,0,0.1);backdrop-filter:blur(10px);opacity:0;border-radius:.25rem}.toast:not(:last-child){margin-bottom:.75rem}.toast.showing{opacity:1}.toast.show{display:block;opacity:1}.toast.hide{display:none}.toast-header{display:flex;align-items:center;padding:.25rem .75rem;color:#6c757d;background-color:rgba(255,255,255,0.85);background-clip:padding-box;border-bottom:1px solid rgba(0,0,0,0.05)}.toast-body{padding:.75rem}.modal-open{overflow:hidden}.modal-open .modal{overflow-x:hidden;overflow-y:auto}.modal{position:fixed;top:0;left:0;z-index:1050;display:none;width:100%;height:100%;overflow:hidden;outline:0}.modal-dialog{position:relative;width:auto;margin:.5rem;pointer-events:none}.modal.fade .modal-dialog{transition:transform 0.3s ease-out;transform:translate(0, -50px)}@media (prefers-reduced-motion: reduce){.modal.fade .modal-dialog{transition:none}}.modal.show .modal-dialog{transform:none}.modal-dialog-scrollable{display:flex;max-height:calc(100% - 1rem)}.modal-dialog-scrollable .modal-content{max-height:calc(100vh - 1rem);overflow:hidden}.modal-dialog-scrollable .modal-header,.modal-dialog-scrollable .modal-footer{flex-shrink:0}.modal-dialog-scrollable .modal-body{overflow-y:auto}.modal-dialog-centered{display:flex;align-items:center;min-height:calc(100% - 1rem)}.modal-dialog-centered::before{display:block;height:calc(100vh - 1rem);content:""}.modal-dialog-centered.modal-dialog-scrollable{flex-direction:column;justify-content:center;height:100%}.modal-dialog-centered.modal-dialog-scrollable .modal-content{max-height:none}.modal-dialog-centered.modal-dialog-scrollable::before{content:none}.modal-content{position:relative;display:flex;flex-direction:column;width:100%;pointer-events:auto;background-color:#fff;background-clip:padding-box;border:1px solid rgba(0,0,0,0.2);border-radius:.3rem;outline:0}.modal-backdrop{position:fixed;top:0;left:0;z-index:1040;width:100vw;height:100vh;background-color:#000}.modal-backdrop.fade{opacity:0}.modal-backdrop.show{opacity:.5}.modal-header{display:flex;align-items:flex-start;justify-content:space-between;padding:1rem 1rem;border-bottom:1px solid #dee2e6;border-top-left-radius:.3rem;border-top-right-radius:.3rem}.modal-header .close{padding:1rem 1rem;margin:-1rem -1rem -1rem auto}.modal-title{margin-bottom:0;line-height:1.5}.modal-body{position:relative;flex:1 1 auto;padding:1rem}.modal-footer{display:flex;align-items:center;justify-content:flex-end;padding:1rem;border-top:1px solid #dee2e6;border-bottom-right-radius:.3rem;border-bottom-left-radius:.3rem}.modal-footer>:not(:first-child){margin-left:.25rem}.modal-footer>:not(:last-child){margin-right:.25rem}.modal-scrollbar-measure{position:absolute;top:-9999px;width:50px;height:50px;overflow:scroll}@media (min-width: 576px){.modal-dialog{max-width:500px;margin:1.75rem auto}.modal-dialog-scrollable{max-height:calc(100% - 3.5rem)}.modal-dialog-scrollable .modal-content{max-height:calc(100vh - 3.5rem)}.modal-dialog-centered{min-height:calc(100% - 3.5rem)}.modal-dialog-centered::before{height:calc(100vh - 3.5rem)}.modal-sm{max-width:300px}}@media (min-width: 992px){.modal-lg,.modal-xl{max-width:800px}}@media (min-width: 1200px){.modal-xl{max-width:1140px}}.tooltip{position:absolute;z-index:1070;display:block;margin:0;font-family:"Open Sans";font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;word-spacing:normal;white-space:normal;line-break:auto;font-size:.76562rem;word-wrap:break-word;opacity:0}.tooltip.show{opacity:.9}.tooltip .arrow{position:absolute;display:block;width:.8rem;height:.4rem}.tooltip .arrow::before{position:absolute;content:"";border-color:transparent;border-style:solid}.bs-tooltip-top,.bs-tooltip-auto[x-placement^="top"]{padding:.4rem 0}.bs-tooltip-top .arrow,.bs-tooltip-auto[x-placement^="top"] .arrow{bottom:0}.bs-tooltip-top .arrow::before,.bs-tooltip-auto[x-placement^="top"] .arrow::before{top:0;border-width:.4rem .4rem 0;border-top-color:#000}.bs-tooltip-right,.bs-tooltip-auto[x-placement^="right"]{padding:0 .4rem}.bs-tooltip-right .arrow,.bs-tooltip-auto[x-placement^="right"] .arrow{left:0;width:.4rem;height:.8rem}.bs-tooltip-right .arrow::before,.bs-tooltip-auto[x-placement^="right"] .arrow::before{right:0;border-width:.4rem .4rem .4rem 0;border-right-color:#000}.bs-tooltip-bottom,.bs-tooltip-auto[x-placement^="bottom"]{padding:.4rem 0}.bs-tooltip-bottom .arrow,.bs-tooltip-auto[x-placement^="bottom"] .arrow{top:0}.bs-tooltip-bottom .arrow::before,.bs-tooltip-auto[x-placement^="bottom"] .arrow::before{bottom:0;border-width:0 .4rem .4rem;border-bottom-color:#000}.bs-tooltip-left,.bs-tooltip-auto[x-placement^="left"]{padding:0 .4rem}.bs-tooltip-left .arrow,.bs-tooltip-auto[x-placement^="left"] .arrow{right:0;width:.4rem;height:.8rem}.bs-tooltip-left .arrow::before,.bs-tooltip-auto[x-placement^="left"] .arrow::before{left:0;border-width:.4rem 0 .4rem .4rem;border-left-color:#000}.tooltip-inner{max-width:200px;padding:.25rem .5rem;color:#fff;text-align:center;background-color:#000;border-radius:.25rem}.popover{position:absolute;top:0;left:0;z-index:1060;display:block;max-width:276px;font-family:"Open Sans";font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;word-spacing:normal;white-space:normal;line-break:auto;font-size:.76562rem;word-wrap:break-word;background-color:#fff;background-clip:padding-box;border:1px solid rgba(0,0,0,0.2);border-radius:.3rem}.popover .arrow{position:absolute;display:block;width:1rem;height:.5rem;margin:0 .3rem}.popover .arrow::before,.popover .arrow::after{position:absolute;display:block;content:"";border-color:transparent;border-style:solid}.bs-popover-top,.bs-popover-auto[x-placement^="top"]{margin-bottom:.5rem}.bs-popover-top>.arrow,.bs-popover-auto[x-placement^="top"]>.arrow{bottom:calc((.5rem + 1px) * -1)}.bs-popover-top>.arrow::before,.bs-popover-auto[x-placement^="top"]>.arrow::before{bottom:0;border-width:.5rem .5rem 0;border-top-color:rgba(0,0,0,0.25)}.bs-popover-top>.arrow::after,.bs-popover-auto[x-placement^="top"]>.arrow::after{bottom:1px;border-width:.5rem .5rem 0;border-top-color:#fff}.bs-popover-right,.bs-popover-auto[x-placement^="right"]{margin-left:.5rem}.bs-popover-right>.arrow,.bs-popover-auto[x-placement^="right"]>.arrow{left:calc((.5rem + 1px) * -1);width:.5rem;height:1rem;margin:.3rem 0}.bs-popover-right>.arrow::before,.bs-popover-auto[x-placement^="right"]>.arrow::before{left:0;border-width:.5rem .5rem .5rem 0;border-right-color:rgba(0,0,0,0.25)}.bs-popover-right>.arrow::after,.bs-popover-auto[x-placement^="right"]>.arrow::after{left:1px;border-width:.5rem .5rem .5rem 0;border-right-color:#fff}.bs-popover-bottom,.bs-popover-auto[x-placement^="bottom"]{margin-top:.5rem}.bs-popover-bottom>.arrow,.bs-popover-auto[x-placement^="bottom"]>.arrow{top:calc((.5rem + 1px) * -1)}.bs-popover-bottom>.arrow::before,.bs-popover-auto[x-placement^="bottom"]>.arrow::before{top:0;border-width:0 .5rem .5rem .5rem;border-bottom-color:rgba(0,0,0,0.25)}.bs-popover-bottom>.arrow::after,.bs-popover-auto[x-placement^="bottom"]>.arrow::after{top:1px;border-width:0 .5rem .5rem .5rem;border-bottom-color:#fff}.bs-popover-bottom .popover-header::before,.bs-popover-auto[x-placement^="bottom"] .popover-header::before{position:absolute;top:0;left:50%;display:block;width:1rem;margin-left:-.5rem;content:"";border-bottom:1px solid #f7f7f7}.bs-popover-left,.bs-popover-auto[x-placement^="left"]{margin-right:.5rem}.bs-popover-left>.arrow,.bs-popover-auto[x-placement^="left"]>.arrow{right:calc((.5rem + 1px) * -1);width:.5rem;height:1rem;margin:.3rem 0}.bs-popover-left>.arrow::before,.bs-popover-auto[x-placement^="left"]>.arrow::before{right:0;border-width:.5rem 0 .5rem .5rem;border-left-color:rgba(0,0,0,0.25)}.bs-popover-left>.arrow::after,.bs-popover-auto[x-placement^="left"]>.arrow::after{right:1px;border-width:.5rem 0 .5rem .5rem;border-left-color:#fff}.popover-header{padding:.5rem .75rem;margin-bottom:0;font-size:.875rem;background-color:#f7f7f7;border-bottom:1px solid #ebebeb;border-top-left-radius:calc(.3rem - 1px);border-top-right-radius:calc(.3rem - 1px)}.popover-header:empty{display:none}.popover-body{padding:.5rem .75rem;color:#373a3c}.carousel{position:relative}.carousel.pointer-event{touch-action:pan-y}.carousel-inner{position:relative;width:100%;overflow:hidden}.carousel-inner::after{display:block;clear:both;content:""}.carousel-item{position:relative;display:none;float:left;width:100%;margin-right:-100%;backface-visibility:hidden;transition:transform .6s ease-in-out}@media (prefers-reduced-motion: reduce){.carousel-item{transition:none}}.carousel-item.active,.carousel-item-next,.carousel-item-prev{display:block}.carousel-item-next:not(.carousel-item-left),.active.carousel-item-right{transform:translateX(100%)}.carousel-item-prev:not(.carousel-item-right),.active.carousel-item-left{transform:translateX(-100%)}.carousel-fade .carousel-item{opacity:0;transition-property:opacity;transform:none}.carousel-fade .carousel-item.active,.carousel-fade .carousel-item-next.carousel-item-left,.carousel-fade .carousel-item-prev.carousel-item-right{z-index:1;opacity:1}.carousel-fade .active.carousel-item-left,.carousel-fade .active.carousel-item-right{z-index:0;opacity:0;transition:0s .6s opacity}@media (prefers-reduced-motion: reduce){.carousel-fade .active.carousel-item-left,.carousel-fade .active.carousel-item-right{transition:none}}.carousel-control-prev,.carousel-control-next{position:absolute;top:0;bottom:0;z-index:1;display:flex;align-items:center;justify-content:center;width:15%;color:#fff;text-align:center;opacity:.5;transition:opacity 0.15s ease}@media (prefers-reduced-motion: reduce){.carousel-control-prev,.carousel-control-next{transition:none}}.carousel-control-prev:hover,.carousel-control-prev:focus,.carousel-control-next:hover,.carousel-control-next:focus{color:#fff;text-decoration:none;outline:0;opacity:.9}.carousel-control-prev{left:0}.carousel-control-next{right:0}.carousel-control-prev-icon,.carousel-control-next-icon{display:inline-block;width:20px;height:20px;background:no-repeat 50% / 100% 100%}.carousel-control-prev-icon{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' fill='%23fff' viewBox='0 0 8 8'%3e%3cpath d='M5.25 0l-4 4 4 4 1.5-1.5-2.5-2.5 2.5-2.5-1.5-1.5z'/%3e%3c/svg%3e")}.carousel-control-next-icon{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' fill='%23fff' viewBox='0 0 8 8'%3e%3cpath d='M2.75 0l-1.5 1.5 2.5 2.5-2.5 2.5 1.5 1.5 4-4-4-4z'/%3e%3c/svg%3e")}.carousel-indicators{position:absolute;right:0;bottom:0;left:0;z-index:15;display:flex;justify-content:center;padding-left:0;margin-right:15%;margin-left:15%;list-style:none}.carousel-indicators li{box-sizing:content-box;flex:0 1 auto;width:30px;height:3px;margin-right:3px;margin-left:3px;text-indent:-999px;cursor:pointer;background-color:#fff;background-clip:padding-box;border-top:10px solid transparent;border-bottom:10px solid transparent;opacity:.5;transition:opacity 0.6s ease}@media (prefers-reduced-motion: reduce){.carousel-indicators li{transition:none}}.carousel-indicators .active{opacity:1}.carousel-caption{position:absolute;right:15%;bottom:20px;left:15%;z-index:10;padding-top:20px;padding-bottom:20px;color:#fff;text-align:center}@keyframes spinner-border{to{transform:rotate(360deg)}}.spinner-border{display:inline-block;width:2rem;height:2rem;vertical-align:text-bottom;border:.25em solid currentColor;border-right-color:transparent;border-radius:50%;animation:spinner-border .75s linear infinite}.spinner-border-sm{width:1rem;height:1rem;border-width:.2em}@keyframes spinner-grow{0%{transform:scale(0)}50%{opacity:1}}.spinner-grow{display:inline-block;width:2rem;height:2rem;vertical-align:text-bottom;background-color:currentColor;border-radius:50%;opacity:0;animation:spinner-grow .75s linear infinite}.spinner-grow-sm{width:1rem;height:1rem}.align-baseline{vertical-align:baseline !important}.align-top{vertical-align:top !important}.align-middle{vertical-align:middle !important}.align-bottom{vertical-align:bottom !important}.align-text-bottom{vertical-align:text-bottom !important}.align-text-top{vertical-align:text-top !important}.bg-primary{background-color:#3c6eb4 !important}a.bg-primary:hover,a.bg-primary:focus,button.bg-primary:hover,button.bg-primary:focus{background-color:#2f578e !important}.bg-secondary{background-color:#6c757d !important}a.bg-secondary:hover,a.bg-secondary:focus,button.bg-secondary:hover,button.bg-secondary:focus{background-color:#545b62 !important}.bg-success{background-color:#28a745 !important}a.bg-success:hover,a.bg-success:focus,button.bg-success:hover,button.bg-success:focus{background-color:#1e7e34 !important}.bg-info{background-color:#17a2b8 !important}a.bg-info:hover,a.bg-info:focus,button.bg-info:hover,button.bg-info:focus{background-color:#117a8b !important}.bg-warning{background-color:#ffc107 !important}a.bg-warning:hover,a.bg-warning:focus,button.bg-warning:hover,button.bg-warning:focus{background-color:#d39e00 !important}.bg-danger{background-color:#dc3545 !important}a.bg-danger:hover,a.bg-danger:focus,button.bg-danger:hover,button.bg-danger:focus{background-color:#bd2130 !important}.bg-light{background-color:#f8f9fa !important}a.bg-light:hover,a.bg-light:focus,button.bg-light:hover,button.bg-light:focus{background-color:#dae0e5 !important}.bg-dark{background-color:#343a40 !important}a.bg-dark:hover,a.bg-dark:focus,button.bg-dark:hover,button.bg-dark:focus{background-color:#1d2124 !important}.bg-white{background-color:#fff !important}.bg-transparent{background-color:transparent !important}.border{border:1px solid #dee2e6 !important}.border-top{border-top:1px solid #dee2e6 !important}.border-right{border-right:1px solid #dee2e6 !important}.border-bottom{border-bottom:1px solid #dee2e6 !important}.border-left{border-left:1px solid #dee2e6 !important}.border-0{border:0 !important}.border-top-0{border-top:0 !important}.border-right-0{border-right:0 !important}.border-bottom-0{border-bottom:0 !important}.border-left-0{border-left:0 !important}.border-primary{border-color:#3c6eb4 !important}.border-secondary{border-color:#6c757d !important}.border-success{border-color:#28a745 !important}.border-info{border-color:#17a2b8 !important}.border-warning{border-color:#ffc107 !important}.border-danger{border-color:#dc3545 !important}.border-light{border-color:#f8f9fa !important}.border-dark{border-color:#343a40 !important}.border-white{border-color:#fff !important}.rounded-sm{border-radius:.2rem !important}.rounded{border-radius:.25rem !important}.rounded-top{border-top-left-radius:.25rem !important;border-top-right-radius:.25rem !important}.rounded-right{border-top-right-radius:.25rem !important;border-bottom-right-radius:.25rem !important}.rounded-bottom{border-bottom-right-radius:.25rem !important;border-bottom-left-radius:.25rem !important}.rounded-left{border-top-left-radius:.25rem !important;border-bottom-left-radius:.25rem !important}.rounded-lg{border-radius:.3rem !important}.rounded-circle{border-radius:50% !important}.rounded-pill{border-radius:50rem !important}.rounded-0{border-radius:0 !important}.clearfix::after{display:block;clear:both;content:""}.d-none{display:none !important}.d-inline{display:inline !important}.d-inline-block{display:inline-block !important}.d-block{display:block !important}.d-table{display:table !important}.d-table-row{display:table-row !important}.d-table-cell{display:table-cell !important}.d-flex{display:flex !important}.d-inline-flex{display:inline-flex !important}@media (min-width: 576px){.d-sm-none{display:none !important}.d-sm-inline{display:inline !important}.d-sm-inline-block{display:inline-block !important}.d-sm-block{display:block !important}.d-sm-table{display:table !important}.d-sm-table-row{display:table-row !important}.d-sm-table-cell{display:table-cell !important}.d-sm-flex{display:flex !important}.d-sm-inline-flex{display:inline-flex !important}}@media (min-width: 768px){.d-md-none{display:none !important}.d-md-inline{display:inline !important}.d-md-inline-block{display:inline-block !important}.d-md-block{display:block !important}.d-md-table{display:table !important}.d-md-table-row{display:table-row !important}.d-md-table-cell{display:table-cell !important}.d-md-flex{display:flex !important}.d-md-inline-flex{display:inline-flex !important}}@media (min-width: 992px){.d-lg-none{display:none !important}.d-lg-inline{display:inline !important}.d-lg-inline-block{display:inline-block !important}.d-lg-block{display:block !important}.d-lg-table{display:table !important}.d-lg-table-row{display:table-row !important}.d-lg-table-cell{display:table-cell !important}.d-lg-flex{display:flex !important}.d-lg-inline-flex{display:inline-flex !important}}@media (min-width: 1200px){.d-xl-none{display:none !important}.d-xl-inline{display:inline !important}.d-xl-inline-block{display:inline-block !important}.d-xl-block{display:block !important}.d-xl-table{display:table !important}.d-xl-table-row{display:table-row !important}.d-xl-table-cell{display:table-cell !important}.d-xl-flex{display:flex !important}.d-xl-inline-flex{display:inline-flex !important}}@media print{.d-print-none{display:none !important}.d-print-inline{display:inline !important}.d-print-inline-block{display:inline-block !important}.d-print-block{display:block !important}.d-print-table{display:table !important}.d-print-table-row{display:table-row !important}.d-print-table-cell{display:table-cell !important}.d-print-flex{display:flex !important}.d-print-inline-flex{display:inline-flex !important}}.embed-responsive{position:relative;display:block;width:100%;padding:0;overflow:hidden}.embed-responsive::before{display:block;content:""}.embed-responsive .embed-responsive-item,.embed-responsive iframe,.embed-responsive embed,.embed-responsive object,.embed-responsive video{position:absolute;top:0;bottom:0;left:0;width:100%;height:100%;border:0}.embed-responsive-21by9::before{padding-top:42.85714%}.embed-responsive-16by9::before{padding-top:56.25%}.embed-responsive-4by3::before{padding-top:75%}.embed-responsive-1by1::before{padding-top:100%}.flex-row{flex-direction:row !important}.flex-column{flex-direction:column !important}.flex-row-reverse{flex-direction:row-reverse !important}.flex-column-reverse{flex-direction:column-reverse !important}.flex-wrap{flex-wrap:wrap !important}.flex-nowrap{flex-wrap:nowrap !important}.flex-wrap-reverse{flex-wrap:wrap-reverse !important}.flex-fill{flex:1 1 auto !important}.flex-grow-0{flex-grow:0 !important}.flex-grow-1{flex-grow:1 !important}.flex-shrink-0{flex-shrink:0 !important}.flex-shrink-1{flex-shrink:1 !important}.justify-content-start{justify-content:flex-start !important}.justify-content-end{justify-content:flex-end !important}.justify-content-center{justify-content:center !important}.justify-content-between{justify-content:space-between !important}.justify-content-around{justify-content:space-around !important}.align-items-start{align-items:flex-start !important}.align-items-end{align-items:flex-end !important}.align-items-center{align-items:center !important}.align-items-baseline{align-items:baseline !important}.align-items-stretch{align-items:stretch !important}.align-content-start{align-content:flex-start !important}.align-content-end{align-content:flex-end !important}.align-content-center{align-content:center !important}.align-content-between{align-content:space-between !important}.align-content-around{align-content:space-around !important}.align-content-stretch{align-content:stretch !important}.align-self-auto{align-self:auto !important}.align-self-start{align-self:flex-start !important}.align-self-end{align-self:flex-end !important}.align-self-center{align-self:center !important}.align-self-baseline{align-self:baseline !important}.align-self-stretch{align-self:stretch !important}@media (min-width: 576px){.flex-sm-row{flex-direction:row !important}.flex-sm-column{flex-direction:column !important}.flex-sm-row-reverse{flex-direction:row-reverse !important}.flex-sm-column-reverse{flex-direction:column-reverse !important}.flex-sm-wrap{flex-wrap:wrap !important}.flex-sm-nowrap{flex-wrap:nowrap !important}.flex-sm-wrap-reverse{flex-wrap:wrap-reverse !important}.flex-sm-fill{flex:1 1 auto !important}.flex-sm-grow-0{flex-grow:0 !important}.flex-sm-grow-1{flex-grow:1 !important}.flex-sm-shrink-0{flex-shrink:0 !important}.flex-sm-shrink-1{flex-shrink:1 !important}.justify-content-sm-start{justify-content:flex-start !important}.justify-content-sm-end{justify-content:flex-end !important}.justify-content-sm-center{justify-content:center !important}.justify-content-sm-between{justify-content:space-between !important}.justify-content-sm-around{justify-content:space-around !important}.align-items-sm-start{align-items:flex-start !important}.align-items-sm-end{align-items:flex-end !important}.align-items-sm-center{align-items:center !important}.align-items-sm-baseline{align-items:baseline !important}.align-items-sm-stretch{align-items:stretch !important}.align-content-sm-start{align-content:flex-start !important}.align-content-sm-end{align-content:flex-end !important}.align-content-sm-center{align-content:center !important}.align-content-sm-between{align-content:space-between !important}.align-content-sm-around{align-content:space-around !important}.align-content-sm-stretch{align-content:stretch !important}.align-self-sm-auto{align-self:auto !important}.align-self-sm-start{align-self:flex-start !important}.align-self-sm-end{align-self:flex-end !important}.align-self-sm-center{align-self:center !important}.align-self-sm-baseline{align-self:baseline !important}.align-self-sm-stretch{align-self:stretch !important}}@media (min-width: 768px){.flex-md-row{flex-direction:row !important}.flex-md-column{flex-direction:column !important}.flex-md-row-reverse{flex-direction:row-reverse !important}.flex-md-column-reverse{flex-direction:column-reverse !important}.flex-md-wrap{flex-wrap:wrap !important}.flex-md-nowrap{flex-wrap:nowrap !important}.flex-md-wrap-reverse{flex-wrap:wrap-reverse !important}.flex-md-fill{flex:1 1 auto !important}.flex-md-grow-0{flex-grow:0 !important}.flex-md-grow-1{flex-grow:1 !important}.flex-md-shrink-0{flex-shrink:0 !important}.flex-md-shrink-1{flex-shrink:1 !important}.justify-content-md-start{justify-content:flex-start !important}.justify-content-md-end{justify-content:flex-end !important}.justify-content-md-center{justify-content:center !important}.justify-content-md-between{justify-content:space-between !important}.justify-content-md-around{justify-content:space-around !important}.align-items-md-start{align-items:flex-start !important}.align-items-md-end{align-items:flex-end !important}.align-items-md-center{align-items:center !important}.align-items-md-baseline{align-items:baseline !important}.align-items-md-stretch{align-items:stretch !important}.align-content-md-start{align-content:flex-start !important}.align-content-md-end{align-content:flex-end !important}.align-content-md-center{align-content:center !important}.align-content-md-between{align-content:space-between !important}.align-content-md-around{align-content:space-around !important}.align-content-md-stretch{align-content:stretch !important}.align-self-md-auto{align-self:auto !important}.align-self-md-start{align-self:flex-start !important}.align-self-md-end{align-self:flex-end !important}.align-self-md-center{align-self:center !important}.align-self-md-baseline{align-self:baseline !important}.align-self-md-stretch{align-self:stretch !important}}@media (min-width: 992px){.flex-lg-row{flex-direction:row !important}.flex-lg-column{flex-direction:column !important}.flex-lg-row-reverse{flex-direction:row-reverse !important}.flex-lg-column-reverse{flex-direction:column-reverse !important}.flex-lg-wrap{flex-wrap:wrap !important}.flex-lg-nowrap{flex-wrap:nowrap !important}.flex-lg-wrap-reverse{flex-wrap:wrap-reverse !important}.flex-lg-fill{flex:1 1 auto !important}.flex-lg-grow-0{flex-grow:0 !important}.flex-lg-grow-1{flex-grow:1 !important}.flex-lg-shrink-0{flex-shrink:0 !important}.flex-lg-shrink-1{flex-shrink:1 !important}.justify-content-lg-start{justify-content:flex-start !important}.justify-content-lg-end{justify-content:flex-end !important}.justify-content-lg-center{justify-content:center !important}.justify-content-lg-between{justify-content:space-between !important}.justify-content-lg-around{justify-content:space-around !important}.align-items-lg-start{align-items:flex-start !important}.align-items-lg-end{align-items:flex-end !important}.align-items-lg-center{align-items:center !important}.align-items-lg-baseline{align-items:baseline !important}.align-items-lg-stretch{align-items:stretch !important}.align-content-lg-start{align-content:flex-start !important}.align-content-lg-end{align-content:flex-end !important}.align-content-lg-center{align-content:center !important}.align-content-lg-between{align-content:space-between !important}.align-content-lg-around{align-content:space-around !important}.align-content-lg-stretch{align-content:stretch !important}.align-self-lg-auto{align-self:auto !important}.align-self-lg-start{align-self:flex-start !important}.align-self-lg-end{align-self:flex-end !important}.align-self-lg-center{align-self:center !important}.align-self-lg-baseline{align-self:baseline !important}.align-self-lg-stretch{align-self:stretch !important}}@media (min-width: 1200px){.flex-xl-row{flex-direction:row !important}.flex-xl-column{flex-direction:column !important}.flex-xl-row-reverse{flex-direction:row-reverse !important}.flex-xl-column-reverse{flex-direction:column-reverse !important}.flex-xl-wrap{flex-wrap:wrap !important}.flex-xl-nowrap{flex-wrap:nowrap !important}.flex-xl-wrap-reverse{flex-wrap:wrap-reverse !important}.flex-xl-fill{flex:1 1 auto !important}.flex-xl-grow-0{flex-grow:0 !important}.flex-xl-grow-1{flex-grow:1 !important}.flex-xl-shrink-0{flex-shrink:0 !important}.flex-xl-shrink-1{flex-shrink:1 !important}.justify-content-xl-start{justify-content:flex-start !important}.justify-content-xl-end{justify-content:flex-end !important}.justify-content-xl-center{justify-content:center !important}.justify-content-xl-between{justify-content:space-between !important}.justify-content-xl-around{justify-content:space-around !important}.align-items-xl-start{align-items:flex-start !important}.align-items-xl-end{align-items:flex-end !important}.align-items-xl-center{align-items:center !important}.align-items-xl-baseline{align-items:baseline !important}.align-items-xl-stretch{align-items:stretch !important}.align-content-xl-start{align-content:flex-start !important}.align-content-xl-end{align-content:flex-end !important}.align-content-xl-center{align-content:center !important}.align-content-xl-between{align-content:space-between !important}.align-content-xl-around{align-content:space-around !important}.align-content-xl-stretch{align-content:stretch !important}.align-self-xl-auto{align-self:auto !important}.align-self-xl-start{align-self:flex-start !important}.align-self-xl-end{align-self:flex-end !important}.align-self-xl-center{align-self:center !important}.align-self-xl-baseline{align-self:baseline !important}.align-self-xl-stretch{align-self:stretch !important}}.float-left{float:left !important}.float-right{float:right !important}.float-none{float:none !important}@media (min-width: 576px){.float-sm-left{float:left !important}.float-sm-right{float:right !important}.float-sm-none{float:none !important}}@media (min-width: 768px){.float-md-left{float:left !important}.float-md-right{float:right !important}.float-md-none{float:none !important}}@media (min-width: 992px){.float-lg-left{float:left !important}.float-lg-right{float:right !important}.float-lg-none{float:none !important}}@media (min-width: 1200px){.float-xl-left{float:left !important}.float-xl-right{float:right !important}.float-xl-none{float:none !important}}.overflow-auto{overflow:auto !important}.overflow-hidden{overflow:hidden !important}.position-static{position:static !important}.position-relative{position:relative !important}.position-absolute{position:absolute !important}.position-fixed{position:fixed !important}.position-sticky{position:sticky !important}.fixed-top{position:fixed;top:0;right:0;left:0;z-index:1030}.fixed-bottom{position:fixed;right:0;bottom:0;left:0;z-index:1030}@supports (position: sticky){.sticky-top{position:sticky;top:0;z-index:1020}}.sr-only{position:absolute;width:1px;height:1px;padding:0;overflow:hidden;clip:rect(0, 0, 0, 0);white-space:nowrap;border:0}.sr-only-focusable:active,.sr-only-focusable:focus{position:static;width:auto;height:auto;overflow:visible;clip:auto;white-space:normal}.shadow-sm{box-shadow:0 0.125rem 0.25rem rgba(0,0,0,0.075) !important}.shadow{box-shadow:0 0.5rem 1rem rgba(0,0,0,0.15) !important}.shadow-lg{box-shadow:0 1rem 3rem rgba(0,0,0,0.175) !important}.shadow-none{box-shadow:none !important}.w-25{width:25% !important}.w-50{width:50% !important}.w-75{width:75% !important}.w-100{width:100% !important}.w-auto{width:auto !important}.h-25{height:25% !important}.h-50{height:50% !important}.h-75{height:75% !important}.h-100{height:100% !important}.h-auto{height:auto !important}.mw-100{max-width:100% !important}.mh-100{max-height:100% !important}.min-vw-100{min-width:100vw !important}.min-vh-100{min-height:100vh !important}.vw-100{width:100vw !important}.vh-100{height:100vh !important}.stretched-link::after{position:absolute;top:0;right:0;bottom:0;left:0;z-index:1;pointer-events:auto;content:"";background-color:rgba(0,0,0,0)}.m-0{margin:0 !important}.mt-0,.my-0{margin-top:0 !important}.mr-0,.mx-0{margin-right:0 !important}.mb-0,.my-0{margin-bottom:0 !important}.ml-0,.mx-0{margin-left:0 !important}.m-1{margin:.25rem !important}.mt-1,.my-1{margin-top:.25rem !important}.mr-1,.mx-1{margin-right:.25rem !important}.mb-1,.my-1{margin-bottom:.25rem !important}.ml-1,.mx-1{margin-left:.25rem !important}.m-2{margin:.5rem !important}.mt-2,.my-2{margin-top:.5rem !important}.mr-2,.mx-2{margin-right:.5rem !important}.mb-2,.my-2{margin-bottom:.5rem !important}.ml-2,.mx-2{margin-left:.5rem !important}.m-3{margin:1rem !important}.mt-3,.my-3{margin-top:1rem !important}.mr-3,.mx-3{margin-right:1rem !important}.mb-3,.my-3{margin-bottom:1rem !important}.ml-3,.mx-3{margin-left:1rem !important}.m-4{margin:1.5rem !important}.mt-4,.my-4{margin-top:1.5rem !important}.mr-4,.mx-4{margin-right:1.5rem !important}.mb-4,.my-4{margin-bottom:1.5rem !important}.ml-4,.mx-4{margin-left:1.5rem !important}.m-5{margin:3rem !important}.mt-5,.my-5{margin-top:3rem !important}.mr-5,.mx-5{margin-right:3rem !important}.mb-5,.my-5{margin-bottom:3rem !important}.ml-5,.mx-5{margin-left:3rem !important}.p-0{padding:0 !important}.pt-0,.py-0{padding-top:0 !important}.pr-0,.px-0{padding-right:0 !important}.pb-0,.py-0{padding-bottom:0 !important}.pl-0,.px-0{padding-left:0 !important}.p-1{padding:.25rem !important}.pt-1,.py-1{padding-top:.25rem !important}.pr-1,.px-1{padding-right:.25rem !important}.pb-1,.py-1{padding-bottom:.25rem !important}.pl-1,.px-1{padding-left:.25rem !important}.p-2{padding:.5rem !important}.pt-2,.py-2{padding-top:.5rem !important}.pr-2,.px-2{padding-right:.5rem !important}.pb-2,.py-2{padding-bottom:.5rem !important}.pl-2,.px-2{padding-left:.5rem !important}.p-3{padding:1rem !important}.pt-3,.py-3{padding-top:1rem !important}.pr-3,.px-3{padding-right:1rem !important}.pb-3,.py-3{padding-bottom:1rem !important}.pl-3,.px-3{padding-left:1rem !important}.p-4{padding:1.5rem !important}.pt-4,.py-4{padding-top:1.5rem !important}.pr-4,.px-4{padding-right:1.5rem !important}.pb-4,.py-4{padding-bottom:1.5rem !important}.pl-4,.px-4{padding-left:1.5rem !important}.p-5{padding:3rem !important}.pt-5,.py-5{padding-top:3rem !important}.pr-5,.px-5{padding-right:3rem !important}.pb-5,.py-5{padding-bottom:3rem !important}.pl-5,.px-5{padding-left:3rem !important}.m-n1{margin:-.25rem !important}.mt-n1,.my-n1{margin-top:-.25rem !important}.mr-n1,.mx-n1{margin-right:-.25rem !important}.mb-n1,.my-n1{margin-bottom:-.25rem !important}.ml-n1,.mx-n1{margin-left:-.25rem !important}.m-n2{margin:-.5rem !important}.mt-n2,.my-n2{margin-top:-.5rem !important}.mr-n2,.mx-n2{margin-right:-.5rem !important}.mb-n2,.my-n2{margin-bottom:-.5rem !important}.ml-n2,.mx-n2{margin-left:-.5rem !important}.m-n3{margin:-1rem !important}.mt-n3,.my-n3{margin-top:-1rem !important}.mr-n3,.mx-n3{margin-right:-1rem !important}.mb-n3,.my-n3{margin-bottom:-1rem !important}.ml-n3,.mx-n3{margin-left:-1rem !important}.m-n4{margin:-1.5rem !important}.mt-n4,.my-n4{margin-top:-1.5rem !important}.mr-n4,.mx-n4{margin-right:-1.5rem !important}.mb-n4,.my-n4{margin-bottom:-1.5rem !important}.ml-n4,.mx-n4{margin-left:-1.5rem !important}.m-n5{margin:-3rem !important}.mt-n5,.my-n5{margin-top:-3rem !important}.mr-n5,.mx-n5{margin-right:-3rem !important}.mb-n5,.my-n5{margin-bottom:-3rem !important}.ml-n5,.mx-n5{margin-left:-3rem !important}.m-auto{margin:auto !important}.mt-auto,.my-auto{margin-top:auto !important}.mr-auto,.mx-auto{margin-right:auto !important}.mb-auto,.my-auto{margin-bottom:auto !important}.ml-auto,.mx-auto{margin-left:auto !important}@media (min-width: 576px){.m-sm-0{margin:0 !important}.mt-sm-0,.my-sm-0{margin-top:0 !important}.mr-sm-0,.mx-sm-0{margin-right:0 !important}.mb-sm-0,.my-sm-0{margin-bottom:0 !important}.ml-sm-0,.mx-sm-0{margin-left:0 !important}.m-sm-1{margin:.25rem !important}.mt-sm-1,.my-sm-1{margin-top:.25rem !important}.mr-sm-1,.mx-sm-1{margin-right:.25rem !important}.mb-sm-1,.my-sm-1{margin-bottom:.25rem !important}.ml-sm-1,.mx-sm-1{margin-left:.25rem !important}.m-sm-2{margin:.5rem !important}.mt-sm-2,.my-sm-2{margin-top:.5rem !important}.mr-sm-2,.mx-sm-2{margin-right:.5rem !important}.mb-sm-2,.my-sm-2{margin-bottom:.5rem !important}.ml-sm-2,.mx-sm-2{margin-left:.5rem !important}.m-sm-3{margin:1rem !important}.mt-sm-3,.my-sm-3{margin-top:1rem !important}.mr-sm-3,.mx-sm-3{margin-right:1rem !important}.mb-sm-3,.my-sm-3{margin-bottom:1rem !important}.ml-sm-3,.mx-sm-3{margin-left:1rem !important}.m-sm-4{margin:1.5rem !important}.mt-sm-4,.my-sm-4{margin-top:1.5rem !important}.mr-sm-4,.mx-sm-4{margin-right:1.5rem !important}.mb-sm-4,.my-sm-4{margin-bottom:1.5rem !important}.ml-sm-4,.mx-sm-4{margin-left:1.5rem !important}.m-sm-5{margin:3rem !important}.mt-sm-5,.my-sm-5{margin-top:3rem !important}.mr-sm-5,.mx-sm-5{margin-right:3rem !important}.mb-sm-5,.my-sm-5{margin-bottom:3rem !important}.ml-sm-5,.mx-sm-5{margin-left:3rem !important}.p-sm-0{padding:0 !important}.pt-sm-0,.py-sm-0{padding-top:0 !important}.pr-sm-0,.px-sm-0{padding-right:0 !important}.pb-sm-0,.py-sm-0{padding-bottom:0 !important}.pl-sm-0,.px-sm-0{padding-left:0 !important}.p-sm-1{padding:.25rem !important}.pt-sm-1,.py-sm-1{padding-top:.25rem !important}.pr-sm-1,.px-sm-1{padding-right:.25rem !important}.pb-sm-1,.py-sm-1{padding-bottom:.25rem !important}.pl-sm-1,.px-sm-1{padding-left:.25rem !important}.p-sm-2{padding:.5rem !important}.pt-sm-2,.py-sm-2{padding-top:.5rem !important}.pr-sm-2,.px-sm-2{padding-right:.5rem !important}.pb-sm-2,.py-sm-2{padding-bottom:.5rem !important}.pl-sm-2,.px-sm-2{padding-left:.5rem !important}.p-sm-3{padding:1rem !important}.pt-sm-3,.py-sm-3{padding-top:1rem !important}.pr-sm-3,.px-sm-3{padding-right:1rem !important}.pb-sm-3,.py-sm-3{padding-bottom:1rem !important}.pl-sm-3,.px-sm-3{padding-left:1rem !important}.p-sm-4{padding:1.5rem !important}.pt-sm-4,.py-sm-4{padding-top:1.5rem !important}.pr-sm-4,.px-sm-4{padding-right:1.5rem !important}.pb-sm-4,.py-sm-4{padding-bottom:1.5rem !important}.pl-sm-4,.px-sm-4{padding-left:1.5rem !important}.p-sm-5{padding:3rem !important}.pt-sm-5,.py-sm-5{padding-top:3rem !important}.pr-sm-5,.px-sm-5{padding-right:3rem !important}.pb-sm-5,.py-sm-5{padding-bottom:3rem !important}.pl-sm-5,.px-sm-5{padding-left:3rem !important}.m-sm-n1{margin:-.25rem !important}.mt-sm-n1,.my-sm-n1{margin-top:-.25rem !important}.mr-sm-n1,.mx-sm-n1{margin-right:-.25rem !important}.mb-sm-n1,.my-sm-n1{margin-bottom:-.25rem !important}.ml-sm-n1,.mx-sm-n1{margin-left:-.25rem !important}.m-sm-n2{margin:-.5rem !important}.mt-sm-n2,.my-sm-n2{margin-top:-.5rem !important}.mr-sm-n2,.mx-sm-n2{margin-right:-.5rem !important}.mb-sm-n2,.my-sm-n2{margin-bottom:-.5rem !important}.ml-sm-n2,.mx-sm-n2{margin-left:-.5rem !important}.m-sm-n3{margin:-1rem !important}.mt-sm-n3,.my-sm-n3{margin-top:-1rem !important}.mr-sm-n3,.mx-sm-n3{margin-right:-1rem !important}.mb-sm-n3,.my-sm-n3{margin-bottom:-1rem !important}.ml-sm-n3,.mx-sm-n3{margin-left:-1rem !important}.m-sm-n4{margin:-1.5rem !important}.mt-sm-n4,.my-sm-n4{margin-top:-1.5rem !important}.mr-sm-n4,.mx-sm-n4{margin-right:-1.5rem !important}.mb-sm-n4,.my-sm-n4{margin-bottom:-1.5rem !important}.ml-sm-n4,.mx-sm-n4{margin-left:-1.5rem !important}.m-sm-n5{margin:-3rem !important}.mt-sm-n5,.my-sm-n5{margin-top:-3rem !important}.mr-sm-n5,.mx-sm-n5{margin-right:-3rem !important}.mb-sm-n5,.my-sm-n5{margin-bottom:-3rem !important}.ml-sm-n5,.mx-sm-n5{margin-left:-3rem !important}.m-sm-auto{margin:auto !important}.mt-sm-auto,.my-sm-auto{margin-top:auto !important}.mr-sm-auto,.mx-sm-auto{margin-right:auto !important}.mb-sm-auto,.my-sm-auto{margin-bottom:auto !important}.ml-sm-auto,.mx-sm-auto{margin-left:auto !important}}@media (min-width: 768px){.m-md-0{margin:0 !important}.mt-md-0,.my-md-0{margin-top:0 !important}.mr-md-0,.mx-md-0{margin-right:0 !important}.mb-md-0,.my-md-0{margin-bottom:0 !important}.ml-md-0,.mx-md-0{margin-left:0 !important}.m-md-1{margin:.25rem !important}.mt-md-1,.my-md-1{margin-top:.25rem !important}.mr-md-1,.mx-md-1{margin-right:.25rem !important}.mb-md-1,.my-md-1{margin-bottom:.25rem !important}.ml-md-1,.mx-md-1{margin-left:.25rem !important}.m-md-2{margin:.5rem !important}.mt-md-2,.my-md-2{margin-top:.5rem !important}.mr-md-2,.mx-md-2{margin-right:.5rem !important}.mb-md-2,.my-md-2{margin-bottom:.5rem !important}.ml-md-2,.mx-md-2{margin-left:.5rem !important}.m-md-3{margin:1rem !important}.mt-md-3,.my-md-3{margin-top:1rem !important}.mr-md-3,.mx-md-3{margin-right:1rem !important}.mb-md-3,.my-md-3{margin-bottom:1rem !important}.ml-md-3,.mx-md-3{margin-left:1rem !important}.m-md-4{margin:1.5rem !important}.mt-md-4,.my-md-4{margin-top:1.5rem !important}.mr-md-4,.mx-md-4{margin-right:1.5rem !important}.mb-md-4,.my-md-4{margin-bottom:1.5rem !important}.ml-md-4,.mx-md-4{margin-left:1.5rem !important}.m-md-5{margin:3rem !important}.mt-md-5,.my-md-5{margin-top:3rem !important}.mr-md-5,.mx-md-5{margin-right:3rem !important}.mb-md-5,.my-md-5{margin-bottom:3rem !important}.ml-md-5,.mx-md-5{margin-left:3rem !important}.p-md-0{padding:0 !important}.pt-md-0,.py-md-0{padding-top:0 !important}.pr-md-0,.px-md-0{padding-right:0 !important}.pb-md-0,.py-md-0{padding-bottom:0 !important}.pl-md-0,.px-md-0{padding-left:0 !important}.p-md-1{padding:.25rem !important}.pt-md-1,.py-md-1{padding-top:.25rem !important}.pr-md-1,.px-md-1{padding-right:.25rem !important}.pb-md-1,.py-md-1{padding-bottom:.25rem !important}.pl-md-1,.px-md-1{padding-left:.25rem !important}.p-md-2{padding:.5rem !important}.pt-md-2,.py-md-2{padding-top:.5rem !important}.pr-md-2,.px-md-2{padding-right:.5rem !important}.pb-md-2,.py-md-2{padding-bottom:.5rem !important}.pl-md-2,.px-md-2{padding-left:.5rem !important}.p-md-3{padding:1rem !important}.pt-md-3,.py-md-3{padding-top:1rem !important}.pr-md-3,.px-md-3{padding-right:1rem !important}.pb-md-3,.py-md-3{padding-bottom:1rem !important}.pl-md-3,.px-md-3{padding-left:1rem !important}.p-md-4{padding:1.5rem !important}.pt-md-4,.py-md-4{padding-top:1.5rem !important}.pr-md-4,.px-md-4{padding-right:1.5rem !important}.pb-md-4,.py-md-4{padding-bottom:1.5rem !important}.pl-md-4,.px-md-4{padding-left:1.5rem !important}.p-md-5{padding:3rem !important}.pt-md-5,.py-md-5{padding-top:3rem !important}.pr-md-5,.px-md-5{padding-right:3rem !important}.pb-md-5,.py-md-5{padding-bottom:3rem !important}.pl-md-5,.px-md-5{padding-left:3rem !important}.m-md-n1{margin:-.25rem !important}.mt-md-n1,.my-md-n1{margin-top:-.25rem !important}.mr-md-n1,.mx-md-n1{margin-right:-.25rem !important}.mb-md-n1,.my-md-n1{margin-bottom:-.25rem !important}.ml-md-n1,.mx-md-n1{margin-left:-.25rem !important}.m-md-n2{margin:-.5rem !important}.mt-md-n2,.my-md-n2{margin-top:-.5rem !important}.mr-md-n2,.mx-md-n2{margin-right:-.5rem !important}.mb-md-n2,.my-md-n2{margin-bottom:-.5rem !important}.ml-md-n2,.mx-md-n2{margin-left:-.5rem !important}.m-md-n3{margin:-1rem !important}.mt-md-n3,.my-md-n3{margin-top:-1rem !important}.mr-md-n3,.mx-md-n3{margin-right:-1rem !important}.mb-md-n3,.my-md-n3{margin-bottom:-1rem !important}.ml-md-n3,.mx-md-n3{margin-left:-1rem !important}.m-md-n4{margin:-1.5rem !important}.mt-md-n4,.my-md-n4{margin-top:-1.5rem !important}.mr-md-n4,.mx-md-n4{margin-right:-1.5rem !important}.mb-md-n4,.my-md-n4{margin-bottom:-1.5rem !important}.ml-md-n4,.mx-md-n4{margin-left:-1.5rem !important}.m-md-n5{margin:-3rem !important}.mt-md-n5,.my-md-n5{margin-top:-3rem !important}.mr-md-n5,.mx-md-n5{margin-right:-3rem !important}.mb-md-n5,.my-md-n5{margin-bottom:-3rem !important}.ml-md-n5,.mx-md-n5{margin-left:-3rem !important}.m-md-auto{margin:auto !important}.mt-md-auto,.my-md-auto{margin-top:auto !important}.mr-md-auto,.mx-md-auto{margin-right:auto !important}.mb-md-auto,.my-md-auto{margin-bottom:auto !important}.ml-md-auto,.mx-md-auto{margin-left:auto !important}}@media (min-width: 992px){.m-lg-0{margin:0 !important}.mt-lg-0,.my-lg-0{margin-top:0 !important}.mr-lg-0,.mx-lg-0{margin-right:0 !important}.mb-lg-0,.my-lg-0{margin-bottom:0 !important}.ml-lg-0,.mx-lg-0{margin-left:0 !important}.m-lg-1{margin:.25rem !important}.mt-lg-1,.my-lg-1{margin-top:.25rem !important}.mr-lg-1,.mx-lg-1{margin-right:.25rem !important}.mb-lg-1,.my-lg-1{margin-bottom:.25rem !important}.ml-lg-1,.mx-lg-1{margin-left:.25rem !important}.m-lg-2{margin:.5rem !important}.mt-lg-2,.my-lg-2{margin-top:.5rem !important}.mr-lg-2,.mx-lg-2{margin-right:.5rem !important}.mb-lg-2,.my-lg-2{margin-bottom:.5rem !important}.ml-lg-2,.mx-lg-2{margin-left:.5rem !important}.m-lg-3{margin:1rem !important}.mt-lg-3,.my-lg-3{margin-top:1rem !important}.mr-lg-3,.mx-lg-3{margin-right:1rem !important}.mb-lg-3,.my-lg-3{margin-bottom:1rem !important}.ml-lg-3,.mx-lg-3{margin-left:1rem !important}.m-lg-4{margin:1.5rem !important}.mt-lg-4,.my-lg-4{margin-top:1.5rem !important}.mr-lg-4,.mx-lg-4{margin-right:1.5rem !important}.mb-lg-4,.my-lg-4{margin-bottom:1.5rem !important}.ml-lg-4,.mx-lg-4{margin-left:1.5rem !important}.m-lg-5{margin:3rem !important}.mt-lg-5,.my-lg-5{margin-top:3rem !important}.mr-lg-5,.mx-lg-5{margin-right:3rem !important}.mb-lg-5,.my-lg-5{margin-bottom:3rem !important}.ml-lg-5,.mx-lg-5{margin-left:3rem !important}.p-lg-0{padding:0 !important}.pt-lg-0,.py-lg-0{padding-top:0 !important}.pr-lg-0,.px-lg-0{padding-right:0 !important}.pb-lg-0,.py-lg-0{padding-bottom:0 !important}.pl-lg-0,.px-lg-0{padding-left:0 !important}.p-lg-1{padding:.25rem !important}.pt-lg-1,.py-lg-1{padding-top:.25rem !important}.pr-lg-1,.px-lg-1{padding-right:.25rem !important}.pb-lg-1,.py-lg-1{padding-bottom:.25rem !important}.pl-lg-1,.px-lg-1{padding-left:.25rem !important}.p-lg-2{padding:.5rem !important}.pt-lg-2,.py-lg-2{padding-top:.5rem !important}.pr-lg-2,.px-lg-2{padding-right:.5rem !important}.pb-lg-2,.py-lg-2{padding-bottom:.5rem !important}.pl-lg-2,.px-lg-2{padding-left:.5rem !important}.p-lg-3{padding:1rem !important}.pt-lg-3,.py-lg-3{padding-top:1rem !important}.pr-lg-3,.px-lg-3{padding-right:1rem !important}.pb-lg-3,.py-lg-3{padding-bottom:1rem !important}.pl-lg-3,.px-lg-3{padding-left:1rem !important}.p-lg-4{padding:1.5rem !important}.pt-lg-4,.py-lg-4{padding-top:1.5rem !important}.pr-lg-4,.px-lg-4{padding-right:1.5rem !important}.pb-lg-4,.py-lg-4{padding-bottom:1.5rem !important}.pl-lg-4,.px-lg-4{padding-left:1.5rem !important}.p-lg-5{padding:3rem !important}.pt-lg-5,.py-lg-5{padding-top:3rem !important}.pr-lg-5,.px-lg-5{padding-right:3rem !important}.pb-lg-5,.py-lg-5{padding-bottom:3rem !important}.pl-lg-5,.px-lg-5{padding-left:3rem !important}.m-lg-n1{margin:-.25rem !important}.mt-lg-n1,.my-lg-n1{margin-top:-.25rem !important}.mr-lg-n1,.mx-lg-n1{margin-right:-.25rem !important}.mb-lg-n1,.my-lg-n1{margin-bottom:-.25rem !important}.ml-lg-n1,.mx-lg-n1{margin-left:-.25rem !important}.m-lg-n2{margin:-.5rem !important}.mt-lg-n2,.my-lg-n2{margin-top:-.5rem !important}.mr-lg-n2,.mx-lg-n2{margin-right:-.5rem !important}.mb-lg-n2,.my-lg-n2{margin-bottom:-.5rem !important}.ml-lg-n2,.mx-lg-n2{margin-left:-.5rem !important}.m-lg-n3{margin:-1rem !important}.mt-lg-n3,.my-lg-n3{margin-top:-1rem !important}.mr-lg-n3,.mx-lg-n3{margin-right:-1rem !important}.mb-lg-n3,.my-lg-n3{margin-bottom:-1rem !important}.ml-lg-n3,.mx-lg-n3{margin-left:-1rem !important}.m-lg-n4{margin:-1.5rem !important}.mt-lg-n4,.my-lg-n4{margin-top:-1.5rem !important}.mr-lg-n4,.mx-lg-n4{margin-right:-1.5rem !important}.mb-lg-n4,.my-lg-n4{margin-bottom:-1.5rem !important}.ml-lg-n4,.mx-lg-n4{margin-left:-1.5rem !important}.m-lg-n5{margin:-3rem !important}.mt-lg-n5,.my-lg-n5{margin-top:-3rem !important}.mr-lg-n5,.mx-lg-n5{margin-right:-3rem !important}.mb-lg-n5,.my-lg-n5{margin-bottom:-3rem !important}.ml-lg-n5,.mx-lg-n5{margin-left:-3rem !important}.m-lg-auto{margin:auto !important}.mt-lg-auto,.my-lg-auto{margin-top:auto !important}.mr-lg-auto,.mx-lg-auto{margin-right:auto !important}.mb-lg-auto,.my-lg-auto{margin-bottom:auto !important}.ml-lg-auto,.mx-lg-auto{margin-left:auto !important}}@media (min-width: 1200px){.m-xl-0{margin:0 !important}.mt-xl-0,.my-xl-0{margin-top:0 !important}.mr-xl-0,.mx-xl-0{margin-right:0 !important}.mb-xl-0,.my-xl-0{margin-bottom:0 !important}.ml-xl-0,.mx-xl-0{margin-left:0 !important}.m-xl-1{margin:.25rem !important}.mt-xl-1,.my-xl-1{margin-top:.25rem !important}.mr-xl-1,.mx-xl-1{margin-right:.25rem !important}.mb-xl-1,.my-xl-1{margin-bottom:.25rem !important}.ml-xl-1,.mx-xl-1{margin-left:.25rem !important}.m-xl-2{margin:.5rem !important}.mt-xl-2,.my-xl-2{margin-top:.5rem !important}.mr-xl-2,.mx-xl-2{margin-right:.5rem !important}.mb-xl-2,.my-xl-2{margin-bottom:.5rem !important}.ml-xl-2,.mx-xl-2{margin-left:.5rem !important}.m-xl-3{margin:1rem !important}.mt-xl-3,.my-xl-3{margin-top:1rem !important}.mr-xl-3,.mx-xl-3{margin-right:1rem !important}.mb-xl-3,.my-xl-3{margin-bottom:1rem !important}.ml-xl-3,.mx-xl-3{margin-left:1rem !important}.m-xl-4{margin:1.5rem !important}.mt-xl-4,.my-xl-4{margin-top:1.5rem !important}.mr-xl-4,.mx-xl-4{margin-right:1.5rem !important}.mb-xl-4,.my-xl-4{margin-bottom:1.5rem !important}.ml-xl-4,.mx-xl-4{margin-left:1.5rem !important}.m-xl-5{margin:3rem !important}.mt-xl-5,.my-xl-5{margin-top:3rem !important}.mr-xl-5,.mx-xl-5{margin-right:3rem !important}.mb-xl-5,.my-xl-5{margin-bottom:3rem !important}.ml-xl-5,.mx-xl-5{margin-left:3rem !important}.p-xl-0{padding:0 !important}.pt-xl-0,.py-xl-0{padding-top:0 !important}.pr-xl-0,.px-xl-0{padding-right:0 !important}.pb-xl-0,.py-xl-0{padding-bottom:0 !important}.pl-xl-0,.px-xl-0{padding-left:0 !important}.p-xl-1{padding:.25rem !important}.pt-xl-1,.py-xl-1{padding-top:.25rem !important}.pr-xl-1,.px-xl-1{padding-right:.25rem !important}.pb-xl-1,.py-xl-1{padding-bottom:.25rem !important}.pl-xl-1,.px-xl-1{padding-left:.25rem !important}.p-xl-2{padding:.5rem !important}.pt-xl-2,.py-xl-2{padding-top:.5rem !important}.pr-xl-2,.px-xl-2{padding-right:.5rem !important}.pb-xl-2,.py-xl-2{padding-bottom:.5rem !important}.pl-xl-2,.px-xl-2{padding-left:.5rem !important}.p-xl-3{padding:1rem !important}.pt-xl-3,.py-xl-3{padding-top:1rem !important}.pr-xl-3,.px-xl-3{padding-right:1rem !important}.pb-xl-3,.py-xl-3{padding-bottom:1rem !important}.pl-xl-3,.px-xl-3{padding-left:1rem !important}.p-xl-4{padding:1.5rem !important}.pt-xl-4,.py-xl-4{padding-top:1.5rem !important}.pr-xl-4,.px-xl-4{padding-right:1.5rem !important}.pb-xl-4,.py-xl-4{padding-bottom:1.5rem !important}.pl-xl-4,.px-xl-4{padding-left:1.5rem !important}.p-xl-5{padding:3rem !important}.pt-xl-5,.py-xl-5{padding-top:3rem !important}.pr-xl-5,.px-xl-5{padding-right:3rem !important}.pb-xl-5,.py-xl-5{padding-bottom:3rem !important}.pl-xl-5,.px-xl-5{padding-left:3rem !important}.m-xl-n1{margin:-.25rem !important}.mt-xl-n1,.my-xl-n1{margin-top:-.25rem !important}.mr-xl-n1,.mx-xl-n1{margin-right:-.25rem !important}.mb-xl-n1,.my-xl-n1{margin-bottom:-.25rem !important}.ml-xl-n1,.mx-xl-n1{margin-left:-.25rem !important}.m-xl-n2{margin:-.5rem !important}.mt-xl-n2,.my-xl-n2{margin-top:-.5rem !important}.mr-xl-n2,.mx-xl-n2{margin-right:-.5rem !important}.mb-xl-n2,.my-xl-n2{margin-bottom:-.5rem !important}.ml-xl-n2,.mx-xl-n2{margin-left:-.5rem !important}.m-xl-n3{margin:-1rem !important}.mt-xl-n3,.my-xl-n3{margin-top:-1rem !important}.mr-xl-n3,.mx-xl-n3{margin-right:-1rem !important}.mb-xl-n3,.my-xl-n3{margin-bottom:-1rem !important}.ml-xl-n3,.mx-xl-n3{margin-left:-1rem !important}.m-xl-n4{margin:-1.5rem !important}.mt-xl-n4,.my-xl-n4{margin-top:-1.5rem !important}.mr-xl-n4,.mx-xl-n4{margin-right:-1.5rem !important}.mb-xl-n4,.my-xl-n4{margin-bottom:-1.5rem !important}.ml-xl-n4,.mx-xl-n4{margin-left:-1.5rem !important}.m-xl-n5{margin:-3rem !important}.mt-xl-n5,.my-xl-n5{margin-top:-3rem !important}.mr-xl-n5,.mx-xl-n5{margin-right:-3rem !important}.mb-xl-n5,.my-xl-n5{margin-bottom:-3rem !important}.ml-xl-n5,.mx-xl-n5{margin-left:-3rem !important}.m-xl-auto{margin:auto !important}.mt-xl-auto,.my-xl-auto{margin-top:auto !important}.mr-xl-auto,.mx-xl-auto{margin-right:auto !important}.mb-xl-auto,.my-xl-auto{margin-bottom:auto !important}.ml-xl-auto,.mx-xl-auto{margin-left:auto !important}}.text-monospace{font-family:"Hack",monospace !important}.text-justify{text-align:justify !important}.text-wrap{white-space:normal !important}.text-nowrap{white-space:nowrap !important}.text-truncate{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.text-left{text-align:left !important}.text-right{text-align:right !important}.text-center{text-align:center !important}@media (min-width: 576px){.text-sm-left{text-align:left !important}.text-sm-right{text-align:right !important}.text-sm-center{text-align:center !important}}@media (min-width: 768px){.text-md-left{text-align:left !important}.text-md-right{text-align:right !important}.text-md-center{text-align:center !important}}@media (min-width: 992px){.text-lg-left{text-align:left !important}.text-lg-right{text-align:right !important}.text-lg-center{text-align:center !important}}@media (min-width: 1200px){.text-xl-left{text-align:left !important}.text-xl-right{text-align:right !important}.text-xl-center{text-align:center !important}}.text-lowercase{text-transform:lowercase !important}.text-uppercase{text-transform:uppercase !important}.text-capitalize{text-transform:capitalize !important}.font-weight-light{font-weight:300 !important}.font-weight-lighter{font-weight:lighter !important}.font-weight-normal{font-weight:400 !important}.font-weight-bold{font-weight:700 !important}.font-weight-bolder{font-weight:bolder !important}.font-italic{font-style:italic !important}.text-white{color:#fff !important}.text-primary{color:#3c6eb4 !important}a.text-primary:hover,a.text-primary:focus{color:#294b7b !important}.text-secondary{color:#6c757d !important}a.text-secondary:hover,a.text-secondary:focus{color:#494f54 !important}.text-success{color:#28a745 !important}a.text-success:hover,a.text-success:focus{color:#19692c !important}.text-info{color:#17a2b8 !important}a.text-info:hover,a.text-info:focus{color:#0f6674 !important}.text-warning{color:#ffc107 !important}a.text-warning:hover,a.text-warning:focus{color:#ba8b00 !important}.text-danger{color:#dc3545 !important}a.text-danger:hover,a.text-danger:focus{color:#a71d2a !important}.text-light{color:#f8f9fa !important}a.text-light:hover,a.text-light:focus{color:#cbd3da !important}.text-dark{color:#343a40 !important}a.text-dark:hover,a.text-dark:focus{color:#121416 !important}.text-body{color:#373a3c !important}.text-muted{color:#6c757d !important}.text-black-50{color:rgba(0,0,0,0.5) !important}.text-white-50{color:rgba(255,255,255,0.5) !important}.text-hide{font:0/0 a;color:transparent;text-shadow:none;background-color:transparent;border:0}.text-decoration-none{text-decoration:none !important}.text-break{word-break:break-word !important;overflow-wrap:break-word !important}.text-reset{color:inherit !important}.visible{visibility:visible !important}.invisible{visibility:hidden !important}@media print{*,*::before,*::after{text-shadow:none !important;box-shadow:none !important}a:not(.btn){text-decoration:underline}abbr[title]::after{content:" (" attr(title) ")"}pre{white-space:pre-wrap !important}pre,blockquote{border:1px solid #adb5bd;page-break-inside:avoid}thead{display:table-header-group}tr,img{page-break-inside:avoid}p,h2,h3{orphans:3;widows:3}h2,h3{page-break-after:avoid}@page{size:a3}body{min-width:992px !important}.container{min-width:992px !important}.navbar{display:none}.badge{border:1px solid #000}.table{border-collapse:collapse !important}.table td,.table th{background-color:#fff !important}.table-bordered th,.table-bordered td{border:1px solid #dee2e6 !important}.table-dark{color:inherit}.table-dark th,.table-dark td,.table-dark thead th,.table-dark tbody+tbody{border-color:#dee2e6}.table .thead-dark th{color:inherit;border-color:#dee2e6}}.container-narrow{width:100%;padding-right:15px;padding-left:15px;margin-right:auto;margin-left:auto}@media (min-width: 576px){.container-narrow{max-width:34rem}}@media (min-width: 768px){.container-narrow{max-width:45rem}}@media (min-width: 992px){.container-narrow{max-width:45rem}}@media (min-width: 1200px){.container-narrow{max-width:45rem}}.inline-list li{display:inline-block}.social-list li{margin:0 0.4rem 1em 0}.social-list a{font-size:1.6em}.headline-list{margin-bottom:1em}.headline-list.flush{margin:0}.headline-list h4{font-weight:normal}.headline-list li{padding:1em/4 0;border-top:1px solid #d5d5d5}.post-list li{margin-bottom:1em}.bullet-list{list-style:square;margin:0 0 1em 1.2em;line-height:1.3}.bullet-list li{margin-bottom:1em}.text-list{margin:0 0 1em;line-height:1.3}.text-list li{margin-bottom:1em}.c-media-list__item{margin-bottom:1.5em}.c-tile-list{display:flex;flex-direction:column}@media all and (min-width: 55rem){.c-tile-list{flex-direction:row;flex-wrap:wrap}}.c-tile-list__item{width:100%;margin-bottom:1em;position:relative}.c-tile-list__item:nth-child(2n){padding-right:0}@media all and (min-width: 55rem){.c-tile-list__item{width:50%;margin:0;padding:0 1em 1em 0}}.c-thumbnail-list li{margin-bottom:1.5em}.c-thumbnail-list .c-block-media__media{width:80px}.c-thumbnail-list .c-block-media__headline{text-transform:none !important;font-size:1.5em}.c-color-bars-list li{max-width:480px;position:relative;height:80px;padding-top:15px;padding-left:20px;border:1px solid #d5d5d5;border-top:0;color:#55595c;font-size:1.3rem;font-weight:bold}.c-color-bars-list li:first-child{border-top:1px solid #d5d5d5}.c-color-bars-list li.cur{height:120px}.c-color-bars-list li.cur:before{position:absolute;height:100%;width:10px;bottom:0px;left:0px;content:"";background:#3c6eb4}.c-color-bars-list li.prev:before{position:absolute;height:100%;width:10px;bottom:0px;left:0px;content:"";background:#79db32}.c-color-bars-list li.old{color:#d5d5d5}.c-ticket-list{max-width:480px}.c-ticket-list li{border:1px solid #d5d5d5;border-top:0;padding:15px 20px;color:gray}.c-ticket-list:first-child{border-top:1px solid #d5d5d5}.c-ticket-list .list-item-title,.c-ticket-list .list-item-data{float:left}.c-ticket-list .list-item-title{border-radius:20px;padding:4px 10px;background:gray;color:white;font-size:1.2rem;font-weight:bold}.c-ticket-list .origin{float:right;margin-top:3px}.c-ticket-list .origin p{display:inline-block;margin-right:2px}.c-ticket-list .origin img{margin-bottom:5px}.c-ticket-list .c-widget-action-btn.btn{float:right;padding:3px 15px}.c-ticket-list .c-widget-action-btn.btn img{display:block}.c-ticket-list .list-subheader{font-size:1.2rem;font-weight:bold}.c-ticket-list .list-item-info,.c-ticket-list .list-item-data{margin:0;font-size:1.2rem}.nav-underline .nav-item.active,.nav-underline .nav-item.active:hover{box-shadow:0px -3px 0 0 #3c6eb4 inset}.nav-underline .nav-item.active .nav-link,.nav-underline .nav-item.active:hover .nav-link{color:#3c6eb4}.nav-underline li:hover{box-shadow:0px -3px 0 0 #ddd inset}.nav-underline li{padding-top:0.2rem;padding-bottom:0.2rem}.navbar-underline{background-color:#d5d5d5;border-top:1px solid #c8c8c8}pre{background-color:#fdf6e3;padding:1rem}.table-expand-col{min-width:100%}body{background-color:#495057}.modal-header{background-color:#eceeef}.modal-footer{border-top:0px !important}.modal h4{text-transform:none !important}.modal-card{background-color:#d5d5d5;padding:15px}.modal-body h4{font-weight:600 !important}.c-widget-header.card-header{padding:10px 10px 5px 10px;max-width:480px;border:1px solid #d5d5d5;border-radius:0 !important;background:#f7f7f9}.c-widget-header h6{font-family:"Open Sans";font-size:1.3rem;font-weight:normal}.c-widget-header-btn{margin-top:-29px;float:right}.c-widget-action-btn.btn{padding:5px 10px;color:#a07cbc;font-weight:bold}.c-widget-action-btn.btn:hover,.c-widget-action-btn.btn:focus,.c-widget-action-btn.btn:active,.c-widget-action-btn.btn:active:focus{color:#a07cbc}.c-widget-view-more-btn button{padding:0px;margin-right:5px;color:gray;font-size:1.2rem}.c-widget-view-more-btn button:hover,.c-widget-view-more-btn button:focus{color:#55595c}.c-widget-view-more-btn img{margin-top:2px}.c-widget-meeting-event{max-width:480px;border:1px solid #d5d5d5;padding:15px 20px}.c-widget-meeting-event h6,.c-widget-meeting-event h5,.c-widget-meeting-event p{color:#55595c;font-family:"Open Sans"}.c-widget-meeting-event h5{font-weight:bold;font-size:2rem}.c-widget-meeting-event h6{margin-top:2px;margin-bottom:10px;font-size:1.1rem}.c-widget-meeting-event .date,.c-widget-meeting-event .time-ch{font-size:0.9rem;float:left}.c-widget-meeting-event button{float:right}.c-widget-meeting-event .date{margin-right:20px}.c-widget-meeting-event .time-ch p,.c-widget-meeting-event .time-ch a{padding:0;margin:0}.c-widget-meeting-request{max-width:480px;border:1px solid #d5d5d5;padding:15px 20px}.c-widget-meeting-request h6,.c-widget-meeting-request h5{color:#55595c;font-family:"Open Sans"}.c-widget-meeting-request h5{float:left;font-weight:bold;font-size:2rem}.c-widget-meeting-request h6{margin-top:2px;margin-bottom:10px;font-size:1.1rem}.c-widget-meeting-request .meeting-request-btn{float:right}.masthead{background-image:linear-gradient(to bottom, #eee 0%, #ddd 100%);background-repeat:repeat-x;padding-top:10px;padding-bottom:10px}.subheader{background:#f8f9fa;border-bottom:1px solid #dee2e6}.subheader .nav-tabs{margin-bottom:-1px}.footer{background-color:#495057}.bodycontent{background:#fff}.document-docutils>.section{padding-bottom:1rem}.document-docutils pre .comment{color:#586e75}.document-docutils pre .error{color:#93a1a1}.document-docutils pre .generic{color:#93a1a1}.document-docutils pre .keyword{color:#859900}.document-docutils pre .literal{color:#93a1a1}.document-docutils pre .name{color:#93a1a1}.document-docutils pre .operator{color:#859900}.document-docutils pre .other{color:#cb4b16}.document-docutils pre .punctuation{color:#93a1a1}.document-docutils pre .comment.multiline{color:#586e75}.document-docutils pre .comment.preproc{color:#859900}.document-docutils pre .comment.single{color:#586e75}.document-docutils pre .comment.special{color:#859900}.document-docutils pre .generic.deleted{color:#2aa198}.document-docutils pre .generic.emph{color:#93a1a1;font-style:italic}.document-docutils pre .generic.error{color:#dc322f}.document-docutils pre .generic.heading{color:#cb4b16}.document-docutils pre .generic.inserted{color:#859900}.document-docutils pre .generic.output{color:#93a1a1}.document-docutils pre .generic.prompt{color:#93a1a1}.document-docutils pre .generic.strong{color:#93a1a1;font-weight:bold}.document-docutils pre .generic.subheading{color:#cb4b16}.document-docutils pre .generic.traceback{color:#93a1a1}.document-docutils pre .keyword.constant{color:#cb4b16}.document-docutils pre .keyword.declaration{color:#268bd2}.document-docutils pre .keyword.namespace{color:#859900}.document-docutils pre .keyword.pseudo{color:#859900}.document-docutils pre .keyword.reserved{color:#268bd2}.document-docutils pre .keyword.type{color:#dc322f}.document-docutils pre .literal.date{color:#93a1a1}.document-docutils pre .literal.number{color:#2aa198}.document-docutils pre .literal.string{color:#2aa198}.document-docutils pre .name.attribute{color:#93a1a1}.document-docutils pre .name.builtin{color:#B58900}.document-docutils pre .name.class{color:#268bd2}.document-docutils pre .name.constant{color:#cb4b16}.document-docutils pre .name.decorator{color:#268bd2}.document-docutils pre .name.entity{color:#cb4b16}.document-docutils pre .name.exception{color:#cb4b16}.document-docutils pre .name.function{color:#268bd2}.document-docutils pre .name.label{color:#93a1a1}.document-docutils pre .name.namespace{color:#93a1a1}.document-docutils pre .name.other{color:#93a1a1}.document-docutils pre .name.property{color:#93a1a1}.document-docutils pre .name.tag{color:#268bd2}.document-docutils pre .name.variable{color:#268bd2}.document-docutils pre .operator.word{color:#859900}.document-docutils pre .text.whitespace{color:#93a1a1}.document-docutils pre .literal.number.float{color:#2aa198}.document-docutils pre .literal.number.hex{color:#2aa198}.document-docutils pre .literal.number.integer{color:#2aa198}.document-docutils pre .literal.number.oct{color:#2aa198}.document-docutils pre .literal.string.backtick{color:#586e75}.document-docutils pre .literal.string.char{color:#2aa198}.document-docutils pre .literal.string.doc{color:#93a1a1}.document-docutils pre .literal.string.double{color:#2aa198}.document-docutils pre .literal.string.escape{color:#cb4b16}.document-docutils pre .literal.string.heredoc{color:#93a1a1}.document-docutils pre .literal.string.interpol{color:#2aa198}.document-docutils pre .literal.string.other{color:#2aa198}.document-docutils pre .literal.string.regex{color:#dc322f}.document-docutils pre .literal.string.single{color:#2aa198}.document-docutils pre .literal.string.symbol{color:#2aa198}.document-docutils pre .name.builtin.pseudo{color:#268bd2}.document-docutils pre .name.variable.class{color:#268bd2}.document-docutils pre .name.variable.global{color:#268bd2}.document-docutils pre .name.variable.instance{color:#268bd2}.document-docutils pre .literal.number.integer.long{color:#2aa198}.markdown blockquote{margin:0 1rem;color:#6a737d;border-left:0.25rem solid #dfe2e5}
diff --git a/roles/apps-fp-o/files/global/fedora-bootstrap-1.5.0/fedora-bootstrap.min.js b/roles/apps-fp-o/files/global/fedora-bootstrap-1.5.0/fedora-bootstrap.min.js
new file mode 100644
index 000000000..43203684c
--- /dev/null
+++ b/roles/apps-fp-o/files/global/fedora-bootstrap-1.5.0/fedora-bootstrap.min.js
@@ -0,0 +1,7 @@
+/*!
+  * Bootstrap v4.3.1 (https://getbootstrap.com/)
+  * Copyright 2011-2019 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors)
+  * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+  */
+!function(t,e){"object"==typeof exports&&"undefined"!=typeof module?e(exports,require("jquery")):"function"==typeof define&&define.amd?define(["exports","jquery"],e):e((t=t||self).bootstrap={},t.jQuery)}(this,function(t,p){"use strict";function i(t,e){for(var n=0;n<e.length;n++){var i=e[n];i.enumerable=i.enumerable||!1,i.configurable=!0,"value"in i&&(i.writable=!0),Object.defineProperty(t,i.key,i)}}function s(t,e,n){return e&&i(t.prototype,e),n&&i(t,n),t}function l(o){for(var t=1;t<arguments.length;t++){var r=null!=arguments[t]?arguments[t]:{},e=Object.keys(r);"function"==typeof Object.getOwnPropertySymbols&&(e=e.concat(Object.getOwnPropertySymbols(r).filter(function(t){return Object.getOwnPropertyDescriptor(r,t).enumerable}))),e.forEach(function(t){var e,n,i;e=o,i=r[n=t],n in e?Object.defineProperty(e,n,{value:i,enumerable:!0,configurable:!0,writable:!0}):e[n]=i})}return o}p=p&&p.hasOwnProperty("default")?p.default:p;var e="transitionend";function n(t){var e=this,n=!1;return p(this).one(m.TRANSITION_END,function(){n=!0}),setTimeout(function(){n||m.triggerTransitionEnd(e)},t),this}var m={TRANSITION_END:"bsTransitionEnd",getUID:function(t){for(;t+=~~(1e6*Math.random()),document.getElementById(t););return t},getSelectorFromElement:function(t){var e=t.getAttribute("data-target");if(!e||"#"===e){var n=t.getAttribute("href");e=n&&"#"!==n?n.trim():""}try{return document.querySelector(e)?e:null}catch(t){return null}},getTransitionDurationFromElement:function(t){if(!t)return 0;var e=p(t).css("transition-duration"),n=p(t).css("transition-delay"),i=parseFloat(e),o=parseFloat(n);return i||o?(e=e.split(",")[0],n=n.split(",")[0],1e3*(parseFloat(e)+parseFloat(n))):0},reflow:function(t){return t.offsetHeight},triggerTransitionEnd:function(t){p(t).trigger(e)},supportsTransitionEnd:function(){return Boolean(e)},isElement:function(t){return(t[0]||t).nodeType},typeCheckConfig:function(t,e,n){for(var i in n)if(Object.prototype.hasOwnProperty.call(n,i)){var o=n[i],r=e[i],s=r&&m.isElement(r)?"element":(a=r,{}.toString.call(a).match(/\s([a-z]+)/i)[1].toLowerCase());if(!new RegExp(o).test(s))throw new Error(t.toUpperCase()+': Option "'+i+'" provided type "'+s+'" but expected type "'+o+'".')}var a},findShadowRoot:function(t){if(!document.documentElement.attachShadow)return null;if("function"!=typeof t.getRootNode)return t instanceof ShadowRoot?t:t.parentNode?m.findShadowRoot(t.parentNode):null;var e=t.getRootNode();return e instanceof ShadowRoot?e:null}};p.fn.emulateTransitionEnd=n,p.event.special[m.TRANSITION_END]={bindType:e,delegateType:e,handle:function(t){if(p(t.target).is(this))return t.handleObj.handler.apply(this,arguments)}};var o="alert",r="bs.alert",a="."+r,c=p.fn[o],h={CLOSE:"close"+a,CLOSED:"closed"+a,CLICK_DATA_API:"click"+a+".data-api"},u="alert",f="fade",d="show",g=function(){function i(t){this._element=t}var t=i.prototype;return t.close=function(t){var e=this._element;t&&(e=this._getRootElement(t)),this._triggerCloseEvent(e).isDefaultPrevented()||this._removeElement(e)},t.dispose=function(){p.removeData(this._element,r),this._element=null},t._getRootElement=function(t){var e=m.getSelectorFromElement(t),n=!1;return e&&(n=document.querySelector(e)),n||(n=p(t).closest("."+u)[0]),n},t._triggerCloseEvent=function(t){var e=p.Event(h.CLOSE);return p(t).trigger(e),e},t._removeElement=function(e){var n=this;if(p(e).removeClass(d),p(e).hasClass(f)){var t=m.getTransitionDurationFromElement(e);p(e).one(m.TRANSITION_END,function(t){return n._destroyElement(e,t)}).emulateTransitionEnd(t)}else this._destroyElement(e)},t._destroyElement=function(t){p(t).detach().trigger(h.CLOSED).remove()},i._jQueryInterface=function(n){return this.each(function(){var t=p(this),e=t.data(r);e||(e=new i(this),t.data(r,e)),"close"===n&&e[n](this)})},i._handleDismiss=function(e){return function(t){t&&t.preventDefault(),e.close(this)}},s(i,null,[{key:"VERSION",get:function(){return"4.3.1"}}]),i}();p(document).on(h.CLICK_DATA_API,'[data-dismiss="alert"]',g._handleDismiss(new g)),p.fn[o]=g._jQueryInterface,p.fn[o].Constructor=g,p.fn[o].noConflict=function(){return p.fn[o]=c,g._jQueryInterface};var _="button",v="bs.button",y="."+v,E=".data-api",b=p.fn[_],w="active",C="btn",T="focus",S='[data-toggle^="button"]',D='[data-toggle="buttons"]',I='input:not([type="hidden"])',A=".active",O=".btn",N={CLICK_DATA_API:"click"+y+E,FOCUS_BLUR_DATA_API:"focus"+y+E+" blur"+y+E},k=function(){function n(t){this._element=t}var t=n.prototype;return t.toggle=function(){var t=!0,e=!0,n=p(this._element).closest(D)[0];if(n){var i=this._element.querySelector(I);if(i){if("radio"===i.type)if(i.checked&&this._element.classList.contains(w))t=!1;else{var o=n.querySelector(A);o&&p(o).removeClass(w)}if(t){if(i.hasAttribute("disabled")||n.hasAttribute("disabled")||i.classList.contains("disabled")||n.classList.contains("disabled"))return;i.checked=!this._element.classList.contains(w),p(i).trigger("change")}i.focus(),e=!1}}e&&this._element.setAttribute("aria-pressed",!this._element.classList.contains(w)),t&&p(this._element).toggleClass(w)},t.dispose=function(){p.removeData(this._element,v),this._element=null},n._jQueryInterface=function(e){return this.each(function(){var t=p(this).data(v);t||(t=new n(this),p(this).data(v,t)),"toggle"===e&&t[e]()})},s(n,null,[{key:"VERSION",get:function(){return"4.3.1"}}]),n}();p(document).on(N.CLICK_DATA_API,S,function(t){t.preventDefault();var e=t.target;p(e).hasClass(C)||(e=p(e).closest(O)),k._jQueryInterface.call(p(e),"toggle")}).on(N.FOCUS_BLUR_DATA_API,S,function(t){var e=p(t.target).closest(O)[0];p(e).toggleClass(T,/^focus(in)?$/.test(t.type))}),p.fn[_]=k._jQueryInterface,p.fn[_].Constructor=k,p.fn[_].noConflict=function(){return p.fn[_]=b,k._jQueryInterface};var L="carousel",x="bs.carousel",P="."+x,H=".data-api",j=p.fn[L],R={interval:5e3,keyboard:!0,slide:!1,pause:"hover",wrap:!0,touch:!0},F={interval:"(number|boolean)",keyboard:"boolean",slide:"(boolean|string)",pause:"(string|boolean)",wrap:"boolean",touch:"boolean"},M="next",W="prev",U="left",B="right",q={SLIDE:"slide"+P,SLID:"slid"+P,KEYDOWN:"keydown"+P,MOUSEENTER:"mouseenter"+P,MOUSELEAVE:"mouseleave"+P,TOUCHSTART:"touchstart"+P,TOUCHMOVE:"touchmove"+P,TOUCHEND:"touchend"+P,POINTERDOWN:"pointerdown"+P,POINTERUP:"pointerup"+P,DRAG_START:"dragstart"+P,LOAD_DATA_API:"load"+P+H,CLICK_DATA_API:"click"+P+H},K="carousel",Q="active",V="slide",Y="carousel-item-right",z="carousel-item-left",X="carousel-item-next",G="carousel-item-prev",$="pointer-event",J=".active",Z=".active.carousel-item",tt=".carousel-item",et=".carousel-item img",nt=".carousel-item-next, .carousel-item-prev",it=".carousel-indicators",ot="[data-slide], [data-slide-to]",rt='[data-ride="carousel"]',st={TOUCH:"touch",PEN:"pen"},at=function(){function r(t,e){this._items=null,this._interval=null,this._activeElement=null,this._isPaused=!1,this._isSliding=!1,this.touchTimeout=null,this.touchStartX=0,this.touchDeltaX=0,this._config=this._getConfig(e),this._element=t,this._indicatorsElement=this._element.querySelector(it),this._touchSupported="ontouchstart"in document.documentElement||0<navigator.maxTouchPoints,this._pointerEvent=Boolean(window.PointerEvent||window.MSPointerEvent),this._addEventListeners()}var t=r.prototype;return t.next=function(){this._isSliding||this._slide(M)},t.nextWhenVisible=function(){!document.hidden&&p(this._element).is(":visible")&&"hidden"!==p(this._element).css("visibility")&&this.next()},t.prev=function(){this._isSliding||this._slide(W)},t.pause=function(t){t||(this._isPaused=!0),this._element.querySelector(nt)&&(m.triggerTransitionEnd(this._element),this.cycle(!0)),clearInterval(this._interval),this._interval=null},t.cycle=function(t){t||(this._isPaused=!1),this._interval&&(clearInterval(this._interval),this._interval=null),this._config.interval&&!this._isPaused&&(this._interval=setInterval((document.visibilityState?this.nextWhenVisible:this.next).bind(this),this._config.interval))},t.to=function(t){var e=this;this._activeElement=this._element.querySelector(Z);var n=this._getItemIndex(this._activeElement);if(!(t>this._items.length-1||t<0))if(this._isSliding)p(this._element).one(q.SLID,function(){return e.to(t)});else{if(n===t)return this.pause(),void this.cycle();var i=n<t?M:W;this._slide(i,this._items[t])}},t.dispose=function(){p(this._element).off(P),p.removeData(this._element,x),this._items=null,this._config=null,this._element=null,this._interval=null,this._isPaused=null,this._isSliding=null,this._activeElement=null,this._indicatorsElement=null},t._getConfig=function(t){return t=l({},R,t),m.typeCheckConfig(L,t,F),t},t._handleSwipe=function(){var t=Math.abs(this.touchDeltaX);if(!(t<=40)){var e=t/this.touchDeltaX;0<e&&this.prev(),e<0&&this.next()}},t._addEventListeners=function(){var e=this;this._config.keyboard&&p(this._element).on(q.KEYDOWN,function(t){return e._keydown(t)}),"hover"===this._config.pause&&p(this._element).on(q.MOUSEENTER,function(t){return e.pause(t)}).on(q.MOUSELEAVE,function(t){return e.cycle(t)}),this._config.touch&&this._addTouchEventListeners()},t._addTouchEventListeners=function(){var n=this;if(this._touchSupported){var e=function(t){n._pointerEvent&&st[t.originalEvent.pointerType.toUpperCase()]?n.touchStartX=t.originalEvent.clientX:n._pointerEvent||(n.touchStartX=t.originalEvent.touches[0].clientX)},i=function(t){n._pointerEvent&&st[t.originalEvent.pointerType.toUpperCase()]&&(n.touchDeltaX=t.originalEvent.clientX-n.touchStartX),n._handleSwipe(),"hover"===n._config.pause&&(n.pause(),n.touchTimeout&&clearTimeout(n.touchTimeout),n.touchTimeout=setTimeout(function(t){return n.cycle(t)},500+n._config.interval))};p(this._element.querySelectorAll(et)).on(q.DRAG_START,function(t){return t.preventDefault()}),this._pointerEvent?(p(this._element).on(q.POINTERDOWN,function(t){return e(t)}),p(this._element).on(q.POINTERUP,function(t){return i(t)}),this._element.classList.add($)):(p(this._element).on(q.TOUCHSTART,function(t){return e(t)}),p(this._element).on(q.TOUCHMOVE,function(t){var e;(e=t).originalEvent.touches&&1<e.originalEvent.touches.length?n.touchDeltaX=0:n.touchDeltaX=e.originalEvent.touches[0].clientX-n.touchStartX}),p(this._element).on(q.TOUCHEND,function(t){return i(t)}))}},t._keydown=function(t){if(!/input|textarea/i.test(t.target.tagName))switch(t.which){case 37:t.preventDefault(),this.prev();break;case 39:t.preventDefault(),this.next()}},t._getItemIndex=function(t){return this._items=t&&t.parentNode?[].slice.call(t.parentNode.querySelectorAll(tt)):[],this._items.indexOf(t)},t._getItemByDirection=function(t,e){var n=t===M,i=t===W,o=this._getItemIndex(e),r=this._items.length-1;if((i&&0===o||n&&o===r)&&!this._config.wrap)return e;var s=(o+(t===W?-1:1))%this._items.length;return-1===s?this._items[this._items.length-1]:this._items[s]},t._triggerSlideEvent=function(t,e){var n=this._getItemIndex(t),i=this._getItemIndex(this._element.querySelector(Z)),o=p.Event(q.SLIDE,{relatedTarget:t,direction:e,from:i,to:n});return p(this._element).trigger(o),o},t._setActiveIndicatorElement=function(t){if(this._indicatorsElement){var e=[].slice.call(this._indicatorsElement.querySelectorAll(J));p(e).removeClass(Q);var n=this._indicatorsElement.children[this._getItemIndex(t)];n&&p(n).addClass(Q)}},t._slide=function(t,e){var n,i,o,r=this,s=this._element.querySelector(Z),a=this._getItemIndex(s),l=e||s&&this._getItemByDirection(t,s),c=this._getItemIndex(l),h=Boolean(this._interval);if(o=t===M?(n=z,i=X,U):(n=Y,i=G,B),l&&p(l).hasClass(Q))this._isSliding=!1;else if(!this._triggerSlideEvent(l,o).isDefaultPrevented()&&s&&l){this._isSliding=!0,h&&this.pause(),this._setActiveIndicatorElement(l);var u=p.Event(q.SLID,{relatedTarget:l,direction:o,from:a,to:c});if(p(this._element).hasClass(V)){p(l).addClass(i),m.reflow(l),p(s).addClass(n),p(l).addClass(n);var f=parseInt(l.getAttribute("data-interval"),10);this._config.interval=f?(this._config.defaultInterval=this._config.defaultInterval||this._config.interval,f):this._config.defaultInterval||this._config.interval;var d=m.getTransitionDurationFromElement(s);p(s).one(m.TRANSITION_END,function(){p(l).removeClass(n+" "+i).addClass(Q),p(s).removeClass(Q+" "+i+" "+n),r._isSliding=!1,setTimeout(function(){return p(r._element).trigger(u)},0)}).emulateTransitionEnd(d)}else p(s).removeClass(Q),p(l).addClass(Q),this._isSliding=!1,p(this._element).trigger(u);h&&this.cycle()}},r._jQueryInterface=function(i){return this.each(function(){var t=p(this).data(x),e=l({},R,p(this).data());"object"==typeof i&&(e=l({},e,i));var n="string"==typeof i?i:e.slide;if(t||(t=new r(this,e),p(this).data(x,t)),"number"==typeof i)t.to(i);else if("string"==typeof n){if("undefined"==typeof t[n])throw new TypeError('No method named "'+n+'"');t[n]()}else e.interval&&e.ride&&(t.pause(),t.cycle())})},r._dataApiClickHandler=function(t){var e=m.getSelectorFromElement(this);if(e){var n=p(e)[0];if(n&&p(n).hasClass(K)){var i=l({},p(n).data(),p(this).data()),o=this.getAttribute("data-slide-to");o&&(i.interval=!1),r._jQueryInterface.call(p(n),i),o&&p(n).data(x).to(o),t.preventDefault()}}},s(r,null,[{key:"VERSION",get:function(){return"4.3.1"}},{key:"Default",get:function(){return R}}]),r}();p(document).on(q.CLICK_DATA_API,ot,at._dataApiClickHandler),p(window).on(q.LOAD_DATA_API,function(){for(var t=[].slice.call(document.querySelectorAll(rt)),e=0,n=t.length;e<n;e++){var i=p(t[e]);at._jQueryInterface.call(i,i.data())}}),p.fn[L]=at._jQueryInterface,p.fn[L].Constructor=at,p.fn[L].noConflict=function(){return p.fn[L]=j,at._jQueryInterface};var lt="collapse",ct="bs.collapse",ht="."+ct,ut=p.fn[lt],ft={toggle:!0,parent:""},dt={toggle:"boolean",parent:"(string|element)"},pt={SHOW:"show"+ht,SHOWN:"shown"+ht,HIDE:"hide"+ht,HIDDEN:"hidden"+ht,CLICK_DATA_API:"click"+ht+".data-api"},mt="show",gt="collapse",_t="collapsing",vt="collapsed",yt="width",Et="height",bt=".show, .collapsing",wt='[data-toggle="collapse"]',Ct=function(){function a(e,t){this._isTransitioning=!1,this._element=e,this._config=this._getConfig(t),this._triggerArray=[].slice.call(document.querySelectorAll('[data-toggle="collapse"][href="#'+e.id+'"],[data-toggle="collapse"][data-target="#'+e.id+'"]'));for(var n=[].slice.call(document.querySelectorAll(wt)),i=0,o=n.length;i<o;i++){var r=n[i],s=m.getSelectorFromElement(r),a=[].slice.call(document.querySelectorAll(s)).filter(function(t){return t===e});null!==s&&0<a.length&&(this._selector=s,this._triggerArray.push(r))}this._parent=this._config.parent?this._getParent():null,this._config.parent||this._addAriaAndCollapsedClass(this._element,this._triggerArray),this._config.toggle&&this.toggle()}var t=a.prototype;return t.toggle=function(){p(this._element).hasClass(mt)?this.hide():this.show()},t.show=function(){var t,e,n=this;if(!this._isTransitioning&&!p(this._element).hasClass(mt)&&(this._parent&&0===(t=[].slice.call(this._parent.querySelectorAll(bt)).filter(function(t){return"string"==typeof n._config.parent?t.getAttribute("data-parent")===n._config.parent:t.classList.contains(gt)})).length&&(t=null),!(t&&(e=p(t).not(this._selector).data(ct))&&e._isTransitioning))){var i=p.Event(pt.SHOW);if(p(this._element).trigger(i),!i.isDefaultPrevented()){t&&(a._jQueryInterface.call(p(t).not(this._selector),"hide"),e||p(t).data(ct,null));var o=this._getDimension();p(this._element).removeClass(gt).addClass(_t),this._element.style[o]=0,this._triggerArray.length&&p(this._triggerArray).removeClass(vt).attr("aria-expanded",!0),this.setTransitioning(!0);var r="scroll"+(o[0].toUpperCase()+o.slice(1)),s=m.getTransitionDurationFromElement(this._element);p(this._element).one(m.TRANSITION_END,function(){p(n._element).removeClass(_t).addClass(gt).addClass(mt),n._element.style[o]="",n.setTransitioning(!1),p(n._element).trigger(pt.SHOWN)}).emulateTransitionEnd(s),this._element.style[o]=this._element[r]+"px"}}},t.hide=function(){var t=this;if(!this._isTransitioning&&p(this._element).hasClass(mt)){var e=p.Event(pt.HIDE);if(p(this._element).trigger(e),!e.isDefaultPrevented()){var n=this._getDimension();this._element.style[n]=this._element.getBoundingClientRect()[n]+"px",m.reflow(this._element),p(this._element).addClass(_t).removeClass(gt).removeClass(mt);var i=this._triggerArray.length;if(0<i)for(var o=0;o<i;o++){var r=this._triggerArray[o],s=m.getSelectorFromElement(r);if(null!==s)p([].slice.call(document.querySelectorAll(s))).hasClass(mt)||p(r).addClass(vt).attr("aria-expanded",!1)}this.setTransitioning(!0);this._element.style[n]="";var a=m.getTransitionDurationFromElement(this._element);p(this._element).one(m.TRANSITION_END,function(){t.setTransitioning(!1),p(t._element).removeClass(_t).addClass(gt).trigger(pt.HIDDEN)}).emulateTransitionEnd(a)}}},t.setTransitioning=function(t){this._isTransitioning=t},t.dispose=function(){p.removeData(this._element,ct),this._config=null,this._parent=null,this._element=null,this._triggerArray=null,this._isTransitioning=null},t._getConfig=function(t){return(t=l({},ft,t)).toggle=Boolean(t.toggle),m.typeCheckConfig(lt,t,dt),t},t._getDimension=function(){return p(this._element).hasClass(yt)?yt:Et},t._getParent=function(){var t,n=this;m.isElement(this._config.parent)?(t=this._config.parent,"undefined"!=typeof this._config.parent.jquery&&(t=this._config.parent[0])):t=document.querySelector(this._config.parent);var e='[data-toggle="collapse"][data-parent="'+this._config.parent+'"]',i=[].slice.call(t.querySelectorAll(e));return p(i).each(function(t,e){n._addAriaAndCollapsedClass(a._getTargetFromElement(e),[e])}),t},t._addAriaAndCollapsedClass=function(t,e){var n=p(t).hasClass(mt);e.length&&p(e).toggleClass(vt,!n).attr("aria-expanded",n)},a._getTargetFromElement=function(t){var e=m.getSelectorFromElement(t);return e?document.querySelector(e):null},a._jQueryInterface=function(i){return this.each(function(){var t=p(this),e=t.data(ct),n=l({},ft,t.data(),"object"==typeof i&&i?i:{});if(!e&&n.toggle&&/show|hide/.test(i)&&(n.toggle=!1),e||(e=new a(this,n),t.data(ct,e)),"string"==typeof i){if("undefined"==typeof e[i])throw new TypeError('No method named "'+i+'"');e[i]()}})},s(a,null,[{key:"VERSION",get:function(){return"4.3.1"}},{key:"Default",get:function(){return ft}}]),a}();p(document).on(pt.CLICK_DATA_API,wt,function(t){"A"===t.currentTarget.tagName&&t.preventDefault();var n=p(this),e=m.getSelectorFromElement(this),i=[].slice.call(document.querySelectorAll(e));p(i).each(function(){var t=p(this),e=t.data(ct)?"toggle":n.data();Ct._jQueryInterface.call(t,e)})}),p.fn[lt]=Ct._jQueryInterface,p.fn[lt].Constructor=Ct,p.fn[lt].noConflict=function(){return p.fn[lt]=ut,Ct._jQueryInterface};for(var Tt="undefined"!=typeof window&&"undefined"!=typeof document,St=["Edge","Trident","Firefox"],Dt=0,It=0;It<St.length;It+=1)if(Tt&&0<=navigator.userAgent.indexOf(St[It])){Dt=1;break}var At=Tt&&window.Promise?function(t){var e=!1;return function(){e||(e=!0,window.Promise.resolve().then(function(){e=!1,t()}))}}:function(t){var e=!1;return function(){e||(e=!0,setTimeout(function(){e=!1,t()},Dt))}};function Ot(t){return t&&"[object Function]"==={}.toString.call(t)}function Nt(t,e){if(1!==t.nodeType)return[];var n=t.ownerDocument.defaultView.getComputedStyle(t,null);return e?n[e]:n}function kt(t){return"HTML"===t.nodeName?t:t.parentNode||t.host}function Lt(t){if(!t)return document.body;switch(t.nodeName){case"HTML":case"BODY":return t.ownerDocument.body;case"#document":return t.body}var e=Nt(t),n=e.overflow,i=e.overflowX,o=e.overflowY;return/(auto|scroll|overlay)/.test(n+o+i)?t:Lt(kt(t))}var xt=Tt&&!(!window.MSInputMethodContext||!document.documentMode),Pt=Tt&&/MSIE 10/.test(navigator.userAgent);function Ht(t){return 11===t?xt:10===t?Pt:xt||Pt}function jt(t){if(!t)return document.documentElement;for(var e=Ht(10)?document.body:null,n=t.offsetParent||null;n===e&&t.nextElementSibling;)n=(t=t.nextElementSibling).offsetParent;var i=n&&n.nodeName;return i&&"BODY"!==i&&"HTML"!==i?-1!==["TH","TD","TABLE"].indexOf(n.nodeName)&&"static"===Nt(n,"position")?jt(n):n:t?t.ownerDocument.documentElement:document.documentElement}function Rt(t){return null!==t.parentNode?Rt(t.parentNode):t}function Ft(t,e){if(!(t&&t.nodeType&&e&&e.nodeType))return document.documentElement;var n=t.compareDocumentPosition(e)&Node.DOCUMENT_POSITION_FOLLOWING,i=n?t:e,o=n?e:t,r=document.createRange();r.setStart(i,0),r.setEnd(o,0);var s,a,l=r.commonAncestorContainer;if(t!==l&&e!==l||i.contains(o))return"BODY"===(a=(s=l).nodeName)||"HTML"!==a&&jt(s.firstElementChild)!==s?jt(l):l;var c=Rt(t);return c.host?Ft(c.host,e):Ft(t,Rt(e).host)}function Mt(t){var e="top"===(1<arguments.length&&void 0!==arguments[1]?arguments[1]:"top")?"scrollTop":"scrollLeft",n=t.nodeName;if("BODY"!==n&&"HTML"!==n)return t[e];var i=t.ownerDocument.documentElement;return(t.ownerDocument.scrollingElement||i)[e]}function Wt(t,e){var n="x"===e?"Left":"Top",i="Left"===n?"Right":"Bottom";return parseFloat(t["border"+n+"Width"],10)+parseFloat(t["border"+i+"Width"],10)}function Ut(t,e,n,i){return Math.max(e["offset"+t],e["scroll"+t],n["client"+t],n["offset"+t],n["scroll"+t],Ht(10)?parseInt(n["offset"+t])+parseInt(i["margin"+("Height"===t?"Top":"Left")])+parseInt(i["margin"+("Height"===t?"Bottom":"Right")]):0)}function Bt(t){var e=t.body,n=t.documentElement,i=Ht(10)&&getComputedStyle(n);return{height:Ut("Height",e,n,i),width:Ut("Width",e,n,i)}}var qt=function(){function i(t,e){for(var n=0;n<e.length;n++){var i=e[n];i.enumerable=i.enumerable||!1,i.configurable=!0,"value"in i&&(i.writable=!0),Object.defineProperty(t,i.key,i)}}return function(t,e,n){return e&&i(t.prototype,e),n&&i(t,n),t}}(),Kt=function(t,e,n){return e in t?Object.defineProperty(t,e,{value:n,enumerable:!0,configurable:!0,writable:!0}):t[e]=n,t},Qt=Object.assign||function(t){for(var e=1;e<arguments.length;e++){var n=arguments[e];for(var i in n)Object.prototype.hasOwnProperty.call(n,i)&&(t[i]=n[i])}return t};function Vt(t){return Qt({},t,{right:t.left+t.width,bottom:t.top+t.height})}function Yt(t){var e={};try{if(Ht(10)){e=t.getBoundingClientRect();var n=Mt(t,"top"),i=Mt(t,"left");e.top+=n,e.left+=i,e.bottom+=n,e.right+=i}else e=t.getBoundingClientRect()}catch(t){}var o={left:e.left,top:e.top,width:e.right-e.left,height:e.bottom-e.top},r="HTML"===t.nodeName?Bt(t.ownerDocument):{},s=r.width||t.clientWidth||o.right-o.left,a=r.height||t.clientHeight||o.bottom-o.top,l=t.offsetWidth-s,c=t.offsetHeight-a;if(l||c){var h=Nt(t);l-=Wt(h,"x"),c-=Wt(h,"y"),o.width-=l,o.height-=c}return Vt(o)}function zt(t,e){var n=2<arguments.length&&void 0!==arguments[2]&&arguments[2],i=Ht(10),o="HTML"===e.nodeName,r=Yt(t),s=Yt(e),a=Lt(t),l=Nt(e),c=parseFloat(l.borderTopWidth,10),h=parseFloat(l.borderLeftWidth,10);n&&o&&(s.top=Math.max(s.top,0),s.left=Math.max(s.left,0));var u=Vt({top:r.top-s.top-c,left:r.left-s.left-h,width:r.width,height:r.height});if(u.marginTop=0,u.marginLeft=0,!i&&o){var f=parseFloat(l.marginTop,10),d=parseFloat(l.marginLeft,10);u.top-=c-f,u.bottom-=c-f,u.left-=h-d,u.right-=h-d,u.marginTop=f,u.marginLeft=d}return(i&&!n?e.contains(a):e===a&&"BODY"!==a.nodeName)&&(u=function(t,e){var n=2<arguments.length&&void 0!==arguments[2]&&arguments[2],i=Mt(e,"top"),o=Mt(e,"left"),r=n?-1:1;return t.top+=i*r,t.bottom+=i*r,t.left+=o*r,t.right+=o*r,t}(u,e)),u}function Xt(t){if(!t||!t.parentElement||Ht())return document.documentElement;for(var e=t.parentElement;e&&"none"===Nt(e,"transform");)e=e.parentElement;return e||document.documentElement}function Gt(t,e,n,i){var o=4<arguments.length&&void 0!==arguments[4]&&arguments[4],r={top:0,left:0},s=o?Xt(t):Ft(t,e);if("viewport"===i)r=function(t){var e=1<arguments.length&&void 0!==arguments[1]&&arguments[1],n=t.ownerDocument.documentElement,i=zt(t,n),o=Math.max(n.clientWidth,window.innerWidth||0),r=Math.max(n.clientHeight,window.innerHeight||0),s=e?0:Mt(n),a=e?0:Mt(n,"left");return Vt({top:s-i.top+i.marginTop,left:a-i.left+i.marginLeft,width:o,height:r})}(s,o);else{var a=void 0;"scrollParent"===i?"BODY"===(a=Lt(kt(e))).nodeName&&(a=t.ownerDocument.documentElement):a="window"===i?t.ownerDocument.documentElement:i;var l=zt(a,s,o);if("HTML"!==a.nodeName||function t(e){var n=e.nodeName;if("BODY"===n||"HTML"===n)return!1;if("fixed"===Nt(e,"position"))return!0;var i=kt(e);return!!i&&t(i)}(s))r=l;else{var c=Bt(t.ownerDocument),h=c.height,u=c.width;r.top+=l.top-l.marginTop,r.bottom=h+l.top,r.left+=l.left-l.marginLeft,r.right=u+l.left}}var f="number"==typeof(n=n||0);return r.left+=f?n:n.left||0,r.top+=f?n:n.top||0,r.right-=f?n:n.right||0,r.bottom-=f?n:n.bottom||0,r}function $t(t,e,i,n,o){var r=5<arguments.length&&void 0!==arguments[5]?arguments[5]:0;if(-1===t.indexOf("auto"))return t;var s=Gt(i,n,r,o),a={top:{width:s.width,height:e.top-s.top},right:{width:s.right-e.right,height:s.height},bottom:{width:s.width,height:s.bottom-e.bottom},left:{width:e.left-s.left,height:s.height}},l=Object.keys(a).map(function(t){return Qt({key:t},a[t],{area:(e=a[t],e.width*e.height)});var e}).sort(function(t,e){return e.area-t.area}),c=l.filter(function(t){var e=t.width,n=t.height;return e>=i.clientWidth&&n>=i.clientHeight}),h=0<c.length?c[0].key:l[0].key,u=t.split("-")[1];return h+(u?"-"+u:"")}function Jt(t,e,n){var i=3<arguments.length&&void 0!==arguments[3]?arguments[3]:null;return zt(n,i?Xt(e):Ft(e,n),i)}function Zt(t){var e=t.ownerDocument.defaultView.getComputedStyle(t),n=parseFloat(e.marginTop||0)+parseFloat(e.marginBottom||0),i=parseFloat(e.marginLeft||0)+parseFloat(e.marginRight||0);return{width:t.offsetWidth+i,height:t.offsetHeight+n}}function te(t){var e={left:"right",right:"left",bottom:"top",top:"bottom"};return t.replace(/left|right|bottom|top/g,function(t){return e[t]})}function ee(t,e,n){n=n.split("-")[0];var i=Zt(t),o={width:i.width,height:i.height},r=-1!==["right","left"].indexOf(n),s=r?"top":"left",a=r?"left":"top",l=r?"height":"width",c=r?"width":"height";return o[s]=e[s]+e[l]/2-i[l]/2,o[a]=n===a?e[a]-i[c]:e[te(a)],o}function ne(t,e){return Array.prototype.find?t.find(e):t.filter(e)[0]}function ie(t,n,e){return(void 0===e?t:t.slice(0,function(t,e,n){if(Array.prototype.findIndex)return t.findIndex(function(t){return t[e]===n});var i=ne(t,function(t){return t[e]===n});return t.indexOf(i)}(t,"name",e))).forEach(function(t){t.function&&console.warn("`modifier.function` is deprecated, use `modifier.fn`!");var e=t.function||t.fn;t.enabled&&Ot(e)&&(n.offsets.popper=Vt(n.offsets.popper),n.offsets.reference=Vt(n.offsets.reference),n=e(n,t))}),n}function oe(t,n){return t.some(function(t){var e=t.name;return t.enabled&&e===n})}function re(t){for(var e=[!1,"ms","Webkit","Moz","O"],n=t.charAt(0).toUpperCase()+t.slice(1),i=0;i<e.length;i++){var o=e[i],r=o?""+o+n:t;if("undefined"!=typeof document.body.style[r])return r}return null}function se(t){var e=t.ownerDocument;return e?e.defaultView:window}function ae(t,e,n,i){n.updateBound=i,se(t).addEventListener("resize",n.updateBound,{passive:!0});var o=Lt(t);return function t(e,n,i,o){var r="BODY"===e.nodeName,s=r?e.ownerDocument.defaultView:e;s.addEventListener(n,i,{passive:!0}),r||t(Lt(s.parentNode),n,i,o),o.push(s)}(o,"scroll",n.updateBound,n.scrollParents),n.scrollElement=o,n.eventsEnabled=!0,n}function le(){var t,e;this.state.eventsEnabled&&(cancelAnimationFrame(this.scheduleUpdate),this.state=(t=this.reference,e=this.state,se(t).removeEventListener("resize",e.updateBound),e.scrollParents.forEach(function(t){t.removeEventListener("scroll",e.updateBound)}),e.updateBound=null,e.scrollParents=[],e.scrollElement=null,e.eventsEnabled=!1,e))}function ce(t){return""!==t&&!isNaN(parseFloat(t))&&isFinite(t)}function he(n,i){Object.keys(i).forEach(function(t){var e="";-1!==["width","height","top","right","bottom","left"].indexOf(t)&&ce(i[t])&&(e="px"),n.style[t]=i[t]+e})}var ue=Tt&&/Firefox/i.test(navigator.userAgent);function fe(t,e,n){var i=ne(t,function(t){return t.name===e}),o=!!i&&t.some(function(t){return t.name===n&&t.enabled&&t.order<i.order});if(!o){var r="`"+e+"`",s="`"+n+"`";console.warn(s+" modifier is required by "+r+" modifier in order to work, be sure to include it before "+r+"!")}return o}var de=["auto-start","auto","auto-end","top-start","top","top-end","right-start","right","right-end","bottom-end","bottom","bottom-start","left-end","left","left-start"],pe=de.slice(3);function me(t){var e=1<arguments.length&&void 0!==arguments[1]&&arguments[1],n=pe.indexOf(t),i=pe.slice(n+1).concat(pe.slice(0,n));return e?i.reverse():i}var ge="flip",_e="clockwise",ve="counterclockwise";function ye(t,o,r,e){var s=[0,0],a=-1!==["right","left"].indexOf(e),n=t.split(/(\+|\-)/).map(function(t){return t.trim()}),i=n.indexOf(ne(n,function(t){return-1!==t.search(/,|\s/)}));n[i]&&-1===n[i].indexOf(",")&&console.warn("Offsets separated by white space(s) are deprecated, use a comma (,) instead.");var l=/\s*,\s*|\s+/,c=-1!==i?[n.slice(0,i).concat([n[i].split(l)[0]]),[n[i].split(l)[1]].concat(n.slice(i+1))]:[n];return(c=c.map(function(t,e){var n=(1===e?!a:a)?"height":"width",i=!1;return t.reduce(function(t,e){return""===t[t.length-1]&&-1!==["+","-"].indexOf(e)?(t[t.length-1]=e,i=!0,t):i?(t[t.length-1]+=e,i=!1,t):t.concat(e)},[]).map(function(t){return function(t,e,n,i){var o=t.match(/((?:\-|\+)?\d*\.?\d*)(.*)/),r=+o[1],s=o[2];if(!r)return t;if(0!==s.indexOf("%"))return"vh"!==s&&"vw"!==s?r:("vh"===s?Math.max(document.documentElement.clientHeight,window.innerHeight||0):Math.max(document.documentElement.clientWidth,window.innerWidth||0))/100*r;var a=void 0;switch(s){case"%p":a=n;break;case"%":case"%r":default:a=i}return Vt(a)[e]/100*r}(t,n,o,r)})})).forEach(function(n,i){n.forEach(function(t,e){ce(t)&&(s[i]+=t*("-"===n[e-1]?-1:1))})}),s}var Ee={placement:"bottom",positionFixed:!1,eventsEnabled:!0,removeOnDestroy:!1,onCreate:function(){},onUpdate:function(){},modifiers:{shift:{order:100,enabled:!0,fn:function(t){var e=t.placement,n=e.split("-")[0],i=e.split("-")[1];if(i){var o=t.offsets,r=o.reference,s=o.popper,a=-1!==["bottom","top"].indexOf(n),l=a?"left":"top",c=a?"width":"height",h={start:Kt({},l,r[l]),end:Kt({},l,r[l]+r[c]-s[c])};t.offsets.popper=Qt({},s,h[i])}return t}},offset:{order:200,enabled:!0,fn:function(t,e){var n=e.offset,i=t.placement,o=t.offsets,r=o.popper,s=o.reference,a=i.split("-")[0],l=void 0;return l=ce(+n)?[+n,0]:ye(n,r,s,a),"left"===a?(r.top+=l[0],r.left-=l[1]):"right"===a?(r.top+=l[0],r.left+=l[1]):"top"===a?(r.left+=l[0],r.top-=l[1]):"bottom"===a&&(r.left+=l[0],r.top+=l[1]),t.popper=r,t},offset:0},preventOverflow:{order:300,enabled:!0,fn:function(t,i){var e=i.boundariesElement||jt(t.instance.popper);t.instance.reference===e&&(e=jt(e));var n=re("transform"),o=t.instance.popper.style,r=o.top,s=o.left,a=o[n];o.top="",o.left="",o[n]="";var l=Gt(t.instance.popper,t.instance.reference,i.padding,e,t.positionFixed);o.top=r,o.left=s,o[n]=a,i.boundaries=l;var c=i.priority,h=t.offsets.popper,u={primary:function(t){var e=h[t];return h[t]<l[t]&&!i.escapeWithReference&&(e=Math.max(h[t],l[t])),Kt({},t,e)},secondary:function(t){var e="right"===t?"left":"top",n=h[e];return h[t]>l[t]&&!i.escapeWithReference&&(n=Math.min(h[e],l[t]-("right"===t?h.width:h.height))),Kt({},e,n)}};return c.forEach(function(t){var e=-1!==["left","top"].indexOf(t)?"primary":"secondary";h=Qt({},h,u[e](t))}),t.offsets.popper=h,t},priority:["left","right","top","bottom"],padding:5,boundariesElement:"scrollParent"},keepTogether:{order:400,enabled:!0,fn:function(t){var e=t.offsets,n=e.popper,i=e.reference,o=t.placement.split("-")[0],r=Math.floor,s=-1!==["top","bottom"].indexOf(o),a=s?"right":"bottom",l=s?"left":"top",c=s?"width":"height";return n[a]<r(i[l])&&(t.offsets.popper[l]=r(i[l])-n[c]),n[l]>r(i[a])&&(t.offsets.popper[l]=r(i[a])),t}},arrow:{order:500,enabled:!0,fn:function(t,e){var n;if(!fe(t.instance.modifiers,"arrow","keepTogether"))return t;var i=e.element;if("string"==typeof i){if(!(i=t.instance.popper.querySelector(i)))return t}else if(!t.instance.popper.contains(i))return console.warn("WARNING: `arrow.element` must be child of its popper element!"),t;var o=t.placement.split("-")[0],r=t.offsets,s=r.popper,a=r.reference,l=-1!==["left","right"].indexOf(o),c=l?"height":"width",h=l?"Top":"Left",u=h.toLowerCase(),f=l?"left":"top",d=l?"bottom":"right",p=Zt(i)[c];a[d]-p<s[u]&&(t.offsets.popper[u]-=s[u]-(a[d]-p)),a[u]+p>s[d]&&(t.offsets.popper[u]+=a[u]+p-s[d]),t.offsets.popper=Vt(t.offsets.popper);var m=a[u]+a[c]/2-p/2,g=Nt(t.instance.popper),_=parseFloat(g["margin"+h],10),v=parseFloat(g["border"+h+"Width"],10),y=m-t.offsets.popper[u]-_-v;return y=Math.max(Math.min(s[c]-p,y),0),t.arrowElement=i,t.offsets.arrow=(Kt(n={},u,Math.round(y)),Kt(n,f,""),n),t},element:"[x-arrow]"},flip:{order:600,enabled:!0,fn:function(p,m){if(oe(p.instance.modifiers,"inner"))return p;if(p.flipped&&p.placement===p.originalPlacement)return p;var g=Gt(p.instance.popper,p.instance.reference,m.padding,m.boundariesElement,p.positionFixed),_=p.placement.split("-")[0],v=te(_),y=p.placement.split("-")[1]||"",E=[];switch(m.behavior){case ge:E=[_,v];break;case _e:E=me(_);break;case ve:E=me(_,!0);break;default:E=m.behavior}return E.forEach(function(t,e){if(_!==t||E.length===e+1)return p;_=p.placement.split("-")[0],v=te(_);var n,i=p.offsets.popper,o=p.offsets.reference,r=Math.floor,s="left"===_&&r(i.right)>r(o.left)||"right"===_&&r(i.left)<r(o.right)||"top"===_&&r(i.bottom)>r(o.top)||"bottom"===_&&r(i.top)<r(o.bottom),a=r(i.left)<r(g.left),l=r(i.right)>r(g.right),c=r(i.top)<r(g.top),h=r(i.bottom)>r(g.bottom),u="left"===_&&a||"right"===_&&l||"top"===_&&c||"bottom"===_&&h,f=-1!==["top","bottom"].indexOf(_),d=!!m.flipVariations&&(f&&"start"===y&&a||f&&"end"===y&&l||!f&&"start"===y&&c||!f&&"end"===y&&h);(s||u||d)&&(p.flipped=!0,(s||u)&&(_=E[e+1]),d&&(y="end"===(n=y)?"start":"start"===n?"end":n),p.placement=_+(y?"-"+y:""),p.offsets.popper=Qt({},p.offsets.popper,ee(p.instance.popper,p.offsets.reference,p.placement)),p=ie(p.instance.modifiers,p,"flip"))}),p},behavior:"flip",padding:5,boundariesElement:"viewport"},inner:{order:700,enabled:!1,fn:function(t){var e=t.placement,n=e.split("-")[0],i=t.offsets,o=i.popper,r=i.reference,s=-1!==["left","right"].indexOf(n),a=-1===["top","left"].indexOf(n);return o[s?"left":"top"]=r[n]-(a?o[s?"width":"height"]:0),t.placement=te(e),t.offsets.popper=Vt(o),t}},hide:{order:800,enabled:!0,fn:function(t){if(!fe(t.instance.modifiers,"hide","preventOverflow"))return t;var e=t.offsets.reference,n=ne(t.instance.modifiers,function(t){return"preventOverflow"===t.name}).boundaries;if(e.bottom<n.top||e.left>n.right||e.top>n.bottom||e.right<n.left){if(!0===t.hide)return t;t.hide=!0,t.attributes["x-out-of-boundaries"]=""}else{if(!1===t.hide)return t;t.hide=!1,t.attributes["x-out-of-boundaries"]=!1}return t}},computeStyle:{order:850,enabled:!0,fn:function(t,e){var n=e.x,i=e.y,o=t.offsets.popper,r=ne(t.instance.modifiers,function(t){return"applyStyle"===t.name}).gpuAcceleration;void 0!==r&&console.warn("WARNING: `gpuAcceleration` option moved to `computeStyle` modifier and will not be supported in future versions of Popper.js!");var s,a,l,c,h,u,f,d,p,m,g,_,v,y,E=void 0!==r?r:e.gpuAcceleration,b=jt(t.instance.popper),w=Yt(b),C={position:o.position},T=(s=t,a=window.devicePixelRatio<2||!ue,l=s.offsets,c=l.popper,h=l.reference,u=Math.round,f=Math.floor,d=function(t){return t},p=u(h.width),m=u(c.width),g=-1!==["left","right"].indexOf(s.placement),_=-1!==s.placement.indexOf("-"),y=a?u:d,{left:(v=a?g||_||p%2==m%2?u:f:d)(p%2==1&&m%2==1&&!_&&a?c.left-1:c.left),top:y(c.top),bottom:y(c.bottom),right:v(c.right)}),S="bottom"===n?"top":"bottom",D="right"===i?"left":"right",I=re("transform"),A=void 0,O=void 0;if(O="bottom"===S?"HTML"===b.nodeName?-b.clientHeight+T.bottom:-w.height+T.bottom:T.top,A="right"===D?"HTML"===b.nodeName?-b.clientWidth+T.right:-w.width+T.right:T.left,E&&I)C[I]="translate3d("+A+"px, "+O+"px, 0)",C[S]=0,C[D]=0,C.willChange="transform";else{var N="bottom"===S?-1:1,k="right"===D?-1:1;C[S]=O*N,C[D]=A*k,C.willChange=S+", "+D}var L={"x-placement":t.placement};return t.attributes=Qt({},L,t.attributes),t.styles=Qt({},C,t.styles),t.arrowStyles=Qt({},t.offsets.arrow,t.arrowStyles),t},gpuAcceleration:!0,x:"bottom",y:"right"},applyStyle:{order:900,enabled:!0,fn:function(t){var e,n;return he(t.instance.popper,t.styles),e=t.instance.popper,n=t.attributes,Object.keys(n).forEach(function(t){!1!==n[t]?e.setAttribute(t,n[t]):e.removeAttribute(t)}),t.arrowElement&&Object.keys(t.arrowStyles).length&&he(t.arrowElement,t.arrowStyles),t},onLoad:function(t,e,n,i,o){var r=Jt(o,e,t,n.positionFixed),s=$t(n.placement,r,e,t,n.modifiers.flip.boundariesElement,n.modifiers.flip.padding);return e.setAttribute("x-placement",s),he(e,{position:n.positionFixed?"fixed":"absolute"}),n},gpuAcceleration:void 0}}},be=function(){function r(t,e){var n=this,i=2<arguments.length&&void 0!==arguments[2]?arguments[2]:{};!function(t,e){if(!(t instanceof e))throw new TypeError("Cannot call a class as a function")}(this,r),this.scheduleUpdate=function(){return requestAnimationFrame(n.update)},this.update=At(this.update.bind(this)),this.options=Qt({},r.Defaults,i),this.state={isDestroyed:!1,isCreated:!1,scrollParents:[]},this.reference=t&&t.jquery?t[0]:t,this.popper=e&&e.jquery?e[0]:e,this.options.modifiers={},Object.keys(Qt({},r.Defaults.modifiers,i.modifiers)).forEach(function(t){n.options.modifiers[t]=Qt({},r.Defaults.modifiers[t]||{},i.modifiers?i.modifiers[t]:{})}),this.modifiers=Object.keys(this.options.modifiers).map(function(t){return Qt({name:t},n.options.modifiers[t])}).sort(function(t,e){return t.order-e.order}),this.modifiers.forEach(function(t){t.enabled&&Ot(t.onLoad)&&t.onLoad(n.reference,n.popper,n.options,t,n.state)}),this.update();var o=this.options.eventsEnabled;o&&this.enableEventListeners(),this.state.eventsEnabled=o}return qt(r,[{key:"update",value:function(){return function(){if(!this.state.isDestroyed){var t={instance:this,styles:{},arrowStyles:{},attributes:{},flipped:!1,offsets:{}};t.offsets.reference=Jt(this.state,this.popper,this.reference,this.options.positionFixed),t.placement=$t(this.options.placement,t.offsets.reference,this.popper,this.reference,this.options.modifiers.flip.boundariesElement,this.options.modifiers.flip.padding),t.originalPlacement=t.placement,t.positionFixed=this.options.positionFixed,t.offsets.popper=ee(this.popper,t.offsets.reference,t.placement),t.offsets.popper.position=this.options.positionFixed?"fixed":"absolute",t=ie(this.modifiers,t),this.state.isCreated?this.options.onUpdate(t):(this.state.isCreated=!0,this.options.onCreate(t))}}.call(this)}},{key:"destroy",value:function(){return function(){return this.state.isDestroyed=!0,oe(this.modifiers,"applyStyle")&&(this.popper.removeAttribute("x-placement"),this.popper.style.position="",this.popper.style.top="",this.popper.style.left="",this.popper.style.right="",this.popper.style.bottom="",this.popper.style.willChange="",this.popper.style[re("transform")]=""),this.disableEventListeners(),this.options.removeOnDestroy&&this.popper.parentNode.removeChild(this.popper),this}.call(this)}},{key:"enableEventListeners",value:function(){return function(){this.state.eventsEnabled||(this.state=ae(this.reference,this.options,this.state,this.scheduleUpdate))}.call(this)}},{key:"disableEventListeners",value:function(){return le.call(this)}}]),r}();be.Utils=("undefined"!=typeof window?window:global).PopperUtils,be.placements=de,be.Defaults=Ee;var we="dropdown",Ce="bs.dropdown",Te="."+Ce,Se=".data-api",De=p.fn[we],Ie=new RegExp("38|40|27"),Ae={HIDE:"hide"+Te,HIDDEN:"hidden"+Te,SHOW:"show"+Te,SHOWN:"shown"+Te,CLICK:"click"+Te,CLICK_DATA_API:"click"+Te+Se,KEYDOWN_DATA_API:"keydown"+Te+Se,KEYUP_DATA_API:"keyup"+Te+Se},Oe="disabled",Ne="show",ke="dropup",Le="dropright",xe="dropleft",Pe="dropdown-menu-right",He="position-static",je='[data-toggle="dropdown"]',Re=".dropdown form",Fe=".dropdown-menu",Me=".navbar-nav",We=".dropdown-menu .dropdown-item:not(.disabled):not(:disabled)",Ue="top-start",Be="top-end",qe="bottom-start",Ke="bottom-end",Qe="right-start",Ve="left-start",Ye={offset:0,flip:!0,boundary:"scrollParent",reference:"toggle",display:"dynamic"},ze={offset:"(number|string|function)",flip:"boolean",boundary:"(string|element)",reference:"(string|element)",display:"string"},Xe=function(){function c(t,e){this._element=t,this._popper=null,this._config=this._getConfig(e),this._menu=this._getMenuElement(),this._inNavbar=this._detectNavbar(),this._addEventListeners()}var t=c.prototype;return t.toggle=function(){if(!this._element.disabled&&!p(this._element).hasClass(Oe)){var t=c._getParentFromElement(this._element),e=p(this._menu).hasClass(Ne);if(c._clearMenus(),!e){var n={relatedTarget:this._element},i=p.Event(Ae.SHOW,n);if(p(t).trigger(i),!i.isDefaultPrevented()){if(!this._inNavbar){if("undefined"==typeof be)throw new TypeError("Bootstrap's dropdowns require Popper.js (https://popper.js.org/)");var o=this._element;"parent"===this._config.reference?o=t:m.isElement(this._config.reference)&&(o=this._config.reference,"undefined"!=typeof this._config.reference.jquery&&(o=this._config.reference[0])),"scrollParent"!==this._config.boundary&&p(t).addClass(He),this._popper=new be(o,this._menu,this._getPopperConfig())}"ontouchstart"in document.documentElement&&0===p(t).closest(Me).length&&p(document.body).children().on("mouseover",null,p.noop),this._element.focus(),this._element.setAttribute("aria-expanded",!0),p(this._menu).toggleClass(Ne),p(t).toggleClass(Ne).trigger(p.Event(Ae.SHOWN,n))}}}},t.show=function(){if(!(this._element.disabled||p(this._element).hasClass(Oe)||p(this._menu).hasClass(Ne))){var t={relatedTarget:this._element},e=p.Event(Ae.SHOW,t),n=c._getParentFromElement(this._element);p(n).trigger(e),e.isDefaultPrevented()||(p(this._menu).toggleClass(Ne),p(n).toggleClass(Ne).trigger(p.Event(Ae.SHOWN,t)))}},t.hide=function(){if(!this._element.disabled&&!p(this._element).hasClass(Oe)&&p(this._menu).hasClass(Ne)){var t={relatedTarget:this._element},e=p.Event(Ae.HIDE,t),n=c._getParentFromElement(this._element);p(n).trigger(e),e.isDefaultPrevented()||(p(this._menu).toggleClass(Ne),p(n).toggleClass(Ne).trigger(p.Event(Ae.HIDDEN,t)))}},t.dispose=function(){p.removeData(this._element,Ce),p(this._element).off(Te),this._element=null,(this._menu=null)!==this._popper&&(this._popper.destroy(),this._popper=null)},t.update=function(){this._inNavbar=this._detectNavbar(),null!==this._popper&&this._popper.scheduleUpdate()},t._addEventListeners=function(){var e=this;p(this._element).on(Ae.CLICK,function(t){t.preventDefault(),t.stopPropagation(),e.toggle()})},t._getConfig=function(t){return t=l({},this.constructor.Default,p(this._element).data(),t),m.typeCheckConfig(we,t,this.constructor.DefaultType),t},t._getMenuElement=function(){if(!this._menu){var t=c._getParentFromElement(this._element);t&&(this._menu=t.querySelector(Fe))}return this._menu},t._getPlacement=function(){var t=p(this._element.parentNode),e=qe;return t.hasClass(ke)?(e=Ue,p(this._menu).hasClass(Pe)&&(e=Be)):t.hasClass(Le)?e=Qe:t.hasClass(xe)?e=Ve:p(this._menu).hasClass(Pe)&&(e=Ke),e},t._detectNavbar=function(){return 0<p(this._element).closest(".navbar").length},t._getOffset=function(){var e=this,t={};return"function"==typeof this._config.offset?t.fn=function(t){return t.offsets=l({},t.offsets,e._config.offset(t.offsets,e._element)||{}),t}:t.offset=this._config.offset,t},t._getPopperConfig=function(){var t={placement:this._getPlacement(),modifiers:{offset:this._getOffset(),flip:{enabled:this._config.flip},preventOverflow:{boundariesElement:this._config.boundary}}};return"static"===this._config.display&&(t.modifiers.applyStyle={enabled:!1}),t},c._jQueryInterface=function(e){return this.each(function(){var t=p(this).data(Ce);if(t||(t=new c(this,"object"==typeof e?e:null),p(this).data(Ce,t)),"string"==typeof e){if("undefined"==typeof t[e])throw new TypeError('No method named "'+e+'"');t[e]()}})},c._clearMenus=function(t){if(!t||3!==t.which&&("keyup"!==t.type||9===t.which))for(var e=[].slice.call(document.querySelectorAll(je)),n=0,i=e.length;n<i;n++){var o=c._getParentFromElement(e[n]),r=p(e[n]).data(Ce),s={relatedTarget:e[n]};if(t&&"click"===t.type&&(s.clickEvent=t),r){var a=r._menu;if(p(o).hasClass(Ne)&&!(t&&("click"===t.type&&/input|textarea/i.test(t.target.tagName)||"keyup"===t.type&&9===t.which)&&p.contains(o,t.target))){var l=p.Event(Ae.HIDE,s);p(o).trigger(l),l.isDefaultPrevented()||("ontouchstart"in document.documentElement&&p(document.body).children().off("mouseover",null,p.noop),e[n].setAttribute("aria-expanded","false"),p(a).removeClass(Ne),p(o).removeClass(Ne).trigger(p.Event(Ae.HIDDEN,s)))}}}},c._getParentFromElement=function(t){var e,n=m.getSelectorFromElement(t);return n&&(e=document.querySelector(n)),e||t.parentNode},c._dataApiKeydownHandler=function(t){if((/input|textarea/i.test(t.target.tagName)?!(32===t.which||27!==t.which&&(40!==t.which&&38!==t.which||p(t.target).closest(Fe).length)):Ie.test(t.which))&&(t.preventDefault(),t.stopPropagation(),!this.disabled&&!p(this).hasClass(Oe))){var e=c._getParentFromElement(this),n=p(e).hasClass(Ne);if(n&&(!n||27!==t.which&&32!==t.which)){var i=[].slice.call(e.querySelectorAll(We));if(0!==i.length){var o=i.indexOf(t.target);38===t.which&&0<o&&o--,40===t.which&&o<i.length-1&&o++,o<0&&(o=0),i[o].focus()}}else{if(27===t.which){var r=e.querySelector(je);p(r).trigger("focus")}p(this).trigger("click")}}},s(c,null,[{key:"VERSION",get:function(){return"4.3.1"}},{key:"Default",get:function(){return Ye}},{key:"DefaultType",get:function(){return ze}}]),c}();p(document).on(Ae.KEYDOWN_DATA_API,je,Xe._dataApiKeydownHandler).on(Ae.KEYDOWN_DATA_API,Fe,Xe._dataApiKeydownHandler).on(Ae.CLICK_DATA_API+" "+Ae.KEYUP_DATA_API,Xe._clearMenus).on(Ae.CLICK_DATA_API,je,function(t){t.preventDefault(),t.stopPropagation(),Xe._jQueryInterface.call(p(this),"toggle")}).on(Ae.CLICK_DATA_API,Re,function(t){t.stopPropagation()}),p.fn[we]=Xe._jQueryInterface,p.fn[we].Constructor=Xe,p.fn[we].noConflict=function(){return p.fn[we]=De,Xe._jQueryInterface};var Ge="modal",$e="bs.modal",Je="."+$e,Ze=p.fn[Ge],tn={backdrop:!0,keyboard:!0,focus:!0,show:!0},en={backdrop:"(boolean|string)",keyboard:"boolean",focus:"boolean",show:"boolean"},nn={HIDE:"hide"+Je,HIDDEN:"hidden"+Je,SHOW:"show"+Je,SHOWN:"shown"+Je,FOCUSIN:"focusin"+Je,RESIZE:"resize"+Je,CLICK_DISMISS:"click.dismiss"+Je,KEYDOWN_DISMISS:"keydown.dismiss"+Je,MOUSEUP_DISMISS:"mouseup.dismiss"+Je,MOUSEDOWN_DISMISS:"mousedown.dismiss"+Je,CLICK_DATA_API:"click"+Je+".data-api"},on="modal-dialog-scrollable",rn="modal-scrollbar-measure",sn="modal-backdrop",an="modal-open",ln="fade",cn="show",hn=".modal-dialog",un=".modal-body",fn='[data-toggle="modal"]',dn='[data-dismiss="modal"]',pn=".fixed-top, .fixed-bottom, .is-fixed, .sticky-top",mn=".sticky-top",gn=function(){function o(t,e){this._config=this._getConfig(e),this._element=t,this._dialog=t.querySelector(hn),this._backdrop=null,this._isShown=!1,this._isBodyOverflowing=!1,this._ignoreBackdropClick=!1,this._isTransitioning=!1,this._scrollbarWidth=0}var t=o.prototype;return t.toggle=function(t){return this._isShown?this.hide():this.show(t)},t.show=function(t){var e=this;if(!this._isShown&&!this._isTransitioning){p(this._element).hasClass(ln)&&(this._isTransitioning=!0);var n=p.Event(nn.SHOW,{relatedTarget:t});p(this._element).trigger(n),this._isShown||n.isDefaultPrevented()||(this._isShown=!0,this._checkScrollbar(),this._setScrollbar(),this._adjustDialog(),this._setEscapeEvent(),this._setResizeEvent(),p(this._element).on(nn.CLICK_DISMISS,dn,function(t){return e.hide(t)}),p(this._dialog).on(nn.MOUSEDOWN_DISMISS,function(){p(e._element).one(nn.MOUSEUP_DISMISS,function(t){p(t.target).is(e._element)&&(e._ignoreBackdropClick=!0)})}),this._showBackdrop(function(){return e._showElement(t)}))}},t.hide=function(t){var e=this;if(t&&t.preventDefault(),this._isShown&&!this._isTransitioning){var n=p.Event(nn.HIDE);if(p(this._element).trigger(n),this._isShown&&!n.isDefaultPrevented()){this._isShown=!1;var i=p(this._element).hasClass(ln);if(i&&(this._isTransitioning=!0),this._setEscapeEvent(),this._setResizeEvent(),p(document).off(nn.FOCUSIN),p(this._element).removeClass(cn),p(this._element).off(nn.CLICK_DISMISS),p(this._dialog).off(nn.MOUSEDOWN_DISMISS),i){var o=m.getTransitionDurationFromElement(this._element);p(this._element).one(m.TRANSITION_END,function(t){return e._hideModal(t)}).emulateTransitionEnd(o)}else this._hideModal()}}},t.dispose=function(){[window,this._element,this._dialog].forEach(function(t){return p(t).off(Je)}),p(document).off(nn.FOCUSIN),p.removeData(this._element,$e),this._config=null,this._element=null,this._dialog=null,this._backdrop=null,this._isShown=null,this._isBodyOverflowing=null,this._ignoreBackdropClick=null,this._isTransitioning=null,this._scrollbarWidth=null},t.handleUpdate=function(){this._adjustDialog()},t._getConfig=function(t){return t=l({},tn,t),m.typeCheckConfig(Ge,t,en),t},t._showElement=function(t){var e=this,n=p(this._element).hasClass(ln);this._element.parentNode&&this._element.parentNode.nodeType===Node.ELEMENT_NODE||document.body.appendChild(this._element),this._element.style.display="block",this._element.removeAttribute("aria-hidden"),this._element.setAttribute("aria-modal",!0),p(this._dialog).hasClass(on)?this._dialog.querySelector(un).scrollTop=0:this._element.scrollTop=0,n&&m.reflow(this._element),p(this._element).addClass(cn),this._config.focus&&this._enforceFocus();var i=p.Event(nn.SHOWN,{relatedTarget:t}),o=function(){e._config.focus&&e._element.focus(),e._isTransitioning=!1,p(e._element).trigger(i)};if(n){var r=m.getTransitionDurationFromElement(this._dialog);p(this._dialog).one(m.TRANSITION_END,o).emulateTransitionEnd(r)}else o()},t._enforceFocus=function(){var e=this;p(document).off(nn.FOCUSIN).on(nn.FOCUSIN,function(t){document!==t.target&&e._element!==t.target&&0===p(e._element).has(t.target).length&&e._element.focus()})},t._setEscapeEvent=function(){var e=this;this._isShown&&this._config.keyboard?p(this._element).on(nn.KEYDOWN_DISMISS,function(t){27===t.which&&(t.preventDefault(),e.hide())}):this._isShown||p(this._element).off(nn.KEYDOWN_DISMISS)},t._setResizeEvent=function(){var e=this;this._isShown?p(window).on(nn.RESIZE,function(t){return e.handleUpdate(t)}):p(window).off(nn.RESIZE)},t._hideModal=function(){var t=this;this._element.style.display="none",this._element.setAttribute("aria-hidden",!0),this._element.removeAttribute("aria-modal"),this._isTransitioning=!1,this._showBackdrop(function(){p(document.body).removeClass(an),t._resetAdjustments(),t._resetScrollbar(),p(t._element).trigger(nn.HIDDEN)})},t._removeBackdrop=function(){this._backdrop&&(p(this._backdrop).remove(),this._backdrop=null)},t._showBackdrop=function(t){var e=this,n=p(this._element).hasClass(ln)?ln:"";if(this._isShown&&this._config.backdrop){if(this._backdrop=document.createElement("div"),this._backdrop.className=sn,n&&this._backdrop.classList.add(n),p(this._backdrop).appendTo(document.body),p(this._element).on(nn.CLICK_DISMISS,function(t){e._ignoreBackdropClick?e._ignoreBackdropClick=!1:t.target===t.currentTarget&&("static"===e._config.backdrop?e._element.focus():e.hide())}),n&&m.reflow(this._backdrop),p(this._backdrop).addClass(cn),!t)return;if(!n)return void t();var i=m.getTransitionDurationFromElement(this._backdrop);p(this._backdrop).one(m.TRANSITION_END,t).emulateTransitionEnd(i)}else if(!this._isShown&&this._backdrop){p(this._backdrop).removeClass(cn);var o=function(){e._removeBackdrop(),t&&t()};if(p(this._element).hasClass(ln)){var r=m.getTransitionDurationFromElement(this._backdrop);p(this._backdrop).one(m.TRANSITION_END,o).emulateTransitionEnd(r)}else o()}else t&&t()},t._adjustDialog=function(){var t=this._element.scrollHeight>document.documentElement.clientHeight;!this._isBodyOverflowing&&t&&(this._element.style.paddingLeft=this._scrollbarWidth+"px"),this._isBodyOverflowing&&!t&&(this._element.style.paddingRight=this._scrollbarWidth+"px")},t._resetAdjustments=function(){this._element.style.paddingLeft="",this._element.style.paddingRight=""},t._checkScrollbar=function(){var t=document.body.getBoundingClientRect();this._isBodyOverflowing=t.left+t.right<window.innerWidth,this._scrollbarWidth=this._getScrollbarWidth()},t._setScrollbar=function(){var o=this;if(this._isBodyOverflowing){var t=[].slice.call(document.querySelectorAll(pn)),e=[].slice.call(document.querySelectorAll(mn));p(t).each(function(t,e){var n=e.style.paddingRight,i=p(e).css("padding-right");p(e).data("padding-right",n).css("padding-right",parseFloat(i)+o._scrollbarWidth+"px")}),p(e).each(function(t,e){var n=e.style.marginRight,i=p(e).css("margin-right");p(e).data("margin-right",n).css("margin-right",parseFloat(i)-o._scrollbarWidth+"px")});var n=document.body.style.paddingRight,i=p(document.body).css("padding-right");p(document.body).data("padding-right",n).css("padding-right",parseFloat(i)+this._scrollbarWidth+"px")}p(document.body).addClass(an)},t._resetScrollbar=function(){var t=[].slice.call(document.querySelectorAll(pn));p(t).each(function(t,e){var n=p(e).data("padding-right");p(e).removeData("padding-right"),e.style.paddingRight=n||""});var e=[].slice.call(document.querySelectorAll(""+mn));p(e).each(function(t,e){var n=p(e).data("margin-right");"undefined"!=typeof n&&p(e).css("margin-right",n).removeData("margin-right")});var n=p(document.body).data("padding-right");p(document.body).removeData("padding-right"),document.body.style.paddingRight=n||""},t._getScrollbarWidth=function(){var t=document.createElement("div");t.className=rn,document.body.appendChild(t);var e=t.getBoundingClientRect().width-t.clientWidth;return document.body.removeChild(t),e},o._jQueryInterface=function(n,i){return this.each(function(){var t=p(this).data($e),e=l({},tn,p(this).data(),"object"==typeof n&&n?n:{});if(t||(t=new o(this,e),p(this).data($e,t)),"string"==typeof n){if("undefined"==typeof t[n])throw new TypeError('No method named "'+n+'"');t[n](i)}else e.show&&t.show(i)})},s(o,null,[{key:"VERSION",get:function(){return"4.3.1"}},{key:"Default",get:function(){return tn}}]),o}();p(document).on(nn.CLICK_DATA_API,fn,function(t){var e,n=this,i=m.getSelectorFromElement(this);i&&(e=document.querySelector(i));var o=p(e).data($e)?"toggle":l({},p(e).data(),p(this).data());"A"!==this.tagName&&"AREA"!==this.tagName||t.preventDefault();var r=p(e).one(nn.SHOW,function(t){t.isDefaultPrevented()||r.one(nn.HIDDEN,function(){p(n).is(":visible")&&n.focus()})});gn._jQueryInterface.call(p(e),o,this)}),p.fn[Ge]=gn._jQueryInterface,p.fn[Ge].Constructor=gn,p.fn[Ge].noConflict=function(){return p.fn[Ge]=Ze,gn._jQueryInterface};var _n=["background","cite","href","itemtype","longdesc","poster","src","xlink:href"],vn={"*":["class","dir","id","lang","role",/^aria-[\w-]*$/i],a:["target","href","title","rel"],area:[],b:[],br:[],col:[],code:[],div:[],em:[],hr:[],h1:[],h2:[],h3:[],h4:[],h5:[],h6:[],i:[],img:["src","alt","title","width","height"],li:[],ol:[],p:[],pre:[],s:[],small:[],span:[],sub:[],sup:[],strong:[],u:[],ul:[]},yn=/^(?:(?:https?|mailto|ftp|tel|file):|[^&:/?#]*(?:[/?#]|$))/gi,En=/^data:(?:image\/(?:bmp|gif|jpeg|jpg|png|tiff|webp)|video\/(?:mpeg|mp4|ogg|webm)|audio\/(?:mp3|oga|ogg|opus));base64,[a-z0-9+/]+=*$/i;function bn(t,s,e){if(0===t.length)return t;if(e&&"function"==typeof e)return e(t);for(var n=(new window.DOMParser).parseFromString(t,"text/html"),a=Object.keys(s),l=[].slice.call(n.body.querySelectorAll("*")),i=function(t,e){var n=l[t],i=n.nodeName.toLowerCase();if(-1===a.indexOf(n.nodeName.toLowerCase()))return n.parentNode.removeChild(n),"continue";var o=[].slice.call(n.attributes),r=[].concat(s["*"]||[],s[i]||[]);o.forEach(function(t){(function(t,e){var n=t.nodeName.toLowerCase();if(-1!==e.indexOf(n))return-1===_n.indexOf(n)||Boolean(t.nodeValue.match(yn)||t.nodeValue.match(En));for(var i=e.filter(function(t){return t instanceof RegExp}),o=0,r=i.length;o<r;o++)if(n.match(i[o]))return!0;return!1})(t,r)||n.removeAttribute(t.nodeName)})},o=0,r=l.length;o<r;o++)i(o);return n.body.innerHTML}var wn="tooltip",Cn="bs.tooltip",Tn="."+Cn,Sn=p.fn[wn],Dn="bs-tooltip",In=new RegExp("(^|\\s)"+Dn+"\\S+","g"),An=["sanitize","whiteList","sanitizeFn"],On={animation:"boolean",template:"string",title:"(string|element|function)",trigger:"string",delay:"(number|object)",html:"boolean",selector:"(string|boolean)",placement:"(string|function)",offset:"(number|string|function)",container:"(string|element|boolean)",fallbackPlacement:"(string|array)",boundary:"(string|element)",sanitize:"boolean",sanitizeFn:"(null|function)",whiteList:"object"},Nn={AUTO:"auto",TOP:"top",RIGHT:"right",BOTTOM:"bottom",LEFT:"left"},kn={animation:!0,template:'<div class="tooltip" role="tooltip"><div class="arrow"></div><div class="tooltip-inner"></div></div>',trigger:"hover focus",title:"",delay:0,html:!1,selector:!1,placement:"top",offset:0,container:!1,fallbackPlacement:"flip",boundary:"scrollParent",sanitize:!0,sanitizeFn:null,whiteList:vn},Ln="show",xn="out",Pn={HIDE:"hide"+Tn,HIDDEN:"hidden"+Tn,SHOW:"show"+Tn,SHOWN:"shown"+Tn,INSERTED:"inserted"+Tn,CLICK:"click"+Tn,FOCUSIN:"focusin"+Tn,FOCUSOUT:"focusout"+Tn,MOUSEENTER:"mouseenter"+Tn,MOUSELEAVE:"mouseleave"+Tn},Hn="fade",jn="show",Rn=".tooltip-inner",Fn=".arrow",Mn="hover",Wn="focus",Un="click",Bn="manual",qn=function(){function i(t,e){if("undefined"==typeof be)throw new TypeError("Bootstrap's tooltips require Popper.js (https://popper.js.org/)");this._isEnabled=!0,this._timeout=0,this._hoverState="",this._activeTrigger={},this._popper=null,this.element=t,this.config=this._getConfig(e),this.tip=null,this._setListeners()}var t=i.prototype;return t.enable=function(){this._isEnabled=!0},t.disable=function(){this._isEnabled=!1},t.toggleEnabled=function(){this._isEnabled=!this._isEnabled},t.toggle=function(t){if(this._isEnabled)if(t){var e=this.constructor.DATA_KEY,n=p(t.currentTarget).data(e);n||(n=new this.constructor(t.currentTarget,this._getDelegateConfig()),p(t.currentTarget).data(e,n)),n._activeTrigger.click=!n._activeTrigger.click,n._isWithActiveTrigger()?n._enter(null,n):n._leave(null,n)}else{if(p(this.getTipElement()).hasClass(jn))return void this._leave(null,this);this._enter(null,this)}},t.dispose=function(){clearTimeout(this._timeout),p.removeData(this.element,this.constructor.DATA_KEY),p(this.element).off(this.constructor.EVENT_KEY),p(this.element).closest(".modal").off("hide.bs.modal"),this.tip&&p(this.tip).remove(),this._isEnabled=null,this._timeout=null,this._hoverState=null,(this._activeTrigger=null)!==this._popper&&this._popper.destroy(),this._popper=null,this.element=null,this.config=null,this.tip=null},t.show=function(){var e=this;if("none"===p(this.element).css("display"))throw new Error("Please use show on visible elements");var t=p.Event(this.constructor.Event.SHOW);if(this.isWithContent()&&this._isEnabled){p(this.element).trigger(t);var n=m.findShadowRoot(this.element),i=p.contains(null!==n?n:this.element.ownerDocument.documentElement,this.element);if(t.isDefaultPrevented()||!i)return;var o=this.getTipElement(),r=m.getUID(this.constructor.NAME);o.setAttribute("id",r),this.element.setAttribute("aria-describedby",r),this.setContent(),this.config.animation&&p(o).addClass(Hn);var s="function"==typeof this.config.placement?this.config.placement.call(this,o,this.element):this.config.placement,a=this._getAttachment(s);this.addAttachmentClass(a);var l=this._getContainer();p(o).data(this.constructor.DATA_KEY,this),p.contains(this.element.ownerDocument.documentElement,this.tip)||p(o).appendTo(l),p(this.element).trigger(this.constructor.Event.INSERTED),this._popper=new be(this.element,o,{placement:a,modifiers:{offset:this._getOffset(),flip:{behavior:this.config.fallbackPlacement},arrow:{element:Fn},preventOverflow:{boundariesElement:this.config.boundary}},onCreate:function(t){t.originalPlacement!==t.placement&&e._handlePopperPlacementChange(t)},onUpdate:function(t){return e._handlePopperPlacementChange(t)}}),p(o).addClass(jn),"ontouchstart"in document.documentElement&&p(document.body).children().on("mouseover",null,p.noop);var c=function(){e.config.animation&&e._fixTransition();var t=e._hoverState;e._hoverState=null,p(e.element).trigger(e.constructor.Event.SHOWN),t===xn&&e._leave(null,e)};if(p(this.tip).hasClass(Hn)){var h=m.getTransitionDurationFromElement(this.tip);p(this.tip).one(m.TRANSITION_END,c).emulateTransitionEnd(h)}else c()}},t.hide=function(t){var e=this,n=this.getTipElement(),i=p.Event(this.constructor.Event.HIDE),o=function(){e._hoverState!==Ln&&n.parentNode&&n.parentNode.removeChild(n),e._cleanTipClass(),e.element.removeAttribute("aria-describedby"),p(e.element).trigger(e.constructor.Event.HIDDEN),null!==e._popper&&e._popper.destroy(),t&&t()};if(p(this.element).trigger(i),!i.isDefaultPrevented()){if(p(n).removeClass(jn),"ontouchstart"in document.documentElement&&p(document.body).children().off("mouseover",null,p.noop),this._activeTrigger[Un]=!1,this._activeTrigger[Wn]=!1,this._activeTrigger[Mn]=!1,p(this.tip).hasClass(Hn)){var r=m.getTransitionDurationFromElement(n);p(n).one(m.TRANSITION_END,o).emulateTransitionEnd(r)}else o();this._hoverState=""}},t.update=function(){null!==this._popper&&this._popper.scheduleUpdate()},t.isWithContent=function(){return Boolean(this.getTitle())},t.addAttachmentClass=function(t){p(this.getTipElement()).addClass(Dn+"-"+t)},t.getTipElement=function(){return this.tip=this.tip||p(this.config.template)[0],this.tip},t.setContent=function(){var t=this.getTipElement();this.setElementContent(p(t.querySelectorAll(Rn)),this.getTitle()),p(t).removeClass(Hn+" "+jn)},t.setElementContent=function(t,e){"object"!=typeof e||!e.nodeType&&!e.jquery?this.config.html?(this.config.sanitize&&(e=bn(e,this.config.whiteList,this.config.sanitizeFn)),t.html(e)):t.text(e):this.config.html?p(e).parent().is(t)||t.empty().append(e):t.text(p(e).text())},t.getTitle=function(){var t=this.element.getAttribute("data-original-title");return t||(t="function"==typeof this.config.title?this.config.title.call(this.element):this.config.title),t},t._getOffset=function(){var e=this,t={};return"function"==typeof this.config.offset?t.fn=function(t){return t.offsets=l({},t.offsets,e.config.offset(t.offsets,e.element)||{}),t}:t.offset=this.config.offset,t},t._getContainer=function(){return!1===this.config.container?document.body:m.isElement(this.config.container)?p(this.config.container):p(document).find(this.config.container)},t._getAttachment=function(t){return Nn[t.toUpperCase()]},t._setListeners=function(){var i=this;this.config.trigger.split(" ").forEach(function(t){if("click"===t)p(i.element).on(i.constructor.Event.CLICK,i.config.selector,function(t){return i.toggle(t)});else if(t!==Bn){var e=t===Mn?i.constructor.Event.MOUSEENTER:i.constructor.Event.FOCUSIN,n=t===Mn?i.constructor.Event.MOUSELEAVE:i.constructor.Event.FOCUSOUT;p(i.element).on(e,i.config.selector,function(t){return i._enter(t)}).on(n,i.config.selector,function(t){return i._leave(t)})}}),p(this.element).closest(".modal").on("hide.bs.modal",function(){i.element&&i.hide()}),this.config.selector?this.config=l({},this.config,{trigger:"manual",selector:""}):this._fixTitle()},t._fixTitle=function(){var t=typeof this.element.getAttribute("data-original-title");(this.element.getAttribute("title")||"string"!==t)&&(this.element.setAttribute("data-original-title",this.element.getAttribute("title")||""),this.element.setAttribute("title",""))},t._enter=function(t,e){var n=this.constructor.DATA_KEY;(e=e||p(t.currentTarget).data(n))||(e=new this.constructor(t.currentTarget,this._getDelegateConfig()),p(t.currentTarget).data(n,e)),t&&(e._activeTrigger["focusin"===t.type?Wn:Mn]=!0),p(e.getTipElement()).hasClass(jn)||e._hoverState===Ln?e._hoverState=Ln:(clearTimeout(e._timeout),e._hoverState=Ln,e.config.delay&&e.config.delay.show?e._timeout=setTimeout(function(){e._hoverState===Ln&&e.show()},e.config.delay.show):e.show())},t._leave=function(t,e){var n=this.constructor.DATA_KEY;(e=e||p(t.currentTarget).data(n))||(e=new this.constructor(t.currentTarget,this._getDelegateConfig()),p(t.currentTarget).data(n,e)),t&&(e._activeTrigger["focusout"===t.type?Wn:Mn]=!1),e._isWithActiveTrigger()||(clearTimeout(e._timeout),e._hoverState=xn,e.config.delay&&e.config.delay.hide?e._timeout=setTimeout(function(){e._hoverState===xn&&e.hide()},e.config.delay.hide):e.hide())},t._isWithActiveTrigger=function(){for(var t in this._activeTrigger)if(this._activeTrigger[t])return!0;return!1},t._getConfig=function(t){var e=p(this.element).data();return Object.keys(e).forEach(function(t){-1!==An.indexOf(t)&&delete e[t]}),"number"==typeof(t=l({},this.constructor.Default,e,"object"==typeof t&&t?t:{})).delay&&(t.delay={show:t.delay,hide:t.delay}),"number"==typeof t.title&&(t.title=t.title.toString()),"number"==typeof t.content&&(t.content=t.content.toString()),m.typeCheckConfig(wn,t,this.constructor.DefaultType),t.sanitize&&(t.template=bn(t.template,t.whiteList,t.sanitizeFn)),t},t._getDelegateConfig=function(){var t={};if(this.config)for(var e in this.config)this.constructor.Default[e]!==this.config[e]&&(t[e]=this.config[e]);return t},t._cleanTipClass=function(){var t=p(this.getTipElement()),e=t.attr("class").match(In);null!==e&&e.length&&t.removeClass(e.join(""))},t._handlePopperPlacementChange=function(t){var e=t.instance;this.tip=e.popper,this._cleanTipClass(),this.addAttachmentClass(this._getAttachment(t.placement))},t._fixTransition=function(){var t=this.getTipElement(),e=this.config.animation;null===t.getAttribute("x-placement")&&(p(t).removeClass(Hn),this.config.animation=!1,this.hide(),this.show(),this.config.animation=e)},i._jQueryInterface=function(n){return this.each(function(){var t=p(this).data(Cn),e="object"==typeof n&&n;if((t||!/dispose|hide/.test(n))&&(t||(t=new i(this,e),p(this).data(Cn,t)),"string"==typeof n)){if("undefined"==typeof t[n])throw new TypeError('No method named "'+n+'"');t[n]()}})},s(i,null,[{key:"VERSION",get:function(){return"4.3.1"}},{key:"Default",get:function(){return kn}},{key:"NAME",get:function(){return wn}},{key:"DATA_KEY",get:function(){return Cn}},{key:"Event",get:function(){return Pn}},{key:"EVENT_KEY",get:function(){return Tn}},{key:"DefaultType",get:function(){return On}}]),i}();p.fn[wn]=qn._jQueryInterface,p.fn[wn].Constructor=qn,p.fn[wn].noConflict=function(){return p.fn[wn]=Sn,qn._jQueryInterface};var Kn="popover",Qn="bs.popover",Vn="."+Qn,Yn=p.fn[Kn],zn="bs-popover",Xn=new RegExp("(^|\\s)"+zn+"\\S+","g"),Gn=l({},qn.Default,{placement:"right",trigger:"click",content:"",template:'<div class="popover" role="tooltip"><div class="arrow"></div><h3 class="popover-header"></h3><div class="popover-body"></div></div>'}),$n=l({},qn.DefaultType,{content:"(string|element|function)"}),Jn="fade",Zn="show",ti=".popover-header",ei=".popover-body",ni={HIDE:"hide"+Vn,HIDDEN:"hidden"+Vn,SHOW:"show"+Vn,SHOWN:"shown"+Vn,INSERTED:"inserted"+Vn,CLICK:"click"+Vn,FOCUSIN:"focusin"+Vn,FOCUSOUT:"focusout"+Vn,MOUSEENTER:"mouseenter"+Vn,MOUSELEAVE:"mouseleave"+Vn},ii=function(t){var e,n;function i(){return t.apply(this,arguments)||this}n=t,(e=i).prototype=Object.create(n.prototype),(e.prototype.constructor=e).__proto__=n;var o=i.prototype;return o.isWithContent=function(){return this.getTitle()||this._getContent()},o.addAttachmentClass=function(t){p(this.getTipElement()).addClass(zn+"-"+t)},o.getTipElement=function(){return this.tip=this.tip||p(this.config.template)[0],this.tip},o.setContent=function(){var t=p(this.getTipElement());this.setElementContent(t.find(ti),this.getTitle());var e=this._getContent();"function"==typeof e&&(e=e.call(this.element)),this.setElementContent(t.find(ei),e),t.removeClass(Jn+" "+Zn)},o._getContent=function(){return this.element.getAttribute("data-content")||this.config.content},o._cleanTipClass=function(){var t=p(this.getTipElement()),e=t.attr("class").match(Xn);null!==e&&0<e.length&&t.removeClass(e.join(""))},i._jQueryInterface=function(n){return this.each(function(){var t=p(this).data(Qn),e="object"==typeof n?n:null;if((t||!/dispose|hide/.test(n))&&(t||(t=new i(this,e),p(this).data(Qn,t)),"string"==typeof n)){if("undefined"==typeof t[n])throw new TypeError('No method named "'+n+'"');t[n]()}})},s(i,null,[{key:"VERSION",get:function(){return"4.3.1"}},{key:"Default",get:function(){return Gn}},{key:"NAME",get:function(){return Kn}},{key:"DATA_KEY",get:function(){return Qn}},{key:"Event",get:function(){return ni}},{key:"EVENT_KEY",get:function(){return Vn}},{key:"DefaultType",get:function(){return $n}}]),i}(qn);p.fn[Kn]=ii._jQueryInterface,p.fn[Kn].Constructor=ii,p.fn[Kn].noConflict=function(){return p.fn[Kn]=Yn,ii._jQueryInterface};var oi="scrollspy",ri="bs.scrollspy",si="."+ri,ai=p.fn[oi],li={offset:10,method:"auto",target:""},ci={offset:"number",method:"string",target:"(string|element)"},hi={ACTIVATE:"activate"+si,SCROLL:"scroll"+si,LOAD_DATA_API:"load"+si+".data-api"},ui="dropdown-item",fi="active",di='[data-spy="scroll"]',pi=".nav, .list-group",mi=".nav-link",gi=".nav-item",_i=".list-group-item",vi=".dropdown",yi=".dropdown-item",Ei=".dropdown-toggle",bi="offset",wi="position",Ci=function(){function n(t,e){var n=this;this._element=t,this._scrollElement="BODY"===t.tagName?window:t,this._config=this._getConfig(e),this._selector=this._config.target+" "+mi+","+this._config.target+" "+_i+","+this._config.target+" "+yi,this._offsets=[],this._targets=[],this._activeTarget=null,this._scrollHeight=0,p(this._scrollElement).on(hi.SCROLL,function(t){return n._process(t)}),this.refresh(),this._process()}var t=n.prototype;return t.refresh=function(){var e=this,t=this._scrollElement===this._scrollElement.window?bi:wi,o="auto"===this._config.method?t:this._config.method,r=o===wi?this._getScrollTop():0;this._offsets=[],this._targets=[],this._scrollHeight=this._getScrollHeight(),[].slice.call(document.querySelectorAll(this._selector)).map(function(t){var e,n=m.getSelectorFromElement(t);if(n&&(e=document.querySelector(n)),e){var i=e.getBoundingClientRect();if(i.width||i.height)return[p(e)[o]().top+r,n]}return null}).filter(function(t){return t}).sort(function(t,e){return t[0]-e[0]}).forEach(function(t){e._offsets.push(t[0]),e._targets.push(t[1])})},t.dispose=function(){p.removeData(this._element,ri),p(this._scrollElement).off(si),this._element=null,this._scrollElement=null,this._config=null,this._selector=null,this._offsets=null,this._targets=null,this._activeTarget=null,this._scrollHeight=null},t._getConfig=function(t){if("string"!=typeof(t=l({},li,"object"==typeof t&&t?t:{})).target){var e=p(t.target).attr("id");e||(e=m.getUID(oi),p(t.target).attr("id",e)),t.target="#"+e}return m.typeCheckConfig(oi,t,ci),t},t._getScrollTop=function(){return this._scrollElement===window?this._scrollElement.pageYOffset:this._scrollElement.scrollTop},t._getScrollHeight=function(){return this._scrollElement.scrollHeight||Math.max(document.body.scrollHeight,document.documentElement.scrollHeight)},t._getOffsetHeight=function(){return this._scrollElement===window?window.innerHeight:this._scrollElement.getBoundingClientRect().height},t._process=function(){var t=this._getScrollTop()+this._config.offset,e=this._getScrollHeight(),n=this._config.offset+e-this._getOffsetHeight();if(this._scrollHeight!==e&&this.refresh(),n<=t){var i=this._targets[this._targets.length-1];this._activeTarget!==i&&this._activate(i)}else{if(this._activeTarget&&t<this._offsets[0]&&0<this._offsets[0])return this._activeTarget=null,void this._clear();for(var o=this._offsets.length;o--;){this._activeTarget!==this._targets[o]&&t>=this._offsets[o]&&("undefined"==typeof this._offsets[o+1]||t<this._offsets[o+1])&&this._activate(this._targets[o])}}},t._activate=function(e){this._activeTarget=e,this._clear();var t=this._selector.split(",").map(function(t){return t+'[data-target="'+e+'"],'+t+'[href="'+e+'"]'}),n=p([].slice.call(document.querySelectorAll(t.join(","))));n.hasClass(ui)?(n.closest(vi).find(Ei).addClass(fi),n.addClass(fi)):(n.addClass(fi),n.parents(pi).prev(mi+", "+_i).addClass(fi),n.parents(pi).prev(gi).children(mi).addClass(fi)),p(this._scrollElement).trigger(hi.ACTIVATE,{relatedTarget:e})},t._clear=function(){[].slice.call(document.querySelectorAll(this._selector)).filter(function(t){return t.classList.contains(fi)}).forEach(function(t){return t.classList.remove(fi)})},n._jQueryInterface=function(e){return this.each(function(){var t=p(this).data(ri);if(t||(t=new n(this,"object"==typeof e&&e),p(this).data(ri,t)),"string"==typeof e){if("undefined"==typeof t[e])throw new TypeError('No method named "'+e+'"');t[e]()}})},s(n,null,[{key:"VERSION",get:function(){return"4.3.1"}},{key:"Default",get:function(){return li}}]),n}();p(window).on(hi.LOAD_DATA_API,function(){for(var t=[].slice.call(document.querySelectorAll(di)),e=t.length;e--;){var n=p(t[e]);Ci._jQueryInterface.call(n,n.data())}}),p.fn[oi]=Ci._jQueryInterface,p.fn[oi].Constructor=Ci,p.fn[oi].noConflict=function(){return p.fn[oi]=ai,Ci._jQueryInterface};var Ti="bs.tab",Si="."+Ti,Di=p.fn.tab,Ii={HIDE:"hide"+Si,HIDDEN:"hidden"+Si,SHOW:"show"+Si,SHOWN:"shown"+Si,CLICK_DATA_API:"click"+Si+".data-api"},Ai="dropdown-menu",Oi="active",Ni="disabled",ki="fade",Li="show",xi=".dropdown",Pi=".nav, .list-group",Hi=".active",ji="> li > .active",Ri='[data-toggle="tab"], [data-toggle="pill"], [data-toggle="list"]',Fi=".dropdown-toggle",Mi="> .dropdown-menu .active",Wi=function(){function i(t){this._element=t}var t=i.prototype;return t.show=function(){var n=this;if(!(this._element.parentNode&&this._element.parentNode.nodeType===Node.ELEMENT_NODE&&p(this._element).hasClass(Oi)||p(this._element).hasClass(Ni))){var t,i,e=p(this._element).closest(Pi)[0],o=m.getSelectorFromElement(this._element);if(e){var r="UL"===e.nodeName||"OL"===e.nodeName?ji:Hi;i=(i=p.makeArray(p(e).find(r)))[i.length-1]}var s=p.Event(Ii.HIDE,{relatedTarget:this._element}),a=p.Event(Ii.SHOW,{relatedTarget:i});if(i&&p(i).trigger(s),p(this._element).trigger(a),!a.isDefaultPrevented()&&!s.isDefaultPrevented()){o&&(t=document.querySelector(o)),this._activate(this._element,e);var l=function(){var t=p.Event(Ii.HIDDEN,{relatedTarget:n._element}),e=p.Event(Ii.SHOWN,{relatedTarget:i});p(i).trigger(t),p(n._element).trigger(e)};t?this._activate(t,t.parentNode,l):l()}}},t.dispose=function(){p.removeData(this._element,Ti),this._element=null},t._activate=function(t,e,n){var i=this,o=(!e||"UL"!==e.nodeName&&"OL"!==e.nodeName?p(e).children(Hi):p(e).find(ji))[0],r=n&&o&&p(o).hasClass(ki),s=function(){return i._transitionComplete(t,o,n)};if(o&&r){var a=m.getTransitionDurationFromElement(o);p(o).removeClass(Li).one(m.TRANSITION_END,s).emulateTransitionEnd(a)}else s()},t._transitionComplete=function(t,e,n){if(e){p(e).removeClass(Oi);var i=p(e.parentNode).find(Mi)[0];i&&p(i).removeClass(Oi),"tab"===e.getAttribute("role")&&e.setAttribute("aria-selected",!1)}if(p(t).addClass(Oi),"tab"===t.getAttribute("role")&&t.setAttribute("aria-selected",!0),m.reflow(t),t.classList.contains(ki)&&t.classList.add(Li),t.parentNode&&p(t.parentNode).hasClass(Ai)){var o=p(t).closest(xi)[0];if(o){var r=[].slice.call(o.querySelectorAll(Fi));p(r).addClass(Oi)}t.setAttribute("aria-expanded",!0)}n&&n()},i._jQueryInterface=function(n){return this.each(function(){var t=p(this),e=t.data(Ti);if(e||(e=new i(this),t.data(Ti,e)),"string"==typeof n){if("undefined"==typeof e[n])throw new TypeError('No method named "'+n+'"');e[n]()}})},s(i,null,[{key:"VERSION",get:function(){return"4.3.1"}}]),i}();p(document).on(Ii.CLICK_DATA_API,Ri,function(t){t.preventDefault(),Wi._jQueryInterface.call(p(this),"show")}),p.fn.tab=Wi._jQueryInterface,p.fn.tab.Constructor=Wi,p.fn.tab.noConflict=function(){return p.fn.tab=Di,Wi._jQueryInterface};var Ui="toast",Bi="bs.toast",qi="."+Bi,Ki=p.fn[Ui],Qi={CLICK_DISMISS:"click.dismiss"+qi,HIDE:"hide"+qi,HIDDEN:"hidden"+qi,SHOW:"show"+qi,SHOWN:"shown"+qi},Vi="fade",Yi="hide",zi="show",Xi="showing",Gi={animation:"boolean",autohide:"boolean",delay:"number"},$i={animation:!0,autohide:!0,delay:500},Ji='[data-dismiss="toast"]',Zi=function(){function i(t,e){this._element=t,this._config=this._getConfig(e),this._timeout=null,this._setListeners()}var t=i.prototype;return t.show=function(){var t=this;p(this._element).trigger(Qi.SHOW),this._config.animation&&this._element.classList.add(Vi);var e=function(){t._element.classList.remove(Xi),t._element.classList.add(zi),p(t._element).trigger(Qi.SHOWN),t._config.autohide&&t.hide()};if(this._element.classList.remove(Yi),this._element.classList.add(Xi),this._config.animation){var n=m.getTransitionDurationFromElement(this._element);p(this._element).one(m.TRANSITION_END,e).emulateTransitionEnd(n)}else e()},t.hide=function(t){var e=this;this._element.classList.contains(zi)&&(p(this._element).trigger(Qi.HIDE),t?this._close():this._timeout=setTimeout(function(){e._close()},this._config.delay))},t.dispose=function(){clearTimeout(this._timeout),this._timeout=null,this._element.classList.contains(zi)&&this._element.classList.remove(zi),p(this._element).off(Qi.CLICK_DISMISS),p.removeData(this._element,Bi),this._element=null,this._config=null},t._getConfig=function(t){return t=l({},$i,p(this._element).data(),"object"==typeof t&&t?t:{}),m.typeCheckConfig(Ui,t,this.constructor.DefaultType),t},t._setListeners=function(){var t=this;p(this._element).on(Qi.CLICK_DISMISS,Ji,function(){return t.hide(!0)})},t._close=function(){var t=this,e=function(){t._element.classList.add(Yi),p(t._element).trigger(Qi.HIDDEN)};if(this._element.classList.remove(zi),this._config.animation){var n=m.getTransitionDurationFromElement(this._element);p(this._element).one(m.TRANSITION_END,e).emulateTransitionEnd(n)}else e()},i._jQueryInterface=function(n){return this.each(function(){var t=p(this),e=t.data(Bi);if(e||(e=new i(this,"object"==typeof n&&n),t.data(Bi,e)),"string"==typeof n){if("undefined"==typeof e[n])throw new TypeError('No method named "'+n+'"');e[n](this)}})},s(i,null,[{key:"VERSION",get:function(){return"4.3.1"}},{key:"DefaultType",get:function(){return Gi}},{key:"Default",get:function(){return $i}}]),i}();p.fn[Ui]=Zi._jQueryInterface,p.fn[Ui].Constructor=Zi,p.fn[Ui].noConflict=function(){return p.fn[Ui]=Ki,Zi._jQueryInterface},function(){if("undefined"==typeof p)throw new TypeError("Bootstrap's JavaScript requires jQuery. jQuery must be included before Bootstrap's JavaScript.");var t=p.fn.jquery.split(" ")[0].split(".");if(t[0]<2&&t[1]<9||1===t[0]&&9===t[1]&&t[2]<1||4<=t[0])throw new Error("Bootstrap's JavaScript requires at least jQuery v1.9.1 but less than v4.0.0")}(),t.Util=m,t.Alert=g,t.Button=k,t.Carousel=at,t.Collapse=Ct,t.Dropdown=Xe,t.Modal=gn,t.Popover=ii,t.Scrollspy=Ci,t.Tab=Wi,t.Toast=Zi,t.Tooltip=qn,Object.defineProperty(t,"__esModule",{value:!0})});
+//# sourceMappingURL=bootstrap.bundle.min.js.map
\ No newline at end of file
-- 
2.19.1

_______________________________________________
infrastructure mailing list -- infrastructure@xxxxxxxxxxxxxxxxxxxxxxx
To unsubscribe send an email to infrastructure-leave@xxxxxxxxxxxxxxxxxxxxxxx
Fedora Code of Conduct: https://getfedora.org/code-of-conduct.html
List Guidelines: https://fedoraproject.org/wiki/Mailing_list_guidelines
List Archives: https://lists.fedoraproject.org/archives/list/infrastructure@xxxxxxxxxxxxxxxxxxxxxxx